From c95424b8d9b15f7e3faa16e82e78eceedf2b4a41 Mon Sep 17 00:00:00 2001 From: RichardG867 Date: Tue, 18 Apr 2023 15:03:26 -0300 Subject: [PATCH 01/60] config: Migrate standalone SSI-2001, CMS and GUS from v3.11 and older --- src/config.c | 33 ++++++++++++++++++++++++++++++++- 1 file changed, 32 insertions(+), 1 deletion(-) diff --git a/src/config.c b/src/config.c index 6399c91ab..4b94fb2ac 100644 --- a/src/config.c +++ b/src/config.c @@ -718,6 +718,20 @@ load_sound(void) mpu401_standalone_enable = !!ini_section_get_int(cat, "mpu401_standalone", 0); + /* Backwards compatibility for standalone SSI-2001, CMS and GUS from v3.11 and older. */ + char *legacy_cards[][2] = {{"ssi2001", "ssi2001"}, {"gameblaster", "cms"}, {"gus", "gus"}}; + for (int i = 0, j = 0; i < (sizeof(legacy_cards) / sizeof(legacy_cards[0])); i++) { + if (ini_section_get_int(cat, legacy_cards[i][0], 0) == 1) { + /* Migrate to the first available sound card slot. */ + for (; j < (sizeof(sound_card_current) / sizeof(sound_card_current[0])); j++) { + if (!sound_card_current[j]) { + sound_card_current[j] = sound_card_get_from_internal_name(legacy_cards[i][1]); + break; + } + } + } + } + memset(temp, '\0', sizeof(temp)); p = ini_section_get_string(cat, "sound_type", "float"); if (strlen(p) > 511) @@ -2159,7 +2173,7 @@ save_machine(void) else ini_section_delete_var(cat, "cpu_override"); - /* Forwards compatibility with the previous CPU model system. */ + /* Downgrade compatibility with the previous CPU model system. */ ini_section_delete_var(cat, "cpu_manufacturer"); ini_section_delete_var(cat, "cpu"); @@ -2390,6 +2404,23 @@ save_sound(void) else ini_section_set_int(cat, "mpu401_standalone", mpu401_standalone_enable); + /* Downgrade compatibility for standalone SSI-2001, CMS and GUS from v3.11 and older. */ + char *legacy_cards[][2] = {{"ssi2001", "ssi2001"}, {"gameblaster", "cms"}, {"gus", "gus"}}; + for (int i = 0; i < (sizeof(legacy_cards) / sizeof(legacy_cards[0])); i++) { + int card_id = sound_card_get_from_internal_name(legacy_cards[i][1]); + for (int j = 0; j < (sizeof(sound_card_current) / sizeof(sound_card_current[0])); j++) { + if (sound_card_current[j] == card_id) { + /* A special value of 2 still enables the cards on older versions, + but lets newer versions know that they've already been migrated. */ + ini_section_set_int(cat, legacy_cards[i][0], 2); + card_id = 0; /* mark as found */ + break; + } + } + if (card_id > 0) /* not found */ + ini_section_delete_var(cat, legacy_cards[i][0]); + } + if (sound_is_float == 1) ini_section_delete_var(cat, "sound_type"); else From fb8ef3e40c6819b9d5624fb85e1d2d97ddf6331f Mon Sep 17 00:00:00 2001 From: RichardG867 Date: Tue, 18 Apr 2023 16:14:44 -0300 Subject: [PATCH 02/60] ini: Constify parameters to optimize execution --- src/config.c | 4 ++-- src/include/86box/ini.h | 40 +++++++++++++++++----------------- src/include/86box/sound.h | 2 +- src/ini.c | 46 +++++++++++++++++++-------------------- src/sound/sound.c | 2 +- 5 files changed, 47 insertions(+), 47 deletions(-) diff --git a/src/config.c b/src/config.c index 4b94fb2ac..96f9374ef 100644 --- a/src/config.c +++ b/src/config.c @@ -719,7 +719,7 @@ load_sound(void) mpu401_standalone_enable = !!ini_section_get_int(cat, "mpu401_standalone", 0); /* Backwards compatibility for standalone SSI-2001, CMS and GUS from v3.11 and older. */ - char *legacy_cards[][2] = {{"ssi2001", "ssi2001"}, {"gameblaster", "cms"}, {"gus", "gus"}}; + const char *legacy_cards[][2] = {{"ssi2001", "ssi2001"}, {"gameblaster", "cms"}, {"gus", "gus"}}; for (int i = 0, j = 0; i < (sizeof(legacy_cards) / sizeof(legacy_cards[0])); i++) { if (ini_section_get_int(cat, legacy_cards[i][0], 0) == 1) { /* Migrate to the first available sound card slot. */ @@ -2405,7 +2405,7 @@ save_sound(void) ini_section_set_int(cat, "mpu401_standalone", mpu401_standalone_enable); /* Downgrade compatibility for standalone SSI-2001, CMS and GUS from v3.11 and older. */ - char *legacy_cards[][2] = {{"ssi2001", "ssi2001"}, {"gameblaster", "cms"}, {"gus", "gus"}}; + const char *legacy_cards[][2] = {{"ssi2001", "ssi2001"}, {"gameblaster", "cms"}, {"gus", "gus"}}; for (int i = 0; i < (sizeof(legacy_cards) / sizeof(legacy_cards[0])); i++) { int card_id = sound_card_get_from_internal_name(legacy_cards[i][1]); for (int j = 0; j < (sizeof(sound_card_current) / sizeof(sound_card_current[0])); j++) { diff --git a/src/include/86box/ini.h b/src/include/86box/ini.h index 5eca9ab8c..866787352 100644 --- a/src/include/86box/ini.h +++ b/src/include/86box/ini.h @@ -30,26 +30,26 @@ typedef void *ini_t; typedef void *ini_section_t; extern ini_t ini_new(void); -extern ini_t ini_read(char *fn); -extern void ini_write(ini_t ini, char *fn); +extern ini_t ini_read(const char *fn); +extern void ini_write(ini_t ini, const char *fn); extern void ini_dump(ini_t ini); extern void ini_close(ini_t ini); -extern void ini_section_delete_var(ini_section_t section, char *name); -extern int ini_section_get_int(ini_section_t section, char *name, int def); -extern double ini_section_get_double(ini_section_t section, char *name, double def); -extern int ini_section_get_hex16(ini_section_t section, char *name, int def); -extern int ini_section_get_hex20(ini_section_t section, char *name, int def); -extern int ini_section_get_mac(ini_section_t section, char *name, int def); -extern char *ini_section_get_string(ini_section_t section, char *name, char *def); -extern wchar_t *ini_section_get_wstring(ini_section_t section, char *name, wchar_t *def); -extern void ini_section_set_int(ini_section_t section, char *name, int val); -extern void ini_section_set_double(ini_section_t section, char *name, double val); -extern void ini_section_set_hex16(ini_section_t section, char *name, int val); -extern void ini_section_set_hex20(ini_section_t section, char *name, int val); -extern void ini_section_set_mac(ini_section_t section, char *name, int val); +extern void ini_section_delete_var(ini_section_t section, const char *name); +extern int ini_section_get_int(ini_section_t section, const char *name, int def); +extern double ini_section_get_double(ini_section_t section, const char *name, double def); +extern int ini_section_get_hex16(ini_section_t section, const char *name, int def); +extern int ini_section_get_hex20(ini_section_t section, const char *name, int def); +extern int ini_section_get_mac(ini_section_t section, const char *name, int def); +extern char *ini_section_get_string(ini_section_t section, const char *name, char *def); +extern wchar_t *ini_section_get_wstring(ini_section_t section, const char *name, wchar_t *def); +extern void ini_section_set_int(ini_section_t section, const char *name, int val); +extern void ini_section_set_double(ini_section_t section, const char *name, double val); +extern void ini_section_set_hex16(ini_section_t section, const char *name, int val); +extern void ini_section_set_hex20(ini_section_t section, const char *name, int val); +extern void ini_section_set_mac(ini_section_t section, const char *name, int val); extern void ini_section_set_string(ini_section_t section, const char *name, const char *val); -extern void ini_section_set_wstring(ini_section_t section, char *name, wchar_t *val); +extern void ini_section_set_wstring(ini_section_t section, const char *name, wchar_t *val); #define ini_delete_var(ini, head, name) ini_section_delete_var(ini_find_section(ini, head), name) @@ -69,13 +69,13 @@ extern void ini_section_set_wstring(ini_section_t section, char *name, wchar #define ini_set_string(ini, head, name, val) ini_section_set_string(ini_find_or_create_section(ini, head), name, val) #define ini_set_wstring(ini, head, name, val) ini_section_set_wstring(ini_find_or_create_section(ini, head), name, val) -extern ini_section_t ini_find_section(ini_t ini, char *name); -extern ini_section_t ini_find_or_create_section(ini_t ini, char *name); -extern void ini_rename_section(ini_section_t section, char *name); +extern ini_section_t ini_find_section(ini_t ini, const char *name); +extern ini_section_t ini_find_or_create_section(ini_t ini, const char *name); +extern void ini_rename_section(ini_section_t section, const char *name); extern void ini_delete_section_if_empty(ini_t ini, ini_section_t section); #ifdef __cplusplus } #endif -#endif \ No newline at end of file +#endif diff --git a/src/include/86box/sound.h b/src/include/86box/sound.h index dada9e164..1cb9357a6 100644 --- a/src/include/86box/sound.h +++ b/src/include/86box/sound.h @@ -62,7 +62,7 @@ extern const device_t *sound_card_getdevice(int card); #endif extern int sound_card_has_config(int card); extern char *sound_card_get_internal_name(int card); -extern int sound_card_get_from_internal_name(char *s); +extern int sound_card_get_from_internal_name(const char *s); extern void sound_card_init(void); extern void sound_set_cd_volume(unsigned int vol_l, unsigned int vol_r); diff --git a/src/ini.c b/src/ini.c index 009d21c0b..d41573bed 100644 --- a/src/ini.c +++ b/src/ini.c @@ -101,10 +101,10 @@ ini_log(const char *fmt, ...) #endif static section_t * -find_section(list_t *head, char *name) +find_section(list_t *head, const char *name) { section_t *sec = (section_t *) head->next; - char blank[] = ""; + const char blank[] = ""; if (name == NULL) name = blank; @@ -120,7 +120,7 @@ find_section(list_t *head, char *name) } ini_section_t -ini_find_section(ini_t ini, char *name) +ini_find_section(ini_t ini, const char *name) { if (ini == NULL) return NULL; @@ -129,7 +129,7 @@ ini_find_section(ini_t ini, char *name) } void -ini_rename_section(ini_section_t section, char *name) +ini_rename_section(ini_section_t section, const char *name) { section_t *sec = (section_t *) section; @@ -197,7 +197,7 @@ ini_delete_section_if_empty(ini_t ini, ini_section_t section) } static section_t * -create_section(list_t *head, char *name) +create_section(list_t *head, const char *name) { section_t *ns = malloc(sizeof(section_t)); @@ -209,7 +209,7 @@ create_section(list_t *head, char *name) } ini_section_t -ini_find_or_create_section(ini_t ini, char *name) +ini_find_or_create_section(ini_t ini, const char *name) { if (ini == NULL) return NULL; @@ -263,7 +263,7 @@ ini_close(ini_t ini) } static int -ini_detect_bom(char *fn) +ini_detect_bom(const char *fn) { FILE *f; unsigned char bom[4] = { 0, 0, 0, 0 }; @@ -311,7 +311,7 @@ ini_fgetws(wchar_t *str, int count, FILE *stream) /* Read and parse the configuration file into memory. */ ini_t -ini_read(char *fn) +ini_read(const char *fn) { char sname[128], ename[128]; wchar_t buff[1024]; @@ -438,7 +438,7 @@ ini_read(char *fn) /* Write the in-memory configuration to disk. */ void -ini_write(ini_t ini, char *fn) +ini_write(ini_t ini, const char *fn) { wchar_t wtemp[512]; list_t *list = (list_t *) ini; @@ -521,7 +521,7 @@ ini_dump(ini_t ini) } void -ini_section_delete_var(ini_section_t self, char *name) +ini_section_delete_var(ini_section_t self, const char *name) { section_t *section = (section_t *) self; entry_t *entry; @@ -537,7 +537,7 @@ ini_section_delete_var(ini_section_t self, char *name) } int -ini_section_get_int(ini_section_t self, char *name, int def) +ini_section_get_int(ini_section_t self, const char *name, int def) { section_t *section = (section_t *) self; entry_t *entry; @@ -556,7 +556,7 @@ ini_section_get_int(ini_section_t self, char *name, int def) } double -ini_section_get_double(ini_section_t self, char *name, double def) +ini_section_get_double(ini_section_t self, const char *name, double def) { section_t *section = (section_t *) self; entry_t *entry; @@ -575,7 +575,7 @@ ini_section_get_double(ini_section_t self, char *name, double def) } int -ini_section_get_hex16(ini_section_t self, char *name, int def) +ini_section_get_hex16(ini_section_t self, const char *name, int def) { section_t *section = (section_t *) self; entry_t *entry; @@ -594,7 +594,7 @@ ini_section_get_hex16(ini_section_t self, char *name, int def) } int -ini_section_get_hex20(ini_section_t self, char *name, int def) +ini_section_get_hex20(ini_section_t self, const char *name, int def) { section_t *section = (section_t *) self; entry_t *entry; @@ -613,7 +613,7 @@ ini_section_get_hex20(ini_section_t self, char *name, int def) } int -ini_section_get_mac(ini_section_t self, char *name, int def) +ini_section_get_mac(ini_section_t self, const char *name, int def) { section_t *section = (section_t *) self; entry_t *entry; @@ -632,7 +632,7 @@ ini_section_get_mac(ini_section_t self, char *name, int def) } char * -ini_section_get_string(ini_section_t self, char *name, char *def) +ini_section_get_string(ini_section_t self, const char *name, char *def) { section_t *section = (section_t *) self; entry_t *entry; @@ -648,7 +648,7 @@ ini_section_get_string(ini_section_t self, char *name, char *def) } wchar_t * -ini_section_get_wstring(ini_section_t self, char *name, wchar_t *def) +ini_section_get_wstring(ini_section_t self, const char *name, wchar_t *def) { section_t *section = (section_t *) self; entry_t *entry; @@ -664,7 +664,7 @@ ini_section_get_wstring(ini_section_t self, char *name, wchar_t *def) } void -ini_section_set_int(ini_section_t self, char *name, int val) +ini_section_set_int(ini_section_t self, const char *name, int val) { section_t *section = (section_t *) self; entry_t *ent; @@ -681,7 +681,7 @@ ini_section_set_int(ini_section_t self, char *name, int val) } void -ini_section_set_double(ini_section_t self, char *name, double val) +ini_section_set_double(ini_section_t self, const char *name, double val) { section_t *section = (section_t *) self; entry_t *ent; @@ -698,7 +698,7 @@ ini_section_set_double(ini_section_t self, char *name, double val) } void -ini_section_set_hex16(ini_section_t self, char *name, int val) +ini_section_set_hex16(ini_section_t self, const char *name, int val) { section_t *section = (section_t *) self; entry_t *ent; @@ -715,7 +715,7 @@ ini_section_set_hex16(ini_section_t self, char *name, int val) } void -ini_section_set_hex20(ini_section_t self, char *name, int val) +ini_section_set_hex20(ini_section_t self, const char *name, int val) { section_t *section = (section_t *) self; entry_t *ent; @@ -732,7 +732,7 @@ ini_section_set_hex20(ini_section_t self, char *name, int val) } void -ini_section_set_mac(ini_section_t self, char *name, int val) +ini_section_set_mac(ini_section_t self, const char *name, int val) { section_t *section = (section_t *) self; entry_t *ent; @@ -774,7 +774,7 @@ ini_section_set_string(ini_section_t self, const char *name, const char *val) } void -ini_section_set_wstring(ini_section_t self, char *name, wchar_t *val) +ini_section_set_wstring(ini_section_t self, const char *name, wchar_t *val) { section_t *section = (section_t *) self; entry_t *ent; diff --git a/src/sound/sound.c b/src/sound/sound.c index dbfaf0fdb..d8791d0cf 100644 --- a/src/sound/sound.c +++ b/src/sound/sound.c @@ -202,7 +202,7 @@ sound_card_get_internal_name(int card) } int -sound_card_get_from_internal_name(char *s) +sound_card_get_from_internal_name(const char *s) { int c = 0; From 5813d425e95a78831df6f36f9a252e9f342794ae Mon Sep 17 00:00:00 2001 From: RichardG867 Date: Tue, 18 Apr 2023 16:16:42 -0300 Subject: [PATCH 03/60] clang-format my previous commits --- src/config.c | 12 ++++++++++-- src/include/86box/sound.h | 12 ++++++------ 2 files changed, 16 insertions(+), 8 deletions(-) diff --git a/src/config.c b/src/config.c index 96f9374ef..7641c637c 100644 --- a/src/config.c +++ b/src/config.c @@ -719,7 +719,11 @@ load_sound(void) mpu401_standalone_enable = !!ini_section_get_int(cat, "mpu401_standalone", 0); /* Backwards compatibility for standalone SSI-2001, CMS and GUS from v3.11 and older. */ - const char *legacy_cards[][2] = {{"ssi2001", "ssi2001"}, {"gameblaster", "cms"}, {"gus", "gus"}}; + const char *legacy_cards[][2] = { + {"ssi2001", "ssi2001"}, + { "gameblaster", "cms" }, + { "gus", "gus" } + }; for (int i = 0, j = 0; i < (sizeof(legacy_cards) / sizeof(legacy_cards[0])); i++) { if (ini_section_get_int(cat, legacy_cards[i][0], 0) == 1) { /* Migrate to the first available sound card slot. */ @@ -2405,7 +2409,11 @@ save_sound(void) ini_section_set_int(cat, "mpu401_standalone", mpu401_standalone_enable); /* Downgrade compatibility for standalone SSI-2001, CMS and GUS from v3.11 and older. */ - const char *legacy_cards[][2] = {{"ssi2001", "ssi2001"}, {"gameblaster", "cms"}, {"gus", "gus"}}; + const char *legacy_cards[][2] = { + {"ssi2001", "ssi2001"}, + { "gameblaster", "cms" }, + { "gus", "gus" } + }; for (int i = 0; i < (sizeof(legacy_cards) / sizeof(legacy_cards[0])); i++) { int card_id = sound_card_get_from_internal_name(legacy_cards[i][1]); for (int j = 0; j < (sizeof(sound_card_current) / sizeof(sound_card_current[0])); j++) { diff --git a/src/include/86box/sound.h b/src/include/86box/sound.h index 1cb9357a6..9f36a70b6 100644 --- a/src/include/86box/sound.h +++ b/src/include/86box/sound.h @@ -24,13 +24,13 @@ extern int sound_gain; -#define FREQ_44100 44100 -#define FREQ_48000 48000 -#define FREQ_49716 49716 -#define FREQ_88200 88200 -#define FREQ_96000 96000 +#define FREQ_44100 44100 +#define FREQ_48000 48000 +#define FREQ_49716 49716 +#define FREQ_88200 88200 +#define FREQ_96000 96000 -#define SOUND_FREQ FREQ_48000 +#define SOUND_FREQ FREQ_48000 #define SOUNDBUFLEN (SOUND_FREQ / 50) #define CD_FREQ FREQ_44100 From beb1df4f5cb9f0f9931389f80d60210bb2558401 Mon Sep 17 00:00:00 2001 From: RichardG867 Date: Tue, 18 Apr 2023 20:28:03 -0300 Subject: [PATCH 04/60] qt: Hide unused CD-ROM controller selector --- src/qt/qt_settingsstoragecontrollers.ui | 12 +++++++++++- 1 file changed, 11 insertions(+), 1 deletion(-) diff --git a/src/qt/qt_settingsstoragecontrollers.ui b/src/qt/qt_settingsstoragecontrollers.ui index 558d4c441..9fc0ea519 100644 --- a/src/qt/qt_settingsstoragecontrollers.ui +++ b/src/qt/qt_settingsstoragecontrollers.ui @@ -54,16 +54,26 @@ CD-ROM Controller: + + false + - + + + false + + Configure + + false + From 19d155cdd7947b241d880482b8c41efb9893b2ab Mon Sep 17 00:00:00 2001 From: OBattler Date: Wed, 19 Apr 2023 23:34:32 +0200 Subject: [PATCH 05/60] Keyboard controller file split and assorted clean-ups and fixes --- src/acpi.c | 3 +- src/chipset/ali1543.c | 2 +- src/cpu/386_common.c | 4 +- src/cpu/x86.c | 6 +- src/device.c | 18 +- src/device/CMakeLists.txt | 4 +- src/device/keyboard_at.c | 2861 ++++------------------------------ src/device/mouse_ps2.c | 200 +-- src/include/86box/device.h | 34 +- src/include/86box/keyboard.h | 29 +- src/io.c | 25 +- src/pci.c | 3 +- src/win/Makefile.mingw | 16 +- 13 files changed, 497 insertions(+), 2708 deletions(-) diff --git a/src/acpi.c b/src/acpi.c index cafa06229..625fdfef2 100644 --- a/src/acpi.c +++ b/src/acpi.c @@ -687,14 +687,13 @@ acpi_reg_write_common_regs(int size, uint16_t addr, uint8_t val, void *p) } if (sus_typ & SUS_RESET_PCI) - device_reset_all_pci(); + device_reset_all(DEVICE_PCI); if (sus_typ & SUS_RESET_CPU) cpu_alt_reset = 0; if (sus_typ & SUS_RESET_PCI) { pci_reset(); - keyboard_at_reset(); mem_a20_alt = 0; mem_a20_recalc(); diff --git a/src/chipset/ali1543.c b/src/chipset/ali1543.c index 5aabd6c63..0b5fe5761 100644 --- a/src/chipset/ali1543.c +++ b/src/chipset/ali1543.c @@ -153,7 +153,7 @@ ali1533_write(int func, int addr, uint8_t val, void *priv) case 0x41: /* TODO: Bit 7 selects keyboard controller type: 0 = AT, 1 = PS/2 */ - pic_kbd_latch(!!(val & 0x80)); + pic_kbd_latch(1); pic_mouse_latch(!!(val & 0x40)); dev->pci_conf[addr] = val & 0xbf; break; diff --git a/src/cpu/386_common.c b/src/cpu/386_common.c index f8e7c11ce..2df72c20e 100644 --- a/src/cpu/386_common.c +++ b/src/cpu/386_common.c @@ -780,8 +780,8 @@ smram_restore_state_p6(uint32_t *saved_state) cpu_state.seg_gs.ar_high = (saved_state[SMRAM_FIELD_P6_GS_SELECTOR_AR] >> 24) & 0xff; smm_seg_load(&cpu_state.seg_gs); - mem_a20_alt = 0; - keyboard_at_set_a20_key(!saved_state[SMRAM_FIELD_P6_A20M]); + mem_a20_alt = 0x00; + mem_a20_key = saved_state[SMRAM_FIELD_P6_A20M] ? 0x00 : 0x02; mem_a20_recalc(); if (SMM_REVISION_ID & SMM_SMBASE_RELOCATION) diff --git a/src/cpu/x86.c b/src/cpu/x86.c index 47250045f..76101c344 100644 --- a/src/cpu/x86.c +++ b/src/cpu/x86.c @@ -245,7 +245,7 @@ reset_common(int hard) /* TODO: Hack, but will do for time being, because all AT machines currently are 286+, and vice-versa. */ dma_set_at(is286); - device_reset_all(); + device_reset_all(DEVICE_ALL); } } @@ -322,7 +322,7 @@ reset_common(int hard) /* If we have an AT or PS/2 keyboard controller, make sure the A20 state is correct. */ - kbc_at_a20_reset(); + device_reset_all(DEVICE_KBC); } if (!is286) @@ -359,7 +359,7 @@ hardresetx86(void) /* TODO: Hack, but will do for time being, because all AT machines currently are 286+, and vice-versa. */ dma_set_at(is286); - device_reset_all(); + device_reset_all(DEVICE_ALL); cpu_alt_reset = 0; diff --git a/src/device.c b/src/device.c index 5d739b13c..d0b502ca1 100644 --- a/src/device.c +++ b/src/device.c @@ -315,27 +315,13 @@ device_close_all(void) } void -device_reset_all(void) +device_reset_all(uint32_t match_flags) { int c; for (c = 0; c < DEVICE_MAX; c++) { if (devices[c] != NULL) { - if (devices[c]->reset != NULL) - devices[c]->reset(device_priv[c]); - } - } -} - -/* Reset all attached PCI devices - needed for PCI turbo reset control. */ -void -device_reset_all_pci(void) -{ - int c; - - for (c = 0; c < DEVICE_MAX; c++) { - if (devices[c] != NULL) { - if ((devices[c]->reset != NULL) && (devices[c]->flags & DEVICE_PCI)) + if ((devices[c]->reset != NULL) && (devices[c]->flags & match_flags)) devices[c]->reset(device_priv[c]); } } diff --git a/src/device/CMakeLists.txt b/src/device/CMakeLists.txt index e60856293..ef3a392ee 100644 --- a/src/device/CMakeLists.txt +++ b/src/device/CMakeLists.txt @@ -18,7 +18,9 @@ add_library(dev OBJECT bugger.c cassette.c cartridge.c hasp.c hwm.c hwm_lm75.c hwm_lm78.c hwm_gl518sm.c hwm_vt82c686.c ibm_5161.c isamem.c isartc.c ../lpt.c pci_bridge.c postcard.c serial.c clock_ics9xxx.c isapnp.c i2c.c i2c_gpio.c - smbus_piix4.c smbus_ali7101.c keyboard.c keyboard_xt.c keyboard_at.c + smbus_piix4.c smbus_ali7101.c keyboard.c keyboard_xt.c + kbc_at.c kbc_at_dev.c + keyboard_at.c mouse.c mouse_bus.c mouse_serial.c mouse_ps2.c phoenix_486_jumper.c mouse_wacom_tablet.c serial_passthrough.c) diff --git a/src/device/keyboard_at.c b/src/device/keyboard_at.c index 3a841ad91..ab1980b72 100644 --- a/src/device/keyboard_at.c +++ b/src/device/keyboard_at.c @@ -6,167 +6,56 @@ * * This file is part of the 86Box distribution. * - * Intel 8042 (AT keyboard controller) emulation. + * Implementation of PS/2 series Mouse devices. * * * - * Authors: Sarah Walker, - * Miran Grca, - * Fred N. van Kempen, - * EngiNerd, - * - * Copyright 2008-2020 Sarah Walker. - * Copyright 2016-2020 Miran Grca. - * Copyright 2017-2020 Fred N. van Kempen. - * Copyright 2020 EngiNerd. + * Authors: Fred N. van Kempen, */ +#include #include #include -#include #include -#include -#define HAVE_STDARG_H +#include #include +#define HAVE_STDARG_H #include <86box/86box.h> -#include "cpu.h" -#include <86box/timer.h> -#include <86box/io.h> -#include <86box/pic.h> -#include <86box/pit.h> -#include <86box/ppi.h> -#include <86box/mem.h> #include <86box/device.h> -#include <86box/machine.h> -#include <86box/m_at_t3100e.h> -#include <86box/fdd.h> -#include <86box/fdc.h> -#include <86box/sound.h> -#include <86box/snd_speaker.h> -#include <86box/video.h> #include <86box/keyboard.h> +#include <86box/mouse.h> -#define STAT_PARITY 0x80 -#define STAT_RTIMEOUT 0x40 -#define STAT_TTIMEOUT 0x20 -#define STAT_MFULL 0x20 -#define STAT_UNLOCKED 0x10 -#define STAT_CD 0x08 -#define STAT_SYSFLAG 0x04 -#define STAT_IFULL 0x02 -#define STAT_OFULL 0x01 - -#define CCB_UNUSED 0x80 -#define CCB_TRANSLATE 0x40 -#define CCB_PCMODE 0x20 -#define CCB_ENABLEKBD 0x10 -#define CCB_IGNORELOCK 0x08 -#define CCB_SYSTEM 0x04 -#define CCB_ENABLEMINT 0x02 -#define CCB_ENABLEKINT 0x01 - -#define CCB_MASK 0x68 -#define MODE_MASK 0x6c - -#define KBC_TYPE_ISA 0x00 /* AT ISA-based chips */ -#define KBC_TYPE_PS2_NOREF 0x01 /* PS2 type, no refresh */ -#define KBC_TYPE_PS2_1 0x02 /* PS2 on PS/2, type 1 */ -#define KBC_TYPE_PS2_2 0x03 /* PS2 on PS/2, type 2 */ -#define KBC_TYPE_MASK 0x03 - -#define KBC_VEN_GENERIC 0x00 -#define KBC_VEN_AMI 0x04 -#define KBC_VEN_IBM_MCA 0x08 -#define KBC_VEN_QUADTEL 0x0c -#define KBC_VEN_TOSHIBA 0x10 -#define KBC_VEN_IBM_PS1 0x14 -#define KBC_VEN_ACER 0x18 -#define KBC_VEN_INTEL_AMI 0x1c -#define KBC_VEN_OLIVETTI 0x20 -#define KBC_VEN_NCR 0x24 -#define KBC_VEN_PHOENIX 0x28 -#define KBC_VEN_ALI 0x2c -#define KBC_VEN_TG 0x30 -#define KBC_VEN_TG_GREEN 0x34 -#define KBC_VEN_MASK 0x3c +#define FLAG_PS2 0x08 /* dev is AT or PS/2 */ +#define FLAG_AT 0x00 /* dev is AT or PS/2 */ +#define FLAG_TYPE_MASK 0x07 /* mask for type */ enum { - KBC_STATE_RESET = 0, - KBC_STATE_MAIN_IBF, - KBC_STATE_MAIN_KBD, - KBC_STATE_MAIN_MOUSE, - KBC_STATE_MAIN_BOTH, - KBC_STATE_KBC_OUT, - KBC_STATE_KBC_PARAM, - KBC_STATE_SEND_KBD, - KBC_STATE_KBD, - KBC_STATE_SEND_MOUSE, - KBC_STATE_MOUSE -}; -#define KBC_STATE_SCAN_KBD KBC_STATE_KBD -#define KBC_STATE_SCAN_MOUSE KBC_STATE_MOUSE - -enum { - DEV_STATE_MAIN_1 = 0, - DEV_STATE_MAIN_2, - DEV_STATE_MAIN_CMD, - DEV_STATE_MAIN_OUT, - DEV_STATE_MAIN_WANT_IN, - DEV_STATE_MAIN_IN + KBD_84_KEY = 0, + KBD_101_KEY, + KBD_102_KEY, + KBD_JIS, + KBD_KOREAN }; -typedef struct { - /* Controller. */ - uint8_t pci, kbc_state, command, want60, - status, ib, out, old_out, - sc_or, secr_phase, mem_addr, input_port, - output_port, old_output_port, output_locked, ami_stat, - ami_flags, key_ctrl_queue_start, key_ctrl_queue_end; +#define FLAG_ENABLED 0x10 /* dev is enabled for use */ +#define FLAG_CTRLDAT 0x08 /* ctrl or data mode */ - /* Keyboard. */ - uint8_t key_command, key_wantdata, kbd_last_scan_code, - kbd_state, key_wantcmd, key_dat, key_cmd_queue_start, - key_cmd_queue_end, key_queue_start, key_queue_end; - - /* Mouse. */ - uint8_t mouse_state, mouse_wantcmd, mouse_dat, mouse_cmd_queue_start, - mouse_cmd_queue_end, mouse_queue_start, mouse_queue_end; - - /* Controller. */ - uint8_t mem[0x100]; - - /* Controller - internal FIFO for the purpose of commands with multi-byte output. */ - uint8_t key_ctrl_queue[64]; - - /* Keyboard - command response FIFO. */ - uint8_t key_cmd_queue[16]; - - /* Keyboard - scan FIFO. */ - uint8_t key_queue[16]; - - /* Mouse - command response FIFO. */ - uint8_t mouse_cmd_queue[16]; - - /* Mouse - scan FIFO. */ - uint8_t mouse_queue[16]; - - /* Keyboard. */ - int out_new; - - /* Mouse. */ - int out_new_mouse; - - /* Controller. */ - uint32_t flags; - - /* Controller (main timer). */ - pc_timer_t send_delay_timer; - - /* Controller (P2 pulse callback timer). */ - pc_timer_t pulse_cb; - - uint8_t (*write60_ven)(void *p, uint8_t val); - uint8_t (*write64_ven)(void *p, uint8_t val); -} atkbd_t; +const uint8_t id_bytes[16][4] = { { 0x00, 0x00, 0x00, 0x00 }, /* AT 84-key */ + { 0x00, 0x00, 0x00, 0x00 }, /* AT 101/102/106-key */ + { 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00 }, /* AT Korean */ + { 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00 }, + { 0xab, 0x83, 0x00, 0x00 }, /* PS/2 101-key */ + { 0xab, 0x83, 0x00, 0x00 }, /* PS/2 102-key */ + { 0xab, 0x90, 0x00, 0x00 }, /* PS/2 106-key JIS */ + /* Japanese keyboard ID - TODO: Find the actual Korean one. */ + { 0xab, 0x90, 0x00, 0x00 }, /* PS/2 Korean */ + { 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00 } }; /* Global keyboard flags for scan code set 3: bit 0 = repeat, bit 1 = makes break code? */ @@ -178,48 +67,7 @@ uint8_t keyboard_set3_all_break; Bits 0 - 1 = scan code set. */ uint8_t keyboard_mode = 0x02; -/* Keyboard controller ports. */ -kbc_port_t *kbc_ports[2] = { NULL, NULL }; - -static void (*mouse_write)(uint8_t val, void *priv) = NULL; -static void *mouse_p = NULL; -static atkbd_t *SavedKbd = NULL; // FIXME: remove!!! --FvK - -/* Non-translated to translated scan codes. */ -static const uint8_t nont_to_t[256] = { - 0xff, 0x43, 0x41, 0x3f, 0x3d, 0x3b, 0x3c, 0x58, - 0x64, 0x44, 0x42, 0x40, 0x3e, 0x0f, 0x29, 0x59, - 0x65, 0x38, 0x2a, 0x70, 0x1d, 0x10, 0x02, 0x5a, - 0x66, 0x71, 0x2c, 0x1f, 0x1e, 0x11, 0x03, 0x5b, - 0x67, 0x2e, 0x2d, 0x20, 0x12, 0x05, 0x04, 0x5c, - 0x68, 0x39, 0x2f, 0x21, 0x14, 0x13, 0x06, 0x5d, - 0x69, 0x31, 0x30, 0x23, 0x22, 0x15, 0x07, 0x5e, - 0x6a, 0x72, 0x32, 0x24, 0x16, 0x08, 0x09, 0x5f, - 0x6b, 0x33, 0x25, 0x17, 0x18, 0x0b, 0x0a, 0x60, - 0x6c, 0x34, 0x35, 0x26, 0x27, 0x19, 0x0c, 0x61, - 0x6d, 0x73, 0x28, 0x74, 0x1a, 0x0d, 0x62, 0x6e, - 0x3a, 0x36, 0x1c, 0x1b, 0x75, 0x2b, 0x63, 0x76, - 0x55, 0x56, 0x77, 0x78, 0x79, 0x7a, 0x0e, 0x7b, - 0x7c, 0x4f, 0x7d, 0x4b, 0x47, 0x7e, 0x7f, 0x6f, - 0x52, 0x53, 0x50, 0x4c, 0x4d, 0x48, 0x01, 0x45, - 0x57, 0x4e, 0x51, 0x4a, 0x37, 0x49, 0x46, 0x54, - 0x80, 0x81, 0x82, 0x41, 0x54, 0x85, 0x86, 0x87, - 0x88, 0x89, 0x8a, 0x8b, 0x8c, 0x8d, 0x8e, 0x8f, - 0x90, 0x91, 0x92, 0x93, 0x94, 0x95, 0x96, 0x97, - 0x98, 0x99, 0x9a, 0x9b, 0x9c, 0x9d, 0x9e, 0x9f, - 0xa0, 0xa1, 0xa2, 0xa3, 0xa4, 0xa5, 0xa6, 0xa7, - 0xa8, 0xa9, 0xaa, 0xab, 0xac, 0xad, 0xae, 0xaf, - 0xb0, 0xb1, 0xb2, 0xb3, 0xb4, 0xb5, 0xb6, 0xb7, - 0xb8, 0xb9, 0xba, 0xbb, 0xbc, 0xbd, 0xbe, 0xbf, - 0xc0, 0xc1, 0xc2, 0xc3, 0xc4, 0xc5, 0xc6, 0xc7, - 0xc8, 0xc9, 0xca, 0xcb, 0xcc, 0xcd, 0xce, 0xcf, - 0xd0, 0xd1, 0xd2, 0xd3, 0xd4, 0xd5, 0xd6, 0xd7, - 0xd8, 0xd9, 0xda, 0xdb, 0xdc, 0xdd, 0xde, 0xdf, - 0xe0, 0xe1, 0xe2, 0xe3, 0xe4, 0xe5, 0xe6, 0xe7, - 0xe8, 0xe9, 0xea, 0xeb, 0xec, 0xed, 0xee, 0xef, - 0xf0, 0xf1, 0xf2, 0xf3, 0xf4, 0xf5, 0xf6, 0xf7, - 0xf8, 0xf9, 0xfa, 0xfb, 0xfc, 0xfd, 0xfe, 0xff -}; +static atkbc_dev_t *SavedKbd = NULL; static const scancode scancode_set1[512] = { // clang-format off @@ -617,12 +465,11 @@ static const scancode scancode_set3[512] = { // clang-format on }; -// #define ENABLE_KEYBOARD_AT_LOG 1 #ifdef ENABLE_KEYBOARD_AT_LOG int keyboard_at_do_log = ENABLE_KEYBOARD_AT_LOG; static void -kbd_log(const char *fmt, ...) +keyboard_at_log(const char *fmt, ...) { va_list ap; @@ -633,690 +480,41 @@ kbd_log(const char *fmt, ...) } } #else -# define kbd_log(fmt, ...) +# define keyboard_at_log(fmt, ...) #endif static void -set_scancode_map(atkbd_t *dev) +keyboard_at_set_scancode_set(void) { switch (keyboard_mode) { - case 1: + case 0x01: default: keyboard_set_table(scancode_set1); break; - case 2: + + case 0x02: keyboard_set_table(scancode_set2); break; - case 3: + case 0x03: keyboard_set_table(scancode_set3); break; } } static void -kbc_queue_reset(atkbd_t *dev, uint8_t channel) -{ - switch (channel) { - case 1: - dev->key_queue_start = dev->key_queue_end = 0; - memset(dev->key_queue, 0x00, sizeof(dev->key_queue)); - /* FALLTHROUGH */ - case 4: - dev->key_cmd_queue_start = dev->key_cmd_queue_end = 0; - memset(dev->key_cmd_queue, 0x00, sizeof(dev->key_cmd_queue)); - break; - - case 2: - dev->mouse_queue_start = dev->mouse_queue_end = 0; - memset(dev->mouse_queue, 0x00, sizeof(dev->mouse_queue)); - /* FALLTHROUGH */ - case 3: - dev->mouse_cmd_queue_start = dev->mouse_cmd_queue_end = 0; - memset(dev->mouse_cmd_queue, 0x00, sizeof(dev->mouse_cmd_queue)); - break; - - case 0: - default: - dev->key_ctrl_queue_start = dev->key_ctrl_queue_end = 0; - memset(dev->key_ctrl_queue, 0x00, sizeof(dev->key_ctrl_queue)); - } -} - -static void -kbc_queue_add(atkbd_t *dev, uint8_t val, uint8_t channel) -{ - switch (channel) { - case 4: - kbd_log("ATkbc: dev->key_cmd_queue[%02X] = %02X;\n", dev->key_cmd_queue_end, val); - dev->key_cmd_queue[dev->key_cmd_queue_end] = val; - dev->key_cmd_queue_end = (dev->key_cmd_queue_end + 1) & 0xf; - break; - case 3: - kbd_log("ATkbc: dev->mouse_cmd_queue[%02X] = %02X;\n", dev->mouse_cmd_queue_end, val); - dev->mouse_cmd_queue[dev->mouse_cmd_queue_end] = val; - dev->mouse_cmd_queue_end = (dev->mouse_cmd_queue_end + 1) & 0xf; - break; - case 2: - kbd_log("ATkbc: dev->mouse_queue[%02X] = %02X;\n", dev->mouse_queue_end, val); - dev->mouse_queue[dev->mouse_queue_end] = val; - dev->mouse_queue_end = (dev->mouse_queue_end + 1) & 0xf; - break; - case 1: - kbd_log("ATkbc: dev->key_queue[%02X] = %02X;\n", dev->key_queue_end, val); - dev->key_queue[dev->key_queue_end] = val; - dev->key_queue_end = (dev->key_queue_end + 1) & 0xf; - break; - case 0: - default: - kbd_log("ATkbc: dev->key_ctrl_queue[%02X] = %02X;\n", dev->key_ctrl_queue_end, val); - dev->key_ctrl_queue[dev->key_ctrl_queue_end] = val; - dev->key_ctrl_queue_end = (dev->key_ctrl_queue_end + 1) & 0x3f; - break; - } -} - -static int -kbc_translate(atkbd_t *dev, uint8_t val) -{ - int xt_mode = (dev->mem[0x20] & 0x20) && ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF); - int translate = (dev->mem[0x20] & 0x40) || xt_mode || ((dev->flags & KBC_TYPE_MASK) == KBC_TYPE_PS2_2); - uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; - int ret = - 1; - - /* Allow for scan code translation. */ - if (translate && (val == 0xf0)) { - kbd_log("ATkbd: translate is on, F0 prefix detected\n"); - dev->sc_or = 0x80; - return ret; - } - - /* Skip break code if translated make code has bit 7 set. */ - if (translate && (dev->sc_or == 0x80) && (nont_to_t[val] & 0x80)) { - kbd_log("ATkbd: translate is on, skipping scan code: %02X (original: F0 %02X)\n", nont_to_t[val], val); - dev->sc_or = 0; - return ret; - } - - /* Test for T3100E 'Fn' key (Right Alt / Right Ctrl) */ - if ((dev != NULL) && (kbc_ven == KBC_VEN_TOSHIBA) && - (keyboard_recv(0x138) || keyboard_recv(0x11d))) switch (val) { - case 0x4f: - t3100e_notify_set(0x01); - break; /* End */ - case 0x50: - t3100e_notify_set(0x02); - break; /* Down */ - case 0x51: - t3100e_notify_set(0x03); - break; /* PgDn */ - case 0x52: - t3100e_notify_set(0x04); - break; /* Ins */ - case 0x53: - t3100e_notify_set(0x05); - break; /* Del */ - case 0x54: - t3100e_notify_set(0x06); - break; /* SysRQ */ - case 0x45: - t3100e_notify_set(0x07); - break; /* NumLock */ - case 0x46: - t3100e_notify_set(0x08); - break; /* ScrLock */ - case 0x47: - t3100e_notify_set(0x09); - break; /* Home */ - case 0x48: - t3100e_notify_set(0x0a); - break; /* Up */ - case 0x49: - t3100e_notify_set(0x0b); - break; /* PgUp */ - case 0x4a: - t3100e_notify_set(0x0c); - break; /* Keypad - */ - case 0x4b: - t3100e_notify_set(0x0d); - break; /* Left */ - case 0x4c: - t3100e_notify_set(0x0e); - break; /* KP 5 */ - case 0x4d: - t3100e_notify_set(0x0f); - break; /* Right */ - } - - kbd_log("ATkbd: translate is %s, ", translate ? "on" : "off"); -#ifdef ENABLE_KEYBOARD_AT_LOG - kbd_log("scan code: "); - if (translate) { - kbd_log("%02X (original: ", (nont_to_t[val] | dev->sc_or)); - if (dev->sc_or == 0x80) - kbd_log("F0 "); - kbd_log("%02X)\n", val); - } else - kbd_log("%02X\n", val); -#endif - - ret = translate ? (nont_to_t[val] | dev->sc_or) : val; - - if (dev->sc_or == 0x80) - dev->sc_or = 0; - - return ret; -} - -static void -add_to_kbc_queue_front(atkbd_t *dev, uint8_t val, uint8_t channel, uint8_t stat_hi) -{ - uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; - int temp = (channel == 1) ? kbc_translate(dev, val) : val; - - if (temp == -1) - return; - - if ((kbc_ven == KBC_VEN_AMI) || (kbc_ven == KBC_VEN_TG) || - (kbc_ven == KBC_VEN_TG_GREEN) || ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF)) - stat_hi |= ((dev->input_port & 0x80) ? 0x10 : 0x00); - else - stat_hi |= 0x10; - - kbd_log("ATkbc: Adding %02X to front on channel %i...\n", temp, channel); - dev->status = (dev->status & ~0xf0) | STAT_OFULL | stat_hi; - - /* WARNING: On PS/2, all IRQ's are level-triggered, but the IBM PS/2 KBC firmware is explicitly - written to pulse its P2 IRQ bits, so they should be kept as as edge-triggered here. */ - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - if (channel >= 2) { - dev->status |= STAT_MFULL; - - if (dev->mem[0x20] & 0x02) - picint_common(1 << 12, 0, 1); - picint_common(1 << 1, 0, 0); - } else { - if (dev->mem[0x20] & 0x01) - picint_common(1 << 1, 0, 1); - picint_common(1 << 12, 0, 0); - } - } else if (dev->mem[0x20] & 0x01) - picintlevel(1 << 1); /* AT KBC: IRQ 1 is level-triggered because it is tied to OBF. */ - - dev->out = temp; -} - -static void -add_data_kbd_cmd_queue(atkbd_t *dev, uint8_t val) -{ - if (dev->key_cmd_queue_end >= 16) { - kbd_log("ATkbc: Unable to add to queue, dev->key_cmd_queue_end >= 16\n"); - return; - } - kbd_log("ATkbc: dev->key_cmd_queue[%02X] = %02X;\n", dev->key_cmd_queue_end, val); - kbc_queue_add(dev, val, 4); - dev->kbd_last_scan_code = val; -} - -static void -add_data_kbd_queue(atkbd_t *dev, uint8_t val) -{ - if (!keyboard_scan || (dev->key_queue_end >= 16)) { - kbd_log("ATkbc: Unable to add to queue, conditions: %i, %i\n", !keyboard_scan, (dev->key_queue_end >= 16)); - return; - } - kbd_log("ATkbc: key_queue[%02X] = %02X;\n", dev->key_queue_end, val); - kbc_queue_add(dev, val, 1); - dev->kbd_last_scan_code = val; -} - -static void -add_data_kbd_front(atkbd_t *dev, uint8_t val) -{ - add_data_kbd_cmd_queue(dev, val); -} - -static void kbd_process_cmd(void *priv); -static void kbc_process_cmd(void *priv); - -static void -set_enable_kbd(atkbd_t *dev, uint8_t enable) -{ - dev->mem[0x20] &= 0xef; - dev->mem[0x20] |= (enable ? 0x00 : 0x10); -} - -static void -set_enable_mouse(atkbd_t *dev, uint8_t enable) -{ - dev->mem[0x20] &= 0xdf; - dev->mem[0x20] |= (enable ? 0x00 : 0x20); -} - -static void -kbc_ibf_process(atkbd_t *dev) -{ - /* IBF set, process both commands and data. */ - dev->status &= ~STAT_IFULL; - dev->kbc_state = KBC_STATE_MAIN_IBF; - if (dev->status & STAT_CD) - kbc_process_cmd(dev); - else { - set_enable_kbd(dev, 1); - dev->key_wantcmd = 1; - dev->key_dat = dev->ib; - dev->kbc_state = KBC_STATE_SEND_KBD; - } -} - -static void -kbc_scan_kbd_at(atkbd_t *dev) -{ - if (!(dev->mem[0x20] & 0x10)) { - /* Both OBF and IBF clear and keyboard is enabled. */ - /* XT mode. */ - if (dev->mem[0x20] & 0x20) { - if (dev->out_new != -1) { - add_to_kbc_queue_front(dev, dev->out_new, 1, 0x00); - dev->out_new = -1; - dev->kbc_state = KBC_STATE_MAIN_IBF; - } else if (dev->status & STAT_IFULL) - kbc_ibf_process(dev); - /* AT mode. */ - } else { - // dev->t = dev->mem[0x28]; - if (dev->mem[0x2e] != 0x00) { - // if (!(dev->t & 0x02)) - // return; - dev->mem[0x2e] = 0x00; - } - dev->output_port &= 0xbf; - if (dev->out_new != -1) { - /* In our case, we never have noise on the line, so we can simplify this. */ - /* Read data from the keyboard. */ - if (dev->mem[0x20] & 0x40) { - if ((dev->mem[0x20] & 0x08) || (dev->input_port & 0x80)) - add_to_kbc_queue_front(dev, dev->out_new, 1, 0x00); - dev->mem[0x2d] = (dev->out_new == 0xf0) ? 0x80 : 0x00; - } else - add_to_kbc_queue_front(dev, dev->out_new, 1, 0x00); - dev->out_new = -1; - dev->kbc_state = KBC_STATE_MAIN_IBF; - } - } - } -} - -static void write_output(atkbd_t *dev, uint8_t val); - -static void -kbc_poll_at(atkbd_t *dev) -{ - switch (dev->kbc_state) { - case KBC_STATE_RESET: - if (dev->status & STAT_IFULL) { - dev->status = ((dev->status & 0x0f) | 0x10) & ~STAT_IFULL; - if ((dev->status & STAT_CD) && (dev->ib == 0xaa)) - kbc_process_cmd(dev); - } - break; - case KBC_STATE_MAIN_IBF: - default: - if (dev->status & STAT_OFULL) { - /* OBF set, wait until it is cleared but still process commands. */ - if ((dev->status & STAT_IFULL) && (dev->status & STAT_CD)) { - dev->status &= ~STAT_IFULL; - kbc_process_cmd(dev); - } - } else if (dev->status & STAT_IFULL) - kbc_ibf_process(dev); - else if (!(dev->mem[0x20] & 0x10)) - dev->kbc_state = KBC_STATE_MAIN_KBD; - break; - case KBC_STATE_MAIN_KBD: - case KBC_STATE_MAIN_BOTH: - if (dev->status & STAT_IFULL) - kbc_ibf_process(dev); - else { - (void) kbc_scan_kbd_at(dev); - dev->kbc_state = KBC_STATE_MAIN_IBF; - } - break; - case KBC_STATE_KBC_OUT: - /* Keyboard controller command want to output multiple bytes. */ - if (dev->status & STAT_IFULL) { - /* Data from host aborts dumping. */ - dev->kbc_state = KBC_STATE_MAIN_IBF; - kbc_ibf_process(dev); - } - /* Do not continue dumping until OBF is clear. */ - if (!(dev->status & STAT_OFULL)) { - kbd_log("ATkbc: %02X coming from channel 0\n", dev->key_ctrl_queue[dev->key_ctrl_queue_start]); - add_to_kbc_queue_front(dev, dev->key_ctrl_queue[dev->key_ctrl_queue_start], 0, 0x00); - dev->key_ctrl_queue_start = (dev->key_ctrl_queue_start + 1) & 0x3f; - if (dev->key_ctrl_queue_start == dev->key_ctrl_queue_end) - dev->kbc_state = KBC_STATE_MAIN_IBF; - } - break; - case KBC_STATE_KBC_PARAM: - /* Keyboard controller command wants data, wait for said data. */ - if (dev->status & STAT_IFULL) { - /* Command written, abort current command. */ - if (dev->status & STAT_CD) - dev->kbc_state = KBC_STATE_MAIN_IBF; - - dev->status &= ~STAT_IFULL; - kbc_process_cmd(dev); - } - break; - case KBC_STATE_SEND_KBD: - if (!dev->key_wantcmd) - dev->kbc_state = KBC_STATE_SCAN_KBD; - break; - case KBC_STATE_SCAN_KBD: - kbc_scan_kbd_at(dev); - break; - } -} - -/* - Correct Procedure: - 1. Controller asks the device (keyboard or mouse) for a byte. - 2. The device, unless it's in the reset or command states, sees if there's anything to give it, - and if yes, begins the transfer. - 3. The controller checks if there is a transfer, if yes, transfers the byte and sends it to the host, - otherwise, checks the next device, or if there is no device left to check, checks if IBF is full - and if yes, processes it. - */ -static int -kbc_scan_kbd_ps2(atkbd_t *dev) -{ - if (dev->out_new != -1) { - kbd_log("ATkbc: %02X coming from channel 1\n", dev->out_new & 0xff); - add_to_kbc_queue_front(dev, dev->out_new, 1, 0x00); - dev->out_new = -1; - dev->kbc_state = KBC_STATE_MAIN_IBF; - return 1; - } - - return 0; -} - -static int -kbc_scan_aux_ps2(atkbd_t *dev) -{ - if (dev->out_new_mouse != -1) { - kbd_log("ATkbc: %02X coming from channel 2\n", dev->out_new_mouse & 0xff); - add_to_kbc_queue_front(dev, dev->out_new_mouse, 2, 0x00); - dev->out_new_mouse = -1; - dev->kbc_state = KBC_STATE_MAIN_IBF; - return 1; - } - - return 0; -} - -static void -kbc_poll_ps2(atkbd_t *dev) -{ - switch (dev->kbc_state) { - case KBC_STATE_RESET: - if (dev->status & STAT_IFULL) { - dev->status = ((dev->status & 0x0f) | 0x10) & ~STAT_IFULL; - if ((dev->status & STAT_CD) && (dev->ib == 0xaa)) - kbc_process_cmd(dev); - } - break; - case KBC_STATE_MAIN_IBF: - default: - if (dev->status & STAT_IFULL) - kbc_ibf_process(dev); - else if (!(dev->status & STAT_OFULL)) { - if (dev->mem[0x20] & 0x20) { - if (!(dev->mem[0x20] & 0x10)) { - dev->output_port &= 0xbf; - dev->kbc_state = KBC_STATE_MAIN_KBD; - } - } else { - dev->output_port &= 0xf7; - if (dev->mem[0x20] & 0x10) - dev->kbc_state = KBC_STATE_MAIN_MOUSE; - else { - dev->output_port &= 0xbf; - dev->kbc_state = KBC_STATE_MAIN_BOTH; - } - } - } - break; - case KBC_STATE_MAIN_KBD: - if (dev->status & STAT_IFULL) - kbc_ibf_process(dev); - else { - (void) kbc_scan_kbd_ps2(dev); - dev->kbc_state = KBC_STATE_MAIN_IBF; - } - break; - case KBC_STATE_MAIN_MOUSE: - if (dev->status & STAT_IFULL) - kbc_ibf_process(dev); - else { - (void) kbc_scan_aux_ps2(dev); - dev->kbc_state = KBC_STATE_MAIN_IBF; - } - break; - case KBC_STATE_MAIN_BOTH: - if (kbc_scan_kbd_ps2(dev)) - dev->kbc_state = KBC_STATE_MAIN_IBF; - else - dev->kbc_state = KBC_STATE_MAIN_MOUSE; - break; - case KBC_STATE_KBC_OUT: - /* Keyboard controller command want to output multiple bytes. */ - if (dev->status & STAT_IFULL) { - /* Data from host aborts dumping. */ - dev->kbc_state = KBC_STATE_MAIN_IBF; - kbc_ibf_process(dev); - } - /* Do not continue dumping until OBF is clear. */ - if (!(dev->status & STAT_OFULL)) { - kbd_log("ATkbc: %02X coming from channel 0\n", dev->out_new & 0xff); - add_to_kbc_queue_front(dev, dev->key_ctrl_queue[dev->key_ctrl_queue_start], 0, 0x00); - dev->key_ctrl_queue_start = (dev->key_ctrl_queue_start + 1) & 0x3f; - if (dev->key_ctrl_queue_start == dev->key_ctrl_queue_end) - dev->kbc_state = KBC_STATE_MAIN_IBF; - } - break; - case KBC_STATE_KBC_PARAM: - /* Keyboard controller command wants data, wait for said data. */ - if (dev->status & STAT_IFULL) { - /* Command written, abort current command. */ - if (dev->status & STAT_CD) - dev->kbc_state = KBC_STATE_MAIN_IBF; - - dev->status &= ~STAT_IFULL; - kbc_process_cmd(dev); - } - break; - case KBC_STATE_SEND_KBD: - if (!dev->key_wantcmd) - dev->kbc_state = KBC_STATE_SCAN_KBD; - break; - case KBC_STATE_SCAN_KBD: - (void) kbc_scan_kbd_ps2(dev); - break; - case KBC_STATE_SEND_MOUSE: - if (!dev->mouse_wantcmd) - dev->kbc_state = KBC_STATE_SCAN_MOUSE; - break; - case KBC_STATE_SCAN_MOUSE: - (void) kbc_scan_aux_ps2(dev); - break; - } -} - -static void -kbc_poll_kbd(atkbd_t *dev) -{ - switch (dev->kbd_state) { - case DEV_STATE_MAIN_1: - /* Process the command if needed and then return to main loop #2. */ - if (dev->key_wantcmd) { - kbd_log("ATkbc: Processing keyboard command %02X...\n", dev->key_dat); - kbc_queue_reset(dev, 4); - // dev->out_new = -1; - kbd_process_cmd(dev); - dev->key_wantcmd = 0; - } else - dev->kbd_state = DEV_STATE_MAIN_2; - break; - case DEV_STATE_MAIN_2: - /* Output from scan queue if needed and then return to main loop #1. */ - if (keyboard_scan && (dev->out_new == -1) && (dev->key_queue_start != dev->key_queue_end)) { - kbd_log("ATkbc: %02X (DATA) on channel 1\n", dev->key_queue[dev->key_queue_start]); - dev->out_new = dev->key_queue[dev->key_queue_start]; - dev->key_queue_start = (dev->key_queue_start + 1) & 0xf; - } - if (!keyboard_scan || dev->key_wantcmd) - dev->kbd_state = DEV_STATE_MAIN_1; - break; - case DEV_STATE_MAIN_OUT: - /* If host wants to send command while we're sending a byte to host, process the command. */ - if (dev->key_wantcmd) { - kbd_log("ATkbc: Processing keyboard command %02X...\n", dev->key_dat); - kbc_queue_reset(dev, 4); - kbd_process_cmd(dev); - dev->key_wantcmd = 0; - break; - } - /* FALLTHROUGH */ - case DEV_STATE_MAIN_WANT_IN: - /* Output command response and then wait for host data. */ - if ((dev->out_new == -1) && (dev->key_cmd_queue_start != dev->key_cmd_queue_end)) { - kbd_log("ATkbc: %02X (CMD ) on channel 1\n", dev->key_cmd_queue[dev->key_cmd_queue_start]); - dev->out_new = dev->key_cmd_queue[dev->key_cmd_queue_start]; - dev->key_cmd_queue_start = (dev->key_cmd_queue_start + 1) & 0xf; - } - if (dev->key_cmd_queue_start == dev->key_cmd_queue_end) - dev->kbd_state = (dev->kbd_state == DEV_STATE_MAIN_OUT) ? DEV_STATE_MAIN_2 : DEV_STATE_MAIN_IN; - break; - case DEV_STATE_MAIN_IN: - /* Wait for host data. */ - if (dev->key_wantcmd) { - kbd_log("ATkbc: Processing keyboard command %02X parameter %02X...\n", dev->key_command, dev->key_dat); - kbc_queue_reset(dev, 4); - // dev->out_new = -1; - kbd_process_cmd(dev); - dev->key_wantcmd = 0; - } - break; - } -} - -static void -kbc_poll_aux(atkbd_t *dev) -{ - switch (dev->mouse_state) { - case DEV_STATE_MAIN_1: - /* Process the command if needed and then return to main loop #2. */ - if (dev->mouse_wantcmd) { - kbd_log("ATkbc: Processing mouse command %02X...\n", dev->mouse_dat); - kbc_queue_reset(dev, 3); - // dev->out_new_mouse = -1; - dev->mouse_state = DEV_STATE_MAIN_OUT; - mouse_write(dev->mouse_dat, mouse_p); - if ((dev->mouse_dat == 0xe8) || (dev->mouse_dat == 0xf3)) - dev->mouse_state = DEV_STATE_MAIN_WANT_IN; - dev->mouse_wantcmd = 0; - } else - dev->mouse_state = DEV_STATE_MAIN_2; - break; - case DEV_STATE_MAIN_2: - /* Output from scan queue if needed and then return to main loop #1. */ - if (mouse_scan && (dev->out_new_mouse == -1) && (dev->mouse_queue_start != dev->mouse_queue_end)) { - kbd_log("ATkbc: %02X (DATA) on channel 2\n", dev->mouse_queue[dev->mouse_queue_start]); - dev->out_new_mouse = dev->mouse_queue[dev->mouse_queue_start]; - dev->mouse_queue_start = (dev->mouse_queue_start + 1) & 0xf; - } - if (!mouse_scan || dev->mouse_wantcmd) - dev->mouse_state = DEV_STATE_MAIN_1; - break; - case DEV_STATE_MAIN_OUT: - /* If host wants to send command while we're sending a byte to host, process the command. */ - if (dev->mouse_wantcmd) { - kbd_log("ATkbc: Processing mouse command %02X...\n", dev->mouse_dat); - kbc_queue_reset(dev, 3); - dev->mouse_state = DEV_STATE_MAIN_OUT; - mouse_write(dev->mouse_dat, mouse_p); - if ((dev->mouse_dat == 0xe8) || (dev->mouse_dat == 0xf3)) - dev->mouse_state = DEV_STATE_MAIN_WANT_IN; - dev->mouse_wantcmd = 0; - break; - } - /* FALLTHROUGH */ - case DEV_STATE_MAIN_WANT_IN: - /* Output command response and then wait for host data. */ - if ((dev->out_new_mouse == -1) && (dev->mouse_cmd_queue_start != dev->mouse_cmd_queue_end)) { - kbd_log("ATkbc: %02X (CMD ) on channel 2\n", dev->mouse_cmd_queue[dev->mouse_cmd_queue_start]); - dev->out_new_mouse = dev->mouse_cmd_queue[dev->mouse_cmd_queue_start]; - dev->mouse_cmd_queue_start = (dev->mouse_cmd_queue_start + 1) & 0xf; - } - if (dev->mouse_cmd_queue_start == dev->mouse_cmd_queue_end) - dev->mouse_state = (dev->mouse_state == DEV_STATE_MAIN_OUT) ? DEV_STATE_MAIN_2 : DEV_STATE_MAIN_IN; - break; - case DEV_STATE_MAIN_IN: - /* Wait for host data. */ - if (dev->mouse_wantcmd) { - kbd_log("ATkbc: Processing mouse command parameter %02X...\n", dev->mouse_dat); - kbc_queue_reset(dev, 3); - // dev->out_new_mouse = -1; - dev->mouse_state = DEV_STATE_MAIN_OUT; - mouse_write(dev->mouse_dat, mouse_p); - dev->mouse_wantcmd = 0; - } - break; - } -} - -/* TODO: State machines for controller, keyboard, and mouse. */ -static void -kbd_poll(void *priv) -{ - atkbd_t *dev = (atkbd_t *) priv; - - timer_advance_u64(&dev->send_delay_timer, (100ULL * TIMER_USEC)); - - /* TODO: Use a fuction pointer for this (also needed to the AMI KBC mode switching) - and implement the password security state. */ - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) - kbc_poll_ps2(dev); - else - kbc_poll_at(dev); - - kbc_poll_kbd(dev); - - if (((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) && mouse_write) - kbc_poll_aux(dev); - - // if (kbc_ports[0] && kbc_ports[0]>-priv) - // kbc_ports[0]>poll(kbc_ports[0]>-priv); - - // if (((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) && kbc_ports[1] && kbc_ports[1]>-priv) - // kbc_ports[1]>poll(kbc_ports[1]>-priv); -} - -static void -add_data_vals(atkbd_t *dev, uint8_t *val, uint8_t len) +add_data_vals(atkbc_dev_t *dev, uint8_t *val, uint8_t len) { int i; for (i = 0; i < len; i++) - add_data_kbd_queue(dev, val[i]); + kbc_at_dev_queue_add(dev, val[i], 1); } static void add_data_kbd(uint16_t val) { - atkbd_t *dev = SavedKbd; + atkbc_dev_t *dev = SavedKbd; uint8_t fake_shift[4]; uint8_t num_lock = 0, shift_states = 0; @@ -1325,10 +523,10 @@ add_data_kbd(uint16_t val) switch (val) { case FAKE_LSHIFT_ON: - kbd_log("fake left shift on, scan code: "); + keyboard_at_log("%s: Fake left shift on, scan code: ", dev->name); if (num_lock) { if (shift_states) { - kbd_log("N/A (one or both shifts on)\n"); + keyboard_at_log("N/A (one or both shifts on)\n"); break; } else { /* Num lock on and no shifts are pressed, send non-inverted fake shift. */ @@ -1346,7 +544,7 @@ add_data_kbd(uint16_t val) break; default: - kbd_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); + keyboard_at_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); break; } } @@ -1368,7 +566,7 @@ add_data_kbd(uint16_t val) break; default: - kbd_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); + keyboard_at_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); break; } } @@ -1389,19 +587,19 @@ add_data_kbd(uint16_t val) break; default: - kbd_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); + keyboard_at_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); break; } } - kbd_log(shift_states ? "" : "N/A (both shifts off)\n"); + keyboard_at_log(shift_states ? "" : "N/A (both shifts off)\n"); } break; case FAKE_LSHIFT_OFF: - kbd_log("fake left shift on, scan code: "); + keyboard_at_log("%s: Fake left shift on, scan code: ", dev->name); if (num_lock) { if (shift_states) { - kbd_log("N/A (one or both shifts on)\n"); + keyboard_at_log("N/A (one or both shifts on)\n"); break; } else { /* Num lock on and no shifts are pressed, send non-inverted fake shift. */ @@ -1420,7 +618,7 @@ add_data_kbd(uint16_t val) break; default: - kbd_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); + keyboard_at_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); break; } } @@ -1441,7 +639,7 @@ add_data_kbd(uint16_t val) break; default: - kbd_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); + keyboard_at_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); break; } } @@ -1461,1368 +659,347 @@ add_data_kbd(uint16_t val) break; default: - kbd_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); + keyboard_at_log("N/A (scan code set %i)\n", keyboard_mode & 0x02); break; } } - kbd_log(shift_states ? "" : "N/A (both shifts off)\n"); + keyboard_at_log(shift_states ? "" : "N/A (both shifts off)\n"); } break; default: - add_data_kbd_queue(dev, val); + kbc_at_dev_queue_add(dev, val, 1); break; } } -static void -write_output(atkbd_t *dev, uint8_t val) -{ - uint8_t old = dev->output_port; - kbd_log("ATkbc: write output port: %02X (old: %02X)\n", val, dev->output_port); - - uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; - -#if 0 - /* PS/2: Handle IRQ's. */ - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - /* IRQ 12 */ - picint_common(1 << 12, 0, val & 0x20); - - /* IRQ 1 */ - picint_common(1 << 1, 0, val & 0x10); - } -#endif - - /* AT, PS/2: Handle A20. */ - if ((old ^ val) & 0x02) { /* A20 enable change */ - mem_a20_key = val & 0x02; - mem_a20_recalc(); - flushmmucache(); - } - - /* AT, PS/2: Handle reset. */ - /* 0 holds the CPU in the RESET state, 1 releases it. To simplify this, - we just do everything on release. */ - if ((old ^ val) & 0x01) { /*Reset*/ - if (!(val & 0x01)) { /* Pin 0 selected. */ - /* Pin 0 selected. */ - kbd_log("write_output(): Pulse reset!\n"); - if (machines[machine].flags & MACHINE_COREBOOT) { - /* The SeaBIOS hard reset code attempts a KBC reset if ACPI RESET_REG - is not available. However, the KBC reset is normally a soft reset, so - SeaBIOS gets caught in a soft reset loop as it tries to hard reset the - machine. Hack around this by making the KBC reset a hard reset only on - coreboot machines. */ - pc_reset_hard(); - } else { - softresetx86(); /*Pulse reset!*/ - cpu_set_edx(); - flushmmucache(); - if (kbc_ven == KBC_VEN_ALI) - smbase = 0x00030000; - } - } - } - - /* Do this here to avoid an infinite reset loop. */ - dev->output_port = val; -} - -static void -write_output_fast_a20(atkbd_t *dev, uint8_t val) -{ - uint8_t old = dev->output_port; - kbd_log("ATkbc: write output port in fast A20 mode: %02X (old: %02X)\n", val, dev->output_port); - - /* AT, PS/2: Handle A20. */ - if ((old ^ val) & 0x02) { /* A20 enable change */ - mem_a20_key = val & 0x02; - mem_a20_recalc(); - flushmmucache(); - } - - /* Do this here to avoid an infinite reset loop. */ - dev->output_port = val; -} - -static void -write_cmd(atkbd_t *dev, uint8_t val) -{ - kbd_log("ATkbc: write command byte: %02X (old: %02X)\n", val, dev->mem[0x20]); - - /* PS/2 type 2 keyboard controllers always force the XLAT bit to 0. */ - if ((dev->flags & KBC_TYPE_MASK) == KBC_TYPE_PS2_2) { - val &= ~CCB_TRANSLATE; - dev->mem[0x20] &= ~CCB_TRANSLATE; - } else if ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) { - if (val & 0x10) - dev->mem[0x2e] = 0x01; - } - - kbd_log("ATkbc: keyboard interrupt is now %s\n", (val & 0x01) ? "enabled" : "disabled"); - - if ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) { - /* Update the output port to mirror the IBF and OBF bits, if active. */ - write_output(dev, (dev->output_port & 0x0f) | ((val & 0x03) << 4) | ((val & 0x20) ? 0xc0 : 0x00)); - } - - kbd_log("Command byte now: %02X (%02X)\n", dev->mem[0x20], val); - - dev->status = (dev->status & ~STAT_SYSFLAG) | (val & STAT_SYSFLAG); -} - -static void -pulse_output(atkbd_t *dev, uint8_t mask) -{ - if (mask != 0x0f) { - dev->old_output_port = dev->output_port & ~(0xf0 | mask); - kbd_log("pulse_output(): Output port now: %02X\n", dev->output_port & (0xf0 | mask)); - write_output(dev, dev->output_port & (0xf0 | mask)); - timer_set_delay_u64(&dev->pulse_cb, 6ULL * TIMER_USEC); - } -} - -static void -pulse_poll(void *priv) -{ - atkbd_t *dev = (atkbd_t *) priv; - - kbd_log("pulse_poll(): Output port now: %02X\n", dev->output_port | dev->old_output_port); - write_output(dev, dev->output_port | dev->old_output_port); -} - -static uint8_t -write64_generic(void *priv, uint8_t val) -{ - atkbd_t *dev = (atkbd_t *) priv; - uint8_t current_drive, fixed_bits; - uint8_t kbc_ven = 0x0; - kbc_ven = dev->flags & KBC_VEN_MASK; - - switch (val) { - case 0xa4: /* check if password installed */ - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: check if password installed\n"); - add_to_kbc_queue_front(dev, 0xf1, 0, 0x00); - return 0; - } - break; - - case 0xa7: /* disable mouse port */ - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: disable mouse port\n"); - set_enable_mouse(dev, 0); - return 0; - } - break; - - case 0xa8: /*Enable mouse port*/ - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: enable mouse port\n"); - set_enable_mouse(dev, 1); - return 0; - } - break; - - case 0xa9: /*Test mouse port*/ - kbd_log("ATkbc: test mouse port\n"); - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); /* no error, this is testing the channel 2 interface */ - return 0; - } - break; - - case 0xaf: /* read keyboard version */ - kbd_log("ATkbc: read keyboard version\n"); - add_to_kbc_queue_front(dev, 0x42, 0, 0x00); - return 0; - - case 0xc0: /* read input port */ - kbd_log("ATkbc: read input port\n"); - fixed_bits = 4; - /* The SMM handlers of Intel AMI Pentium BIOS'es expect bit 6 to be set. */ - if (kbc_ven == KBC_VEN_INTEL_AMI) - fixed_bits |= 0x40; - if (kbc_ven == KBC_VEN_IBM_PS1) { - current_drive = fdc_get_current_drive(); - add_to_kbc_queue_front(dev, dev->input_port | fixed_bits | (fdd_is_525(current_drive) ? 0x40 : 0x00), - 0, 0x00); - dev->input_port = ((dev->input_port + 1) & 3) | (dev->input_port & 0xfc) | (fdd_is_525(current_drive) ? 0x40 : 0x00); - } else if (kbc_ven == KBC_VEN_NCR) { - /* switch settings - * bit 7: keyboard disable - * bit 6: display type (0 color, 1 mono) - * bit 5: power-on default speed (0 high, 1 low) - * bit 4: sense RAM size (0 unsupported, 1 512k on system board) - * bit 3: coprocessor detect - * bit 2: unused - * bit 1: high/auto speed - * bit 0: dma mode - */ - add_to_kbc_queue_front(dev, (dev->input_port | fixed_bits | (video_is_mda() ? 0x40 : 0x00) | (hasfpu ? 0x08 : 0x00)) & 0xdf, - 0, 0x00); - dev->input_port = ((dev->input_port + 1) & 3) | (dev->input_port & 0xfc); - } else { - if ((kbc_ven == KBC_VEN_TG) || (kbc_ven == KBC_VEN_TG_GREEN)) { - /* Bit 3, 2: - 1, 1: TriGem logo; - 1, 0: Garbled logo; - 0, 1: Epson logo; - 0, 0: Generic AMI logo. */ - if (dev->pci) - fixed_bits |= 8; - add_to_kbc_queue_front(dev, dev->input_port | fixed_bits, 0, 0x00); - } else if (((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) && ((dev->flags & KBC_VEN_MASK) != KBC_VEN_INTEL_AMI)) -#if 0 - add_to_kbc_queue_front(dev, (dev->input_port | fixed_bits) & - (((dev->flags & KBC_VEN_MASK) == KBC_VEN_ACER) ? 0xeb : 0xef), 0, 0x00); -#else - add_to_kbc_queue_front(dev, ((dev->input_port | fixed_bits) & 0xf0) | (((dev->flags & KBC_VEN_MASK) == KBC_VEN_ACER) ? 0x08 : 0x0c), 0, 0x00); -#endif - else - add_to_kbc_queue_front(dev, dev->input_port | fixed_bits, 0, 0x00); - dev->input_port = ((dev->input_port + 1) & 3) | (dev->input_port & 0xfc); - } - return 0; - - case 0xd3: /* write mouse output buffer */ - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: write mouse output buffer\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - return 0; - } - break; - - case 0xd4: /* write to mouse */ - kbd_log("ATkbc: write to mouse\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - return 0; - - case 0xf0 ... 0xff: - kbd_log("ATkbc: pulse %01X\n", val & 0x0f); - pulse_output(dev, val & 0x0f); - return 0; - } - - kbd_log("ATkbc: bad command %02X\n", val); - return 1; -} - -static uint8_t -write60_ami(void *priv, uint8_t val) -{ - atkbd_t *dev = (atkbd_t *) priv; - - switch (dev->command) { - /* 0x40 - 0x5F are aliases for 0x60-0x7F */ - case 0x40 ... 0x5f: - kbd_log("ATkbc: AMI - alias write to %08X\n", dev->command); - dev->mem[(dev->command & 0x1f) + 0x20] = val; - if (dev->command == 0x60) - write_cmd(dev, val); - return 0; - - case 0xa5: /* get extended controller RAM */ - kbd_log("ATkbc: AMI - get extended controller RAM\n"); - add_to_kbc_queue_front(dev, dev->mem[val], 0, 0x00); - return 0; - - case 0xaf: /* set extended controller RAM */ - kbd_log("ATkbc: AMI - set extended controller RAM\n"); - if (dev->secr_phase == 1) { - dev->mem_addr = val; - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - dev->secr_phase = 2; - } else if (dev->secr_phase == 2) { - dev->mem[dev->mem_addr] = val; - dev->secr_phase = 0; - } - return 0; - - case 0xc1: - kbd_log("ATkbc: AMI MegaKey - write %02X to input port\n", val); - dev->input_port = val; - return 0; - - case 0xcb: /* set keyboard mode */ - kbd_log("ATkbc: AMI - set keyboard mode\n"); - dev->ami_flags = val; - return 0; - } - - return 1; -} - -static uint8_t -write64_ami(void *priv, uint8_t val) -{ - atkbd_t *dev = (atkbd_t *) priv; - uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; - - switch (val) { - case 0x00 ... 0x1f: - kbd_log("ATkbc: AMI - alias read from %08X\n", val); - add_to_kbc_queue_front(dev, dev->mem[val + 0x20], 0, 0x00); - return 0; - - case 0x40 ... 0x5f: - kbd_log("ATkbc: AMI - alias write to %08X\n", dev->command); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - return 0; - - case 0xa0: /* copyright message */ - kbc_queue_add(dev, 0x28, 0); - kbc_queue_add(dev, 0x00, 0); - dev->kbc_state = KBC_STATE_KBC_OUT; - break; - - case 0xa1: /* get controller version */ - kbd_log("ATkbc: AMI - get controller version\n"); - if ((kbc_ven == KBC_VEN_TG) || (kbc_ven == KBC_VEN_TG_GREEN)) - add_to_kbc_queue_front(dev, 'Z', 0, 0x00); - else if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - if (kbc_ven == KBC_VEN_ALI) - add_to_kbc_queue_front(dev, 'F', 0, 0x00); - else if ((dev->flags & KBC_VEN_MASK) == KBC_VEN_INTEL_AMI) - add_to_kbc_queue_front(dev, '5', 0, 0x00); - else if (cpu_64bitbus) - add_to_kbc_queue_front(dev, 'R', 0, 0x00); - else if (is486) - add_to_kbc_queue_front(dev, 'P', 0, 0x00); - else - add_to_kbc_queue_front(dev, 'H', 0, 0x00); - } else if (is386 && !is486) { - if (cpu_16bitbus) - add_to_kbc_queue_front(dev, 'D', 0, 0x00); - else - add_to_kbc_queue_front(dev, 'B', 0, 0x00); - } else if (!is386) - add_to_kbc_queue_front(dev, '8', 0, 0x00); - else - add_to_kbc_queue_front(dev, 'F', 0, 0x00); - return 0; - - case 0xa2: /* clear keyboard controller lines P22/P23 */ - if ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: AMI - clear KBC lines P22 and P23\n"); - write_output(dev, dev->output_port & 0xf3); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); - return 0; - } - break; - - case 0xa3: /* set keyboard controller lines P22/P23 */ - if ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: AMI - set KBC lines P22 and P23\n"); - write_output(dev, dev->output_port | 0x0c); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); - return 0; - } - break; - - case 0xa4: /* write clock = low */ - if ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: AMI - write clock = low\n"); - dev->ami_stat &= 0xfe; - return 0; - } - break; - - case 0xa5: /* write clock = high */ - if ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: AMI - write clock = high\n"); - dev->ami_stat |= 0x01; - } else { - kbd_log("ATkbc: get extended controller RAM\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - } - return 0; - - case 0xa6: /* read clock */ - if ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: AMI - read clock\n"); - add_to_kbc_queue_front(dev, (dev->ami_stat & 1) ? 0xff : 0x00, 0, 0x00); - return 0; - } - break; - - case 0xa7: /* write cache bad */ - if ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: AMI - write cache bad\n"); - dev->ami_stat &= 0xfd; - return 0; - } - break; - - case 0xa8: /* write cache good */ - if ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: AMI - write cache good\n"); - dev->ami_stat |= 0x02; - return 0; - } - break; - - case 0xa9: /* read cache */ - if ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: AMI - read cache\n"); - add_to_kbc_queue_front(dev, (dev->ami_stat & 2) ? 0xff : 0x00, 0, 0x00); - return 0; - } - break; - - case 0xaf: /* set extended controller RAM */ - if (kbc_ven == KBC_VEN_ALI) { - kbd_log("ATkbc: Award/ALi/VIA keyboard controller revision\n"); - add_to_kbc_queue_front(dev, 0x43, 0, 0x00); - } else { - kbd_log("ATkbc: set extended controller RAM\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - dev->secr_phase = 1; - } - return 0; - - case 0xb0 ... 0xb3: - /* set KBC lines P10-P13 (input port bits 0-3) low */ - kbd_log("ATkbc: set KBC lines P10-P13 (input port bits 0-3) low\n"); - if (!(dev->flags & DEVICE_PCI) || (val > 0xb1)) - dev->input_port &= ~(1 << (val & 0x03)); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); - return 0; - - case 0xb4: case 0xb5: - /* set KBC lines P22-P23 (output port bits 2-3) low */ - kbd_log("ATkbc: set KBC lines P22-P23 (output port bits 2-3) low\n"); - if (!(dev->flags & DEVICE_PCI)) - write_output(dev, dev->output_port & ~(4 << (val & 0x01))); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); - return 0; - - case 0xb8 ... 0xbb: - /* set KBC lines P10-P13 (input port bits 0-3) high */ - kbd_log("ATkbc: set KBC lines P10-P13 (input port bits 0-3) high\n"); - if (!(dev->flags & DEVICE_PCI) || (val > 0xb9)) { - dev->input_port |= (1 << (val & 0x03)); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); - } - return 0; - - case 0xbc: case 0xbd: - /* set KBC lines P22-P23 (output port bits 2-3) high */ - kbd_log("ATkbc: set KBC lines P22-P23 (output port bits 2-3) high\n"); - if (!(dev->flags & DEVICE_PCI)) - write_output(dev, dev->output_port | (4 << (val & 0x01))); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); - return 0; - - case 0xc1: /* write input port */ - kbd_log("ATkbc: AMI MegaKey - write input port\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - return 0; - - case 0xc4: - /* set KBC line P14 low */ - kbd_log("ATkbc: set KBC line P14 (input port bit 4) low\n"); - dev->input_port &= 0xef; - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); - return 0; - case 0xc5: - /* set KBC line P15 low */ - kbd_log("ATkbc: set KBC line P15 (input port bit 5) low\n"); - dev->input_port &= 0xdf; - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); - return 0; - - case 0xc8: - /* - * unblock KBC lines P22/P23 - * (allow command D1 to change bits 2/3 of the output port) - */ - kbd_log("ATkbc: AMI - unblock KBC lines P22 and P23\n"); - dev->ami_flags &= 0xfb; - return 0; - - case 0xc9: - /* - * block KBC lines P22/P23 - * (disallow command D1 from changing bits 2/3 of the port) - */ - kbd_log("ATkbc: AMI - block KBC lines P22 and P23\n"); - dev->ami_flags |= 0x04; - return 0; - - case 0xcc: - /* set KBC line P14 high */ - kbd_log("ATkbc: set KBC line P14 (input port bit 4) high\n"); - dev->input_port |= 0x10; - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); - return 0; - case 0xcd: - /* set KBC line P15 high */ - kbd_log("ATkbc: set KBC line P15 (input port bit 5) high\n"); - dev->input_port |= 0x20; - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); - return 0; - - case 0xef: /* ??? - sent by AMI486 */ - kbd_log("ATkbc: ??? - sent by AMI486\n"); - return 0; - } - - return write64_generic(dev, val); -} - -static uint8_t -write64_ibm_mca(void *priv, uint8_t val) -{ - atkbd_t *dev = (atkbd_t *) priv; - - switch (val) { - case 0xc1: /*Copy bits 0 to 3 of input port to status bits 4 to 7*/ - kbd_log("ATkbc: copy bits 0 to 3 of input port to status bits 4 to 7\n"); - dev->status &= 0x0f; - dev->status |= ((((dev->input_port & 0xfc) | 0x84) & 0x0f) << 4); - return 0; - - case 0xc2: /*Copy bits 4 to 7 of input port to status bits 4 to 7*/ - kbd_log("ATkbc: copy bits 4 to 7 of input port to status bits 4 to 7\n"); - dev->status &= 0x0f; - dev->status |= (((dev->input_port & 0xfc) | 0x84) & 0xf0); - return 0; - - case 0xaf: - kbd_log("ATkbc: bad KBC command AF\n"); - return 1; - - case 0xf0 ... 0xff: - kbd_log("ATkbc: pulse: %01X\n", (val & 0x03) | 0x0c); - pulse_output(dev, (val & 0x03) | 0x0c); - return 0; - } - - return write64_generic(dev, val); -} - -static uint8_t -write60_quadtel(void *priv, uint8_t val) -{ - atkbd_t *dev = (atkbd_t *) priv; - - switch (dev->command) { - case 0xcf: /*??? - sent by MegaPC BIOS*/ - kbd_log("ATkbc: ??? - sent by MegaPC BIOS\n"); - return 0; - } - - return 1; -} - -static uint8_t -write64_olivetti(void *priv, uint8_t val) -{ - atkbd_t *dev = (atkbd_t *) priv; - - switch (val) { - case 0x80: /* Olivetti-specific command */ - /* - * bit 7: bus expansion board present (M300) / keyboard unlocked (M290) - * bits 4-6: ??? - * bit 3: fast ram check (if inactive keyboard works erratically) - * bit 2: keyboard fuse present - * bits 0-1: ??? - */ - add_to_kbc_queue_front(dev, (0x0c | ((is386) ? 0x00 : 0x80)) & 0xdf, 0, 0x00); - dev->input_port = ((dev->input_port + 1) & 3) | (dev->input_port & 0xfc); - return 0; - } - - return write64_generic(dev, val); -} - -static uint8_t -write64_quadtel(void *priv, uint8_t val) -{ - atkbd_t *dev = (atkbd_t *) priv; - - switch (val) { - case 0xaf: - kbd_log("ATkbc: bad KBC command AF\n"); - return 1; - - case 0xcf: /*??? - sent by MegaPC BIOS*/ - kbd_log("ATkbc: ??? - sent by MegaPC BIOS\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - return 0; - } - - return write64_generic(dev, val); -} - -static uint8_t -write60_toshiba(void *priv, uint8_t val) -{ - atkbd_t *dev = (atkbd_t *) priv; - - switch (dev->command) { - case 0xb6: /* T3100e - set color/mono switch */ - kbd_log("ATkbc: T3100e - set color/mono switch\n"); - t3100e_mono_set(val); - return 0; - } - - return 1; -} - -static uint8_t -write64_toshiba(void *priv, uint8_t val) -{ - atkbd_t *dev = (atkbd_t *) priv; - - switch (val) { - case 0xaf: - kbd_log("ATkbc: bad KBC command AF\n"); - return 1; - - case 0xb0: /* T3100e: Turbo on */ - kbd_log("ATkbc: T3100e: Turbo on\n"); - t3100e_turbo_set(1); - return 0; - - case 0xb1: /* T3100e: Turbo off */ - kbd_log("ATkbc: T3100e: Turbo off\n"); - t3100e_turbo_set(0); - return 0; - - case 0xb2: /* T3100e: Select external display */ - kbd_log("ATkbc: T3100e: Select external display\n"); - t3100e_display_set(0x00); - return 0; - - case 0xb3: /* T3100e: Select internal display */ - kbd_log("ATkbc: T3100e: Select internal display\n"); - t3100e_display_set(0x01); - return 0; - - case 0xb4: /* T3100e: Get configuration / status */ - kbd_log("ATkbc: T3100e: Get configuration / status\n"); - add_to_kbc_queue_front(dev, t3100e_config_get(), 0, 0x00); - return 0; - - case 0xb5: /* T3100e: Get colour / mono byte */ - kbd_log("ATkbc: T3100e: Get colour / mono byte\n"); - add_to_kbc_queue_front(dev, t3100e_mono_get(), 0, 0x00); - return 0; - - case 0xb6: /* T3100e: Set colour / mono byte */ - kbd_log("ATkbc: T3100e: Set colour / mono byte\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - return 0; - - case 0xb7: /* T3100e: Emulate PS/2 keyboard */ - case 0xb8: /* T3100e: Emulate AT keyboard */ - dev->flags &= ~KBC_TYPE_MASK; - if (val == 0xb7) { - kbd_log("ATkbc: T3100e: Emulate PS/2 keyboard\n"); - dev->flags |= KBC_TYPE_PS2_NOREF; - } else { - kbd_log("ATkbc: T3100e: Emulate AT keyboard\n"); - dev->flags |= KBC_TYPE_ISA; - } - return 0; - - case 0xbb: /* T3100e: Read 'Fn' key. - Return it for right Ctrl and right Alt; on the real - T3100e, these keystrokes could only be generated - using 'Fn'. */ - kbd_log("ATkbc: T3100e: Read 'Fn' key\n"); - if (keyboard_recv(0xb8) || /* Right Alt */ - keyboard_recv(0x9d)) /* Right Ctrl */ - add_to_kbc_queue_front(dev, 0x04, 0, 0x00); - else - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); - return 0; - - case 0xbc: /* T3100e: Reset Fn+Key notification */ - kbd_log("ATkbc: T3100e: Reset Fn+Key notification\n"); - t3100e_notify_set(0x00); - return 0; - - case 0xc0: /*Read input port*/ - kbd_log("ATkbc: read input port\n"); - - /* The T3100e returns all bits set except bit 6 which - * is set by t3100e_mono_set() */ - dev->input_port = (t3100e_mono_get() & 1) ? 0xff : 0xbf; - add_to_kbc_queue_front(dev, dev->input_port, 0, 0x00); - return 0; - } - - return write64_generic(dev, val); -} - -static void -kbd_key_reset(atkbd_t *dev, int do_fa) -{ - dev->out_new = -1; - kbc_queue_reset(dev, 1); - - dev->kbd_last_scan_code = 0x00; - - /* Set scan code set to 2. */ - keyboard_mode = 0x02; - set_scancode_map(dev); - - /* The BAT enables scanning. */ - keyboard_scan = 1; - - dev->sc_or = 0; - - if (do_fa) - add_data_kbd_front(dev, 0xfa); - add_data_kbd_front(dev, 0xaa); - - if (!do_fa) - dev->kbd_state = DEV_STATE_MAIN_OUT; -} - -static void -kbd_aux_reset(atkbd_t *dev, int do_fa) -{ - dev->out_new_mouse = -1; - kbc_queue_reset(dev, 2); - - /* The BAT enables scanning. */ - mouse_scan = 1; - - if (!do_fa) { - add_data_kbd_front(dev, 0xaa); - add_data_kbd_front(dev, 0x00); - - dev->mouse_state = DEV_STATE_MAIN_OUT; - } -} - void -keyboard_at_mouse_reset(void) +keyboard_at_clear_data(void *priv) { - atkbd_t *dev = SavedKbd; + atkbc_dev_t *dev = (atkbc_dev_t *) priv; - kbd_aux_reset(dev, 1); + dev->flags &= ~FLAG_CTRLDAT; } static void -kbd_process_cmd(void *priv) +keyboard_at_set_defaults(atkbc_dev_t *dev) { - atkbd_t *dev = (atkbd_t *) priv; + dev->rate = 1; + dev->flags &= FLAG_ENABLED; - dev->kbd_state = DEV_STATE_MAIN_OUT; + keyboard_set3_all_break = 0; + keyboard_set3_all_repeat = 0; + memset(keyboard_set3_flags, 0, 512); - if (dev->key_wantdata) { - dev->key_wantdata = 0; + keyboard_mode = 0x02; + keyboard_at_set_scancode_set(); +} - /* - * Several system BIOSes and OS device drivers - * mess up with this, and repeat the command - * code many times. Fun! - */ - if (dev->key_dat == dev->key_command) { - /* Respond NAK and ignore it. */ - add_data_kbd_front(dev, 0xfe); - dev->key_command = 0x00; - return; - } +static void +keyboard_at_bat(void *priv) +{ + atkbc_dev_t *dev = (atkbc_dev_t *) priv; - switch (dev->key_command) { - case 0xed: /* set/reset LEDs */ - add_data_kbd_front(dev, 0xfa); - kbd_log("ATkbd: set LEDs [%02x]\n", dev->key_dat); + keyboard_at_set_defaults(dev); + + keyboard_scan = 1; + dev->flags |= FLAG_ENABLED; + + kbc_at_dev_queue_add(dev, 0xaa, 0); +} + +static void +keyboard_at_invalid_cmd(atkbc_dev_t *dev) +{ + /* The AT firmware sends FA on unknown but semantically valid (ie. >= 0xED) commands. */ + keyboard_at_log("%s: Invalid AT command [%02X]\n", dev->name, dev->port->dat); + kbc_at_dev_queue_add(dev, 0xfa, 0); +} + +static void +keyboard_ps2_invalid_cmd(atkbc_dev_t *dev) +{ + /* Send FE on unknown/invalid command per the PS/2 technical reference. */ + keyboard_at_log("%s: Invalid PS/2 command [%02X]\n", dev->name, dev->port->dat); + kbc_at_dev_queue_add(dev, 0xfe, 0); +} + +static void +keyboard_at_write(void *priv) +{ + atkbc_dev_t *dev = (atkbc_dev_t *) priv; + uint8_t i, val; + + if (dev->port == NULL) + return; + + val = dev->port->dat; + + dev->state = DEV_STATE_MAIN_OUT; + + if ((val < 0xed) && (dev->flags & FLAG_CTRLDAT)) { + dev->flags &= ~FLAG_CTRLDAT; + + switch (dev->command) { + case 0xed: /* Set/reset LEDs */ + kbc_at_dev_queue_add(dev, 0xfa, 0); + keyboard_at_log("%s: Set/reset LEDs [%02X]\n", dev->name, val); break; - case 0xf0: /* get/set scancode set */ - add_data_kbd_front(dev, 0xfa); - if (dev->key_dat == 0) { - kbd_log("Get scan code set: %02X\n", keyboard_mode); - add_data_kbd_front(dev, keyboard_mode); + case 0xf0: /* Get/set scancode set */ + kbc_at_dev_queue_add(dev, (val > 3) ? 0xfe : 0xfa, 0); + if (val == 0) { + keyboard_at_log("%s: Get scan code set [%02X]\n", dev->name, keyboard_mode); + kbc_at_dev_queue_add(dev, keyboard_mode, 0); } else { - if (dev->key_dat <= 3) { - keyboard_mode = dev->key_dat; - kbd_log("Scan code set now: %02X\n", keyboard_mode); + if (val <= 3) { + keyboard_mode = val; + keyboard_at_log("%s: Set scan code set [%02X]\n", dev->name, keyboard_mode); + keyboard_at_set_scancode_set(); + } else { + /* Fatal so any instance of anything attempting to set scan code > 3 can be reported to us. */ + fatal("%s: Scan code set [%02X] invalid, resend\n", dev->name, val); + dev->flags |= FLAG_CTRLDAT; + dev->state = DEV_STATE_MAIN_WANT_IN; } - set_scancode_map(dev); } break; case 0xf3: /* set typematic rate/delay */ - add_data_kbd_front(dev, 0xfa); + if (val & 0x80) { + keyboard_at_log("%s: Set typematic rate/delay [%02X] has bit 7 set - invalid\n", dev->name, val); + dev->flags |= FLAG_CTRLDAT; /* Resend = keep waiting for parameter. */ + kbc_at_dev_queue_add(dev, 0xfe, 0); /* Command response */ + dev->state = DEV_STATE_MAIN_WANT_IN; + } else { + dev->rate = val; + kbc_at_dev_queue_add(dev, 0xfa, 0); /* Command response */ + keyboard_at_log("%s: Set typematic rate/delay [%02X]\n", dev->name, val); + } break; default: - kbd_log("ATkbd: bad keyboard 0060 write %02X command %02X\n", dev->key_dat, dev->key_command); - add_data_kbd_front(dev, 0xfe); - break; + fatal("%s: Parameter [%02X] for invalid command [%02X] - possibly memory corruption!\n", dev->name, val, dev->command); + kbc_at_dev_queue_add(dev, 0xfe, 0); + } + } else { + if (dev->flags & FLAG_CTRLDAT) { + if (val == 0xfe) { + /* Special case - resend last scan code command during another command that wants + input - output as normal but do not cancel the command (so keep waiting for + input). */ + keyboard_at_log("%s: resend last scan code during command [%02X]\n", dev->name, dev->command); + dev->state = DEV_STATE_MAIN_WANT_IN; + kbc_at_dev_queue_add(dev, 0xfa, dev->last_scan_code); + } else { + /* Special case - another command during another command that wants input - proceed + as normal but do not cancel the command (so keep waiting for input), unless the + command in progress is ED (Set/reset LEDs). */ + if (dev->command == 0xed) { + keyboard_scan = 1; + dev->flags &= ~FLAG_CTRLDAT; + } else + dev->state = DEV_STATE_MAIN_WANT_IN; + } } - /* Keyboard command is now done. */ - dev->key_command = 0x00; - } else { - /* No keyboard command in progress. */ - dev->key_command = 0x00; - - switch (dev->key_dat) { - case 0x00 ... 0x7f: - kbd_log("ATkbd: invalid command %02X\n", dev->key_dat); - add_data_kbd_front(dev, 0xfe); - break; + dev->command = val; + switch (dev->command) { case 0xed: /* set/reset LEDs */ - kbd_log("ATkbd: set/reset leds\n"); - add_data_kbd_front(dev, 0xfa); - - dev->key_wantdata = 1; - dev->kbd_state = DEV_STATE_MAIN_WANT_IN; + keyboard_at_log("%s: set/reset LEDs\n", dev->name); + dev->flags |= FLAG_CTRLDAT; + kbc_at_dev_queue_add(dev, 0xfa, 0); /* ACK for command byte */ + dev->state = DEV_STATE_MAIN_WANT_IN; break; case 0xee: /* diagnostic echo */ - kbd_log("ATkbd: ECHO\n"); - add_data_kbd_front(dev, 0xee); + keyboard_at_log("%s: ECHO\n", dev->name); + kbc_at_dev_queue_add(dev, 0xee, 0); break; - case 0xef: /* NOP (reserved for future use) */ - kbd_log("ATkbd: NOP\n"); + case 0xef: /* Invalid command */ + case 0xf1: /* Invalid command */ + if (dev->type & FLAG_PS2) + keyboard_ps2_invalid_cmd(dev); + else + keyboard_at_invalid_cmd(dev); break; case 0xf0: /* get/set scan code set */ - kbd_log("ATkbd: scan code set\n"); - add_data_kbd_front(dev, 0xfa); - dev->key_wantdata = 1; - dev->kbd_state = DEV_STATE_MAIN_WANT_IN; + if (dev->type & FLAG_PS2) { + keyboard_at_log("%s: scan code set\n", dev->name); + dev->flags |= FLAG_CTRLDAT; + kbc_at_dev_queue_add(dev, 0xfa, 0); /* ACK for command byte */ + dev->state = DEV_STATE_MAIN_WANT_IN; + } else + keyboard_at_invalid_cmd(dev); break; case 0xf2: /* read ID */ - kbd_log("ATkbd: read keyboard id\n"); + keyboard_at_log("%s: read keyboard id\n", dev->name); /* TODO: After keyboard type selection is implemented, make this return the correct keyboard ID for the selected type. */ - add_data_kbd_front(dev, 0xfa); - add_data_kbd_front(dev, 0xab); - add_data_kbd_front(dev, 0x83); + kbc_at_dev_queue_add(dev, 0xfa, 0); + for (i = 0; i < 4; i++) { + if (id_bytes[dev->type][i] == 0) + break; + + kbc_at_dev_queue_add(dev, id_bytes[dev->type][i], 0); + } break; - case 0xf3: /* set typematic rate/delay */ - kbd_log("ATkbd: set typematic rate/delay\n"); - add_data_kbd_front(dev, 0xfa); - dev->key_wantdata = 1; - dev->kbd_state = DEV_STATE_MAIN_WANT_IN; + case 0xf3: /* set command mode */ + keyboard_at_log("%s: set typematic rate/delay\n", dev->name); + dev->flags |= FLAG_CTRLDAT; + kbc_at_dev_queue_add(dev, 0xfa, 0); /* ACK for command byte */ + dev->state = DEV_STATE_MAIN_WANT_IN; break; - case 0xf4: /* enable keyboard */ - kbd_log("ATkbd: enable keyboard\n"); - add_data_kbd_front(dev, 0xfa); + case 0xf4: /* enable */ + keyboard_at_log("%s: enable keyboard\n", dev->name); + dev->flags |= FLAG_ENABLED; keyboard_scan = 1; + kbc_at_dev_queue_add(dev, 0xfa, 0); break; case 0xf5: /* set defaults and disable keyboard */ case 0xf6: /* set defaults */ - kbd_log("ATkbd: set defaults%s\n", (dev->key_dat == 0xf6) ? "" : " and disable keyboard"); - keyboard_scan = (dev->key_dat == 0xf6); - kbd_log("dev->key_dat = %02X, keyboard_scan = %i, dev->mem[0x20] = %02X\n", - dev->key_dat, keyboard_scan, dev->mem[0]); - add_data_kbd_front(dev, 0xfa); + keyboard_at_log("%s: set defaults%s\n", (val == 0xf6) ? "" : " and disable keyboard"); + keyboard_scan = (val == 0xf6); + keyboard_at_log("%s: val = %02X, keyboard_scan = %i\n", + dev->name, val, keyboard_scan); + kbc_at_dev_queue_add(dev, 0xfa, 0); keyboard_set3_all_break = 0; keyboard_set3_all_repeat = 0; memset(keyboard_set3_flags, 0, 512); + keyboard_mode = 0x02; - set_scancode_map(dev); + keyboard_at_set_scancode_set(); break; case 0xf7: /* set all keys to repeat */ - kbd_log("ATkbd: set all keys to repeat\n"); - add_data_kbd_front(dev, 0xfa); - keyboard_set3_all_break = 1; + if (dev->type & FLAG_PS2) { + keyboard_at_log("%s: set all keys to repeat\n", dev->name); + kbc_at_dev_queue_add(dev, 0xfa, 0); + keyboard_set3_all_break = 1; + } else + keyboard_at_invalid_cmd(dev); break; case 0xf8: /* set all keys to give make/break codes */ - kbd_log("ATkbd: set all keys to give make/break codes\n"); - add_data_kbd_front(dev, 0xfa); - keyboard_set3_all_break = 1; + if (dev->type & FLAG_PS2) { + keyboard_at_log("%s: set all keys to give make/break codes\n", dev->name); + kbc_at_dev_queue_add(dev, 0xfa, 0); + keyboard_set3_all_break = 1; + } else + keyboard_at_invalid_cmd(dev); break; case 0xf9: /* set all keys to give make codes only */ - kbd_log("ATkbd: set all keys to give make codes only\n"); - add_data_kbd_front(dev, 0xfa); - keyboard_set3_all_break = 0; + if (dev->type & FLAG_PS2) { + keyboard_at_log("%s: set all keys to give make codes only\n", dev->name); + kbc_at_dev_queue_add(dev, 0xfa, 0); + keyboard_set3_all_break = 0; + } else + keyboard_at_invalid_cmd(dev); break; case 0xfa: /* set all keys to repeat and give make/break codes */ - kbd_log("ATkbd: set all keys to repeat and give make/break codes\n"); - add_data_kbd_front(dev, 0xfa); - keyboard_set3_all_repeat = 1; - keyboard_set3_all_break = 1; + if (dev->type & FLAG_PS2) { + keyboard_at_log("%s: set all keys to repeat and give make/break codes\n", dev->name); + kbc_at_dev_queue_add(dev, 0xfa, 0); + keyboard_set3_all_repeat = 1; + keyboard_set3_all_break = 1; + } else + keyboard_at_invalid_cmd(dev); break; + /* TODO: Actually implement these commands. */ + case 0xfb: /* set some keys to repeat */ + if (dev->type & FLAG_PS2) { + keyboard_at_log("%s: set some keys to repeat\n", dev->name); + kbc_at_dev_queue_add(dev, 0xfe, 0); + } else + keyboard_at_invalid_cmd(dev); + break; + + case 0xfc: /* set some keys to give make/break codes */ + if (dev->type & FLAG_PS2) { + keyboard_at_log("%s: set some keys to give make/break codes\n", dev->name); + kbc_at_dev_queue_add(dev, 0xfe, 0); + } else + keyboard_at_invalid_cmd(dev); + break; + + case 0xfd: /* set some keys to give make codes only */ + if (dev->type & FLAG_PS2) { + keyboard_at_log("%s: set some keys to give make codes only\n", dev->name); + kbc_at_dev_queue_add(dev, 0xfe, 0); + } else + keyboard_at_invalid_cmd(dev); + break; + + /* TODO: This is supposed to resend multiple bytes after some commands. */ case 0xfe: /* resend last scan code */ - kbd_log("ATkbd: resend last scan code\n"); - add_data_kbd_front(dev, dev->kbd_last_scan_code); + keyboard_at_log("%s: resend last scan code\n", dev->name); + kbc_at_dev_queue_add(dev, 0xfa, dev->last_scan_code); break; case 0xff: /* reset */ - kbd_log("ATkbd: kbd reset\n"); - kbd_key_reset(dev, 1); - break; - - default: - kbd_log("ATkbd: bad keyboard command %02X\n", dev->key_dat); - add_data_kbd_front(dev, 0xfe); - } - - /* If command needs data, remember command. */ - if (dev->key_wantdata == 1) - dev->key_command = dev->key_dat; - } -} - -static void -kbc_process_cmd(void *priv) -{ - atkbd_t *dev = (atkbd_t *) priv; - int i = 0, bad = 1; - uint8_t mask, kbc_ven = dev->flags & KBC_VEN_MASK; - uint8_t cmd_ac_conv[16] = { 0x0b, 2, 3, 4, 5, 6, 7, 8, 9, 0x0a, 0x1e, 0x30, 0x2e, 0x20, 0x12, 0x21 }; - - if (dev->status & STAT_CD) { - /* Controller command. */ - dev->want60 = 0; - dev->kbc_state = KBC_STATE_MAIN_IBF; - - /* Clear the keyboard controller queue. */ - kbc_queue_reset(dev, 0); - - switch (dev->ib) { - /* Read data from KBC memory. */ - case 0x20 ... 0x3f: - add_to_kbc_queue_front(dev, dev->mem[dev->ib], 0, 0x00); - break; - - /* Write data to KBC memory. */ - case 0x60 ... 0x7f: - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - break; - - case 0xaa: /* self-test */ - kbd_log("ATkbc: self-test\n"); - - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - if (dev->kbc_state != KBC_STATE_RESET) { - kbd_log("ATkbc: self-test reinitialization\n"); - /* Yes, the firmware has an OR, but we need to make sure to keep any forcibly lowered bytes lowered. */ - /* TODO: Proper P1 implementation, with OR and AND flags in the machine table. */ - dev->input_port = dev->input_port & 0xff; - write_output(dev, 0x4b); - } - - dev->status = (dev->status & 0x0f) | 0x60; - - dev->mem[0x20] = 0x30; - dev->mem[0x21] = 0x01; - dev->mem[0x22] = 0x0b; - dev->mem[0x25] = 0x02; - dev->mem[0x27] = 0xf8; - dev->mem[0x28] = 0xce; - dev->mem[0x29] = 0x0b; - dev->mem[0x2a] = 0x10; - dev->mem[0x2b] = 0x20; - dev->mem[0x2c] = 0x15; - dev->mem[0x30] = 0x0b; - } else { - if (dev->kbc_state != KBC_STATE_RESET) { - kbd_log("ATkbc: self-test reinitialization\n"); - /* Yes, the firmware has an OR, but we need to make sure to keep any forcibly lowered bytes lowered. */ - /* TODO: Proper P1 implementation, with OR and AND flags in the machine table. */ - dev->input_port = dev->input_port & 0xff; - write_output(dev, 0xcf); - } - - dev->status = (dev->status & 0x0f) | 0x60; - - dev->mem[0x20] = 0x10; - dev->mem[0x21] = 0x01; - dev->mem[0x22] = 0x06; - dev->mem[0x25] = 0x01; - dev->mem[0x27] = 0xfb; - dev->mem[0x28] = 0xe0; - dev->mem[0x29] = 0x06; - dev->mem[0x2a] = 0x10; - dev->mem[0x2b] = 0x20; - dev->mem[0x2c] = 0x15; - } - - dev->out_new = dev->out_new_mouse = -1; - kbc_queue_reset(dev, 0); - - // dev->kbc_state = KBC_STATE_MAIN_IBF; - dev->kbc_state = KBC_STATE_KBC_OUT; - - // add_to_kbc_queue_front(dev, 0x55, 0, 0x00); - kbc_queue_add(dev, 0x55, 0); - break; - - case 0xab: /* interface test */ - kbd_log("ATkbc: interface test\n"); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); /*no error*/ - break; - - case 0xac: /* diagnostic dump */ - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - kbd_log("ATkbc: diagnostic dump\n"); - dev->mem[0x30] = (dev->input_port & 0xf0) | 0x80; - dev->mem[0x31] = dev->output_port; - dev->mem[0x32] = 0x00; /* T0 and T1. */ - dev->mem[0x33] = 0x00; /* PSW - Program Status Word - always return 0x00 because we do not emulate this byte. */ - /* 20 bytes in high nibble in set 1, low nibble in set 1, set 1 space format = 60 bytes. */ - for (i = 0; i < 20; i++) { - kbc_queue_add(dev, cmd_ac_conv[dev->mem[i + 0x20] >> 4], 0); - kbc_queue_add(dev, cmd_ac_conv[dev->mem[i + 0x20] & 0x0f], 0); - kbc_queue_add(dev, 0x39, 0); - } - dev->kbc_state = KBC_STATE_KBC_OUT; - } - break; - - case 0xad: /* disable keyboard */ - kbd_log("ATkbc: disable keyboard\n"); - set_enable_kbd(dev, 0); - break; - - case 0xae: /* enable keyboard */ - kbd_log("ATkbc: enable keyboard\n"); - set_enable_kbd(dev, 1); - break; - - case 0xc7: /* set port1 bits */ - kbd_log("ATkbc: Phoenix - set port1 bits\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - break; - - case 0xca: /* read keyboard mode */ - kbd_log("ATkbc: AMI - read keyboard mode\n"); - add_to_kbc_queue_front(dev, dev->ami_flags, 0, 0x00); - break; - - case 0xcb: /* set keyboard mode */ - kbd_log("ATkbc: AMI - set keyboard mode\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - break; - - case 0xd0: /* read output port */ - kbd_log("ATkbc: read output port\n"); - mask = 0xff; - if ((kbc_ven != KBC_VEN_OLIVETTI) && ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) && (dev->mem[0x20] & 0x10)) - mask &= 0xbf; - add_to_kbc_queue_front(dev, dev->output_port & mask, 0, 0x00); - break; - - case 0xd1: /* write output port */ - kbd_log("ATkbc: write output port\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - break; - - case 0xd2: /* write keyboard output buffer */ - kbd_log("ATkbc: write keyboard output buffer\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - break; - - case 0xdd: /* disable A20 address line */ - case 0xdf: /* enable A20 address line */ - kbd_log("ATkbc: %sable A20\n", (dev->ib == 0xdd) ? "dis" : "en"); - write_output_fast_a20(dev, (dev->output_port & 0xfd) | (dev->ib & 0x02)); - break; - - case 0xe0: /* read test inputs */ - kbd_log("ATkbc: read test inputs\n"); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_at_dev_reset(dev, 1); break; default: - /* - * Unrecognized controller command. - * - * If we have a vendor-specific handler, run - * that. Otherwise, or if that handler fails, - * log a bad command. - */ - if (dev->write64_ven) - bad = dev->write64_ven(dev, dev->ib); - - kbd_log(bad ? "ATkbc: bad controller command %02X\n" : "", dev->ib); - } - - /* If the command needs data, remember the command. */ - if (dev->want60) - dev->command = dev->ib; - } else if (dev->want60) { - /* Write data to controller. */ - dev->want60 = 0; - dev->kbc_state = KBC_STATE_MAIN_IBF; - - switch (dev->command) { - case 0x60 ... 0x7f: - dev->mem[(dev->command & 0x1f) + 0x20] = dev->ib; - if (dev->command == 0x60) - write_cmd(dev, dev->ib); - break; - - case 0xc7: /* set port1 bits */ - kbd_log("ATkbc: Phoenix - set port1 bits\n"); - dev->input_port |= dev->ib; - break; - - case 0xd1: /* write output port */ - kbd_log("ATkbc: write output port\n"); - /* Bit 2 of AMI flags is P22-P23 blocked (1 = yes, 0 = no), - discovered by reverse-engineering the AOpen Vi15G BIOS. */ - if (dev->ami_flags & 0x04) { - /* If keyboard controller lines P22-P23 are blocked, - we force them to remain unchanged. */ - dev->ib &= ~0x0c; - dev->ib |= (dev->output_port & 0x0c); - } - write_output(dev, dev->ib | 0x01); - break; - - case 0xd2: /* write to keyboard output buffer */ - kbd_log("ATkbc: write to keyboard output buffer\n"); - add_to_kbc_queue_front(dev, dev->ib, 0, 0x00); - break; - - case 0xd3: /* write to mouse output buffer */ - kbd_log("ATkbc: write to mouse output buffer\n"); - if (mouse_write && ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF)) - keyboard_at_adddata_mouse(dev->ib); - break; - - case 0xd4: /* write to mouse */ - kbd_log("ATkbc: write to mouse (%02X)\n", dev->ib); - - if (dev->ib == 0xbb) - break; - - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - set_enable_mouse(dev, 1); - if (mouse_write) { - dev->mouse_wantcmd = 1; - dev->mouse_dat = dev->ib; - dev->kbc_state = KBC_STATE_SEND_MOUSE; - } else - add_to_kbc_queue_front(dev, 0xfe, 2, 0x40); - } - break; - - default: - /* - * Run the vendor-specific handler - * if we have one. Otherwise, or if - * it returns an error, log a bad - * controller command. - */ - if (dev->write60_ven) - bad = dev->write60_ven(dev, dev->ib); - - if (bad) { - kbd_log("ATkbc: bad controller command %02x data %02x\n", dev->command, dev->ib); - } + kbc_at_dev_queue_add(dev, 0xfe, 0); } } } -static void -kbd_write(uint16_t port, uint8_t val, void *priv) +/* + * Initialize the device for use by the user. + * + * We also get called from the various machines. + */ +void * +keyboard_at_init(const device_t *info) { - atkbd_t *dev = (atkbd_t *) priv; + atkbc_dev_t *dev = kbc_at_dev_init(DEV_KBD); - kbd_log((port == 0x61) ? "" : "[%04X:%08X] ATkbc: write(%04X) = %02X\n", CS, cpu_state.pc, port, val); + dev->name = info->name; + /* Key 14 = Japanese key next to backspace, scan code: 13 (Yen 7D); + Key 29 = US backslash, scan code: 5C (Backslash 2B); + Key 42 = European backslash, scan code: 53 (Backslash 2B); + Key 45 = European key next to left shift, scan code: 13 (Key 56); + Key 56 = Japanese key next to right shift, scan code: 5C (Backslash 73); + Key 59 = Japanese key between left Ctrl and left Alt, scan code: 85 (Muhenkan 7B); + Key 63 = Japanese key between right Ctrl and right Alt, scan code: 86 (Henkan/Zenkouho 79); + Key 65? = Japanese key between right Ctrl and right Alt, scan code: 87 (Hiragana/Katakana 70). + */ + dev->type = FLAG_PS2 | KBD_102_KEY /* device_get_config_int("type") */; - switch (port) { - case 0x60: - dev->status &= ~STAT_CD; - if (dev->want60 && (dev->command == 0xd1)) { - kbd_log("ATkbc: write output port\n"); + keyboard_at_log("%s: type=%d\n", dev->name, dev->type); - /* Fast A20 - ignore all other bits. */ - val = (val & 0x02) | (dev->output_port & 0xfd); + dev->process_cmd = keyboard_at_write; + dev->execute_bat = keyboard_at_bat; - /* Bit 2 of AMI flags is P22-P23 blocked (1 = yes, 0 = no), - discovered by reverse-engineering the AOpeN Vi15G BIOS. */ - if (dev->ami_flags & 0x04) { - /* If keyboard controller lines P22-P23 are blocked, - we force them to remain unchanged. */ - val &= ~0x0c; - val |= (dev->output_port & 0x0c); - } + dev->scan = &keyboard_scan; - write_output_fast_a20(dev, val | 0x01); + if (dev->port != NULL) + kbc_at_dev_reset(dev, 0); - dev->want60 = 0; - dev->kbc_state = KBC_STATE_MAIN_IBF; - return; - } - break; + keyboard_send = add_data_kbd; + SavedKbd = dev; - case 0x64: - dev->status |= STAT_CD; - if (val == 0xd1) { - kbd_log("ATkbc: write output port\n"); - dev->want60 = 1; - dev->kbc_state = KBC_STATE_KBC_PARAM; - dev->command = 0xd1; - return; - } - break; - } - - dev->ib = val; - dev->status |= STAT_IFULL; -} - -static uint8_t -kbd_read(uint16_t port, void *priv) -{ - atkbd_t *dev = (atkbd_t *) priv; - uint8_t ret = 0xff; - - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) - cycles -= ISA_CYCLES(8); - - switch (port) { - case 0x60: - ret = dev->out; - dev->status &= ~STAT_OFULL; - /* TODO: IRQ is only tied to OBF on the AT KBC, on the PS/2 KBC, it is controlled by a bit the - output port (P2). - This also means that in AT mode, the IRQ is level-triggered. */ - if ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_PS2_NOREF) - picintc(1 << 1); - break; - - case 0x64: - ret = dev->status; - break; - - default: - kbd_log("ATkbc: read(%04x) invalid!\n",port); - break; - } - - kbd_log((port == 0x61) ? "" : "[%04X:%08X] ATkbc: read (%04X) = %02X\n", CS, cpu_state.pc, port, ret); - - return (ret); + /* Return our private data to the I/O layer. */ + return (dev); } static void -kbd_reset(void *priv) +keyboard_at_close(void *priv) { - atkbd_t *dev = (atkbd_t *) priv; - int i; - uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; - - dev->status = STAT_UNLOCKED; - dev->mem[0x20] = 0x01; - dev->mem[0x20] |= CCB_TRANSLATE; - dev->secr_phase = 0; - dev->key_wantdata = 0; - - /* Set up the correct Video Type bits. */ - if (!is286 || (kbc_ven == KBC_VEN_ACER)) - dev->input_port = video_is_mda() ? 0xb0 : 0xf0; - else - dev->input_port = video_is_mda() ? 0xf0 : 0xb0; - kbd_log("ATkbc: input port = %02x\n", dev->input_port); - - /* Enable keyboard, disable mouse. */ - set_enable_kbd(dev, 0); - keyboard_scan = 0; - set_enable_mouse(dev, 0); - mouse_scan = 0; - - dev->out_new = dev->out_new_mouse = -1; - for (i = 0; i < 3; i++) - kbc_queue_reset(dev, i); - dev->kbd_last_scan_code = 0; - - dev->sc_or = 0; - - keyboard_mode = 0x02; - - memset(keyboard_set3_flags, 0, 512); - - set_scancode_map(dev); - - dev->ami_flags = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) ? 0x01 : 0x00; - dev->ami_stat |= 0x02; - - dev->output_port = 0xcd; - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - write_output(dev, 0x4b); - } else { - /* The real thing writes CF and then AND's it with BF. */ - write_output(dev, 0x8f); - } - - /* Stage 1. */ - dev->status = (dev->status & 0x0f) | (dev->input_port & 0xf0); - - /* Reset the keyboard. */ - kbd_key_reset(dev, 0); - - /* Reset the mouse. */ - kbd_aux_reset(dev, 0); -} - -/* Reset the AT keyboard - this is needed for the PCI TRC and is done - until a better solution is found. */ -void -keyboard_at_reset(void) -{ - kbd_reset(SavedKbd); -} - -void -kbc_at_a20_reset(void) -{ - if (SavedKbd) { - SavedKbd->output_port = 0xcd; - if ((SavedKbd->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - write_output(SavedKbd, 0x4b); - } else { - /* The real thing writes CF and then AND's it with BF. */ - write_output(SavedKbd, 0x8f); - } - } -} - -static void -kbd_close(void *priv) -{ - atkbd_t *dev = (atkbd_t *) priv; - int i, max_ports = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) ? 2 : 1; - - kbd_reset(dev); - - /* Stop timers. */ - timer_disable(&dev->send_delay_timer); + atkbc_dev_t *dev = (atkbc_dev_t *) priv; keyboard_scan = 0; keyboard_send = NULL; @@ -2832,427 +1009,47 @@ kbd_close(void *priv) SavedKbd = NULL; - for (i = 0; i < max_ports; i++) { - if (kbc_ports[i] != NULL) { - free(kbc_ports[i]); - kbc_ports[i] = NULL; - } - } - free(dev); } -static void * -kbd_init(const device_t *info) -{ - atkbd_t *dev; - int i, max_ports; - - dev = (atkbd_t *) malloc(sizeof(atkbd_t)); - memset(dev, 0x00, sizeof(atkbd_t)); - - dev->flags = info->local; - dev->pci = !!(info->flags & DEVICE_PCI); - - /* We need this, sadly. */ - SavedKbd = dev; - - video_reset(gfxcard[0]); - kbd_reset(dev); - - io_sethandler(0x0060, 1, kbd_read, NULL, NULL, kbd_write, NULL, NULL, dev); - io_sethandler(0x0064, 1, kbd_read, NULL, NULL, kbd_write, NULL, NULL, dev); - keyboard_send = add_data_kbd; - - timer_add(&dev->send_delay_timer, kbd_poll, dev, 1); - timer_add(&dev->pulse_cb, pulse_poll, dev, 0); - - dev->write60_ven = NULL; - dev->write64_ven = NULL; - - switch (dev->flags & KBC_VEN_MASK) { - case KBC_VEN_ACER: - case KBC_VEN_GENERIC: - case KBC_VEN_NCR: - case KBC_VEN_IBM_PS1: - dev->write64_ven = write64_generic; - break; - - case KBC_VEN_OLIVETTI: - dev->write64_ven = write64_olivetti; - break; - - case KBC_VEN_AMI: - case KBC_VEN_INTEL_AMI: - case KBC_VEN_ALI: - case KBC_VEN_TG: - case KBC_VEN_TG_GREEN: - dev->write60_ven = write60_ami; - dev->write64_ven = write64_ami; - break; - - case KBC_VEN_IBM_MCA: - dev->write64_ven = write64_ibm_mca; - break; - - case KBC_VEN_QUADTEL: - dev->write60_ven = write60_quadtel; - dev->write64_ven = write64_quadtel; - break; - - case KBC_VEN_TOSHIBA: - dev->write60_ven = write60_toshiba; - dev->write64_ven = write64_toshiba; - break; +static const device_config_t keyboard_at_config[] = { + // clang-format off + { + .name = "type", + .description = "Type", + .type = CONFIG_SELECTION, + .default_string = "", + .default_int = 2, + .file_filter = "", + .spinner = { 0 }, + .selection = { + { .description = "AT 84-key", .value = FLAG_AT | KBD_84_KEY }, + { .description = "AT 101/102/106-key", .value = FLAG_AT | KBD_101_KEY }, + { .description = "AT Korean", .value = FLAG_AT | KBD_KOREAN }, + { .description = "PS/2 101-key", .value = FLAG_PS2 | KBD_101_KEY }, + { .description = "PS/2 102-key", .value = FLAG_PS2 | KBD_102_KEY }, + { .description = "PS/2 106-key JIS", .value = FLAG_PS2 | KBD_JIS }, + { .description = "PS/2 Korean", .value = FLAG_PS2 | KBD_KOREAN }, + { .description = "" } + } + }, + { + .name = "", .description = "", .type = CONFIG_END } - - max_ports = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) ? 2 : 1; - - for (i = 0; i < max_ports; i++) { - kbc_ports[i] = (kbc_port_t *) malloc(sizeof(kbc_port_t)); - memset(kbc_ports[i], 0x00, sizeof(kbc_port_t)); - } - - return (dev); -} - -const device_t keyboard_at_device = { - .name = "PC/AT Keyboard", - .internal_name = "keyboard_at", - .flags = 0, - .local = KBC_TYPE_ISA | KBC_VEN_GENERIC, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL + // clang-format on }; -const device_t keyboard_at_ami_device = { - .name = "PC/AT Keyboard (AMI)", - .internal_name = "keyboard_at_ami", - .flags = 0, - .local = KBC_TYPE_ISA | KBC_VEN_AMI, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, +/* TODO: Add more keyboard types. */ +const device_t keyboard_at_generic_device = { + .name = "Standard AT or PS/2 Keyboard", + .internal_name = "ps2", + .flags = DEVICE_PS2, + .local = 0, + .init = keyboard_at_init, + .close = keyboard_at_close, + .reset = NULL, + { .poll = NULL }, .speed_changed = NULL, .force_redraw = NULL, - .config = NULL + .config = keyboard_at_config }; - -const device_t keyboard_at_tg_ami_device = { - .name = "PC/AT Keyboard (TriGem AMI)", - .internal_name = "keyboard_at_tg_ami", - .flags = 0, - .local = KBC_TYPE_ISA | KBC_VEN_TG, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_at_toshiba_device = { - .name = "PC/AT Keyboard (Toshiba)", - .internal_name = "keyboard_at_toshiba", - .flags = 0, - .local = KBC_TYPE_ISA | KBC_VEN_TOSHIBA, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_at_olivetti_device = { - .name = "PC/AT Keyboard (Olivetti)", - .internal_name = "keyboard_at_olivetti", - .flags = 0, - .local = KBC_TYPE_ISA | KBC_VEN_OLIVETTI, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_at_ncr_device = { - .name = "PC/AT Keyboard (NCR)", - .internal_name = "keyboard_at_ncr", - .flags = 0, - .local = KBC_TYPE_ISA | KBC_VEN_NCR, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_device = { - .name = "PS/2 Keyboard", - .internal_name = "keyboard_ps2", - .flags = 0, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_GENERIC, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_ps1_device = { - .name = "PS/2 Keyboard (IBM PS/1)", - .internal_name = "keyboard_ps2_ps1", - .flags = 0, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_IBM_PS1, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_ps1_pci_device = { - .name = "PS/2 Keyboard (IBM PS/1)", - .internal_name = "keyboard_ps2_ps1_pci", - .flags = DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_IBM_PS1, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_xi8088_device = { - .name = "PS/2 Keyboard (Xi8088)", - .internal_name = "keyboard_ps2_xi8088", - .flags = 0, - .local = KBC_TYPE_PS2_1 | KBC_VEN_GENERIC, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_ami_device = { - .name = "PS/2 Keyboard (AMI)", - .internal_name = "keyboard_ps2_ami", - .flags = 0, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_AMI, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_tg_ami_device = { - .name = "PS/2 Keyboard (TriGem AMI)", - .internal_name = "keyboard_ps2_tg_ami", - .flags = 0, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_TG, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_mca_device = { - .name = "PS/2 Keyboard", - .internal_name = "keyboard_ps2_mca", - .flags = 0, - .local = KBC_TYPE_PS2_1 | KBC_VEN_IBM_MCA, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_mca_2_device = { - .name = "PS/2 Keyboard", - .internal_name = "keyboard_ps2_mca_2", - .flags = 0, - .local = KBC_TYPE_PS2_2 | KBC_VEN_IBM_MCA, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_quadtel_device = { - .name = "PS/2 Keyboard (Quadtel/MegaPC)", - .internal_name = "keyboard_ps2_quadtel", - .flags = 0, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_QUADTEL, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_pci_device = { - .name = "PS/2 Keyboard", - .internal_name = "keyboard_ps2_pci", - .flags = DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_GENERIC, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_ami_pci_device = { - .name = "PS/2 Keyboard (AMI)", - .internal_name = "keyboard_ps2_ami_pci", - .flags = DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_AMI, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_ali_pci_device = { - .name = "PS/2 Keyboard (ALi M5123/M1543C)", - .internal_name = "keyboard_ps2_ali_pci", - .flags = DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_ALI, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_intel_ami_pci_device = { - .name = "PS/2 Keyboard (AMI)", - .internal_name = "keyboard_ps2_intel_ami_pci", - .flags = DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_INTEL_AMI, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_tg_ami_pci_device = { - .name = "PS/2 Keyboard (TriGem AMI)", - .internal_name = "keyboard_ps2_tg_ami_pci", - .flags = DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_TG, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_acer_pci_device = { - .name = "PS/2 Keyboard (Acer 90M002A)", - .internal_name = "keyboard_ps2_acer_pci", - .flags = DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_ACER, - .init = kbd_init, - .close = kbd_close, - .reset = kbd_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -void -keyboard_at_set_mouse(void (*func)(uint8_t val, void *priv), void *priv) -{ - mouse_write = func; - mouse_p = priv; -} - -void -keyboard_at_adddata_mouse(uint8_t val) -{ - atkbd_t *dev = SavedKbd; - - if (!mouse_scan || (dev->mouse_queue_end >= 16)) { - kbd_log("ATkbc: Unable to add to queue, conditions: %i, %i\n", !mouse_scan, (dev->mouse_queue_end >= 16)); - return; - } - kbc_queue_add(dev, val, 2); -} - -void -keyboard_at_adddata_mouse_cmd(uint8_t val) -{ - atkbd_t *dev = SavedKbd; - - if (dev->mouse_cmd_queue_end >= 16) { - kbd_log("ATkbc: Unable to add to queue, dev->mouse_cmd_queue_end >= 16\n"); - return; - } - kbc_queue_add(dev, val, 3); -} - -uint8_t -keyboard_at_mouse_pos(void) -{ - atkbd_t *dev = SavedKbd; - - return ((dev->mouse_queue_end - dev->mouse_queue_start) & 0xf); -} - -void -keyboard_at_set_a20_key(int state) -{ - atkbd_t *dev = SavedKbd; - - write_output(dev, (dev->output_port & 0xfd) | ((!!state) << 1)); -} diff --git a/src/device/mouse_ps2.c b/src/device/mouse_ps2.c index 1c8e0334d..eae528058 100644 --- a/src/device/mouse_ps2.c +++ b/src/device/mouse_ps2.c @@ -30,22 +30,7 @@ enum { MODE_ECHO }; -typedef struct { - const char *name; /* name of this device */ - int8_t type; /* type of this device */ - - int mode; - - uint16_t flags; - uint8_t resolution; - uint8_t sample_rate; - - uint8_t command; - - int x, y, z, b; - - uint8_t last_data[6]; -} mouse_t; +#define FLAG_EXPLORER 0x200 /* Has 5 buttons */ #define FLAG_5BTN 0x100 /* using Intellimouse Optical mode */ #define FLAG_INTELLI 0x80 /* device is IntelliMouse */ #define FLAG_INTMODE 0x40 /* using Intellimouse mode */ @@ -76,13 +61,13 @@ mouse_ps2_log(const char *fmt, ...) void mouse_clear_data(void *priv) { - mouse_t *dev = (mouse_t *) priv; + atkbc_dev_t *dev = (atkbc_dev_t *) priv; dev->flags &= ~FLAG_CTRLDAT; } static void -ps2_report_coordinates(mouse_t *dev, int cmd) +ps2_report_coordinates(atkbc_dev_t *dev, int main) { uint8_t buff[3] = { 0x08, 0x00, 0x00 }; int temp_z; @@ -123,15 +108,9 @@ ps2_report_coordinates(mouse_t *dev, int cmd) buff[1] = (dev->x & 0xff); buff[2] = (dev->y & 0xff); - if (cmd) { - keyboard_at_adddata_mouse_cmd(buff[0]); - keyboard_at_adddata_mouse_cmd(buff[1]); - keyboard_at_adddata_mouse_cmd(buff[2]); - } else { - keyboard_at_adddata_mouse(buff[0]); - keyboard_at_adddata_mouse(buff[1]); - keyboard_at_adddata_mouse(buff[2]); - } + kbc_at_dev_queue_add(dev, buff[0], main); + kbc_at_dev_queue_add(dev, buff[1], main); + kbc_at_dev_queue_add(dev, buff[2], main); if (dev->flags & FLAG_INTMODE) { temp_z = dev->z & 0x0f; if ((dev->flags & FLAG_5BTN)) { @@ -144,62 +123,94 @@ ps2_report_coordinates(mouse_t *dev, int cmd) if (temp_z & 0x08) temp_z |= 0xf0; } - if (cmd) - keyboard_at_adddata_mouse_cmd(temp_z); - else - keyboard_at_adddata_mouse(temp_z); + kbc_at_dev_queue_add(dev, temp_z, main); } dev->x = dev->y = dev->z = 0; } static void -ps2_write(uint8_t val, void *priv) +ps2_set_defaults(atkbc_dev_t *dev) { - mouse_t *dev = (mouse_t *) priv; - uint8_t temp; + dev->mode = MODE_STREAM; + dev->rate = 1; + dev->flags &= (0x88 | FLAG_ENABLED); +} + +static void +ps2_bat(void *priv) +{ + atkbc_dev_t *dev = (atkbc_dev_t *) priv; + + ps2_set_defaults(dev); + + mouse_scan = 1; + dev->flags |= FLAG_ENABLED; + + kbc_at_dev_queue_add(dev, 0xaa, 0); + kbc_at_dev_queue_add(dev, 0x00, 0); +} + +static void +ps2_write(void *priv) +{ + atkbc_dev_t *dev = (atkbc_dev_t *) priv; + uint8_t temp, val; + + if (dev->port == NULL) + return; + + val = dev->port->dat; + + dev->state = DEV_STATE_MAIN_OUT; if (dev->flags & FLAG_CTRLDAT) { dev->flags &= ~FLAG_CTRLDAT; if (val == 0xff) - goto mouse_reset; - - switch (dev->command) { + kbc_at_dev_reset(dev, 1); + else switch (dev->command) { case 0xe8: /* set mouse resolution */ dev->resolution = val; - keyboard_at_adddata_mouse_cmd(0xfa); + kbc_at_dev_queue_add(dev, 0xfa, 0); + mouse_ps2_log("%s: Set mouse resolution [%02X]\n", dev->name, val); break; case 0xf3: /* set sample rate */ - dev->sample_rate = val; - keyboard_at_adddata_mouse_cmd(0xfa); /* Command response */ + dev->rate = val; + kbc_at_dev_queue_add(dev, 0xfa, 0); /* Command response */ + mouse_ps2_log("%s: Set sample rate [%02X]\n", dev->name, val); break; default: - keyboard_at_adddata_mouse_cmd(0xfc); + kbc_at_dev_queue_add(dev, 0xfc, 0); } } else { dev->command = val; switch (dev->command) { case 0xe6: /* set scaling to 1:1 */ + mouse_ps2_log("%s: Set scaling to 1:1\n", dev->name); dev->flags &= ~FLAG_SCALED; - keyboard_at_adddata_mouse_cmd(0xfa); + kbc_at_dev_queue_add(dev, 0xfa, 0); break; case 0xe7: /* set scaling to 2:1 */ + mouse_ps2_log("%s: Set scaling to 2:1\n", dev->name); dev->flags |= FLAG_SCALED; - keyboard_at_adddata_mouse_cmd(0xfa); + kbc_at_dev_queue_add(dev, 0xfa, 0); break; case 0xe8: /* set mouse resolution */ + mouse_ps2_log("%s: Set mouse resolution\n", dev->name); dev->flags |= FLAG_CTRLDAT; - keyboard_at_adddata_mouse_cmd(0xfa); + kbc_at_dev_queue_add(dev, 0xfa, 0); + dev->state = DEV_STATE_MAIN_WANT_IN; break; case 0xe9: /* status request */ - keyboard_at_adddata_mouse_cmd(0xfa); + mouse_ps2_log("%s: Status request\n", dev->name); + kbc_at_dev_queue_add(dev, 0xfa, 0); temp = (dev->flags & 0x30); if (mouse_buttons & 1) temp |= 4; @@ -207,64 +218,68 @@ ps2_write(uint8_t val, void *priv) temp |= 1; if ((mouse_buttons & 4) && (dev->flags & FLAG_INTELLI)) temp |= 2; - keyboard_at_adddata_mouse_cmd(temp); - keyboard_at_adddata_mouse_cmd(dev->resolution); - keyboard_at_adddata_mouse_cmd(dev->sample_rate); + kbc_at_dev_queue_add(dev, temp, 0); + kbc_at_dev_queue_add(dev, dev->resolution, 0); + kbc_at_dev_queue_add(dev, dev->rate, 0); break; case 0xea: /* set stream */ + mouse_ps2_log("%s: Set stream\n", dev->name); dev->flags &= ~FLAG_CTRLDAT; mouse_scan = 1; - keyboard_at_adddata_mouse_cmd(0xfa); /* ACK for command byte */ + kbc_at_dev_queue_add(dev, 0xfa, 0); /* ACK for command byte */ break; case 0xeb: /* Get mouse data */ - keyboard_at_adddata_mouse_cmd(0xfa); + mouse_ps2_log("%s: Get mouse data\n", dev->name); + kbc_at_dev_queue_add(dev, 0xfa, 0); - ps2_report_coordinates(dev, 1); + ps2_report_coordinates(dev, 0); break; case 0xf2: /* read ID */ - keyboard_at_adddata_mouse_cmd(0xfa); + mouse_ps2_log("%s: Read ID\n", dev->name); + kbc_at_dev_queue_add(dev, 0xfa, 0); if (dev->flags & FLAG_INTMODE) - keyboard_at_adddata_mouse_cmd((dev->flags & FLAG_5BTN) ? 0x04 : 0x03); + kbc_at_dev_queue_add(dev, (dev->flags & FLAG_5BTN) ? 0x04 : 0x03, 0); else - keyboard_at_adddata_mouse_cmd(0x00); + kbc_at_dev_queue_add(dev, 0x00, 0); break; - case 0xf3: /* set command mode */ + case 0xf3: /* set sample rate */ + mouse_ps2_log("%s: Set sample rate\n", dev->name); dev->flags |= FLAG_CTRLDAT; - keyboard_at_adddata_mouse_cmd(0xfa); /* ACK for command byte */ + kbc_at_dev_queue_add(dev, 0xfa, 0); /* ACK for command byte */ + dev->state = DEV_STATE_MAIN_WANT_IN; break; case 0xf4: /* enable */ + mouse_ps2_log("%s: Enable\n", dev->name); dev->flags |= FLAG_ENABLED; mouse_scan = 1; - keyboard_at_adddata_mouse_cmd(0xfa); + kbc_at_dev_queue_add(dev, 0xfa, 0); break; case 0xf5: /* disable */ + mouse_ps2_log("%s: Disable\n", dev->name); dev->flags &= ~FLAG_ENABLED; mouse_scan = 0; - keyboard_at_adddata_mouse_cmd(0xfa); + kbc_at_dev_queue_add(dev, 0xfa, 0); break; case 0xf6: /* set defaults */ + mouse_ps2_log("%s: Set defaults\n", dev->name); + ps2_set_defaults(dev); + kbc_at_dev_queue_add(dev, 0xfa, 0); + break; + case 0xff: /* reset */ -mouse_reset: - dev->mode = MODE_STREAM; - dev->flags &= 0x88; - mouse_scan = 1; - keyboard_at_mouse_reset(); - keyboard_at_adddata_mouse_cmd(0xfa); - if (dev->command == 0xff) { - keyboard_at_adddata_mouse_cmd(0xaa); - keyboard_at_adddata_mouse_cmd(0x00); - } + mouse_ps2_log("%s: Reset\n", dev->name); + kbc_at_dev_reset(dev, 1); break; default: - keyboard_at_adddata_mouse_cmd(0xfe); + kbc_at_dev_queue_add(dev, 0xfe, 0); } } @@ -279,7 +294,8 @@ mouse_reset: (dev->last_data[4] == 0xf3) && (dev->last_data[5] == 0x50)) dev->flags |= FLAG_INTMODE; - if ((dev->flags & FLAG_INTMODE) && (dev->last_data[0] == 0xf3) && (dev->last_data[1] == 0xc8) && + if ((dev->flags & FLAG_EXPLORER) && (dev->flags & FLAG_INTMODE) && + (dev->last_data[0] == 0xf3) && (dev->last_data[1] == 0xc8) && (dev->last_data[2] == 0xf3) && (dev->last_data[3] == 0xc8) && (dev->last_data[4] == 0xf3) && (dev->last_data[5] == 0x50)) dev->flags |= FLAG_5BTN; @@ -289,30 +305,18 @@ mouse_reset: static int ps2_poll(int x, int y, int z, int b, double abs_x, double abs_y, void *priv) { - mouse_t *dev = (mouse_t *) priv; + atkbc_dev_t *dev = (atkbc_dev_t *) priv; - if (!x && !y && !z && (b == dev->b)) - return (0xff); - -#if 0 - if (!(dev->flags & FLAG_ENABLED)) - return(0xff); -#endif - - if (!mouse_scan) + if (!mouse_scan || (!x && !y && !z && (b == dev->b))) return (0xff); dev->x += x; dev->y -= y; dev->z -= z; -#if 0 - if ((dev->mode == MODE_STREAM) && (dev->flags & FLAG_ENABLED) && (keyboard_at_mouse_pos() < 13)) { -#else - if ((dev->mode == MODE_STREAM) && (keyboard_at_mouse_pos() < 13)) { -#endif + if ((dev->mode == MODE_STREAM) && (kbc_at_dev_queue_pos(dev, 1) < 13)) { dev->b = b; - ps2_report_coordinates(dev, 0); + ps2_report_coordinates(dev, 1); } return (0); @@ -326,11 +330,9 @@ ps2_poll(int x, int y, int z, int b, double abs_x, double abs_y, void *priv) void * mouse_ps2_init(const device_t *info) { - mouse_t *dev; + atkbc_dev_t *dev = kbc_at_dev_init(DEV_AUX); int i; - dev = (mouse_t *) malloc(sizeof(mouse_t)); - memset(dev, 0x00, sizeof(mouse_t)); dev->name = info->name; dev->type = info->local; @@ -338,18 +340,25 @@ mouse_ps2_init(const device_t *info) i = device_get_config_int("buttons"); if (i > 2) dev->flags |= FLAG_INTELLI; + if (i > 4) + dev->flags |= FLAG_EXPLORER; - if (i == 4) + if (i >= 4) i = 3; - /* Hook into the general AT Keyboard driver. */ - keyboard_at_set_mouse(ps2_write, dev); - mouse_ps2_log("%s: buttons=%d\n", dev->name, i); /* Tell them how many buttons we have. */ mouse_set_buttons(i); + dev->process_cmd = ps2_write; + dev->execute_bat = ps2_bat; + + dev->scan = &mouse_scan; + + if (dev->port != NULL) + kbc_at_dev_reset(dev, 0); + /* Return our private data to the I/O layer. */ return (dev); } @@ -357,10 +366,7 @@ mouse_ps2_init(const device_t *info) static void ps2_close(void *priv) { - mouse_t *dev = (mouse_t *) priv; - - /* Unhook from the general AT Keyboard driver. */ - keyboard_at_set_mouse(NULL, NULL); + atkbc_dev_t *dev = (atkbc_dev_t *) priv; free(dev); } diff --git a/src/include/86box/device.h b/src/include/86box/device.h index f85be460d..2390e5128 100644 --- a/src/include/86box/device.h +++ b/src/include/86box/device.h @@ -57,21 +57,24 @@ #define CONFIG_SERPORT 12 enum { - DEVICE_PCJR = 2, /* requires an IBM PCjr */ - DEVICE_AT = 4, /* requires an AT-compatible system */ - DEVICE_PS2 = 8, /* requires a PS/1 or PS/2 system */ - DEVICE_ISA = 0x10, /* requires the ISA bus */ - DEVICE_CBUS = 0x20, /* requires the C-BUS bus */ - DEVICE_MCA = 0x40, /* requires the MCA bus */ - DEVICE_EISA = 0x80, /* requires the EISA bus */ - DEVICE_VLB = 0x100, /* requires the PCI bus */ - DEVICE_PCI = 0x200, /* requires the VLB bus */ - DEVICE_AGP = 0x400, /* requires the AGP bus */ - DEVICE_AC97 = 0x800, /* requires the AC'97 bus */ - DEVICE_COM = 0x1000, /* requires a serial port */ - DEVICE_LPT = 0x2000, /* requires a parallel port */ + DEVICE_PCJR = 2, /* requires an IBM PCjr */ + DEVICE_AT = 4, /* requires an AT-compatible system */ + DEVICE_PS2 = 8, /* requires a PS/1 or PS/2 system */ + DEVICE_ISA = 0x10, /* requires the ISA bus */ + DEVICE_CBUS = 0x20, /* requires the C-BUS bus */ + DEVICE_MCA = 0x40, /* requires the MCA bus */ + DEVICE_EISA = 0x80, /* requires the EISA bus */ + DEVICE_VLB = 0x100, /* requires the PCI bus */ + DEVICE_PCI = 0x200, /* requires the VLB bus */ + DEVICE_AGP = 0x400, /* requires the AGP bus */ + DEVICE_AC97 = 0x800, /* requires the AC'97 bus */ + DEVICE_COM = 0x1000, /* requires a serial port */ + DEVICE_LPT = 0x2000, /* requires a parallel port */ + DEVICE_KBC = 0x4000, /* is a keyboard controller */ - DEVICE_EXTPARAMS = 0x40000000 /* accepts extended parameters */ + DEVICE_EXTPARAMS = 0x40000000, /* accepts extended parameters */ + + DEVICE_ALL = 0xffffffff /* match all devices */ }; #define BIOS_NORMAL 0 @@ -171,8 +174,7 @@ extern void *device_cadd_inst_parameters(const device_t *d, const device_t *cd, extern void device_cadd_inst_ex(const device_t *d, const device_t *cd, void *priv, int inst); extern void device_cadd_inst_ex_parameters(const device_t *d, const device_t *cd, void *priv, int inst, void *params); extern void device_close_all(void); -extern void device_reset_all(void); -extern void device_reset_all_pci(void); +extern void device_reset_all(uint32_t match_flags); extern void *device_get_priv(const device_t *d); extern int device_available(const device_t *d); extern int device_poll(const device_t *d, int x, int y, int z, int b); diff --git a/src/include/86box/keyboard.h b/src/include/86box/keyboard.h index 2834937ff..08a425f6d 100644 --- a/src/include/86box/keyboard.h +++ b/src/include/86box/keyboard.h @@ -27,6 +27,15 @@ enum { DEV_AUX }; +enum { + DEV_STATE_MAIN_1 = 0, + DEV_STATE_MAIN_2, + DEV_STATE_MAIN_CMD, + DEV_STATE_MAIN_OUT, + DEV_STATE_MAIN_WANT_IN, + DEV_STATE_MAIN_IN +}; + /* Used by the AT / PS/2 keyboard controller, common device, keyboard, and mouse. */ typedef struct { uint8_t wantcmd, dat, pad, pad0; @@ -36,7 +45,7 @@ typedef struct { void *priv; void (*poll)(void *priv); -} kbc_port_t; +} kbc_at_port_t; /* Used by the AT / PS/2 common device, keyboard, and mouse. */ typedef struct { @@ -65,7 +74,7 @@ typedef struct { void (*process_cmd)(void *priv); void (*execute_bat)(void *priv); - kbc_port_t *port; + kbc_at_port_t *port; } atkbc_dev_t; typedef struct { @@ -188,7 +197,7 @@ extern int mouse_queue_start, mouse_queue_end; extern int mouse_cmd_queue_start, mouse_cmd_queue_end; extern int mouse_scan; -extern kbc_port_t *kbc_ports[2]; +extern kbc_at_port_t *kbc_at_ports[2]; #ifdef EMU_DEVICE_H extern const device_t keyboard_pc_device; @@ -228,6 +237,8 @@ extern const device_t keyboard_ps2_intel_ami_pci_device; extern const device_t keyboard_ps2_acer_pci_device; extern const device_t keyboard_ps2_ali_pci_device; extern const device_t keyboard_ps2_tg_ami_pci_device; + +extern const device_t keyboard_at_generic_device; #endif /*EMU_DEVICE_H*/ extern void keyboard_init(void); @@ -249,14 +260,10 @@ extern int keyboard_isfsexit_down(void); extern int keyboard_ismsexit(void); extern void keyboard_set_is_amstrad(int ams); -extern void keyboard_at_adddata_mouse(uint8_t val); -extern void keyboard_at_adddata_mouse_cmd(uint8_t val); -extern void keyboard_at_mouse_reset(void); -extern uint8_t keyboard_at_mouse_pos(void); -extern void keyboard_at_set_mouse(void (*mouse_write)(uint8_t val, void *), void *); -extern void keyboard_at_set_a20_key(int state); -extern void keyboard_at_reset(void); -extern void kbc_at_a20_reset(void); +extern uint8_t kbc_at_dev_queue_pos(atkbc_dev_t *dev, uint8_t main); +extern void kbc_at_dev_queue_add(atkbc_dev_t *dev, uint8_t val, uint8_t main); +extern void kbc_at_dev_reset(atkbc_dev_t *dev, int do_fa); +extern atkbc_dev_t *kbc_at_dev_init(uint8_t inst); #ifdef __cplusplus } diff --git a/src/io.c b/src/io.c index 87cceae62..0cd7cd87b 100644 --- a/src/io.c +++ b/src/io.c @@ -56,7 +56,6 @@ typedef struct { int initialized = 0; io_t *io[NPORTS], *io_last[NPORTS]; -// #define ENABLE_IO_LOG 1 #ifdef ENABLE_IO_LOG int io_do_log = ENABLE_IO_LOG; @@ -311,9 +310,7 @@ inb(uint16_t port) /* if (port == 0x1ed) ret = 0xfe; */ - if (port == 0x92) { - io_log("[%04X:%08X] (%i, %i, %04i) in b(%04X) = %02X\n", CS, cpu_state.pc, in_smm, found, qfound, port, ret); - } + io_log("[%04X:%08X] (%i, %i, %04i) in b(%04X) = %02X\n", CS, cpu_state.pc, in_smm, found, qfound, port, ret); return (ret); } @@ -344,9 +341,7 @@ outb(uint16_t port, uint8_t val) #endif } - if (port == 0x92) { - io_log("[%04X:%08X] (%i, %i, %04i) outb(%04X, %02X)\n", CS, cpu_state.pc, in_smm, found, qfound, port, val); - } + io_log("[%04X:%08X] (%i, %i, %04i) outb(%04X, %02X)\n", CS, cpu_state.pc, in_smm, found, qfound, port, val); return; } @@ -400,9 +395,7 @@ inw(uint16_t port) if (!found) cycles -= io_delay; - if (port == 0x92) { - io_log("[%04X:%08X] (%i, %i, %04i) in w(%04X) = %04X\n", CS, cpu_state.pc, in_smm, found, qfound, port, ret); - } + io_log("[%04X:%08X] (%i, %i, %04i) in w(%04X) = %04X\n", CS, cpu_state.pc, in_smm, found, qfound, port, ret); return ret; } @@ -447,9 +440,7 @@ outw(uint16_t port, uint16_t val) #endif } - if (port == 0x92) { - io_log("[%04X:%08X] (%i, %i, %04i) outw(%04X, %04X)\n", CS, cpu_state.pc, in_smm, found, qfound, port, val); - } + io_log("[%04X:%08X] (%i, %i, %04i) outw(%04X, %04X)\n", CS, cpu_state.pc, in_smm, found, qfound, port, val); return; } @@ -531,9 +522,7 @@ inl(uint16_t port) if (!found) cycles -= io_delay; - if (port == 0x92) { - io_log("[%04X:%08X] (%i, %i, %04i) in l(%04X) = %08X\n", CS, cpu_state.pc, in_smm, found, qfound, port, ret); - } + io_log("[%04X:%08X] (%i, %i, %04i) in l(%04X) = %08X\n", CS, cpu_state.pc, in_smm, found, qfound, port, ret); return ret; } @@ -593,9 +582,7 @@ outl(uint16_t port, uint32_t val) #endif } - if (port == 0x92) { - io_log("[%04X:%08X] (%i, %i, %04i) outl(%04X, %08X)\n", CS, cpu_state.pc, in_smm, found, qfound, port, val); - } + io_log("[%04X:%08X] (%i, %i, %04i) outl(%04X, %08X)\n", CS, cpu_state.pc, in_smm, found, qfound, port, val); return; } diff --git a/src/pci.c b/src/pci.c index f9155e2e3..692733422 100644 --- a/src/pci.c +++ b/src/pci.c @@ -922,12 +922,11 @@ trc_reset(uint8_t val) dma_reset(); dma_set_at(1); - device_reset_all(); + device_reset_all(DEVICE_ALL); cpu_alt_reset = 0; pci_reset(); - keyboard_at_reset(); mem_a20_alt = 0; mem_a20_recalc(); diff --git a/src/win/Makefile.mingw b/src/win/Makefile.mingw index 76d402a83..3725e6e09 100644 --- a/src/win/Makefile.mingw +++ b/src/win/Makefile.mingw @@ -209,6 +209,9 @@ endif ifndef MINITRACE MINITRACE := n endif +ifndef AVX + AVX := n +endif ifeq ($(DYNAREC), y) ifeq ($(ARM), y) ifeq ($(NEW_DYNAREC), n) @@ -314,7 +317,11 @@ else endif endif endif -AFLAGS := -msse2 -mfpmath=sse +ifeq ($(AVX), y) + AFLAGS := -msse2 -msse3 -mssse3 -msse4 -msse4a -mavx -mavx2 -mfpmath=sse +else + AFLAGS := -msse2 -mfpmath=sse +endif ifeq ($(ARM), y) DFLAGS := -march=armv7-a AOPTIM := @@ -581,11 +588,8 @@ MCHOBJ := machine.o machine_table.o \ m_at_socket8.o m_at_slot1.o m_at_slot2.o m_at_socket370.o \ m_at_misc.o -ifeq ($(NEW_KBC), y) - KBCOBJ := kbc_at.o kbd_at.o -else - KBCOBJ := keyboard_at.o -endif +KBCOBJ := kbc_at.o kbc_at_dev.o \ + keyboard_at.o DEVOBJ := bugger.o cartridge.o cassette.o hasp.o hwm.o hwm_lm75.o hwm_lm78.o hwm_gl518sm.o hwm_vt82c686.o \ ibm_5161.o isamem.o isartc.o lpt.o pci_bridge.o postcard.o serial.o \ From 06fc5e9d0d8b5fd6325594d212e2521288d3c182 Mon Sep 17 00:00:00 2001 From: OBattler Date: Wed, 19 Apr 2023 23:46:33 +0200 Subject: [PATCH 06/60] Committed the two missing files. --- src/device/kbc_at.c | 2111 +++++++++++++++++++++++++++++++++++++++ src/device/kbc_at_dev.c | 198 ++++ 2 files changed, 2309 insertions(+) create mode 100644 src/device/kbc_at.c create mode 100644 src/device/kbc_at_dev.c diff --git a/src/device/kbc_at.c b/src/device/kbc_at.c new file mode 100644 index 000000000..7026815a4 --- /dev/null +++ b/src/device/kbc_at.c @@ -0,0 +1,2111 @@ +/* + * 86Box A hypervisor and IBM PC system emulator that specializes in + * running old operating systems and software designed for IBM + * PC systems and compatibles from 1981 through fairly recent + * system designs based on the PCI bus. + * + * This file is part of the 86Box distribution. + * + * Intel 8042 (AT keyboard controller) emulation. + * + * + * + * Authors: Miran Grca, + * EngiNerd, + * + * Copyright 2023 Miran Grca. + * Copyright 2023 EngiNerd. + */ +#include +#include +#include +#include +#include +#define HAVE_STDARG_H +#include +#include <86box/86box.h> +#include "cpu.h" +#include <86box/timer.h> +#include <86box/io.h> +#include <86box/pic.h> +#include <86box/pit.h> +#include <86box/ppi.h> +#include <86box/mem.h> +#include <86box/device.h> +#include <86box/machine.h> +#include <86box/m_at_t3100e.h> +#include <86box/fdd.h> +#include <86box/fdc.h> +#include <86box/sound.h> +#include <86box/snd_speaker.h> +#include <86box/video.h> +#include <86box/keyboard.h> + +#define STAT_PARITY 0x80 +#define STAT_RTIMEOUT 0x40 +#define STAT_TTIMEOUT 0x20 +#define STAT_MFULL 0x20 +#define STAT_UNLOCKED 0x10 +#define STAT_CD 0x08 +#define STAT_SYSFLAG 0x04 +#define STAT_IFULL 0x02 +#define STAT_OFULL 0x01 + +#define CCB_UNUSED 0x80 +#define CCB_TRANSLATE 0x40 +#define CCB_PCMODE 0x20 +#define CCB_ENABLEKBD 0x10 +#define CCB_IGNORELOCK 0x08 +#define CCB_SYSTEM 0x04 +#define CCB_ENABLEMINT 0x02 +#define CCB_ENABLEKINT 0x01 + +#define CCB_MASK 0x68 +#define MODE_MASK 0x6c + +#define KBC_TYPE_ISA 0x00 /* AT ISA-based chips */ +#define KBC_TYPE_PS2_NOREF 0x01 /* PS2 type, no refresh */ +#define KBC_TYPE_PS2_1 0x02 /* PS2 on PS/2, type 1 */ +#define KBC_TYPE_PS2_2 0x03 /* PS2 on PS/2, type 2 */ +#define KBC_TYPE_MASK 0x03 + +#define KBC_VEN_GENERIC 0x00 +#define KBC_VEN_AMI 0x04 +#define KBC_VEN_IBM_MCA 0x08 +#define KBC_VEN_QUADTEL 0x0c +#define KBC_VEN_TOSHIBA 0x10 +#define KBC_VEN_IBM_PS1 0x14 +#define KBC_VEN_ACER 0x18 +#define KBC_VEN_INTEL_AMI 0x1c +#define KBC_VEN_OLIVETTI 0x20 +#define KBC_VEN_NCR 0x24 +#define KBC_VEN_PHOENIX 0x28 +#define KBC_VEN_ALI 0x2c +#define KBC_VEN_TG 0x30 +#define KBC_VEN_TG_GREEN 0x34 +#define KBC_VEN_MASK 0x3c + +#define FLAG_CLOCK 0x01 +#define FLAG_CACHE 0x02 +#define FLAG_PS2 0x04 +#define FLAG_PCI 0x08 + +enum { + STATE_RESET = 0, + STATE_MAIN_IBF, + STATE_MAIN_KBD, + STATE_MAIN_AUX, + STATE_MAIN_BOTH, + STATE_KBC_OUT, + STATE_KBC_PARAM, + STATE_SEND_KBD, + STATE_SCAN_KBD, + STATE_SEND_AUX, + STATE_SCAN_AUX +}; + +typedef struct { + uint8_t state, command, command_phase, status, + wantdata, ib, ob, sc_or, + mem_addr, p1, p2, old_p2, + misc_flags, ami_flags, key_ctrl_queue_start, key_ctrl_queue_end; + + uint8_t mem[0x100]; + + /* Internal FIFO for the purpose of commands with multi-byte output. */ + uint8_t key_ctrl_queue[64]; + + uint32_t flags; + + /* Main timer. */ + pc_timer_t send_delay_timer; + + /* P2 pulse callback timer. */ + pc_timer_t pulse_cb; + + /* Local copies of the pointers to both ports for easier swapping (AMI '5' MegaKey). */ + kbc_at_port_t *ports[2]; + + uint8_t (*write60_ven)(void *p, uint8_t val); + uint8_t (*write64_ven)(void *p, uint8_t val); +} atkbc_t; + +/* Keyboard controller ports. */ +kbc_at_port_t *kbc_at_ports[2] = { NULL, NULL }; + +/* Non-translated to translated scan codes. */ +static const uint8_t nont_to_t[256] = { + 0xff, 0x43, 0x41, 0x3f, 0x3d, 0x3b, 0x3c, 0x58, + 0x64, 0x44, 0x42, 0x40, 0x3e, 0x0f, 0x29, 0x59, + 0x65, 0x38, 0x2a, 0x70, 0x1d, 0x10, 0x02, 0x5a, + 0x66, 0x71, 0x2c, 0x1f, 0x1e, 0x11, 0x03, 0x5b, + 0x67, 0x2e, 0x2d, 0x20, 0x12, 0x05, 0x04, 0x5c, + 0x68, 0x39, 0x2f, 0x21, 0x14, 0x13, 0x06, 0x5d, + 0x69, 0x31, 0x30, 0x23, 0x22, 0x15, 0x07, 0x5e, + 0x6a, 0x72, 0x32, 0x24, 0x16, 0x08, 0x09, 0x5f, + 0x6b, 0x33, 0x25, 0x17, 0x18, 0x0b, 0x0a, 0x60, + 0x6c, 0x34, 0x35, 0x26, 0x27, 0x19, 0x0c, 0x61, + 0x6d, 0x73, 0x28, 0x74, 0x1a, 0x0d, 0x62, 0x6e, + 0x3a, 0x36, 0x1c, 0x1b, 0x75, 0x2b, 0x63, 0x76, + 0x55, 0x56, 0x77, 0x78, 0x79, 0x7a, 0x0e, 0x7b, + 0x7c, 0x4f, 0x7d, 0x4b, 0x47, 0x7e, 0x7f, 0x6f, + 0x52, 0x53, 0x50, 0x4c, 0x4d, 0x48, 0x01, 0x45, + 0x57, 0x4e, 0x51, 0x4a, 0x37, 0x49, 0x46, 0x54, + 0x80, 0x81, 0x82, 0x41, 0x54, 0x85, 0x86, 0x87, + 0x88, 0x89, 0x8a, 0x8b, 0x8c, 0x8d, 0x8e, 0x8f, + 0x90, 0x91, 0x92, 0x93, 0x94, 0x95, 0x96, 0x97, + 0x98, 0x99, 0x9a, 0x9b, 0x9c, 0x9d, 0x9e, 0x9f, + 0xa0, 0xa1, 0xa2, 0xa3, 0xa4, 0xa5, 0xa6, 0xa7, + 0xa8, 0xa9, 0xaa, 0xab, 0xac, 0xad, 0xae, 0xaf, + 0xb0, 0xb1, 0xb2, 0xb3, 0xb4, 0xb5, 0xb6, 0xb7, + 0xb8, 0xb9, 0xba, 0xbb, 0xbc, 0xbd, 0xbe, 0xbf, + 0xc0, 0xc1, 0xc2, 0xc3, 0xc4, 0xc5, 0xc6, 0xc7, + 0xc8, 0xc9, 0xca, 0xcb, 0xcc, 0xcd, 0xce, 0xcf, + 0xd0, 0xd1, 0xd2, 0xd3, 0xd4, 0xd5, 0xd6, 0xd7, + 0xd8, 0xd9, 0xda, 0xdb, 0xdc, 0xdd, 0xde, 0xdf, + 0xe0, 0xe1, 0xe2, 0xe3, 0xe4, 0xe5, 0xe6, 0xe7, + 0xe8, 0xe9, 0xea, 0xeb, 0xec, 0xed, 0xee, 0xef, + 0xf0, 0xf1, 0xf2, 0xf3, 0xf4, 0xf5, 0xf6, 0xf7, + 0xf8, 0xf9, 0xfa, 0xfb, 0xfc, 0xfd, 0xfe, 0xff +}; + +#ifdef ENABLE_KBC_AT_LOG +int kbc_at_do_log = ENABLE_KBC_AT_LOG; + +static void +kbc_at_log(const char *fmt, ...) +{ + va_list ap; + + if (kbc_at_do_log) { + va_start(ap, fmt); + pclog_ex(fmt, ap); + va_end(ap); + } +} +#else +# define kbc_at_log(fmt, ...) +#endif + +static void +kbc_at_queue_reset(atkbc_t *dev) +{ + dev->key_ctrl_queue_start = dev->key_ctrl_queue_end = 0; + memset(dev->key_ctrl_queue, 0x00, sizeof(dev->key_ctrl_queue)); +} + +static void +kbc_at_queue_add(atkbc_t *dev, uint8_t val) +{ + kbc_at_log("ATkbc: dev->key_ctrl_queue[%02X] = %02X;\n", dev->key_ctrl_queue_end, val); + dev->key_ctrl_queue[dev->key_ctrl_queue_end] = val; + dev->key_ctrl_queue_end = (dev->key_ctrl_queue_end + 1) & 0x3f; +} + +static int +kbc_translate(atkbc_t *dev, uint8_t val) +{ + int xt_mode = (dev->mem[0x20] & 0x20) && !(dev->misc_flags & FLAG_PS2); + int translate = (dev->mem[0x20] & 0x40) || xt_mode || ((dev->flags & KBC_TYPE_MASK) == KBC_TYPE_PS2_2); + uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; + int ret = - 1; + + /* Allow for scan code translation. */ + if (translate && (val == 0xf0)) { + kbc_at_log("ATkbc: translate is on, F0 prefix detected\n"); + dev->sc_or = 0x80; + return ret; + } + + /* Skip break code if translated make code has bit 7 set. */ + if (translate && (dev->sc_or == 0x80) && (nont_to_t[val] & 0x80)) { + kbc_at_log("ATkbc: translate is on, skipping scan code: %02X (original: F0 %02X)\n", nont_to_t[val], val); + dev->sc_or = 0; + return ret; + } + + /* Test for T3100E 'Fn' key (Right Alt / Right Ctrl) */ + if ((dev != NULL) && (kbc_ven == KBC_VEN_TOSHIBA) && + (keyboard_recv(0x138) || keyboard_recv(0x11d))) switch (val) { + case 0x4f: + t3100e_notify_set(0x01); + break; /* End */ + case 0x50: + t3100e_notify_set(0x02); + break; /* Down */ + case 0x51: + t3100e_notify_set(0x03); + break; /* PgDn */ + case 0x52: + t3100e_notify_set(0x04); + break; /* Ins */ + case 0x53: + t3100e_notify_set(0x05); + break; /* Del */ + case 0x54: + t3100e_notify_set(0x06); + break; /* SysRQ */ + case 0x45: + t3100e_notify_set(0x07); + break; /* NumLock */ + case 0x46: + t3100e_notify_set(0x08); + break; /* ScrLock */ + case 0x47: + t3100e_notify_set(0x09); + break; /* Home */ + case 0x48: + t3100e_notify_set(0x0a); + break; /* Up */ + case 0x49: + t3100e_notify_set(0x0b); + break; /* PgUp */ + case 0x4a: + t3100e_notify_set(0x0c); + break; /* Keypad - */ + case 0x4b: + t3100e_notify_set(0x0d); + break; /* Left */ + case 0x4c: + t3100e_notify_set(0x0e); + break; /* KP 5 */ + case 0x4d: + t3100e_notify_set(0x0f); + break; /* Right */ + } + + kbc_at_log("ATkbc: translate is %s, ", translate ? "on" : "off"); +#ifdef ENABLE_KEYBOARD_AT_LOG + kbc_at_log("scan code: "); + if (translate) { + kbc_at_log("%02X (original: ", (nont_to_t[val] | dev->sc_or)); + if (dev->sc_or == 0x80) + kbc_at_log("F0 "); + kbc_at_log("%02X)\n", val); + } else + kbc_at_log("%02X\n", val); +#endif + + ret = translate ? (nont_to_t[val] | dev->sc_or) : val; + + if (dev->sc_or == 0x80) + dev->sc_or = 0; + + return ret; +} + +static void +add_to_kbc_queue_front(atkbc_t *dev, uint8_t val, uint8_t channel, uint8_t stat_hi) +{ + uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; + int temp = (channel == 1) ? kbc_translate(dev, val) : val; + + if (temp == -1) + return; + + if ((kbc_ven == KBC_VEN_AMI) || (kbc_ven == KBC_VEN_TG) || + (kbc_ven == KBC_VEN_TG_GREEN) || (dev->misc_flags & FLAG_PS2)) + stat_hi |= ((dev->p1 & 0x80) ? 0x10 : 0x00); + else + stat_hi |= 0x10; + + kbc_at_log("ATkbc: Adding %02X to front on channel %i...\n", temp, channel); + dev->status = (dev->status & ~0xf0) | STAT_OFULL | stat_hi; + + /* WARNING: On PS/2, all IRQ's are level-triggered, but the IBM PS/2 KBC firmware is explicitly + written to pulse its P2 IRQ bits, so they should be kept as as edge-triggered here. */ + if (dev->misc_flags & FLAG_PS2) { + if (channel >= 2) { + dev->status |= STAT_MFULL; + + if (dev->mem[0x20] & 0x02) + picint_common(1 << 12, 0, 1); + picint_common(1 << 1, 0, 0); + } else { + if (dev->mem[0x20] & 0x01) + picint_common(1 << 1, 0, 1); + picint_common(1 << 12, 0, 0); + } + } else if (dev->mem[0x20] & 0x01) + picintlevel(1 << 1); /* AT KBC: IRQ 1 is level-triggered because it is tied to OBF. */ + + dev->ob = temp; +} + +static void kbc_at_process_cmd(void *priv); + +static void +set_enable_kbd(atkbc_t *dev, uint8_t enable) +{ + dev->mem[0x20] &= 0xef; + dev->mem[0x20] |= (enable ? 0x00 : 0x10); +} + +static void +set_enable_aux(atkbc_t *dev, uint8_t enable) +{ + dev->mem[0x20] &= 0xdf; + dev->mem[0x20] |= (enable ? 0x00 : 0x20); +} + +static void +kbc_ibf_process(atkbc_t *dev) +{ + /* IBF set, process both commands and data. */ + dev->status &= ~STAT_IFULL; + dev->state = STATE_MAIN_IBF; + if (dev->status & STAT_CD) + kbc_at_process_cmd(dev); + else { + set_enable_kbd(dev, 1); + if ((dev->ports[0] != NULL) && (dev->ports[0]->priv != NULL)) { + dev->ports[0]->wantcmd = 1; + dev->ports[0]->dat = dev->ib; + dev->state = STATE_SEND_KBD; + } else + add_to_kbc_queue_front(dev, 0xfe, 1, 0x40); + } +} + +static void +kbc_scan_kbd_at(atkbc_t *dev) +{ + if (!(dev->mem[0x20] & 0x10)) { + /* Both OBF and IBF clear and keyboard is enabled. */ + /* XT mode. */ + if (dev->mem[0x20] & 0x20) { + if ((dev->ports[0] != NULL) && (dev->ports[0]->out_new != -1)) { + add_to_kbc_queue_front(dev, dev->ports[0]->out_new, 1, 0x00); + dev->ports[0]->out_new = -1; + dev->state = STATE_MAIN_IBF; + } else if (dev->status & STAT_IFULL) + kbc_ibf_process(dev); + /* AT mode. */ + } else { + // dev->t = dev->mem[0x28]; + if (dev->mem[0x2e] != 0x00) { + // if (!(dev->t & 0x02)) + // return; + dev->mem[0x2e] = 0x00; + } + dev->p2 &= 0xbf; + if ((dev->ports[0] != NULL) && (dev->ports[0]->out_new != -1)) { + /* In our case, we never have noise on the line, so we can simplify this. */ + /* Read data from the keyboard. */ + if (dev->mem[0x20] & 0x40) { + if ((dev->mem[0x20] & 0x08) || (dev->p1 & 0x80)) + add_to_kbc_queue_front(dev, dev->ports[0]->out_new, 1, 0x00); + dev->mem[0x2d] = (dev->ports[0]->out_new == 0xf0) ? 0x80 : 0x00; + } else + add_to_kbc_queue_front(dev, dev->ports[0]->out_new, 1, 0x00); + dev->ports[0]->out_new = -1; + dev->state = STATE_MAIN_IBF; + } + } + } +} + +static void write_p2(atkbc_t *dev, uint8_t val); + +static void +kbc_at_poll_at(atkbc_t *dev) +{ + switch (dev->state) { + case STATE_RESET: + if (dev->status & STAT_IFULL) { + dev->status = ((dev->status & 0x0f) | 0x10) & ~STAT_IFULL; + if ((dev->status & STAT_CD) && (dev->ib == 0xaa)) + kbc_at_process_cmd(dev); + } + break; + case STATE_MAIN_IBF: + default: + if (dev->status & STAT_OFULL) { + /* OBF set, wait until it is cleared but still process commands. */ + if ((dev->status & STAT_IFULL) && (dev->status & STAT_CD)) { + dev->status &= ~STAT_IFULL; + kbc_at_process_cmd(dev); + } + } else if (dev->status & STAT_IFULL) + kbc_ibf_process(dev); + else if (!(dev->mem[0x20] & 0x10)) + dev->state = STATE_MAIN_KBD; + break; + case STATE_MAIN_KBD: + case STATE_MAIN_BOTH: + if (dev->status & STAT_IFULL) + kbc_ibf_process(dev); + else { + (void) kbc_scan_kbd_at(dev); + dev->state = STATE_MAIN_IBF; + } + break; + case STATE_KBC_OUT: + /* Keyboard controller command want to output multiple bytes. */ + if (dev->status & STAT_IFULL) { + /* Data from host aborts dumping. */ + dev->state = STATE_MAIN_IBF; + kbc_ibf_process(dev); + } + /* Do not continue dumping until OBF is clear. */ + if (!(dev->status & STAT_OFULL)) { + kbc_at_log("ATkbc: %02X coming from channel 0\n", dev->key_ctrl_queue[dev->key_ctrl_queue_start]); + add_to_kbc_queue_front(dev, dev->key_ctrl_queue[dev->key_ctrl_queue_start], 0, 0x00); + dev->key_ctrl_queue_start = (dev->key_ctrl_queue_start + 1) & 0x3f; + if (dev->key_ctrl_queue_start == dev->key_ctrl_queue_end) + dev->state = STATE_MAIN_IBF; + } + break; + case STATE_KBC_PARAM: + /* Keyboard controller command wants data, wait for said data. */ + if (dev->status & STAT_IFULL) { + /* Command written, abort current command. */ + if (dev->status & STAT_CD) + dev->state = STATE_MAIN_IBF; + + dev->status &= ~STAT_IFULL; + kbc_at_process_cmd(dev); + } + break; + case STATE_SEND_KBD: + if (!dev->ports[0]->wantcmd) + dev->state = STATE_SCAN_KBD; + break; + case STATE_SCAN_KBD: + kbc_scan_kbd_at(dev); + break; + } +} + +/* + Correct Procedure: + 1. Controller asks the device (keyboard or auxiliary device) for a byte. + 2. The device, unless it's in the reset or command states, sees if there's anything to give it, + and if yes, begins the transfer. + 3. The controller checks if there is a transfer, if yes, transfers the byte and sends it to the host, + otherwise, checks the next device, or if there is no device left to check, checks if IBF is full + and if yes, processes it. + */ +static int +kbc_scan_kbd_ps2(atkbc_t *dev) +{ + if ((dev->ports[0] != NULL) && (dev->ports[0]->out_new != -1)) { + kbc_at_log("ATkbc: %02X coming from channel 1\n", dev->ports[0]->out_new & 0xff); + add_to_kbc_queue_front(dev, dev->ports[0]->out_new, 1, 0x00); + dev->ports[0]->out_new = -1; + dev->state = STATE_MAIN_IBF; + return 1; + } + + return 0; +} + +static int +kbc_scan_aux_ps2(atkbc_t *dev) +{ + if ((dev->ports[1] != NULL) && (dev->ports[1]->out_new != -1)) { + kbc_at_log("ATkbc: %02X coming from channel 2\n", dev->ports[1]->out_new & 0xff); + add_to_kbc_queue_front(dev, dev->ports[1]->out_new, 2, 0x00); + dev->ports[1]->out_new = -1; + dev->state = STATE_MAIN_IBF; + return 1; + } + + return 0; +} + +static void +kbc_at_poll_ps2(atkbc_t *dev) +{ + switch (dev->state) { + case STATE_RESET: + if (dev->status & STAT_IFULL) { + dev->status = ((dev->status & 0x0f) | 0x10) & ~STAT_IFULL; + if ((dev->status & STAT_CD) && (dev->ib == 0xaa)) + kbc_at_process_cmd(dev); + } + break; + case STATE_MAIN_IBF: + default: + if (dev->status & STAT_IFULL) + kbc_ibf_process(dev); + else if (!(dev->status & STAT_OFULL)) { + if (dev->mem[0x20] & 0x20) { + if (!(dev->mem[0x20] & 0x10)) { + dev->p2 &= 0xbf; + dev->state = STATE_MAIN_KBD; + } + } else { + dev->p2 &= 0xf7; + if (dev->mem[0x20] & 0x10) + dev->state = STATE_MAIN_AUX; + else { + dev->p2 &= 0xbf; + dev->state = STATE_MAIN_BOTH; + } + } + } + break; + case STATE_MAIN_KBD: + if (dev->status & STAT_IFULL) + kbc_ibf_process(dev); + else { + (void) kbc_scan_kbd_ps2(dev); + dev->state = STATE_MAIN_IBF; + } + break; + case STATE_MAIN_AUX: + if (dev->status & STAT_IFULL) + kbc_ibf_process(dev); + else { + (void) kbc_scan_aux_ps2(dev); + dev->state = STATE_MAIN_IBF; + } + break; + case STATE_MAIN_BOTH: + if (kbc_scan_kbd_ps2(dev)) + dev->state = STATE_MAIN_IBF; + else + dev->state = STATE_MAIN_AUX; + break; + case STATE_KBC_OUT: + /* Keyboard controller command want to output multiple bytes. */ + if (dev->status & STAT_IFULL) { + /* Data from host aborts dumping. */ + dev->state = STATE_MAIN_IBF; + kbc_ibf_process(dev); + } + /* Do not continue dumping until OBF is clear. */ + if (!(dev->status & STAT_OFULL)) { + kbc_at_log("ATkbc: %02X coming from channel 0\n", dev->key_ctrl_queue[dev->key_ctrl_queue_start] & 0xff); + add_to_kbc_queue_front(dev, dev->key_ctrl_queue[dev->key_ctrl_queue_start], 0, 0x00); + dev->key_ctrl_queue_start = (dev->key_ctrl_queue_start + 1) & 0x3f; + if (dev->key_ctrl_queue_start == dev->key_ctrl_queue_end) + dev->state = STATE_MAIN_IBF; + } + break; + case STATE_KBC_PARAM: + /* Keyboard controller command wants data, wait for said data. */ + if (dev->status & STAT_IFULL) { + /* Command written, abort current command. */ + if (dev->status & STAT_CD) + dev->state = STATE_MAIN_IBF; + + dev->status &= ~STAT_IFULL; + kbc_at_process_cmd(dev); + } + break; + case STATE_SEND_KBD: + if (!dev->ports[0]->wantcmd) + dev->state = STATE_SCAN_KBD; + break; + case STATE_SCAN_KBD: + (void) kbc_scan_kbd_ps2(dev); + break; + case STATE_SEND_AUX: + if (!dev->ports[1]->wantcmd) + dev->state = STATE_SCAN_AUX; + break; + case STATE_SCAN_AUX: + (void) kbc_scan_aux_ps2(dev); + break; + } +} + +static void +kbc_at_poll(void *priv) +{ + atkbc_t *dev = (atkbc_t *) priv; + + timer_advance_u64(&dev->send_delay_timer, (100ULL * TIMER_USEC)); + + /* TODO: Use a fuction pointer for this (also needed to the AMI KBC mode switching) + and implement the password security state. */ + if (dev->misc_flags & FLAG_PS2) + kbc_at_poll_ps2(dev); + else + kbc_at_poll_at(dev); + + if ((kbc_at_ports[0] != NULL) && (kbc_at_ports[0]->priv != NULL)) + kbc_at_ports[0]->poll(kbc_at_ports[0]->priv); + + if ((dev->misc_flags & FLAG_PS2) && (kbc_at_ports[1] != NULL) && (kbc_at_ports[1]->priv != NULL)) + kbc_at_ports[1]->poll(kbc_at_ports[1]->priv); +} + +static void +write_p2(atkbc_t *dev, uint8_t val) +{ + uint8_t old = dev->p2; + kbc_at_log("ATkbc: write P2: %02X (old: %02X)\n", val, dev->p2); + + uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; + +#if 0 + /* PS/2: Handle IRQ's. */ + if (dev->misc_flags & FLAG_PS2) { + /* IRQ 12 */ + picint_common(1 << 12, 0, val & 0x20); + + /* IRQ 1 */ + picint_common(1 << 1, 0, val & 0x10); + } +#endif + + /* AT, PS/2: Handle A20. */ + if ((mem_a20_key ^ val) & 0x02) { /* A20 enable change */ + mem_a20_key = val & 0x02; + mem_a20_recalc(); + flushmmucache(); + } + + /* AT, PS/2: Handle reset. */ + /* 0 holds the CPU in the RESET state, 1 releases it. To simplify this, + we just do everything on release. */ + if ((old ^ val) & 0x01) { /*Reset*/ + if (!(val & 0x01)) { /* Pin 0 selected. */ + /* Pin 0 selected. */ + kbc_at_log("write_p2(): Pulse reset!\n"); + if (machines[machine].flags & MACHINE_COREBOOT) { + /* The SeaBIOS hard reset code attempts a KBC reset if ACPI RESET_REG + is not available. However, the KBC reset is normally a soft reset, so + SeaBIOS gets caught in a soft reset loop as it tries to hard reset the + machine. Hack around this by making the KBC reset a hard reset only on + coreboot machines. */ + pc_reset_hard(); + } else { + softresetx86(); /*Pulse reset!*/ + cpu_set_edx(); + flushmmucache(); + if (kbc_ven == KBC_VEN_ALI) + smbase = 0x00030000; + } + } + } + + /* Do this here to avoid an infinite reset loop. */ + dev->p2 = val; +} + +static void +write_p2_fast_a20(atkbc_t *dev, uint8_t val) +{ + uint8_t old = dev->p2; + kbc_at_log("ATkbc: write P2 in fast A20 mode: %02X (old: %02X)\n", val, dev->p2); + + /* AT, PS/2: Handle A20. */ + if ((old ^ val) & 0x02) { /* A20 enable change */ + mem_a20_key = val & 0x02; + mem_a20_recalc(); + flushmmucache(); + } + + /* Do this here to avoid an infinite reset loop. */ + dev->p2 = val; +} + +static void +write_cmd(atkbc_t *dev, uint8_t val) +{ + kbc_at_log("ATkbc: write command byte: %02X (old: %02X)\n", val, dev->mem[0x20]); + + /* PS/2 type 2 keyboard controllers always force the XLAT bit to 0. */ + if ((dev->flags & KBC_TYPE_MASK) == KBC_TYPE_PS2_2) { + val &= ~CCB_TRANSLATE; + dev->mem[0x20] &= ~CCB_TRANSLATE; + } else if (!(dev->misc_flags & FLAG_PS2)) { + if (val & 0x10) + dev->mem[0x2e] = 0x01; + } + + kbc_at_log("ATkbc: keyboard interrupt is now %s\n", (val & 0x01) ? "enabled" : "disabled"); + + if (!(dev->misc_flags & FLAG_PS2)) { + /* Update P2 to mirror the IBF and OBF bits, if active. */ + write_p2(dev, (dev->p2 & 0x0f) | ((val & 0x03) << 4) | ((val & 0x20) ? 0xc0 : 0x00)); + } + + kbc_at_log("ATkbc: Command byte now: %02X (%02X)\n", dev->mem[0x20], val); + + dev->status = (dev->status & ~STAT_SYSFLAG) | (val & STAT_SYSFLAG); +} + +static void +pulse_output(atkbc_t *dev, uint8_t mask) +{ + if (mask != 0x0f) { + dev->old_p2 = dev->p2 & ~(0xf0 | mask); + kbc_at_log("ATkbc: pulse_output(): P2 now: %02X\n", dev->p2 & (0xf0 | mask)); + write_p2(dev, dev->p2 & (0xf0 | mask)); + timer_set_delay_u64(&dev->pulse_cb, 6ULL * TIMER_USEC); + } +} + +static void +pulse_poll(void *priv) +{ + atkbc_t *dev = (atkbc_t *) priv; + + kbc_at_log("ATkbc: pulse_poll(): P2 now: %02X\n", dev->p2 | dev->old_p2); + write_p2(dev, dev->p2 | dev->old_p2); +} + +static uint8_t +write64_generic(void *priv, uint8_t val) +{ + atkbc_t *dev = (atkbc_t *) priv; + uint8_t current_drive, fixed_bits; + uint8_t kbc_ven = 0x0; + kbc_ven = dev->flags & KBC_VEN_MASK; + + switch (val) { + case 0xa4: /* check if password installed */ + if (dev->misc_flags & FLAG_PS2) { + kbc_at_log("ATkbc: check if password installed\n"); + add_to_kbc_queue_front(dev, 0xf1, 0, 0x00); + return 0; + } + break; + + case 0xa7: /* disable auxiliary port */ + if (dev->misc_flags & FLAG_PS2) { + kbc_at_log("ATkbc: disable auxiliary port\n"); + set_enable_aux(dev, 0); + return 0; + } + break; + + case 0xa8: /* Enable auxiliary port */ + if (dev->misc_flags & FLAG_PS2) { + kbc_at_log("ATkbc: enable auxiliary port\n"); + set_enable_aux(dev, 1); + return 0; + } + break; + + case 0xa9: /* Test auxiliary port */ + kbc_at_log("ATkbc: test auxiliary port\n"); + if (dev->misc_flags & FLAG_PS2) { + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); /* no error, this is testing the channel 2 interface */ + return 0; + } + break; + + case 0xaf: /* read keyboard version */ + kbc_at_log("ATkbc: read keyboard version\n"); + add_to_kbc_queue_front(dev, 0x42, 0, 0x00); + return 0; + + case 0xc0: /* read P1 */ + kbc_at_log("ATkbc: read P1\n"); + fixed_bits = 4; + /* The SMM handlers of Intel AMI Pentium BIOS'es expect bit 6 to be set. */ + if (kbc_ven == KBC_VEN_INTEL_AMI) + fixed_bits |= 0x40; + if (kbc_ven == KBC_VEN_IBM_PS1) { + current_drive = fdc_get_current_drive(); + add_to_kbc_queue_front(dev, dev->p1 | fixed_bits | (fdd_is_525(current_drive) ? 0x40 : 0x00), + 0, 0x00); + dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc) | (fdd_is_525(current_drive) ? 0x40 : 0x00); + } else if (kbc_ven == KBC_VEN_NCR) { + /* switch settings + * bit 7: keyboard disable + * bit 6: display type (0 color, 1 mono) + * bit 5: power-on default speed (0 high, 1 low) + * bit 4: sense RAM size (0 unsupported, 1 512k on system board) + * bit 3: coprocessor detect + * bit 2: unused + * bit 1: high/auto speed + * bit 0: dma mode + */ + add_to_kbc_queue_front(dev, (dev->p1 | fixed_bits | (video_is_mda() ? 0x40 : 0x00) | (hasfpu ? 0x08 : 0x00)) & 0xdf, + 0, 0x00); + dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc); + } else { + if ((kbc_ven == KBC_VEN_TG) || (kbc_ven == KBC_VEN_TG_GREEN)) { + /* Bit 3, 2: + 1, 1: TriGem logo; + 1, 0: Garbled logo; + 0, 1: Epson logo; + 0, 0: Generic AMI logo. */ + if (dev->misc_flags & FLAG_PCI) + fixed_bits |= 8; + add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); + } else if (((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) && ((dev->flags & KBC_VEN_MASK) != KBC_VEN_INTEL_AMI)) +#if 0 + add_to_kbc_queue_front(dev, (dev->p1 | fixed_bits) & + (((dev->flags & KBC_VEN_MASK) == KBC_VEN_ACER) ? 0xeb : 0xef), 0, 0x00); +#else + add_to_kbc_queue_front(dev, ((dev->p1 | fixed_bits) & 0xf0) | (((dev->flags & KBC_VEN_MASK) == KBC_VEN_ACER) ? 0x08 : 0x0c), 0, 0x00); +#endif + else + add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); + dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc); + } + return 0; + + case 0xd3: /* write auxiliary output buffer */ + if (dev->misc_flags & FLAG_PS2) { + kbc_at_log("ATkbc: write auxiliary output buffer\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + return 0; + } + break; + + case 0xd4: /* write to auxiliary port */ + kbc_at_log("ATkbc: write to auxiliary port\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + return 0; + + case 0xf0 ... 0xff: + kbc_at_log("ATkbc: pulse %01X\n", val & 0x0f); + pulse_output(dev, val & 0x0f); + return 0; + } + + kbc_at_log("ATkbc: bad command %02X\n", val); + return 1; +} + +static uint8_t +write60_ami(void *priv, uint8_t val) +{ + atkbc_t *dev = (atkbc_t *) priv; + + switch (dev->command) { + /* 0x40 - 0x5F are aliases for 0x60-0x7F */ + case 0x40 ... 0x5f: + kbc_at_log("ATkbc: AMI - alias write to %08X\n", dev->command); + dev->mem[(dev->command & 0x1f) + 0x20] = val; + if (dev->command == 0x60) + write_cmd(dev, val); + return 0; + + case 0xa5: /* get extended controller RAM */ + kbc_at_log("ATkbc: AMI - get extended controller RAM\n"); + add_to_kbc_queue_front(dev, dev->mem[val], 0, 0x00); + return 0; + + case 0xaf: /* set extended controller RAM */ + kbc_at_log("ATkbc: AMI - set extended controller RAM\n"); + if (dev->command_phase == 1) { + dev->mem_addr = val; + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + dev->command_phase = 2; + } else if (dev->command_phase == 2) { + dev->mem[dev->mem_addr] = val; + dev->command_phase = 0; + } + return 0; + + case 0xc1: + kbc_at_log("ATkbc: AMI MegaKey - write %02X to P1\n", val); + dev->p1 = val; + return 0; + + case 0xcb: /* set keyboard mode */ + kbc_at_log("ATkbc: AMI - set keyboard mode\n"); + dev->ami_flags = val; + dev->misc_flags &= ~FLAG_PS2; + if (val & 0x01) + dev->misc_flags |= FLAG_PS2; + return 0; + } + + return 1; +} + +static uint8_t +write64_ami(void *priv, uint8_t val) +{ + atkbc_t *dev = (atkbc_t *) priv; + uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; + + switch (val) { + case 0x00 ... 0x1f: + kbc_at_log("ATkbc: AMI - alias read from %08X\n", val); + add_to_kbc_queue_front(dev, dev->mem[val + 0x20], 0, 0x00); + return 0; + + case 0x40 ... 0x5f: + kbc_at_log("ATkbc: AMI - alias write to %08X\n", dev->command); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + return 0; + + case 0xa0: /* copyright message */ + kbc_at_queue_add(dev, 0x28); + kbc_at_queue_add(dev, 0x00); + dev->state = STATE_KBC_OUT; + break; + + case 0xa1: /* get controller version */ + kbc_at_log("ATkbc: AMI - get controller version\n"); + if ((kbc_ven == KBC_VEN_TG) || (kbc_ven == KBC_VEN_TG_GREEN)) + add_to_kbc_queue_front(dev, 'Z', 0, 0x00); + else if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { + if (kbc_ven == KBC_VEN_ALI) + add_to_kbc_queue_front(dev, 'F', 0, 0x00); + else if ((dev->flags & KBC_VEN_MASK) == KBC_VEN_INTEL_AMI) + add_to_kbc_queue_front(dev, '5', 0, 0x00); + else if (cpu_64bitbus) + add_to_kbc_queue_front(dev, 'R', 0, 0x00); + else if (is486) + add_to_kbc_queue_front(dev, 'P', 0, 0x00); + else + add_to_kbc_queue_front(dev, 'H', 0, 0x00); + } else if (is386 && !is486) { + if (cpu_16bitbus) + add_to_kbc_queue_front(dev, 'D', 0, 0x00); + else + add_to_kbc_queue_front(dev, 'B', 0, 0x00); + } else if (!is386) + add_to_kbc_queue_front(dev, '8', 0, 0x00); + else + add_to_kbc_queue_front(dev, 'F', 0, 0x00); + return 0; + + case 0xa2: /* clear keyboard controller lines P22/P23 */ + if (!(dev->misc_flags & FLAG_PS2)) { + kbc_at_log("ATkbc: AMI - clear KBC lines P22 and P23\n"); + write_p2(dev, dev->p2 & 0xf3); + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + return 0; + } + break; + + case 0xa3: /* set keyboard controller lines P22/P23 */ + if (!(dev->misc_flags & FLAG_PS2)) { + kbc_at_log("ATkbc: AMI - set KBC lines P22 and P23\n"); + write_p2(dev, dev->p2 | 0x0c); + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + return 0; + } + break; + + case 0xa4: /* write clock = low */ + if (!(dev->misc_flags & FLAG_PS2)) { + kbc_at_log("ATkbc: AMI - write clock = low\n"); + dev->misc_flags &= ~FLAG_CLOCK; + return 0; + } + break; + + case 0xa5: /* write clock = high */ + if (!(dev->misc_flags & FLAG_PS2)) { + kbc_at_log("ATkbc: AMI - write clock = high\n"); + dev->misc_flags |= FLAG_CLOCK; + } else { + kbc_at_log("ATkbc: get extended controller RAM\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + } + return 0; + + case 0xa6: /* read clock */ + if (!(dev->misc_flags & FLAG_PS2)) { + kbc_at_log("ATkbc: AMI - read clock\n"); + add_to_kbc_queue_front(dev, (dev->misc_flags & FLAG_CLOCK) ? 0xff : 0x00, 0, 0x00); + return 0; + } + break; + + case 0xa7: /* write cache bad */ + if (!(dev->misc_flags & FLAG_PS2)) { + kbc_at_log("ATkbc: AMI - write cache bad\n"); + dev->misc_flags &= FLAG_CACHE; + return 0; + } + break; + + case 0xa8: /* write cache good */ + if (!(dev->misc_flags & FLAG_PS2)) { + kbc_at_log("ATkbc: AMI - write cache good\n"); + dev->misc_flags |= FLAG_CACHE; + return 0; + } + break; + + case 0xa9: /* read cache */ + if (!(dev->misc_flags & FLAG_PS2)) { + kbc_at_log("ATkbc: AMI - read cache\n"); + add_to_kbc_queue_front(dev, (dev->misc_flags & FLAG_CACHE) ? 0xff : 0x00, 0, 0x00); + return 0; + } + break; + + case 0xaf: /* set extended controller RAM */ + if (kbc_ven == KBC_VEN_ALI) { + kbc_at_log("ATkbc: Award/ALi/VIA keyboard controller revision\n"); + add_to_kbc_queue_front(dev, 0x43, 0, 0x00); + } else { + kbc_at_log("ATkbc: set extended controller RAM\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + dev->command_phase = 1; + } + return 0; + + case 0xb0 ... 0xb3: + /* set KBC lines P10-P13 (P1 bits 0-3) low */ + kbc_at_log("ATkbc: set KBC lines P10-P13 (P1 bits 0-3) low\n"); + if (!(dev->flags & DEVICE_PCI) || (val > 0xb1)) + dev->p1 &= ~(1 << (val & 0x03)); + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + return 0; + + case 0xb4: case 0xb5: + /* set KBC lines P22-P23 (P2 bits 2-3) low */ + kbc_at_log("ATkbc: set KBC lines P22-P23 (P2 bits 2-3) low\n"); + if (!(dev->flags & DEVICE_PCI)) + write_p2(dev, dev->p2 & ~(4 << (val & 0x01))); + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + return 0; + + case 0xb8 ... 0xbb: + /* set KBC lines P10-P13 (P1 bits 0-3) high */ + kbc_at_log("ATkbc: set KBC lines P10-P13 (P1 bits 0-3) high\n"); + if (!(dev->flags & DEVICE_PCI) || (val > 0xb9)) { + dev->p1 |= (1 << (val & 0x03)); + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + } + return 0; + + case 0xbc: case 0xbd: + /* set KBC lines P22-P23 (P2 bits 2-3) high */ + kbc_at_log("ATkbc: set KBC lines P22-P23 (P2 bits 2-3) high\n"); + if (!(dev->flags & DEVICE_PCI)) + write_p2(dev, dev->p2 | (4 << (val & 0x01))); + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + return 0; + + case 0xc1: /* write P1 */ + kbc_at_log("ATkbc: AMI MegaKey - write P1\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + return 0; + + case 0xc4: + /* set KBC line P14 low */ + kbc_at_log("ATkbc: set KBC line P14 (P1 bit 4) low\n"); + dev->p1 &= 0xef; + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + return 0; + case 0xc5: + /* set KBC line P15 low */ + kbc_at_log("ATkbc: set KBC line P15 (P1 bit 5) low\n"); + dev->p1 &= 0xdf; + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + return 0; + + case 0xc8: + /* + * unblock KBC lines P22/P23 + * (allow command D1 to change bits 2/3 of P2) + */ + kbc_at_log("ATkbc: AMI - unblock KBC lines P22 and P23\n"); + dev->ami_flags &= 0xfb; + return 0; + + case 0xc9: + /* + * block KBC lines P22/P23 + * (disallow command D1 from changing bits 2/3 of the port) + */ + kbc_at_log("ATkbc: AMI - block KBC lines P22 and P23\n"); + dev->ami_flags |= 0x04; + return 0; + + case 0xcc: + /* set KBC line P14 high */ + kbc_at_log("ATkbc: set KBC line P14 (P1 bit 4) high\n"); + dev->p1 |= 0x10; + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + return 0; + case 0xcd: + /* set KBC line P15 high */ + kbc_at_log("ATkbc: set KBC line P15 (P1 bit 5) high\n"); + dev->p1 |= 0x20; + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + return 0; + + case 0xef: /* ??? - sent by AMI486 */ + kbc_at_log("ATkbc: ??? - sent by AMI486\n"); + return 0; + } + + return write64_generic(dev, val); +} + +static uint8_t +write64_ibm_mca(void *priv, uint8_t val) +{ + atkbc_t *dev = (atkbc_t *) priv; + + switch (val) { + case 0xc1: /*Copy bits 0 to 3 of P1 to status bits 4 to 7*/ + kbc_at_log("ATkbc: copy bits 0 to 3 of P1 to status bits 4 to 7\n"); + dev->status &= 0x0f; + dev->status |= ((((dev->p1 & 0xfc) | 0x84) & 0x0f) << 4); + return 0; + + case 0xc2: /*Copy bits 4 to 7 of P1 to status bits 4 to 7*/ + kbc_at_log("ATkbc: copy bits 4 to 7 of P1 to status bits 4 to 7\n"); + dev->status &= 0x0f; + dev->status |= (((dev->p1 & 0xfc) | 0x84) & 0xf0); + return 0; + + case 0xaf: + kbc_at_log("ATkbc: bad KBC command AF\n"); + return 1; + + case 0xf0 ... 0xff: + kbc_at_log("ATkbc: pulse: %01X\n", (val & 0x03) | 0x0c); + pulse_output(dev, (val & 0x03) | 0x0c); + return 0; + } + + return write64_generic(dev, val); +} + +static uint8_t +write60_quadtel(void *priv, uint8_t val) +{ + atkbc_t *dev = (atkbc_t *) priv; + + switch (dev->command) { + case 0xcf: /*??? - sent by MegaPC BIOS*/ + kbc_at_log("ATkbc: ??? - sent by MegaPC BIOS\n"); + return 0; + } + + return 1; +} + +static uint8_t +write64_olivetti(void *priv, uint8_t val) +{ + atkbc_t *dev = (atkbc_t *) priv; + + switch (val) { + case 0x80: /* Olivetti-specific command */ + /* + * bit 7: bus expansion board present (M300) / keyboard unlocked (M290) + * bits 4-6: ??? + * bit 3: fast ram check (if inactive keyboard works erratically) + * bit 2: keyboard fuse present + * bits 0-1: ??? + */ + add_to_kbc_queue_front(dev, (0x0c | ((is386) ? 0x00 : 0x80)) & 0xdf, 0, 0x00); + dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc); + return 0; + } + + return write64_generic(dev, val); +} + +static uint8_t +write64_quadtel(void *priv, uint8_t val) +{ + atkbc_t *dev = (atkbc_t *) priv; + + switch (val) { + case 0xaf: + kbc_at_log("ATkbc: bad KBC command AF\n"); + return 1; + + case 0xcf: /*??? - sent by MegaPC BIOS*/ + kbc_at_log("ATkbc: ??? - sent by MegaPC BIOS\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + return 0; + } + + return write64_generic(dev, val); +} + +static uint8_t +write60_toshiba(void *priv, uint8_t val) +{ + atkbc_t *dev = (atkbc_t *) priv; + + switch (dev->command) { + case 0xb6: /* T3100e - set color/mono switch */ + kbc_at_log("ATkbc: T3100e - set color/mono switch\n"); + t3100e_mono_set(val); + return 0; + } + + return 1; +} + +static uint8_t +write64_toshiba(void *priv, uint8_t val) +{ + atkbc_t *dev = (atkbc_t *) priv; + + switch (val) { + case 0xaf: + kbc_at_log("ATkbc: bad KBC command AF\n"); + return 1; + + case 0xb0: /* T3100e: Turbo on */ + kbc_at_log("ATkbc: T3100e: Turbo on\n"); + t3100e_turbo_set(1); + return 0; + + case 0xb1: /* T3100e: Turbo off */ + kbc_at_log("ATkbc: T3100e: Turbo off\n"); + t3100e_turbo_set(0); + return 0; + + case 0xb2: /* T3100e: Select external display */ + kbc_at_log("ATkbc: T3100e: Select external display\n"); + t3100e_display_set(0x00); + return 0; + + case 0xb3: /* T3100e: Select internal display */ + kbc_at_log("ATkbc: T3100e: Select internal display\n"); + t3100e_display_set(0x01); + return 0; + + case 0xb4: /* T3100e: Get configuration / status */ + kbc_at_log("ATkbc: T3100e: Get configuration / status\n"); + add_to_kbc_queue_front(dev, t3100e_config_get(), 0, 0x00); + return 0; + + case 0xb5: /* T3100e: Get colour / mono byte */ + kbc_at_log("ATkbc: T3100e: Get colour / mono byte\n"); + add_to_kbc_queue_front(dev, t3100e_mono_get(), 0, 0x00); + return 0; + + case 0xb6: /* T3100e: Set colour / mono byte */ + kbc_at_log("ATkbc: T3100e: Set colour / mono byte\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + return 0; + + case 0xb7: /* T3100e: Emulate PS/2 keyboard */ + case 0xb8: /* T3100e: Emulate AT keyboard */ + dev->flags &= ~KBC_TYPE_MASK; + if (val == 0xb7) { + kbc_at_log("ATkbc: T3100e: Emulate PS/2 keyboard\n"); + dev->flags |= KBC_TYPE_PS2_NOREF; + } else { + kbc_at_log("ATkbc: T3100e: Emulate AT keyboard\n"); + dev->flags |= KBC_TYPE_ISA; + } + return 0; + + case 0xbb: /* T3100e: Read 'Fn' key. + Return it for right Ctrl and right Alt; on the real + T3100e, these keystrokes could only be generated + using 'Fn'. */ + kbc_at_log("ATkbc: T3100e: Read 'Fn' key\n"); + if (keyboard_recv(0xb8) || /* Right Alt */ + keyboard_recv(0x9d)) /* Right Ctrl */ + add_to_kbc_queue_front(dev, 0x04, 0, 0x00); + else + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + return 0; + + case 0xbc: /* T3100e: Reset Fn+Key notification */ + kbc_at_log("ATkbc: T3100e: Reset Fn+Key notification\n"); + t3100e_notify_set(0x00); + return 0; + + case 0xc0: /* Read P1 */ + kbc_at_log("ATkbc: read P1\n"); + + /* The T3100e returns all bits set except bit 6 which + * is set by t3100e_mono_set() */ + dev->p1 = (t3100e_mono_get() & 1) ? 0xff : 0xbf; + add_to_kbc_queue_front(dev, dev->p1, 0, 0x00); + return 0; + } + + return write64_generic(dev, val); +} + +static void +kbc_at_process_cmd(void *priv) +{ + atkbc_t *dev = (atkbc_t *) priv; + int i = 0, bad = 1; + uint8_t mask, kbc_ven = dev->flags & KBC_VEN_MASK; + uint8_t cmd_ac_conv[16] = { 0x0b, 2, 3, 4, 5, 6, 7, 8, 9, 0x0a, 0x1e, 0x30, 0x2e, 0x20, 0x12, 0x21 }; + + if (dev->status & STAT_CD) { + /* Controller command. */ + dev->wantdata = 0; + dev->state = STATE_MAIN_IBF; + + /* Clear the keyboard controller queue. */ + kbc_at_queue_reset(dev); + + switch (dev->ib) { + /* Read data from KBC memory. */ + case 0x20 ... 0x3f: + add_to_kbc_queue_front(dev, dev->mem[dev->ib], 0, 0x00); + break; + + /* Write data to KBC memory. */ + case 0x60 ... 0x7f: + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + break; + + case 0xaa: /* self-test */ + kbc_at_log("ATkbc: self-test\n"); + + if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { + if (dev->state != STATE_RESET) { + kbc_at_log("ATkbc: self-test reinitialization\n"); + /* Yes, the firmware has an OR, but we need to make sure to keep any forcibly lowered bytes lowered. */ + /* TODO: Proper P1 implementation, with OR and AND flags in the machine table. */ + dev->p1 = dev->p1 & 0xff; + write_p2(dev, 0x4b); + } + + dev->status = (dev->status & 0x0f) | 0x60; + + dev->mem[0x20] = 0x30; + dev->mem[0x21] = 0x01; + dev->mem[0x22] = 0x0b; + dev->mem[0x25] = 0x02; + dev->mem[0x27] = 0xf8; + dev->mem[0x28] = 0xce; + dev->mem[0x29] = 0x0b; + dev->mem[0x2a] = 0x10; + dev->mem[0x2b] = 0x20; + dev->mem[0x2c] = 0x15; + dev->mem[0x30] = 0x0b; + } else { + if (dev->state != STATE_RESET) { + kbc_at_log("ATkbc: self-test reinitialization\n"); + /* Yes, the firmware has an OR, but we need to make sure to keep any forcibly lowered bytes lowered. */ + /* TODO: Proper P1 implementation, with OR and AND flags in the machine table. */ + dev->p1 = dev->p1 & 0xff; + write_p2(dev, 0xcf); + } + + dev->status = (dev->status & 0x0f) | 0x60; + + dev->mem[0x20] = 0x10; + dev->mem[0x21] = 0x01; + dev->mem[0x22] = 0x06; + dev->mem[0x25] = 0x01; + dev->mem[0x27] = 0xfb; + dev->mem[0x28] = 0xe0; + dev->mem[0x29] = 0x06; + dev->mem[0x2a] = 0x10; + dev->mem[0x2b] = 0x20; + dev->mem[0x2c] = 0x15; + } + + if (dev->ports[0] != NULL) + dev->ports[0]->out_new = -1; + if (dev->ports[1] != NULL) + dev->ports[1]->out_new = -1; + kbc_at_queue_reset(dev); + + // dev->state = STATE_MAIN_IBF; + dev->state = STATE_KBC_OUT; + + // add_to_kbc_queue_front(dev, 0x55, 0, 0x00); + kbc_at_queue_add(dev, 0x55); + break; + + case 0xab: /* interface test */ + kbc_at_log("ATkbc: interface test\n"); + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); /*no error*/ + break; + + case 0xac: /* diagnostic dump */ + if (dev->misc_flags & FLAG_PS2) { + kbc_at_log("ATkbc: diagnostic dump\n"); + dev->mem[0x30] = (dev->p1 & 0xf0) | 0x80; + dev->mem[0x31] = dev->p2; + dev->mem[0x32] = 0x00; /* T0 and T1. */ + dev->mem[0x33] = 0x00; /* PSW - Program Status Word - always return 0x00 because we do not emulate this byte. */ + /* 20 bytes in high nibble in set 1, low nibble in set 1, set 1 space format = 60 bytes. */ + for (i = 0; i < 20; i++) { + kbc_at_queue_add(dev, cmd_ac_conv[dev->mem[i + 0x20] >> 4]); + kbc_at_queue_add(dev, cmd_ac_conv[dev->mem[i + 0x20] & 0x0f]); + kbc_at_queue_add(dev, 0x39); + } + dev->state = STATE_KBC_OUT; + } + break; + + case 0xad: /* disable keyboard */ + kbc_at_log("ATkbc: disable keyboard\n"); + set_enable_kbd(dev, 0); + break; + + case 0xae: /* enable keyboard */ + kbc_at_log("ATkbc: enable keyboard\n"); + set_enable_kbd(dev, 1); + break; + + case 0xc7: /* set port1 bits */ + kbc_at_log("ATkbc: Phoenix - set port1 bits\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + break; + + case 0xca: /* read keyboard mode */ + kbc_at_log("ATkbc: AMI - read keyboard mode\n"); + add_to_kbc_queue_front(dev, dev->ami_flags, 0, 0x00); + break; + + case 0xcb: /* set keyboard mode */ + kbc_at_log("ATkbc: AMI - set keyboard mode\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + break; + + case 0xd0: /* read P2 */ + kbc_at_log("ATkbc: read P2\n"); + mask = 0xff; + if ((kbc_ven != KBC_VEN_OLIVETTI) && !(dev->misc_flags & FLAG_PS2) && (dev->mem[0x20] & 0x10)) + mask &= 0xbf; + add_to_kbc_queue_front(dev, (((dev->p2 & 0xfd) | mem_a20_key) & mask), 0, 0x00); + break; + + case 0xd1: /* write P2 */ + kbc_at_log("ATkbc: write P2\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + break; + + case 0xd2: /* write keyboard output buffer */ + kbc_at_log("ATkbc: write keyboard output buffer\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + break; + + case 0xdd: /* disable A20 address line */ + case 0xdf: /* enable A20 address line */ + kbc_at_log("ATkbc: %sable A20\n", (dev->ib == 0xdd) ? "dis" : "en"); + write_p2_fast_a20(dev, (dev->p2 & 0xfd) | (dev->ib & 0x02)); + break; + + case 0xe0: /* read test inputs */ + kbc_at_log("ATkbc: read test inputs\n"); + add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + break; + + default: + /* + * Unrecognized controller command. + * + * If we have a vendor-specific handler, run + * that. Otherwise, or if that handler fails, + * log a bad command. + */ + if (dev->write64_ven) + bad = dev->write64_ven(dev, dev->ib); + + kbc_at_log(bad ? "ATkbc: bad controller command %02X\n" : "", dev->ib); + } + + /* If the command needs data, remember the command. */ + if (dev->wantdata) + dev->command = dev->ib; + } else if (dev->wantdata) { + /* Write data to controller. */ + dev->wantdata = 0; + dev->state = STATE_MAIN_IBF; + + switch (dev->command) { + case 0x60 ... 0x7f: + dev->mem[(dev->command & 0x1f) + 0x20] = dev->ib; + if (dev->command == 0x60) + write_cmd(dev, dev->ib); + break; + + case 0xc7: /* set port1 bits */ + kbc_at_log("ATkbc: Phoenix - set port1 bits\n"); + dev->p1 |= dev->ib; + break; + + case 0xd1: /* write P2 */ + kbc_at_log("ATkbc: write P2\n"); + /* Bit 2 of AMI flags is P22-P23 blocked (1 = yes, 0 = no), + discovered by reverse-engineering the AOpen Vi15G BIOS. */ + if (dev->ami_flags & 0x04) { + /* If keyboard controller lines P22-P23 are blocked, + we force them to remain unchanged. */ + dev->ib &= ~0x0c; + dev->ib |= (dev->p2 & 0x0c); + } + write_p2(dev, dev->ib | 0x01); + break; + + case 0xd2: /* write to keyboard output buffer */ + kbc_at_log("ATkbc: write to keyboard output buffer\n"); + add_to_kbc_queue_front(dev, dev->ib, 0, 0x00); + break; + + case 0xd3: /* write to auxiliary output buffer */ + kbc_at_log("ATkbc: write to auxiliary output buffer\n"); + add_to_kbc_queue_front(dev, dev->ib, 2, 0x00); + break; + + case 0xd4: /* write to auxiliary port */ + kbc_at_log("ATkbc: write to auxiliary port (%02X)\n", dev->ib); + + if (dev->ib == 0xbb) + break; + + if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { + set_enable_aux(dev, 1); + if ((dev->ports[1] != NULL) && (dev->ports[1]->priv != NULL)) { + dev->ports[1]->wantcmd = 1; + dev->ports[1]->dat = dev->ib; + dev->state = STATE_SEND_AUX; + } else + add_to_kbc_queue_front(dev, 0xfe, 2, 0x40); + } + break; + + default: + /* + * Run the vendor-specific handler + * if we have one. Otherwise, or if + * it returns an error, log a bad + * controller command. + */ + if (dev->write60_ven) + bad = dev->write60_ven(dev, dev->ib); + + if (bad) { + kbc_at_log("ATkbc: bad controller command %02x data %02x\n", dev->command, dev->ib); + } + } + } +} + +static void +kbc_at_write(uint16_t port, uint8_t val, void *priv) +{ + atkbc_t *dev = (atkbc_t *) priv; + + kbc_at_log("ATkbc: [%04X:%08X] write(%04X) = %02X\n", CS, cpu_state.pc, port, val); + + switch (port) { + case 0x60: + dev->status &= ~STAT_CD; + if (dev->wantdata && (dev->command == 0xd1)) { + kbc_at_log("ATkbc: write P2\n"); + + /* Fast A20 - ignore all other bits. */ + val = (val & 0x02) | (dev->p2 & 0xfd); + + /* Bit 2 of AMI flags is P22-P23 blocked (1 = yes, 0 = no), + discovered by reverse-engineering the AOpeN Vi15G BIOS. */ + if (dev->ami_flags & 0x04) { + /* If keyboard controller lines P22-P23 are blocked, + we force them to remain unchanged. */ + val &= ~0x0c; + val |= (dev->p2 & 0x0c); + } + + write_p2_fast_a20(dev, val | 0x01); + + dev->wantdata = 0; + dev->state = STATE_MAIN_IBF; + return; + } + break; + + case 0x64: + dev->status |= STAT_CD; + if (val == 0xd1) { + kbc_at_log("ATkbc: write P2\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + dev->command = 0xd1; + return; + } + break; + } + + dev->ib = val; + dev->status |= STAT_IFULL; +} + +static uint8_t +kbc_at_read(uint16_t port, void *priv) +{ + atkbc_t *dev = (atkbc_t *) priv; + uint8_t ret = 0xff; + + if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) + cycles -= ISA_CYCLES(8); + + switch (port) { + case 0x60: + ret = dev->ob; + dev->status &= ~STAT_OFULL; + /* TODO: IRQ is only tied to OBF on the AT KBC, on the PS/2 KBC, it is controlled by a P2 bit. + This also means that in AT mode, the IRQ is level-triggered. */ + if (!(dev->misc_flags & FLAG_PS2)) + picintc(1 << 1); + break; + + case 0x64: + ret = dev->status; + break; + + default: + kbc_at_log("ATkbc: read(%04x) invalid!\n",port); + break; + } + + kbc_at_log("ATkbc: [%04X:%08X] read (%04X) = %02X\n", CS, cpu_state.pc, port, ret); + + return (ret); +} + +static void +kbc_at_reset(void *priv) +{ + atkbc_t *dev = (atkbc_t *) priv; + uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; + + dev->status = STAT_UNLOCKED; + dev->mem[0x20] = 0x01; + dev->mem[0x20] |= CCB_TRANSLATE; + dev->command_phase = 0; + + /* Set up the correct Video Type bits. */ + if (!is286 || (kbc_ven == KBC_VEN_ACER)) + dev->p1 = video_is_mda() ? 0xb0 : 0xf0; + else + dev->p1 = video_is_mda() ? 0xf0 : 0xb0; + kbc_at_log("ATkbc: P1 = %02x\n", dev->p1); + + /* Disabled both the keyboard and auxiliary ports. */ + set_enable_kbd(dev, 0); + set_enable_aux(dev, 0); + + kbc_at_queue_reset(dev); + + dev->sc_or = 0; + + dev->ami_flags = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) ? 0x01 : 0x00; + + if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) + dev->misc_flags |= FLAG_PS2; + dev->misc_flags |= FLAG_CACHE; + + dev->p2 = 0xcd; + if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { + write_p2(dev, 0x4b); + } else { + /* The real thing writes CF and then AND's it with BF. */ + write_p2(dev, 0x8f); + } + + /* Stage 1. */ + dev->status = (dev->status & 0x0f) | (dev->p1 & 0xf0); +} + +static void +kbc_at_close(void *priv) +{ + atkbc_t *dev = (atkbc_t *) priv; + int i, max_ports = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) ? 2 : 1; + + kbc_at_reset(dev); + + /* Stop timers. */ + timer_disable(&dev->send_delay_timer); + + for (i = 0; i < max_ports; i++) { + if (kbc_at_ports[i] != NULL) { + free(kbc_at_ports[i]); + kbc_at_ports[i] = NULL; + } + } + + free(dev); +} + +static void * +kbc_at_init(const device_t *info) +{ + atkbc_t *dev; + int i, max_ports; + + dev = (atkbc_t *) malloc(sizeof(atkbc_t)); + memset(dev, 0x00, sizeof(atkbc_t)); + + dev->flags = info->local; + + if (info->flags & DEVICE_PCI) + dev->misc_flags |= FLAG_PCI; + + video_reset(gfxcard[0]); + kbc_at_reset(dev); + + io_sethandler(0x0060, 1, kbc_at_read, NULL, NULL, kbc_at_write, NULL, NULL, dev); + io_sethandler(0x0064, 1, kbc_at_read, NULL, NULL, kbc_at_write, NULL, NULL, dev); + + timer_add(&dev->send_delay_timer, kbc_at_poll, dev, 1); + timer_add(&dev->pulse_cb, pulse_poll, dev, 0); + + dev->write60_ven = NULL; + dev->write64_ven = NULL; + + switch (dev->flags & KBC_VEN_MASK) { + case KBC_VEN_ACER: + case KBC_VEN_GENERIC: + case KBC_VEN_NCR: + case KBC_VEN_IBM_PS1: + dev->write64_ven = write64_generic; + break; + + case KBC_VEN_OLIVETTI: + dev->write64_ven = write64_olivetti; + break; + + case KBC_VEN_AMI: + case KBC_VEN_INTEL_AMI: + case KBC_VEN_ALI: + case KBC_VEN_TG: + case KBC_VEN_TG_GREEN: + dev->write60_ven = write60_ami; + dev->write64_ven = write64_ami; + break; + + case KBC_VEN_IBM_MCA: + dev->write64_ven = write64_ibm_mca; + break; + + case KBC_VEN_QUADTEL: + dev->write60_ven = write60_quadtel; + dev->write64_ven = write64_quadtel; + break; + + case KBC_VEN_TOSHIBA: + dev->write60_ven = write60_toshiba; + dev->write64_ven = write64_toshiba; + break; + } + + max_ports = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) ? 2 : 1; + + for (i = 0; i < max_ports; i++) { + kbc_at_ports[i] = (kbc_at_port_t *) malloc(sizeof(kbc_at_port_t)); + memset(kbc_at_ports[i], 0x00, sizeof(kbc_at_port_t)); + kbc_at_ports[i]->out_new = -1; + } + + dev->ports[0] = kbc_at_ports[0]; + dev->ports[1] = kbc_at_ports[1]; + + /* The actual keyboard. */ + device_add(&keyboard_at_generic_device); + + return (dev); +} + +const device_t keyboard_at_device = { + .name = "PC/AT Keyboard", + .internal_name = "keyboard_at", + .flags = DEVICE_KBC, + .local = KBC_TYPE_ISA | KBC_VEN_GENERIC, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_at_ami_device = { + .name = "PC/AT Keyboard (AMI)", + .internal_name = "keyboard_at_ami", + .flags = DEVICE_KBC, + .local = KBC_TYPE_ISA | KBC_VEN_AMI, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_at_tg_ami_device = { + .name = "PC/AT Keyboard (TriGem AMI)", + .internal_name = "keyboard_at_tg_ami", + .flags = DEVICE_KBC, + .local = KBC_TYPE_ISA | KBC_VEN_TG, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_at_toshiba_device = { + .name = "PC/AT Keyboard (Toshiba)", + .internal_name = "keyboard_at_toshiba", + .flags = DEVICE_KBC, + .local = KBC_TYPE_ISA | KBC_VEN_TOSHIBA, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_at_olivetti_device = { + .name = "PC/AT Keyboard (Olivetti)", + .internal_name = "keyboard_at_olivetti", + .flags = DEVICE_KBC, + .local = KBC_TYPE_ISA | KBC_VEN_OLIVETTI, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_at_ncr_device = { + .name = "PC/AT Keyboard (NCR)", + .internal_name = "keyboard_at_ncr", + .flags = DEVICE_KBC, + .local = KBC_TYPE_ISA | KBC_VEN_NCR, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_device = { + .name = "PS/2 Keyboard", + .internal_name = "keyboard_ps2", + .flags = DEVICE_KBC, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_GENERIC, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_ps1_device = { + .name = "PS/2 Keyboard (IBM PS/1)", + .internal_name = "keyboard_ps2_ps1", + .flags = DEVICE_KBC, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_IBM_PS1, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_ps1_pci_device = { + .name = "PS/2 Keyboard (IBM PS/1)", + .internal_name = "keyboard_ps2_ps1_pci", + .flags = DEVICE_KBC | DEVICE_PCI, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_IBM_PS1, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_xi8088_device = { + .name = "PS/2 Keyboard (Xi8088)", + .internal_name = "keyboard_ps2_xi8088", + .flags = DEVICE_KBC, + .local = KBC_TYPE_PS2_1 | KBC_VEN_GENERIC, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_ami_device = { + .name = "PS/2 Keyboard (AMI)", + .internal_name = "keyboard_ps2_ami", + .flags = DEVICE_KBC, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_AMI, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_tg_ami_device = { + .name = "PS/2 Keyboard (TriGem AMI)", + .internal_name = "keyboard_ps2_tg_ami", + .flags = DEVICE_KBC, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_TG, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_mca_device = { + .name = "PS/2 Keyboard", + .internal_name = "keyboard_ps2_mca", + .flags = DEVICE_KBC, + .local = KBC_TYPE_PS2_1 | KBC_VEN_IBM_MCA, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_mca_2_device = { + .name = "PS/2 Keyboard", + .internal_name = "keyboard_ps2_mca_2", + .flags = DEVICE_KBC, + .local = KBC_TYPE_PS2_2 | KBC_VEN_IBM_MCA, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_quadtel_device = { + .name = "PS/2 Keyboard (Quadtel/MegaPC)", + .internal_name = "keyboard_ps2_quadtel", + .flags = DEVICE_KBC, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_QUADTEL, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_pci_device = { + .name = "PS/2 Keyboard", + .internal_name = "keyboard_ps2_pci", + .flags = DEVICE_KBC | DEVICE_PCI, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_GENERIC, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_ami_pci_device = { + .name = "PS/2 Keyboard (AMI)", + .internal_name = "keyboard_ps2_ami_pci", + .flags = DEVICE_KBC | DEVICE_PCI, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_AMI, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_ali_pci_device = { + .name = "PS/2 Keyboard (ALi M5123/M1543C)", + .internal_name = "keyboard_ps2_ali_pci", + .flags = DEVICE_KBC | DEVICE_PCI, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_ALI, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_intel_ami_pci_device = { + .name = "PS/2 Keyboard (AMI)", + .internal_name = "keyboard_ps2_intel_ami_pci", + .flags = DEVICE_KBC | DEVICE_PCI, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_INTEL_AMI, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_tg_ami_pci_device = { + .name = "PS/2 Keyboard (TriGem AMI)", + .internal_name = "keyboard_ps2_tg_ami_pci", + .flags = DEVICE_KBC | DEVICE_PCI, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_TG, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; + +const device_t keyboard_ps2_acer_pci_device = { + .name = "PS/2 Keyboard (Acer 90M002A)", + .internal_name = "keyboard_ps2_acer_pci", + .flags = DEVICE_KBC | DEVICE_PCI, + .local = KBC_TYPE_PS2_NOREF | KBC_VEN_ACER, + .init = kbc_at_init, + .close = kbc_at_close, + .reset = kbc_at_reset, + { .available = NULL }, + .speed_changed = NULL, + .force_redraw = NULL, + .config = NULL +}; diff --git a/src/device/kbc_at_dev.c b/src/device/kbc_at_dev.c new file mode 100644 index 000000000..a2baa21a0 --- /dev/null +++ b/src/device/kbc_at_dev.c @@ -0,0 +1,198 @@ +/* + * 86Box A hypervisor and IBM PC system emulator that specializes in + * running old operating systems and software designed for IBM + * PC systems and compatibles from 1981 through fairly recent + * system designs based on the PCI bus. + * + * This file is part of the 86Box distribution. + * + * AT / PS/2 attached device emulation. + * + * + * + * Authors: Miran Grca, + * + * Copyright 2023 Miran Grca. + */ +#include +#include +#include +#include +#include +#define HAVE_STDARG_H +#include +#include <86box/86box.h> +#include "cpu.h" +#include <86box/timer.h> +#include <86box/io.h> +#include <86box/pic.h> +#include <86box/pit.h> +#include <86box/ppi.h> +#include <86box/mem.h> +#include <86box/device.h> +#include <86box/machine.h> +#include <86box/m_at_t3100e.h> +#include <86box/fdd.h> +#include <86box/fdc.h> +#include <86box/sound.h> +#include <86box/snd_speaker.h> +#include <86box/video.h> +#include <86box/keyboard.h> + +#ifdef ENABLE_KBC_AT_DEV_LOG +int kbc_at_dev_do_log = ENABLE_KBC_AT_DEV_LOG; + +static void +kbc_at_dev_log(const char *fmt, ...) +{ + va_list ap; + + if (kbc_at_dev_do_log) { + va_start(ap, fmt); + pclog_ex(fmt, ap); + va_end(ap); + } +} +#else +# define kbc_at_dev_log(fmt, ...) +#endif + +static void +kbc_at_dev_queue_reset(atkbc_dev_t *dev, uint8_t reset_main) +{ + if (reset_main) { + dev->queue_start = dev->queue_end = 0; + memset(dev->queue, 0x00, sizeof(dev->queue)); + } + + dev->cmd_queue_start = dev->cmd_queue_end = 0; + memset(dev->cmd_queue, 0x00, sizeof(dev->cmd_queue)); +} + +uint8_t +kbc_at_dev_queue_pos(atkbc_dev_t *dev, uint8_t main) +{ + uint8_t ret; + + if (main) + ret = ((dev->queue_end - dev->queue_start) & 0xf); + else + ret = ((dev->cmd_queue_end - dev->cmd_queue_start) & 0xf); + + return ret; +} + +void +kbc_at_dev_queue_add(atkbc_dev_t *dev, uint8_t val, uint8_t main) +{ + if (main) { + kbc_at_dev_log("%s: dev->queue[%02X] = %02X;\n", dev->name, dev->queue_end, val); + dev->queue[dev->queue_end] = val; + dev->queue_end = (dev->queue_end + 1) & 0xf; + } else { + kbc_at_dev_log("%s: dev->cmd_queue[%02X] = %02X;\n", dev->name, dev->cmd_queue_end, val); + dev->cmd_queue[dev->cmd_queue_end] = val; + dev->cmd_queue_end = (dev->cmd_queue_end + 1) & 0xf; + } + + /* TODO: This should be done on actual send to host. */ + if (val != 0xfe) + dev->last_scan_code = val; +} + +static void +kbc_at_dev_poll(void *priv) +{ + atkbc_dev_t *dev = (atkbc_dev_t *) priv; + + switch (dev->state) { + case DEV_STATE_MAIN_1: + /* Process the command if needed and then return to main loop #2. */ + if (dev->port->wantcmd) { + kbc_at_dev_log("%s: Processing keyboard command %02X...\n", dev->name, dev->port->dat); + kbc_at_dev_queue_reset(dev, 0); + dev->process_cmd(dev); + dev->port->wantcmd = 0; + } else + dev->state = DEV_STATE_MAIN_2; + break; + case DEV_STATE_MAIN_2: + /* Output from scan queue if needed and then return to main loop #1. */ + if (*dev->scan && (dev->port->out_new == -1) && (dev->queue_start != dev->queue_end)) { + kbc_at_dev_log("%s %1: %02X (DATA) on channel 1\n", dev->name, dev->inst, dev->queue[dev->queue_start]); + dev->port->out_new = dev->queue[dev->queue_start]; + dev->queue_start = (dev->queue_start + 1) & 0xf; + } + if (!(*dev->scan) || dev->port->wantcmd) + dev->state = DEV_STATE_MAIN_1; + break; + case DEV_STATE_MAIN_OUT: + /* If host wants to send command while we're sending a byte to host, process the command. */ + if (dev->port->wantcmd) { + kbc_at_dev_log("%s: Processing keyboard command %02X...\n", dev->name, dev->port->dat); + kbc_at_dev_queue_reset(dev, 0); + dev->process_cmd(dev); + dev->port->wantcmd = 0; + break; + } + /* FALLTHROUGH */ + case DEV_STATE_MAIN_WANT_IN: + /* Output command response and then return to main loop #2. */ + if ((dev->port->out_new == -1) && (dev->cmd_queue_start != dev->cmd_queue_end)) { + kbc_at_dev_log("%s: %02X (CMD ) on channel 1\n", dev->name, dev->cmd_queue[dev->cmd_queue_start]); + dev->port->out_new = dev->cmd_queue[dev->cmd_queue_start]; + dev->cmd_queue_start = (dev->cmd_queue_start + 1) & 0xf; + } + if (dev->cmd_queue_start == dev->cmd_queue_end) + dev->state = (dev->state == DEV_STATE_MAIN_OUT) ? DEV_STATE_MAIN_2 : DEV_STATE_MAIN_IN; + break; + case DEV_STATE_MAIN_IN: + /* Wait for host data. */ + if (dev->port->wantcmd) { + kbc_at_dev_log("%s: Processing keyboard command %02X parameter %02X...\n", dev->name, dev->command, dev->port->dat); + kbc_at_dev_queue_reset(dev, 0); + dev->process_cmd(dev); + dev->port->wantcmd = 0; + } + break; + } +} + +void +kbc_at_dev_reset(atkbc_dev_t *dev, int do_fa) +{ + dev->port->out_new = -1; + dev->port->wantcmd = 0; + + kbc_at_dev_queue_reset(dev, 1); + + dev->last_scan_code = 0x00; + + *dev->scan = 1; + + if (do_fa) + kbc_at_dev_queue_add(dev, 0xfa, 0); + + dev->execute_bat(dev); + + dev->state = DEV_STATE_MAIN_OUT; +} + +atkbc_dev_t * +kbc_at_dev_init(uint8_t inst) +{ + atkbc_dev_t *dev; + + dev = (atkbc_dev_t *) malloc(sizeof(atkbc_dev_t)); + memset(dev, 0x00, sizeof(atkbc_dev_t)); + + dev->port = kbc_at_ports[inst]; + + if (dev->port != NULL) { + dev->port->priv = dev; + dev->port->poll = kbc_at_dev_poll; + } + + /* Return our private data to the I/O layer. */ + return (dev); +} From 333e9377ff54696ed2e7f81017fdf71b9ca10c37 Mon Sep 17 00:00:00 2001 From: OBattler Date: Thu, 20 Apr 2023 02:24:03 +0200 Subject: [PATCH 07/60] Some minor CPU bugfixes - one for 808x and one for the new dynarec. --- src/cpu/808x.c | 6 +++--- src/cpu/cpu.h | 4 ++++ 2 files changed, 7 insertions(+), 3 deletions(-) diff --git a/src/cpu/808x.c b/src/cpu/808x.c index b2859153a..1a842dd9c 100644 --- a/src/cpu/808x.c +++ b/src/cpu/808x.c @@ -426,13 +426,13 @@ pfq_write(void) free in the queue. */ tempw = readmemwf(pfq_ip); *(uint16_t *) &(pfq[pfq_pos]) = tempw; - pfq_ip += 2; + pfq_ip = (pfq_ip + 2) & 0xffff; pfq_pos += 2; } else if (!is8086 && (pfq_pos < pfq_size)) { /* The 8088 fetches 1 byte at a time, and only if there's at least 1 byte free in the queue. */ pfq[pfq_pos] = readmembf(pfq_ip); - pfq_ip++; + pfq_ip = (pfq_ip + 1) & 0xffff; pfq_pos++; } } @@ -2248,7 +2248,7 @@ execx86(int cycs) default: opcode = orig_opcode; - cpu_state.pc--; + cpu_state.pc = (cpu_state.pc - 1) & 0xffff; break; } } else diff --git a/src/cpu/cpu.h b/src/cpu/cpu.h index 229fcb9bb..93dae98d1 100644 --- a/src/cpu/cpu.h +++ b/src/cpu/cpu.h @@ -416,7 +416,11 @@ typedef struct { #define CPU_STATUS_PMODE (1 << 2) #define CPU_STATUS_V86 (1 << 3) #define CPU_STATUS_SMM (1 << 4) +#ifdef USE_NEW_DYNAREC +#define CPU_STATUS_FLAGS 0xff +#else #define CPU_STATUS_FLAGS 0xffff +#endif /*If the cpu_state.flags below are set in cpu_cur_status, they must be set in block->status. Otherwise they are ignored*/ From 0458034cbfb71d06692c9e674a1eb82ed651881e Mon Sep 17 00:00:00 2001 From: OBattler Date: Thu, 20 Apr 2023 14:28:37 +0200 Subject: [PATCH 08/60] Some clean-ups. --- src/device/keyboard_at.c | 89 +++++++++++++----------------------- src/device/mouse_ps2.c | 26 +++++------ src/include/86box/keyboard.h | 13 ++---- 3 files changed, 50 insertions(+), 78 deletions(-) diff --git a/src/device/keyboard_at.c b/src/device/keyboard_at.c index ab1980b72..886016023 100644 --- a/src/device/keyboard_at.c +++ b/src/device/keyboard_at.c @@ -69,6 +69,8 @@ uint8_t keyboard_mode = 0x02; static atkbc_dev_t *SavedKbd = NULL; +static uint8_t inv_cmd_response = 0xfa; + static const scancode scancode_set1[512] = { // clang-format off { { 0},{ 0} }, { { 0x01,0},{ 0x81,0} }, { { 0x02,0},{ 0x82,0} }, { { 0x03,0},{ 0x83,0} }, /*000*/ @@ -685,7 +687,6 @@ static void keyboard_at_set_defaults(atkbc_dev_t *dev) { dev->rate = 1; - dev->flags &= FLAG_ENABLED; keyboard_set3_all_break = 0; keyboard_set3_all_repeat = 0; @@ -703,7 +704,6 @@ keyboard_at_bat(void *priv) keyboard_at_set_defaults(dev); keyboard_scan = 1; - dev->flags |= FLAG_ENABLED; kbc_at_dev_queue_add(dev, 0xaa, 0); } @@ -711,18 +711,10 @@ keyboard_at_bat(void *priv) static void keyboard_at_invalid_cmd(atkbc_dev_t *dev) { - /* The AT firmware sends FA on unknown but semantically valid (ie. >= 0xED) commands. */ - keyboard_at_log("%s: Invalid AT command [%02X]\n", dev->name, dev->port->dat); - kbc_at_dev_queue_add(dev, 0xfa, 0); + keyboard_at_log("%s: Invalid command [%02X]\n", dev->name, dev->port->dat); + kbc_at_dev_queue_add(dev, inv_cmd_response, 0); } -static void -keyboard_ps2_invalid_cmd(atkbc_dev_t *dev) -{ - /* Send FE on unknown/invalid command per the PS/2 technical reference. */ - keyboard_at_log("%s: Invalid PS/2 command [%02X]\n", dev->name, dev->port->dat); - kbc_at_dev_queue_add(dev, 0xfe, 0); -} static void keyboard_at_write(void *priv) @@ -748,20 +740,22 @@ keyboard_at_write(void *priv) case 0xf0: /* Get/set scancode set */ kbc_at_dev_queue_add(dev, (val > 3) ? 0xfe : 0xfa, 0); - if (val == 0) { - keyboard_at_log("%s: Get scan code set [%02X]\n", dev->name, keyboard_mode); - kbc_at_dev_queue_add(dev, keyboard_mode, 0); - } else { - if (val <= 3) { + switch (val) { + case 0x00: + keyboard_at_log("%s: Get scan code set [%02X]\n", dev->name, keyboard_mode); + kbc_at_dev_queue_add(dev, keyboard_mode, 0); + break; + case 0x01 ... 0x03: keyboard_mode = val; keyboard_at_log("%s: Set scan code set [%02X]\n", dev->name, keyboard_mode); keyboard_at_set_scancode_set(); - } else { + break; + default: /* Fatal so any instance of anything attempting to set scan code > 3 can be reported to us. */ fatal("%s: Scan code set [%02X] invalid, resend\n", dev->name, val); dev->flags |= FLAG_CTRLDAT; dev->state = DEV_STATE_MAIN_WANT_IN; - } + break; } break; @@ -784,23 +778,14 @@ keyboard_at_write(void *priv) } } else { if (dev->flags & FLAG_CTRLDAT) { - if (val == 0xfe) { - /* Special case - resend last scan code command during another command that wants - input - output as normal but do not cancel the command (so keep waiting for - input). */ - keyboard_at_log("%s: resend last scan code during command [%02X]\n", dev->name, dev->command); + /* Special case - another command during another command that wants input - proceed + as normal but do not cancel the command (so keep waiting for input), unless the + command in progress is ED (Set/reset LEDs). */ + if (val == 0xed) { + keyboard_scan = 1; + dev->flags &= ~FLAG_CTRLDAT; + } else dev->state = DEV_STATE_MAIN_WANT_IN; - kbc_at_dev_queue_add(dev, 0xfa, dev->last_scan_code); - } else { - /* Special case - another command during another command that wants input - proceed - as normal but do not cancel the command (so keep waiting for input), unless the - command in progress is ED (Set/reset LEDs). */ - if (dev->command == 0xed) { - keyboard_scan = 1; - dev->flags &= ~FLAG_CTRLDAT; - } else - dev->state = DEV_STATE_MAIN_WANT_IN; - } } dev->command = val; @@ -820,10 +805,8 @@ keyboard_at_write(void *priv) case 0xef: /* Invalid command */ case 0xf1: /* Invalid command */ - if (dev->type & FLAG_PS2) - keyboard_ps2_invalid_cmd(dev); - else - keyboard_at_invalid_cmd(dev); + keyboard_at_log("%s: Invalid command [%02X]\n", dev->name, dev->port->dat); + kbc_at_dev_queue_add(dev, inv_cmd_response, 0); break; case 0xf0: /* get/set scan code set */ @@ -858,7 +841,6 @@ keyboard_at_write(void *priv) case 0xf4: /* enable */ keyboard_at_log("%s: enable keyboard\n", dev->name); - dev->flags |= FLAG_ENABLED; keyboard_scan = 1; kbc_at_dev_queue_add(dev, 0xfa, 0); break; @@ -866,7 +848,7 @@ keyboard_at_write(void *priv) case 0xf5: /* set defaults and disable keyboard */ case 0xf6: /* set defaults */ keyboard_at_log("%s: set defaults%s\n", (val == 0xf6) ? "" : " and disable keyboard"); - keyboard_scan = (val == 0xf6); + keyboard_scan = !(val & 0x01); keyboard_at_log("%s: val = %02X, keyboard_scan = %i\n", dev->name, val, keyboard_scan); kbc_at_dev_queue_add(dev, 0xfa, 0); @@ -918,33 +900,24 @@ keyboard_at_write(void *priv) /* TODO: Actually implement these commands. */ case 0xfb: /* set some keys to repeat */ - if (dev->type & FLAG_PS2) { - keyboard_at_log("%s: set some keys to repeat\n", dev->name); - kbc_at_dev_queue_add(dev, 0xfe, 0); - } else - keyboard_at_invalid_cmd(dev); + keyboard_at_log("%s: set some keys to repeat\n", dev->name); + kbc_at_dev_queue_add(dev, inv_cmd_response, 0); break; case 0xfc: /* set some keys to give make/break codes */ - if (dev->type & FLAG_PS2) { - keyboard_at_log("%s: set some keys to give make/break codes\n", dev->name); - kbc_at_dev_queue_add(dev, 0xfe, 0); - } else - keyboard_at_invalid_cmd(dev); + keyboard_at_log("%s: set some keys to give make/break codes\n", dev->name); + kbc_at_dev_queue_add(dev, inv_cmd_response, 0); break; case 0xfd: /* set some keys to give make codes only */ - if (dev->type & FLAG_PS2) { - keyboard_at_log("%s: set some keys to give make codes only\n", dev->name); - kbc_at_dev_queue_add(dev, 0xfe, 0); - } else - keyboard_at_invalid_cmd(dev); + keyboard_at_log("%s: set some keys to give make codes only\n", dev->name); + kbc_at_dev_queue_add(dev, inv_cmd_response, 0); break; /* TODO: This is supposed to resend multiple bytes after some commands. */ case 0xfe: /* resend last scan code */ keyboard_at_log("%s: resend last scan code\n", dev->name); - kbc_at_dev_queue_add(dev, 0xfa, dev->last_scan_code); + kbc_at_dev_queue_add(dev, dev->last_scan_code, 0); break; case 0xff: /* reset */ @@ -992,6 +965,8 @@ keyboard_at_init(const device_t *info) keyboard_send = add_data_kbd; SavedKbd = dev; + inv_cmd_response = (dev->type & FLAG_PS2) ? 0xfe : 0xfa; + /* Return our private data to the I/O layer. */ return (dev); } diff --git a/src/device/mouse_ps2.c b/src/device/mouse_ps2.c index eae528058..4027c6173 100644 --- a/src/device/mouse_ps2.c +++ b/src/device/mouse_ps2.c @@ -134,7 +134,7 @@ ps2_set_defaults(atkbc_dev_t *dev) { dev->mode = MODE_STREAM; dev->rate = 1; - dev->flags &= (0x88 | FLAG_ENABLED); + dev->flags &= 0x88; } static void @@ -145,7 +145,6 @@ ps2_bat(void *priv) ps2_set_defaults(dev); mouse_scan = 1; - dev->flags |= FLAG_ENABLED; kbc_at_dev_queue_add(dev, 0xaa, 0); kbc_at_dev_queue_add(dev, 0x00, 0); @@ -156,6 +155,7 @@ ps2_write(void *priv) { atkbc_dev_t *dev = (atkbc_dev_t *) priv; uint8_t temp, val; + static uint8_t last_data[6] = { 0x00 }; if (dev->port == NULL) return; @@ -211,7 +211,9 @@ ps2_write(void *priv) case 0xe9: /* status request */ mouse_ps2_log("%s: Status request\n", dev->name); kbc_at_dev_queue_add(dev, 0xfa, 0); - temp = (dev->flags & 0x30); + temp = (dev->flags & 0x20); + if (mouse_scan) + temp |= FLAG_ENABLED; if (mouse_buttons & 1) temp |= 4; if (mouse_buttons & 2) @@ -255,14 +257,12 @@ ps2_write(void *priv) case 0xf4: /* enable */ mouse_ps2_log("%s: Enable\n", dev->name); - dev->flags |= FLAG_ENABLED; mouse_scan = 1; kbc_at_dev_queue_add(dev, 0xfa, 0); break; case 0xf5: /* disable */ mouse_ps2_log("%s: Disable\n", dev->name); - dev->flags &= ~FLAG_ENABLED; mouse_scan = 0; kbc_at_dev_queue_add(dev, 0xfa, 0); break; @@ -285,19 +285,19 @@ ps2_write(void *priv) if (dev->flags & FLAG_INTELLI) { for (temp = 0; temp < 5; temp++) - dev->last_data[temp] = dev->last_data[temp + 1]; + last_data[temp] = last_data[temp + 1]; - dev->last_data[5] = val; + last_data[5] = val; - if ((dev->last_data[0] == 0xf3) && (dev->last_data[1] == 0xc8) && - (dev->last_data[2] == 0xf3) && (dev->last_data[3] == 0x64) && - (dev->last_data[4] == 0xf3) && (dev->last_data[5] == 0x50)) + if ((last_data[0] == 0xf3) && (last_data[1] == 0xc8) && + (last_data[2] == 0xf3) && (last_data[3] == 0x64) && + (last_data[4] == 0xf3) && (last_data[5] == 0x50)) dev->flags |= FLAG_INTMODE; if ((dev->flags & FLAG_EXPLORER) && (dev->flags & FLAG_INTMODE) && - (dev->last_data[0] == 0xf3) && (dev->last_data[1] == 0xc8) && - (dev->last_data[2] == 0xf3) && (dev->last_data[3] == 0xc8) && - (dev->last_data[4] == 0xf3) && (dev->last_data[5] == 0x50)) + (last_data[0] == 0xf3) && (last_data[1] == 0xc8) && + (last_data[2] == 0xf3) && (last_data[3] == 0xc8) && + (last_data[4] == 0xf3) && (last_data[5] == 0x50)) dev->flags |= FLAG_5BTN; } } diff --git a/src/include/86box/keyboard.h b/src/include/86box/keyboard.h index 08a425f6d..6dec8a6db 100644 --- a/src/include/86box/keyboard.h +++ b/src/include/86box/keyboard.h @@ -38,9 +38,9 @@ enum { /* Used by the AT / PS/2 keyboard controller, common device, keyboard, and mouse. */ typedef struct { - uint8_t wantcmd, dat, pad, pad0; + uint8_t wantcmd, dat; - int out_new; + int16_t out_new; void *priv; @@ -51,12 +51,9 @@ typedef struct { typedef struct { const char *name; /* name of this device */ - uint8_t type, inst, command, wantdata, - last_scan_code, state, resolution, rate, - cmd_queue_start, cmd_queue_end, queue_start, queue_end; - - /* 6 bytes needed for mouse */ - uint8_t last_data[6]; + uint8_t type, command, last_scan_code, state, + resolution, rate, cmd_queue_start, cmd_queue_end, + queue_start, queue_end; uint16_t flags; From 634ecfeab9441a8ce78419c50e833ec611dbdbd6 Mon Sep 17 00:00:00 2001 From: OBattler Date: Thu, 20 Apr 2023 14:50:44 +0200 Subject: [PATCH 09/60] More clean-ups. --- src/device/kbc_at.c | 148 +++++++++++++++++++++++--------------------- 1 file changed, 79 insertions(+), 69 deletions(-) diff --git a/src/device/kbc_at.c b/src/device/kbc_at.c index 7026815a4..287d8b4d0 100644 --- a/src/device/kbc_at.c +++ b/src/device/kbc_at.c @@ -133,6 +133,11 @@ typedef struct { /* Keyboard controller ports. */ kbc_at_port_t *kbc_at_ports[2] = { NULL, NULL }; +static uint8_t kbc_ami_revision = '8'; +static uint8_t kbc_award_revision = 0x42; + +static void (*kbc_at_do_poll)(atkbc_t *dev); + /* Non-translated to translated scan codes. */ static const uint8_t nont_to_t[256] = { 0xff, 0x43, 0x41, 0x3f, 0x3d, 0x3b, 0x3c, 0x58, @@ -619,17 +624,13 @@ kbc_at_poll(void *priv) timer_advance_u64(&dev->send_delay_timer, (100ULL * TIMER_USEC)); - /* TODO: Use a fuction pointer for this (also needed to the AMI KBC mode switching) - and implement the password security state. */ - if (dev->misc_flags & FLAG_PS2) - kbc_at_poll_ps2(dev); - else - kbc_at_poll_at(dev); + /* TODO: Implement the password security state. */ + kbc_at_do_poll(dev); if ((kbc_at_ports[0] != NULL) && (kbc_at_ports[0]->priv != NULL)) kbc_at_ports[0]->poll(kbc_at_ports[0]->priv); - if ((dev->misc_flags & FLAG_PS2) && (kbc_at_ports[1] != NULL) && (kbc_at_ports[1]->priv != NULL)) + if ((kbc_at_ports[1] != NULL) && (kbc_at_ports[1]->priv != NULL)) kbc_at_ports[1]->poll(kbc_at_ports[1]->priv); } @@ -793,7 +794,7 @@ write64_generic(void *priv, uint8_t val) case 0xaf: /* read keyboard version */ kbc_at_log("ATkbc: read keyboard version\n"); - add_to_kbc_queue_front(dev, 0x42, 0, 0x00); + add_to_kbc_queue_front(dev, kbc_award_revision, 0, 0x00); return 0; case 0xc0: /* read P1 */ @@ -806,7 +807,6 @@ write64_generic(void *priv, uint8_t val) current_drive = fdc_get_current_drive(); add_to_kbc_queue_front(dev, dev->p1 | fixed_bits | (fdd_is_525(current_drive) ? 0x40 : 0x00), 0, 0x00); - dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc) | (fdd_is_525(current_drive) ? 0x40 : 0x00); } else if (kbc_ven == KBC_VEN_NCR) { /* switch settings * bit 7: keyboard disable @@ -820,28 +820,20 @@ write64_generic(void *priv, uint8_t val) */ add_to_kbc_queue_front(dev, (dev->p1 | fixed_bits | (video_is_mda() ? 0x40 : 0x00) | (hasfpu ? 0x08 : 0x00)) & 0xdf, 0, 0x00); - dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc); - } else { - if ((kbc_ven == KBC_VEN_TG) || (kbc_ven == KBC_VEN_TG_GREEN)) { - /* Bit 3, 2: - 1, 1: TriGem logo; - 1, 0: Garbled logo; - 0, 1: Epson logo; - 0, 0: Generic AMI logo. */ - if (dev->misc_flags & FLAG_PCI) - fixed_bits |= 8; - add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); - } else if (((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) && ((dev->flags & KBC_VEN_MASK) != KBC_VEN_INTEL_AMI)) -#if 0 - add_to_kbc_queue_front(dev, (dev->p1 | fixed_bits) & - (((dev->flags & KBC_VEN_MASK) == KBC_VEN_ACER) ? 0xeb : 0xef), 0, 0x00); -#else - add_to_kbc_queue_front(dev, ((dev->p1 | fixed_bits) & 0xf0) | (((dev->flags & KBC_VEN_MASK) == KBC_VEN_ACER) ? 0x08 : 0x0c), 0, 0x00); -#endif - else - add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); - dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc); - } + } else if ((kbc_ven == KBC_VEN_TG) || (kbc_ven == KBC_VEN_TG_GREEN)) { + /* Bit 3, 2: + 1, 1: TriGem logo; + 1, 0: Garbled logo; + 0, 1: Epson logo; + 0, 0: Generic AMI logo. */ + if (dev->misc_flags & FLAG_PCI) + fixed_bits |= 8; + add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); + } else if (((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) && ((dev->flags & KBC_VEN_MASK) != KBC_VEN_INTEL_AMI)) + add_to_kbc_queue_front(dev, ((dev->p1 | fixed_bits) & 0xf0) | (((dev->flags & KBC_VEN_MASK) == KBC_VEN_ACER) ? 0x08 : 0x0c), 0, 0x00); + else + add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); + dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc); return 0; case 0xd3: /* write auxiliary output buffer */ @@ -910,8 +902,11 @@ write60_ami(void *priv, uint8_t val) kbc_at_log("ATkbc: AMI - set keyboard mode\n"); dev->ami_flags = val; dev->misc_flags &= ~FLAG_PS2; - if (val & 0x01) + if (val & 0x01) { dev->misc_flags |= FLAG_PS2; + kbc_at_do_poll = kbc_at_poll_ps2; + } else + kbc_at_do_poll = kbc_at_poll_at; return 0; } @@ -944,28 +939,7 @@ write64_ami(void *priv, uint8_t val) case 0xa1: /* get controller version */ kbc_at_log("ATkbc: AMI - get controller version\n"); - if ((kbc_ven == KBC_VEN_TG) || (kbc_ven == KBC_VEN_TG_GREEN)) - add_to_kbc_queue_front(dev, 'Z', 0, 0x00); - else if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { - if (kbc_ven == KBC_VEN_ALI) - add_to_kbc_queue_front(dev, 'F', 0, 0x00); - else if ((dev->flags & KBC_VEN_MASK) == KBC_VEN_INTEL_AMI) - add_to_kbc_queue_front(dev, '5', 0, 0x00); - else if (cpu_64bitbus) - add_to_kbc_queue_front(dev, 'R', 0, 0x00); - else if (is486) - add_to_kbc_queue_front(dev, 'P', 0, 0x00); - else - add_to_kbc_queue_front(dev, 'H', 0, 0x00); - } else if (is386 && !is486) { - if (cpu_16bitbus) - add_to_kbc_queue_front(dev, 'D', 0, 0x00); - else - add_to_kbc_queue_front(dev, 'B', 0, 0x00); - } else if (!is386) - add_to_kbc_queue_front(dev, '8', 0, 0x00); - else - add_to_kbc_queue_front(dev, 'F', 0, 0x00); + add_to_kbc_queue_front(dev, kbc_ami_revision, 0, 0x00); return 0; case 0xa2: /* clear keyboard controller lines P22/P23 */ @@ -1038,16 +1012,14 @@ write64_ami(void *priv, uint8_t val) break; case 0xaf: /* set extended controller RAM */ - if (kbc_ven == KBC_VEN_ALI) { - kbc_at_log("ATkbc: Award/ALi/VIA keyboard controller revision\n"); - add_to_kbc_queue_front(dev, 0x43, 0, 0x00); - } else { + if (kbc_ven != KBC_VEN_ALI) { kbc_at_log("ATkbc: set extended controller RAM\n"); dev->wantdata = 1; dev->state = STATE_KBC_PARAM; dev->command_phase = 1; + return 0; } - return 0; + break; case 0xb0 ... 0xb3: /* set KBC lines P10-P13 (P1 bits 0-3) low */ @@ -1373,15 +1345,11 @@ kbc_at_process_cmd(void *priv) dev->status = (dev->status & 0x0f) | 0x60; dev->mem[0x20] = 0x30; - dev->mem[0x21] = 0x01; dev->mem[0x22] = 0x0b; dev->mem[0x25] = 0x02; dev->mem[0x27] = 0xf8; dev->mem[0x28] = 0xce; dev->mem[0x29] = 0x0b; - dev->mem[0x2a] = 0x10; - dev->mem[0x2b] = 0x20; - dev->mem[0x2c] = 0x15; dev->mem[0x30] = 0x0b; } else { if (dev->state != STATE_RESET) { @@ -1395,17 +1363,18 @@ kbc_at_process_cmd(void *priv) dev->status = (dev->status & 0x0f) | 0x60; dev->mem[0x20] = 0x10; - dev->mem[0x21] = 0x01; dev->mem[0x22] = 0x06; dev->mem[0x25] = 0x01; dev->mem[0x27] = 0xfb; dev->mem[0x28] = 0xe0; dev->mem[0x29] = 0x06; - dev->mem[0x2a] = 0x10; - dev->mem[0x2b] = 0x20; - dev->mem[0x2c] = 0x15; } + dev->mem[0x21] = 0x01; + dev->mem[0x2a] = 0x10; + dev->mem[0x2b] = 0x20; + dev->mem[0x2c] = 0x15; + if (dev->ports[0] != NULL) dev->ports[0]->out_new = -1; if (dev->ports[1] != NULL) @@ -1699,9 +1668,14 @@ kbc_at_reset(void *priv) dev->sc_or = 0; dev->ami_flags = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) ? 0x01 : 0x00; + dev->misc_flags = 0x00; - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) + if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { dev->misc_flags |= FLAG_PS2; + kbc_at_do_poll = kbc_at_poll_ps2; + } else + kbc_at_do_poll = kbc_at_poll_at; + dev->misc_flags |= FLAG_CACHE; dev->p2 = 0xcd; @@ -1763,6 +1737,9 @@ kbc_at_init(const device_t *info) dev->write60_ven = NULL; dev->write64_ven = NULL; + kbc_ami_revision = '8'; + kbc_award_revision = 0x42; + switch (dev->flags & KBC_VEN_MASK) { case KBC_VEN_ACER: case KBC_VEN_GENERIC: @@ -1775,11 +1752,44 @@ kbc_at_init(const device_t *info) dev->write64_ven = write64_olivetti; break; - case KBC_VEN_AMI: case KBC_VEN_INTEL_AMI: + kbc_ami_revision = '5'; + dev->write60_ven = write60_ami; + dev->write64_ven = write64_ami; + break; + case KBC_VEN_ALI: + kbc_ami_revision = 'F'; + kbc_award_revision = 0x43; + dev->write60_ven = write60_ami; + dev->write64_ven = write64_ami; + break; + case KBC_VEN_TG: case KBC_VEN_TG_GREEN: + kbc_ami_revision = 'Z'; + dev->write60_ven = write60_ami; + dev->write64_ven = write64_ami; + break; + + case KBC_VEN_AMI: + if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { + if (cpu_64bitbus) + kbc_ami_revision = 'R'; + else if (is486) + kbc_ami_revision = 'P'; + else + kbc_ami_revision = 'H'; + } else if (is386 && !is486) { + if (cpu_16bitbus) + kbc_ami_revision = 'D'; + else + kbc_ami_revision = 'B'; + } else if (!is386) + kbc_ami_revision = '8'; + else + kbc_ami_revision = 'F'; + dev->write60_ven = write60_ami; dev->write64_ven = write64_ami; break; From 041e916472c0e71cf65774aa1ddf02bd564a17b6 Mon Sep 17 00:00:00 2001 From: OBattler Date: Thu, 20 Apr 2023 15:05:51 +0200 Subject: [PATCH 10/60] AS small optimization. --- src/device/kbc_at_dev.c | 2 +- src/include/86box/keyboard.h | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/src/device/kbc_at_dev.c b/src/device/kbc_at_dev.c index a2baa21a0..87fdd51c6 100644 --- a/src/device/kbc_at_dev.c +++ b/src/device/kbc_at_dev.c @@ -144,7 +144,7 @@ kbc_at_dev_poll(void *priv) dev->cmd_queue_start = (dev->cmd_queue_start + 1) & 0xf; } if (dev->cmd_queue_start == dev->cmd_queue_end) - dev->state = (dev->state == DEV_STATE_MAIN_OUT) ? DEV_STATE_MAIN_2 : DEV_STATE_MAIN_IN; + dev->state++; break; case DEV_STATE_MAIN_IN: /* Wait for host data. */ diff --git a/src/include/86box/keyboard.h b/src/include/86box/keyboard.h index 6dec8a6db..6f7517e9d 100644 --- a/src/include/86box/keyboard.h +++ b/src/include/86box/keyboard.h @@ -29,9 +29,9 @@ enum { enum { DEV_STATE_MAIN_1 = 0, + DEV_STATE_MAIN_OUT, DEV_STATE_MAIN_2, DEV_STATE_MAIN_CMD, - DEV_STATE_MAIN_OUT, DEV_STATE_MAIN_WANT_IN, DEV_STATE_MAIN_IN }; From 3aa34f3bca35cce5b9767652d1ee2043ebf8f047 Mon Sep 17 00:00:00 2001 From: Dungeonseeker Date: Fri, 21 Apr 2023 10:53:54 +0100 Subject: [PATCH 11/60] Update README.md Add linbox-qt5 to README.md --- README.md | 1 + 1 file changed, 1 insertion(+) diff --git a/README.md b/README.md index a1e3985e1..66dc21402 100644 --- a/README.md +++ b/README.md @@ -28,6 +28,7 @@ It is also recommended to use a manager application with 86Box for easier handli * [86Box Manager](https://github.com/86Box/86BoxManager) by [Overdoze](https://github.com/daviunic) (Windows only) * [86Box Manager Lite](https://github.com/insanemal/86box_manager_py) by [Insanemal](https://github.com/insanemal) * [WinBox for 86Box](https://github.com/86Box/WinBox-for-86Box) by Laci bá' (Windows only) +* [Linbox-qt5](https://github.com/Dungeonseeker/linbox-qt5) by Dungeonseeker (Linux focused, should work on Windows though untested) It is also possible to use 86Box on its own with the `--vmpath`/`-P` command line option. From 5d9de974ee186d93ad3c75405dff15082b4aa760 Mon Sep 17 00:00:00 2001 From: OBattler Date: Sat, 22 Apr 2023 03:48:50 +0200 Subject: [PATCH 12/60] More keyboard controller clean-ups and fixes to mem/mem.c and port_92.c - OS/2 1.3 now works on IBM PS/2 MCA machines. --- src/device/kbc_at.c | 225 +++++++++++++++++++---------------- src/include/86box/keyboard.h | 1 - src/machine/m_ps2_mca.c | 6 +- src/mem/mem.c | 2 +- src/port_92.c | 20 +++- 5 files changed, 142 insertions(+), 112 deletions(-) diff --git a/src/device/kbc_at.c b/src/device/kbc_at.c index 287d8b4d0..2c9433bd9 100644 --- a/src/device/kbc_at.c +++ b/src/device/kbc_at.c @@ -64,25 +64,22 @@ #define MODE_MASK 0x6c #define KBC_TYPE_ISA 0x00 /* AT ISA-based chips */ -#define KBC_TYPE_PS2_NOREF 0x01 /* PS2 type, no refresh */ -#define KBC_TYPE_PS2_1 0x02 /* PS2 on PS/2, type 1 */ -#define KBC_TYPE_PS2_2 0x03 /* PS2 on PS/2, type 2 */ +#define KBC_TYPE_PS2_1 0x01 /* PS2 on PS/2, type 1 */ +#define KBC_TYPE_PS2_2 0x02 /* PS2 on PS/2, type 2 */ +#define KBC_TYPE_GREEN 0x03 /* PS2 green controller */ #define KBC_TYPE_MASK 0x03 #define KBC_VEN_GENERIC 0x00 -#define KBC_VEN_AMI 0x04 -#define KBC_VEN_IBM_MCA 0x08 -#define KBC_VEN_QUADTEL 0x0c -#define KBC_VEN_TOSHIBA 0x10 -#define KBC_VEN_IBM_PS1 0x14 -#define KBC_VEN_ACER 0x18 -#define KBC_VEN_INTEL_AMI 0x1c -#define KBC_VEN_OLIVETTI 0x20 +#define KBC_VEN_IBM_PS1 0x04 +#define KBC_VEN_TOSHIBA 0x08 +#define KBC_VEN_OLIVETTI 0x0c +#define KBC_VEN_AMI 0x10 +#define KBC_VEN_TRIGEM_AMI 0x14 +#define KBC_VEN_QUADTEL 0x18 +#define KBC_VEN_PHOENIX 0x1c +#define KBC_VEN_ACER 0x20 #define KBC_VEN_NCR 0x24 -#define KBC_VEN_PHOENIX 0x28 -#define KBC_VEN_ALI 0x2c -#define KBC_VEN_TG 0x30 -#define KBC_VEN_TG_GREEN 0x34 +#define KBC_VEN_ALI 0x28 #define KBC_VEN_MASK 0x3c #define FLAG_CLOCK 0x01 @@ -210,6 +207,7 @@ kbc_at_queue_add(atkbc_t *dev, uint8_t val) static int kbc_translate(atkbc_t *dev, uint8_t val) { + /* TODO: Does the IBM AT keyboard controller firmware apply translation in XT mode or not? */ int xt_mode = (dev->mem[0x20] & 0x20) && !(dev->misc_flags & FLAG_PS2); int translate = (dev->mem[0x20] & 0x40) || xt_mode || ((dev->flags & KBC_TYPE_MASK) == KBC_TYPE_PS2_2); uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; @@ -308,8 +306,8 @@ add_to_kbc_queue_front(atkbc_t *dev, uint8_t val, uint8_t channel, uint8_t stat_ if (temp == -1) return; - if ((kbc_ven == KBC_VEN_AMI) || (kbc_ven == KBC_VEN_TG) || - (kbc_ven == KBC_VEN_TG_GREEN) || (dev->misc_flags & FLAG_PS2)) + if ((kbc_ven == KBC_VEN_AMI) || (kbc_ven == KBC_VEN_TRIGEM_AMI) || + (dev->misc_flags & FLAG_PS2)) stat_hi |= ((dev->p1 & 0x80) ? 0x10 : 0x00); else stat_hi |= 0x10; @@ -675,7 +673,7 @@ write_p2(atkbc_t *dev, uint8_t val) coreboot machines. */ pc_reset_hard(); } else { - softresetx86(); /*Pulse reset!*/ + softresetx86(); /* Pulse reset! */ cpu_set_edx(); flushmmucache(); if (kbc_ven == KBC_VEN_ALI) @@ -797,11 +795,59 @@ write64_generic(void *priv, uint8_t val) add_to_kbc_queue_front(dev, kbc_award_revision, 0, 0x00); return 0; + /* + P1 bits: 76543210 + ----------------- + IBM PS/1: xxxxxxxx + IBM PS/2 MCA: xxxxx1xx + Intel AMI Pentium BIOS'es with AMI MegaKey KB-5 keyboard controller: x1x1xxxx + Acer: xxx0x0xx + Packard Bell PB450: xxxxx1xx + P6RP4: xx1xx1xx + Epson Action Tower 2600: xxxx01xx + TriGem Hawk: xxxx11xx + + Bit 7: AT KBC only - keyboard inhibited (often physical lock): 0 = yes, 1 = no (also Compaq); + Bit 6: Mostly, display: 0 = CGA, 1 = MDA, inverted on Xi8088 and Acer KBC's; + Intel AMI MegaKey KB-5: Used for green features, SMM handler expects it to be set; + IBM PS/1 Model 2011: 0 = current FDD is 3.5", 1 = current FDD is 5.25"; + Comapq: 0 = Compaq dual-scan display, 1 = non-Compaq display. + Bit 5: Mostly, manufacturing jumper: 0 = installed (infinite loop at POST), 1 = not installed; + NCR: power-on default speed: 0 = high, 1 = low; + Compaq: System board DIP switch 5: 0 = ON, 1 = OFF. + Bit 4: (Which board?): RAM on motherboard: 0 = 512 kB, 1 = 256 kB; + NCR: RAM on motherboard: 0 = unsupported, 1 = 512 kB; + Acer: Must be 0; + Intel AMI MegaKey KB-5: Must be 1; + IBM PS/1: Ignored; + Compaq: 0 = Auto speed selected, 1 = High speed selected. + Bit 3: TriGem AMIKey: most significant bit of 2-bit OEM ID; + NCR: Coprocessor detect (1 = yes, 0 = no); + Compaq: 0 = Slow (4 MHz), 1 = Fast (8 MHz); + Sometimes configured for clock switching; + Bit 2: TriGem AMIKey: least significant bit of 2-bit OEM ID; + Bit 3, 2: + 1, 1: TriGem logo; + 1, 0: Garbled logo; + 0, 1: Epson logo; + 0, 0: Generic AMI logo. + NCR: Unused; + IBM PS/2: Keyboard power: 0 = no power (fuse error), 1 = OK + (for some reason, www.win.tue.nl has this in reverse); + Compaq: FPU: 0 = 80287, 1 = none; + Sometimes configured for clock switching; + Bit 1: PS/2: Auxiliary device data in; + Compaq: Reserved; + NCR: High/auto speed. + Bit 0: PS/2: Keyboard device data in; + Compaq: Reserved; + NCR: DMA mode. + */ case 0xc0: /* read P1 */ kbc_at_log("ATkbc: read P1\n"); fixed_bits = 4; /* The SMM handlers of Intel AMI Pentium BIOS'es expect bit 6 to be set. */ - if (kbc_ven == KBC_VEN_INTEL_AMI) + if ((kbc_ven == KBC_VEN_AMI) && ((dev->flags & KBC_TYPE_MASK) == KBC_TYPE_GREEN)) fixed_bits |= 0x40; if (kbc_ven == KBC_VEN_IBM_PS1) { current_drive = fdc_get_current_drive(); @@ -820,7 +866,7 @@ write64_generic(void *priv, uint8_t val) */ add_to_kbc_queue_front(dev, (dev->p1 | fixed_bits | (video_is_mda() ? 0x40 : 0x00) | (hasfpu ? 0x08 : 0x00)) & 0xdf, 0, 0x00); - } else if ((kbc_ven == KBC_VEN_TG) || (kbc_ven == KBC_VEN_TG_GREEN)) { + } else if (kbc_ven == KBC_VEN_TRIGEM_AMI) { /* Bit 3, 2: 1, 1: TriGem logo; 1, 0: Garbled logo; @@ -829,13 +875,31 @@ write64_generic(void *priv, uint8_t val) if (dev->misc_flags & FLAG_PCI) fixed_bits |= 8; add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); - } else if (((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) && ((dev->flags & KBC_VEN_MASK) != KBC_VEN_INTEL_AMI)) + } else if (((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) && ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_GREEN)) add_to_kbc_queue_front(dev, ((dev->p1 | fixed_bits) & 0xf0) | (((dev->flags & KBC_VEN_MASK) == KBC_VEN_ACER) ? 0x08 : 0x0c), 0, 0x00); else add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc); return 0; + case 0xc1: /*Copy bits 0 to 3 of P1 to status bits 4 to 7*/ + if (dev->misc_flags & FLAG_PS2) { + kbc_at_log("ATkbc: copy bits 0 to 3 of P1 to status bits 4 to 7\n"); + dev->status &= 0x0f; + dev->status |= (dev->p1 << 4); + return 0; + } + break; + + case 0xc2: /*Copy bits 4 to 7 of P1 to status bits 4 to 7*/ + if (dev->misc_flags & FLAG_PS2) { + kbc_at_log("ATkbc: copy bits 4 to 7 of P1 to status bits 4 to 7\n"); + dev->status &= 0x0f; + dev->status |= (dev->p1 & 0xf0); + return 0; + } + break; + case 0xd3: /* write auxiliary output buffer */ if (dev->misc_flags & FLAG_PS2) { kbc_at_log("ATkbc: write auxiliary output buffer\n"); @@ -903,10 +967,13 @@ write60_ami(void *priv, uint8_t val) dev->ami_flags = val; dev->misc_flags &= ~FLAG_PS2; if (val & 0x01) { + kbc_at_log("ATkbc: AMI: Emulate PS/2 keyboard\n"); dev->misc_flags |= FLAG_PS2; kbc_at_do_poll = kbc_at_poll_ps2; - } else + } else { + kbc_at_log("ATkbc: AMI: Emulate AT keyboard\n"); kbc_at_do_poll = kbc_at_poll_at; + } return 0; } @@ -1112,37 +1179,6 @@ write64_ami(void *priv, uint8_t val) return write64_generic(dev, val); } -static uint8_t -write64_ibm_mca(void *priv, uint8_t val) -{ - atkbc_t *dev = (atkbc_t *) priv; - - switch (val) { - case 0xc1: /*Copy bits 0 to 3 of P1 to status bits 4 to 7*/ - kbc_at_log("ATkbc: copy bits 0 to 3 of P1 to status bits 4 to 7\n"); - dev->status &= 0x0f; - dev->status |= ((((dev->p1 & 0xfc) | 0x84) & 0x0f) << 4); - return 0; - - case 0xc2: /*Copy bits 4 to 7 of P1 to status bits 4 to 7*/ - kbc_at_log("ATkbc: copy bits 4 to 7 of P1 to status bits 4 to 7\n"); - dev->status &= 0x0f; - dev->status |= (((dev->p1 & 0xfc) | 0x84) & 0xf0); - return 0; - - case 0xaf: - kbc_at_log("ATkbc: bad KBC command AF\n"); - return 1; - - case 0xf0 ... 0xff: - kbc_at_log("ATkbc: pulse: %01X\n", (val & 0x03) | 0x0c); - pulse_output(dev, (val & 0x03) | 0x0c); - return 0; - } - - return write64_generic(dev, val); -} - static uint8_t write60_quadtel(void *priv, uint8_t val) { @@ -1260,15 +1296,17 @@ write64_toshiba(void *priv, uint8_t val) dev->state = STATE_KBC_PARAM; return 0; + /* TODO: Toshiba KBC mode switching. */ case 0xb7: /* T3100e: Emulate PS/2 keyboard */ case 0xb8: /* T3100e: Emulate AT keyboard */ - dev->flags &= ~KBC_TYPE_MASK; + dev->misc_flags &= ~FLAG_PS2; if (val == 0xb7) { kbc_at_log("ATkbc: T3100e: Emulate PS/2 keyboard\n"); - dev->flags |= KBC_TYPE_PS2_NOREF; + dev->misc_flags |= FLAG_PS2; + kbc_at_do_poll = kbc_at_poll_ps2; } else { kbc_at_log("ATkbc: T3100e: Emulate AT keyboard\n"); - dev->flags |= KBC_TYPE_ISA; + kbc_at_do_poll = kbc_at_poll_at; } return 0; @@ -1333,7 +1371,7 @@ kbc_at_process_cmd(void *priv) case 0xaa: /* self-test */ kbc_at_log("ATkbc: self-test\n"); - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { + if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) { if (dev->state != STATE_RESET) { kbc_at_log("ATkbc: self-test reinitialization\n"); /* Yes, the firmware has an OR, but we need to make sure to keep any forcibly lowered bytes lowered. */ @@ -1531,7 +1569,7 @@ kbc_at_process_cmd(void *priv) if (dev->ib == 0xbb) break; - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { + if (dev->misc_flags & FLAG_PS2) { set_enable_aux(dev, 1); if ((dev->ports[1] != NULL) && (dev->ports[1]->priv != NULL)) { dev->ports[1]->wantcmd = 1; @@ -1614,7 +1652,7 @@ kbc_at_read(uint16_t port, void *priv) atkbc_t *dev = (atkbc_t *) priv; uint8_t ret = 0xff; - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) + if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) cycles -= ISA_CYCLES(8); switch (port) { @@ -1667,10 +1705,10 @@ kbc_at_reset(void *priv) dev->sc_or = 0; - dev->ami_flags = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) ? 0x01 : 0x00; + dev->ami_flags = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) ? 0x01 : 0x00; dev->misc_flags = 0x00; - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { + if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) { dev->misc_flags |= FLAG_PS2; kbc_at_do_poll = kbc_at_poll_ps2; } else @@ -1679,7 +1717,7 @@ kbc_at_reset(void *priv) dev->misc_flags |= FLAG_CACHE; dev->p2 = 0xcd; - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { + if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) { write_p2(dev, 0x4b); } else { /* The real thing writes CF and then AND's it with BF. */ @@ -1694,7 +1732,7 @@ static void kbc_at_close(void *priv) { atkbc_t *dev = (atkbc_t *) priv; - int i, max_ports = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) ? 2 : 1; + int i, max_ports = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) ? 2 : 1; kbc_at_reset(dev); @@ -1752,12 +1790,6 @@ kbc_at_init(const device_t *info) dev->write64_ven = write64_olivetti; break; - case KBC_VEN_INTEL_AMI: - kbc_ami_revision = '5'; - dev->write60_ven = write60_ami; - dev->write64_ven = write64_ami; - break; - case KBC_VEN_ALI: kbc_ami_revision = 'F'; kbc_award_revision = 0x43; @@ -1765,15 +1797,16 @@ kbc_at_init(const device_t *info) dev->write64_ven = write64_ami; break; - case KBC_VEN_TG: - case KBC_VEN_TG_GREEN: + case KBC_VEN_TRIGEM_AMI: kbc_ami_revision = 'Z'; dev->write60_ven = write60_ami; dev->write64_ven = write64_ami; break; case KBC_VEN_AMI: - if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) { + if ((dev->flags & KBC_TYPE_MASK) == KBC_TYPE_GREEN) + kbc_ami_revision = '5'; + else if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) { if (cpu_64bitbus) kbc_ami_revision = 'R'; else if (is486) @@ -1794,10 +1827,6 @@ kbc_at_init(const device_t *info) dev->write64_ven = write64_ami; break; - case KBC_VEN_IBM_MCA: - dev->write64_ven = write64_ibm_mca; - break; - case KBC_VEN_QUADTEL: dev->write60_ven = write60_quadtel; dev->write64_ven = write64_quadtel; @@ -1809,7 +1838,7 @@ kbc_at_init(const device_t *info) break; } - max_ports = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_NOREF) ? 2 : 1; + max_ports = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) ? 2 : 1; for (i = 0; i < max_ports; i++) { kbc_at_ports[i] = (kbc_at_port_t *) malloc(sizeof(kbc_at_port_t)); @@ -1858,7 +1887,7 @@ const device_t keyboard_at_tg_ami_device = { .name = "PC/AT Keyboard (TriGem AMI)", .internal_name = "keyboard_at_tg_ami", .flags = DEVICE_KBC, - .local = KBC_TYPE_ISA | KBC_VEN_TG, + .local = KBC_TYPE_ISA | KBC_VEN_TRIGEM_AMI, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -1914,7 +1943,7 @@ const device_t keyboard_ps2_device = { .name = "PS/2 Keyboard", .internal_name = "keyboard_ps2", .flags = DEVICE_KBC, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_GENERIC, + .local = KBC_TYPE_PS2_1 | KBC_VEN_GENERIC, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -1928,7 +1957,7 @@ const device_t keyboard_ps2_ps1_device = { .name = "PS/2 Keyboard (IBM PS/1)", .internal_name = "keyboard_ps2_ps1", .flags = DEVICE_KBC, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_IBM_PS1, + .local = KBC_TYPE_PS2_1 | KBC_VEN_IBM_PS1, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -1942,7 +1971,7 @@ const device_t keyboard_ps2_ps1_pci_device = { .name = "PS/2 Keyboard (IBM PS/1)", .internal_name = "keyboard_ps2_ps1_pci", .flags = DEVICE_KBC | DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_IBM_PS1, + .local = KBC_TYPE_PS2_1 | KBC_VEN_IBM_PS1, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -1970,7 +1999,7 @@ const device_t keyboard_ps2_ami_device = { .name = "PS/2 Keyboard (AMI)", .internal_name = "keyboard_ps2_ami", .flags = DEVICE_KBC, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_AMI, + .local = KBC_TYPE_PS2_1 | KBC_VEN_AMI, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -1984,21 +2013,7 @@ const device_t keyboard_ps2_tg_ami_device = { .name = "PS/2 Keyboard (TriGem AMI)", .internal_name = "keyboard_ps2_tg_ami", .flags = DEVICE_KBC, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_TG, - .init = kbc_at_init, - .close = kbc_at_close, - .reset = kbc_at_reset, - { .available = NULL }, - .speed_changed = NULL, - .force_redraw = NULL, - .config = NULL -}; - -const device_t keyboard_ps2_mca_device = { - .name = "PS/2 Keyboard", - .internal_name = "keyboard_ps2_mca", - .flags = DEVICE_KBC, - .local = KBC_TYPE_PS2_1 | KBC_VEN_IBM_MCA, + .local = KBC_TYPE_PS2_1 | KBC_VEN_TRIGEM_AMI, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -2012,7 +2027,7 @@ const device_t keyboard_ps2_mca_2_device = { .name = "PS/2 Keyboard", .internal_name = "keyboard_ps2_mca_2", .flags = DEVICE_KBC, - .local = KBC_TYPE_PS2_2 | KBC_VEN_IBM_MCA, + .local = KBC_TYPE_PS2_2 | KBC_VEN_GENERIC, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -2026,7 +2041,7 @@ const device_t keyboard_ps2_quadtel_device = { .name = "PS/2 Keyboard (Quadtel/MegaPC)", .internal_name = "keyboard_ps2_quadtel", .flags = DEVICE_KBC, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_QUADTEL, + .local = KBC_TYPE_PS2_1 | KBC_VEN_QUADTEL, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -2040,7 +2055,7 @@ const device_t keyboard_ps2_pci_device = { .name = "PS/2 Keyboard", .internal_name = "keyboard_ps2_pci", .flags = DEVICE_KBC | DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_GENERIC, + .local = KBC_TYPE_PS2_1 | KBC_VEN_GENERIC, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -2054,7 +2069,7 @@ const device_t keyboard_ps2_ami_pci_device = { .name = "PS/2 Keyboard (AMI)", .internal_name = "keyboard_ps2_ami_pci", .flags = DEVICE_KBC | DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_AMI, + .local = KBC_TYPE_PS2_1 | KBC_VEN_AMI, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -2068,7 +2083,7 @@ const device_t keyboard_ps2_ali_pci_device = { .name = "PS/2 Keyboard (ALi M5123/M1543C)", .internal_name = "keyboard_ps2_ali_pci", .flags = DEVICE_KBC | DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_ALI, + .local = KBC_TYPE_PS2_1 | KBC_VEN_ALI, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -2082,7 +2097,7 @@ const device_t keyboard_ps2_intel_ami_pci_device = { .name = "PS/2 Keyboard (AMI)", .internal_name = "keyboard_ps2_intel_ami_pci", .flags = DEVICE_KBC | DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_INTEL_AMI, + .local = KBC_TYPE_GREEN | KBC_VEN_AMI, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -2096,7 +2111,7 @@ const device_t keyboard_ps2_tg_ami_pci_device = { .name = "PS/2 Keyboard (TriGem AMI)", .internal_name = "keyboard_ps2_tg_ami_pci", .flags = DEVICE_KBC | DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_TG, + .local = KBC_TYPE_PS2_1 | KBC_VEN_TRIGEM_AMI, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, @@ -2110,7 +2125,7 @@ const device_t keyboard_ps2_acer_pci_device = { .name = "PS/2 Keyboard (Acer 90M002A)", .internal_name = "keyboard_ps2_acer_pci", .flags = DEVICE_KBC | DEVICE_PCI, - .local = KBC_TYPE_PS2_NOREF | KBC_VEN_ACER, + .local = KBC_TYPE_PS2_1 | KBC_VEN_ACER, .init = kbc_at_init, .close = kbc_at_close, .reset = kbc_at_reset, diff --git a/src/include/86box/keyboard.h b/src/include/86box/keyboard.h index 6f7517e9d..fe642fec1 100644 --- a/src/include/86box/keyboard.h +++ b/src/include/86box/keyboard.h @@ -225,7 +225,6 @@ extern const device_t keyboard_ps2_ami_device; extern const device_t keyboard_ps2_tg_ami_device; extern const device_t keyboard_ps2_tg_ami_green_device; extern const device_t keyboard_ps2_olivetti_device; -extern const device_t keyboard_ps2_mca_device; extern const device_t keyboard_ps2_mca_2_device; extern const device_t keyboard_ps2_quadtel_device; extern const device_t keyboard_ps2_pci_device; diff --git a/src/machine/m_ps2_mca.c b/src/machine/m_ps2_mca.c index 3de9ef491..328de216b 100644 --- a/src/machine/m_ps2_mca.c +++ b/src/machine/m_ps2_mca.c @@ -998,7 +998,7 @@ ps2_mca_board_model_55sx_init(int has_sec_nvram, int slots) } mca_init(slots); - device_add(&keyboard_ps2_mca_device); + device_add(&keyboard_ps2_device); if (has_sec_nvram == 1) device_add(&ps2_nvr_55ls_device); @@ -1162,7 +1162,7 @@ ps2_mca_board_model_70_type34_init(int is_type4, int slots) ps2.split_addr = mem_size * 1024; mca_init(slots); - device_add(&keyboard_ps2_mca_device); + device_add(&keyboard_ps2_device); ps2.planar_read = model_70_type3_read; ps2.planar_write = model_70_type3_write; @@ -1255,7 +1255,7 @@ ps2_mca_board_model_80_type2_init(int is486) ps2.split_addr = mem_size * 1024; mca_init(8); - device_add(&keyboard_ps2_mca_device); + device_add(&keyboard_ps2_device); ps2.planar_read = model_80_read; ps2.planar_write = model_80_write; diff --git a/src/mem/mem.c b/src/mem/mem.c index f3f0f3110..910f67619 100644 --- a/src/mem/mem.c +++ b/src/mem/mem.c @@ -2898,7 +2898,7 @@ mem_remap_top(int kb) if (addr >= 0x000c0000) addr += 0x00010000; } - if (start_addr != 0) + if (start_addr == 0) start_addr = addr; pages[c].mem = set ? &ram[addr] : page_ff; pages[c].write_b = set ? mem_write_ramb_page : NULL; diff --git a/src/port_92.c b/src/port_92.c index cbc419569..fd0471b0e 100644 --- a/src/port_92.c +++ b/src/port_92.c @@ -69,11 +69,18 @@ port_92_readw(uint16_t port, void *priv) return ret; } +/* + This does the exact same thing as keyboard controller reset. + TODO: ALi M1543(c) behavior. + */ static void port_92_pulse(void *priv) { - resetx86(); + softresetx86(); /* Pulse reset! */ cpu_set_edx(); + flushmmucache(); + + cpu_alt_reset = 1; } static void @@ -166,6 +173,15 @@ port_92_remove(void *priv) port_92_readb, NULL, NULL, port_92_writeb, NULL, NULL, dev); } +static void +port_92_reset(void *priv) +{ + cpu_alt_reset = 0; + + mem_a20_alt = 0x00; + mem_a20_recalc(); +} + static void port_92_close(void *priv) { @@ -252,7 +268,7 @@ const device_t port_92_pci_device = { .local = PORT_92_PCI, .init = port_92_init, .close = port_92_close, - .reset = NULL, + .reset = port_92_reset, { .available = NULL }, .speed_changed = NULL, .force_redraw = NULL, From 8d6181de50133e8b7a0e48e391974cf225326abf Mon Sep 17 00:00:00 2001 From: OBattler Date: Sat, 22 Apr 2023 08:38:15 +0200 Subject: [PATCH 13/60] A small change in device/keyboard_at.c so the keyboard no longer loses track of what command a parameter is intended for when interrupted by another command. --- src/device/keyboard_at.c | 7 ++++--- 1 file changed, 4 insertions(+), 3 deletions(-) diff --git a/src/device/keyboard_at.c b/src/device/keyboard_at.c index 886016023..19a754d7b 100644 --- a/src/device/keyboard_at.c +++ b/src/device/keyboard_at.c @@ -788,10 +788,9 @@ keyboard_at_write(void *priv) dev->state = DEV_STATE_MAIN_WANT_IN; } - dev->command = val; - - switch (dev->command) { + switch (val) { case 0xed: /* set/reset LEDs */ + dev->command = val; keyboard_at_log("%s: set/reset LEDs\n", dev->name); dev->flags |= FLAG_CTRLDAT; kbc_at_dev_queue_add(dev, 0xfa, 0); /* ACK for command byte */ @@ -811,6 +810,7 @@ keyboard_at_write(void *priv) case 0xf0: /* get/set scan code set */ if (dev->type & FLAG_PS2) { + dev->command = val; keyboard_at_log("%s: scan code set\n", dev->name); dev->flags |= FLAG_CTRLDAT; kbc_at_dev_queue_add(dev, 0xfa, 0); /* ACK for command byte */ @@ -833,6 +833,7 @@ keyboard_at_write(void *priv) break; case 0xf3: /* set command mode */ + dev->command = val; keyboard_at_log("%s: set typematic rate/delay\n", dev->name); dev->flags |= FLAG_CTRLDAT; kbc_at_dev_queue_add(dev, 0xfa, 0); /* ACK for command byte */ From cc4dd568bd48031a9169aa59190bd210979aae97 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?David=20Hrdli=C4=8Dka?= Date: Sat, 22 Apr 2023 18:05:36 +0200 Subject: [PATCH 14/60] Update README.md The contribution requirements section is basically stating the sky is blue, not sure the point of it --- README.md | 10 ---------- 1 file changed, 10 deletions(-) diff --git a/README.md b/README.md index a1e3985e1..05a2a9ed2 100644 --- a/README.md +++ b/README.md @@ -49,16 +49,6 @@ Licensing The emulator can also optionally make use of [munt](https://github.com/munt/munt), [FluidSynth](https://www.fluidsynth.org/), [Ghostscript](https://www.ghostscript.com/) and [Discord Game SDK](https://discord.com/developers/docs/game-sdk/sdk-starter-guide), which are distributed under their respective licenses. -Contribution requirements -------------------------- - Formal codification of the project's emulated hardware contribution requirements, which all have to be met to accept an addition: -* A ROM must be available; -* Documentation must be available or it must be feasible to reverse engineer with a reasonable amount of time and effort; -* It must be feasible to implement with a reasonable amount of time and effort; -* It has to fall inside the project's scope. - -Where unsure or for more details about the project's emulated hardware contribution requirements, contact a Contributor or higher. - Donations --------- We do not charge you for the emulator but donations are still welcome: From c076406450f46df3806015d44605e45be89673a7 Mon Sep 17 00:00:00 2001 From: RichardG867 Date: Sat, 22 Apr 2023 18:41:42 -0300 Subject: [PATCH 15/60] 386_common: Optimize I/O permission checking for word and dword operations (based on qemu) --- src/cpu/386_common.c | 19 ++++++++++--------- src/cpu/386_common.h | 6 +++--- src/cpu/cpu.h | 2 +- src/cpu/x86_ops_io.h | 40 ++++++++++++--------------------------- src/cpu/x86_ops_rep.h | 20 ++++++-------------- src/cpu/x86_ops_rep_dyn.h | 20 ++++++-------------- src/cpu/x86_ops_string.h | 40 ++++++++++++--------------------------- 7 files changed, 50 insertions(+), 97 deletions(-) diff --git a/src/cpu/386_common.c b/src/cpu/386_common.c index 2df72c20e..454815de0 100644 --- a/src/cpu/386_common.c +++ b/src/cpu/386_common.c @@ -1427,25 +1427,26 @@ x86illegal(void) } int -checkio(uint32_t port) +checkio(uint32_t port, int mask) { uint16_t t; - uint8_t d; cpl_override = 1; t = readmemw(tr.base, 0x66); - cpl_override = 0; - if (cpu_state.abrt) + if (cpu_state.abrt) { + cpl_override = 0; return 0; + } - if ((t + (port >> 3UL)) > tr.limit) - return 1; + if ((t + (port >> 3UL) + 1) > tr.limit) { + cpl_override = 0; + return mask; + } - cpl_override = 1; - d = readmembl(tr.base + t + (port >> 3)); + t = readmemwl(tr.base + t + (port >> 3)); cpl_override = 0; - return d & (1 << (port & 7)); + return (t >> (port & 7)) & mask; } #ifdef OLD_DIVEXCP diff --git a/src/cpu/386_common.h b/src/cpu/386_common.h index f26eb7f98..ae71347b6 100644 --- a/src/cpu/386_common.h +++ b/src/cpu/386_common.h @@ -97,11 +97,11 @@ if (writelookup2[(uint32_t) ((s) + (a)) >> 12] == (uintptr_t) LOOKUP_INV || (s) == 0xFFFFFFFF || (((s) + (a)) & 3)) \ do_mmutranslate((s) + (a), b, 4, 1) -int checkio(uint32_t port); +int checkio(uint32_t port, int mask); -#define check_io_perm(port) \ +#define check_io_perm(port, size) \ if (msw & 1 && ((CPL > IOPL) || (cpu_state.eflags & VM_FLAG))) { \ - int tempi = checkio(port); \ + int tempi = checkio(port, (1 << size) - 1); \ if (cpu_state.abrt) \ return 1; \ if (tempi) { \ diff --git a/src/cpu/cpu.h b/src/cpu/cpu.h index 93dae98d1..f8ffaced3 100644 --- a/src/cpu/cpu.h +++ b/src/cpu/cpu.h @@ -642,7 +642,7 @@ extern void cpu_CPUID(void); extern void cpu_RDMSR(void); extern void cpu_WRMSR(void); -extern int checkio(uint32_t port); +extern int checkio(uint32_t port, int mask); extern void codegen_block_end(void); extern void codegen_reset(void); extern void cpu_set_edx(void); diff --git a/src/cpu/x86_ops_io.h b/src/cpu/x86_ops_io.h index c4d46404d..8a99b8668 100644 --- a/src/cpu/x86_ops_io.h +++ b/src/cpu/x86_ops_io.h @@ -2,7 +2,7 @@ static int opIN_AL_imm(uint32_t fetchdat) { uint16_t port = (uint16_t) getbytef(); - check_io_perm(port); + check_io_perm(port, 1); AL = inb(port); CLOCK_CYCLES(12); PREFETCH_RUN(12, 2, -1, 1, 0, 0, 0, 0); @@ -14,8 +14,7 @@ static int opIN_AX_imm(uint32_t fetchdat) { uint16_t port = (uint16_t) getbytef(); - check_io_perm(port); - check_io_perm(port + 1); + check_io_perm(port, 2); AX = inw(port); CLOCK_CYCLES(12); PREFETCH_RUN(12, 2, -1, 1, 0, 0, 0, 0); @@ -27,10 +26,7 @@ static int opIN_EAX_imm(uint32_t fetchdat) { uint16_t port = (uint16_t) getbytef(); - check_io_perm(port); - check_io_perm(port + 1); - check_io_perm(port + 2); - check_io_perm(port + 3); + check_io_perm(port, 4); EAX = inl(port); CLOCK_CYCLES(12); PREFETCH_RUN(12, 2, -1, 0, 1, 0, 0, 0); @@ -43,7 +39,7 @@ static int opOUT_AL_imm(uint32_t fetchdat) { uint16_t port = (uint16_t) getbytef(); - check_io_perm(port); + check_io_perm(port, 1); outb(port, AL); CLOCK_CYCLES(10); PREFETCH_RUN(10, 2, -1, 0, 0, 1, 0, 0); @@ -57,8 +53,7 @@ static int opOUT_AX_imm(uint32_t fetchdat) { uint16_t port = (uint16_t) getbytef(); - check_io_perm(port); - check_io_perm(port + 1); + check_io_perm(port, 2); outw(port, AX); CLOCK_CYCLES(10); PREFETCH_RUN(10, 2, -1, 0, 0, 1, 0, 0); @@ -70,10 +65,7 @@ static int opOUT_EAX_imm(uint32_t fetchdat) { uint16_t port = (uint16_t) getbytef(); - check_io_perm(port); - check_io_perm(port + 1); - check_io_perm(port + 2); - check_io_perm(port + 3); + check_io_perm(port, 4); outl(port, EAX); CLOCK_CYCLES(10); PREFETCH_RUN(10, 2, -1, 0, 0, 0, 1, 0); @@ -85,7 +77,7 @@ opOUT_EAX_imm(uint32_t fetchdat) static int opIN_AL_DX(uint32_t fetchdat) { - check_io_perm(DX); + check_io_perm(DX, 1); AL = inb(DX); CLOCK_CYCLES(12); PREFETCH_RUN(12, 1, -1, 1, 0, 0, 0, 0); @@ -96,8 +88,7 @@ opIN_AL_DX(uint32_t fetchdat) static int opIN_AX_DX(uint32_t fetchdat) { - check_io_perm(DX); - check_io_perm(DX + 1); + check_io_perm(DX, 2); AX = inw(DX); CLOCK_CYCLES(12); PREFETCH_RUN(12, 1, -1, 1, 0, 0, 0, 0); @@ -108,10 +99,7 @@ opIN_AX_DX(uint32_t fetchdat) static int opIN_EAX_DX(uint32_t fetchdat) { - check_io_perm(DX); - check_io_perm(DX + 1); - check_io_perm(DX + 2); - check_io_perm(DX + 3); + check_io_perm(DX, 4); EAX = inl(DX); CLOCK_CYCLES(12); PREFETCH_RUN(12, 1, -1, 0, 1, 0, 0, 0); @@ -123,7 +111,7 @@ opIN_EAX_DX(uint32_t fetchdat) static int opOUT_AL_DX(uint32_t fetchdat) { - check_io_perm(DX); + check_io_perm(DX, 1); outb(DX, AL); CLOCK_CYCLES(11); PREFETCH_RUN(11, 1, -1, 0, 0, 1, 0, 0); @@ -134,8 +122,7 @@ opOUT_AL_DX(uint32_t fetchdat) static int opOUT_AX_DX(uint32_t fetchdat) { - check_io_perm(DX); - check_io_perm(DX + 1); + check_io_perm(DX, 2); outw(DX, AX); CLOCK_CYCLES(11); PREFETCH_RUN(11, 1, -1, 0, 0, 1, 0, 0); @@ -146,10 +133,7 @@ opOUT_AX_DX(uint32_t fetchdat) static int opOUT_EAX_DX(uint32_t fetchdat) { - check_io_perm(DX); - check_io_perm(DX + 1); - check_io_perm(DX + 2); - check_io_perm(DX + 3); + check_io_perm(DX, 4); outl(DX, EAX); PREFETCH_RUN(11, 1, -1, 0, 0, 0, 1, 0); if (nmi && nmi_enable && nmi_mask) diff --git a/src/cpu/x86_ops_rep.h b/src/cpu/x86_ops_rep.h index 67bd8433d..4b8f42185 100644 --- a/src/cpu/x86_ops_rep.h +++ b/src/cpu/x86_ops_rep.h @@ -9,7 +9,7 @@ uint8_t temp; \ \ SEG_CHECK_WRITE(&cpu_state.seg_es); \ - check_io_perm(DX); \ + check_io_perm(DX, 1); \ CHECK_WRITE(&cpu_state.seg_es, DEST_REG, DEST_REG); \ high_page = 0; \ do_mmut_wb(es, DEST_REG, &addr64); \ @@ -48,8 +48,7 @@ uint16_t temp; \ \ SEG_CHECK_WRITE(&cpu_state.seg_es); \ - check_io_perm(DX); \ - check_io_perm(DX + 1); \ + check_io_perm(DX, 2); \ CHECK_WRITE(&cpu_state.seg_es, DEST_REG, DEST_REG + 1UL); \ high_page = 0; \ do_mmut_ww(es, DEST_REG, addr64a); \ @@ -88,10 +87,7 @@ uint32_t temp; \ \ SEG_CHECK_WRITE(&cpu_state.seg_es); \ - check_io_perm(DX); \ - check_io_perm(DX + 1); \ - check_io_perm(DX + 2); \ - check_io_perm(DX + 3); \ + check_io_perm(DX, 4); \ CHECK_WRITE(&cpu_state.seg_es, DEST_REG, DEST_REG + 3UL); \ high_page = 0; \ do_mmut_wl(es, DEST_REG, addr64a); \ @@ -132,7 +128,7 @@ temp = readmemb(cpu_state.ea_seg->base, SRC_REG); \ if (cpu_state.abrt) \ return 1; \ - check_io_perm(DX); \ + check_io_perm(DX, 1); \ outb(DX, temp); \ if (cpu_state.flags & D_FLAG) \ SRC_REG--; \ @@ -163,8 +159,7 @@ temp = readmemw(cpu_state.ea_seg->base, SRC_REG); \ if (cpu_state.abrt) \ return 1; \ - check_io_perm(DX); \ - check_io_perm(DX + 1); \ + check_io_perm(DX, 2); \ outw(DX, temp); \ if (cpu_state.flags & D_FLAG) \ SRC_REG -= 2; \ @@ -195,10 +190,7 @@ temp = readmeml(cpu_state.ea_seg->base, SRC_REG); \ if (cpu_state.abrt) \ return 1; \ - check_io_perm(DX); \ - check_io_perm(DX + 1); \ - check_io_perm(DX + 2); \ - check_io_perm(DX + 3); \ + check_io_perm(DX, 4); \ outl(DX, temp); \ if (cpu_state.flags & D_FLAG) \ SRC_REG -= 4; \ diff --git a/src/cpu/x86_ops_rep_dyn.h b/src/cpu/x86_ops_rep_dyn.h index 576baa403..5c64ed94d 100644 --- a/src/cpu/x86_ops_rep_dyn.h +++ b/src/cpu/x86_ops_rep_dyn.h @@ -7,7 +7,7 @@ uint8_t temp; \ \ SEG_CHECK_WRITE(&cpu_state.seg_es); \ - check_io_perm(DX); \ + check_io_perm(DX, 1); \ CHECK_WRITE(&cpu_state.seg_es, DEST_REG, DEST_REG); \ high_page = 0; \ do_mmut_wb(es, DEST_REG, &addr64); \ @@ -40,8 +40,7 @@ uint16_t temp; \ \ SEG_CHECK_WRITE(&cpu_state.seg_es); \ - check_io_perm(DX); \ - check_io_perm(DX + 1); \ + check_io_perm(DX, 2); \ CHECK_WRITE(&cpu_state.seg_es, DEST_REG, DEST_REG + 1UL); \ high_page = 0; \ do_mmut_ww(es, DEST_REG, addr64a); \ @@ -74,10 +73,7 @@ uint32_t temp; \ \ SEG_CHECK_WRITE(&cpu_state.seg_es); \ - check_io_perm(DX); \ - check_io_perm(DX + 1); \ - check_io_perm(DX + 2); \ - check_io_perm(DX + 3); \ + check_io_perm(DX, 4); \ CHECK_WRITE(&cpu_state.seg_es, DEST_REG, DEST_REG + 3UL); \ high_page = 0; \ do_mmut_wl(es, DEST_REG, addr64a); \ @@ -112,7 +108,7 @@ temp = readmemb(cpu_state.ea_seg->base, SRC_REG); \ if (cpu_state.abrt) \ return 1; \ - check_io_perm(DX); \ + check_io_perm(DX, 1); \ outb(DX, temp); \ if (cpu_state.flags & D_FLAG) \ SRC_REG--; \ @@ -137,8 +133,7 @@ temp = readmemw(cpu_state.ea_seg->base, SRC_REG); \ if (cpu_state.abrt) \ return 1; \ - check_io_perm(DX); \ - check_io_perm(DX + 1); \ + check_io_perm(DX, 2); \ outw(DX, temp); \ if (cpu_state.flags & D_FLAG) \ SRC_REG -= 2; \ @@ -163,10 +158,7 @@ temp = readmeml(cpu_state.ea_seg->base, SRC_REG); \ if (cpu_state.abrt) \ return 1; \ - check_io_perm(DX); \ - check_io_perm(DX + 1); \ - check_io_perm(DX + 2); \ - check_io_perm(DX + 3); \ + check_io_perm(DX, 4); \ outl(DX, temp); \ if (cpu_state.flags & D_FLAG) \ SRC_REG -= 4; \ diff --git a/src/cpu/x86_ops_string.h b/src/cpu/x86_ops_string.h index 5cc5f3806..c3875a648 100644 --- a/src/cpu/x86_ops_string.h +++ b/src/cpu/x86_ops_string.h @@ -804,7 +804,7 @@ opINSB_a16(uint32_t fetchdat) addr64 = 0x00000000; SEG_CHECK_WRITE(&cpu_state.seg_es); - check_io_perm(DX); + check_io_perm(DX, 1); CHECK_WRITE(&cpu_state.seg_es, DI, DI); high_page = 0; do_mmut_wb(es, DI, &addr64); @@ -830,7 +830,7 @@ opINSB_a32(uint32_t fetchdat) addr64 = 0x00000000; SEG_CHECK_WRITE(&cpu_state.seg_es); - check_io_perm(DX); + check_io_perm(DX, 1); high_page = 0; CHECK_WRITE(&cpu_state.seg_es, EDI, EDI); do_mmut_wb(es, EDI, &addr64); @@ -857,8 +857,7 @@ opINSW_a16(uint32_t fetchdat) addr64a[0] = addr64a[1] = 0x00000000; SEG_CHECK_WRITE(&cpu_state.seg_es); - check_io_perm(DX); - check_io_perm(DX + 1); + check_io_perm(DX, 2); CHECK_WRITE(&cpu_state.seg_es, DI, DI + 1UL); high_page = 0; do_mmut_ww(es, DI, addr64a); @@ -885,8 +884,7 @@ opINSW_a32(uint32_t fetchdat) SEG_CHECK_WRITE(&cpu_state.seg_es); high_page = 0; - check_io_perm(DX); - check_io_perm(DX + 1); + check_io_perm(DX, 2); CHECK_WRITE(&cpu_state.seg_es, EDI, EDI + 1UL); do_mmut_ww(es, EDI, addr64a); if (cpu_state.abrt) @@ -912,10 +910,7 @@ opINSL_a16(uint32_t fetchdat) addr64a[0] = addr64a[1] = addr64a[2] = addr64a[3] = 0x00000000; SEG_CHECK_WRITE(&cpu_state.seg_es); - check_io_perm(DX); - check_io_perm(DX + 1); - check_io_perm(DX + 2); - check_io_perm(DX + 3); + check_io_perm(DX, 4); CHECK_WRITE(&cpu_state.seg_es, DI, DI + 3UL); high_page = 0; do_mmut_wl(es, DI, addr64a); @@ -941,10 +936,7 @@ opINSL_a32(uint32_t fetchdat) addr64a[0] = addr64a[1] = addr64a[2] = addr64a[3] = 0x00000000; SEG_CHECK_WRITE(&cpu_state.seg_es); - check_io_perm(DX); - check_io_perm(DX + 1); - check_io_perm(DX + 2); - check_io_perm(DX + 3); + check_io_perm(DX, 4); CHECK_WRITE(&cpu_state.seg_es, EDI, EDI + 3UL); high_page = 0; do_mmut_wl(es, DI, addr64a); @@ -973,7 +965,7 @@ opOUTSB_a16(uint32_t fetchdat) temp = readmemb(cpu_state.ea_seg->base, SI); if (cpu_state.abrt) return 1; - check_io_perm(DX); + check_io_perm(DX, 1); if (cpu_state.flags & D_FLAG) SI--; else @@ -993,7 +985,7 @@ opOUTSB_a32(uint32_t fetchdat) temp = readmemb(cpu_state.ea_seg->base, ESI); if (cpu_state.abrt) return 1; - check_io_perm(DX); + check_io_perm(DX, 1); if (cpu_state.flags & D_FLAG) ESI--; else @@ -1014,8 +1006,7 @@ opOUTSW_a16(uint32_t fetchdat) temp = readmemw(cpu_state.ea_seg->base, SI); if (cpu_state.abrt) return 1; - check_io_perm(DX); - check_io_perm(DX + 1); + check_io_perm(DX, 2); if (cpu_state.flags & D_FLAG) SI -= 2; else @@ -1035,8 +1026,7 @@ opOUTSW_a32(uint32_t fetchdat) temp = readmemw(cpu_state.ea_seg->base, ESI); if (cpu_state.abrt) return 1; - check_io_perm(DX); - check_io_perm(DX + 1); + check_io_perm(DX, 2); if (cpu_state.flags & D_FLAG) ESI -= 2; else @@ -1057,10 +1047,7 @@ opOUTSL_a16(uint32_t fetchdat) temp = readmeml(cpu_state.ea_seg->base, SI); if (cpu_state.abrt) return 1; - check_io_perm(DX); - check_io_perm(DX + 1); - check_io_perm(DX + 2); - check_io_perm(DX + 3); + check_io_perm(DX, 4); if (cpu_state.flags & D_FLAG) SI -= 4; else @@ -1080,10 +1067,7 @@ opOUTSL_a32(uint32_t fetchdat) temp = readmeml(cpu_state.ea_seg->base, ESI); if (cpu_state.abrt) return 1; - check_io_perm(DX); - check_io_perm(DX + 1); - check_io_perm(DX + 2); - check_io_perm(DX + 3); + check_io_perm(DX, 4); if (cpu_state.flags & D_FLAG) ESI -= 4; else From b6fbc748377cb046b9824960e3016ee0faa79f09 Mon Sep 17 00:00:00 2001 From: SuperMaxusa <41739128+SuperMaxusa@users.noreply.github.com> Date: Sun, 23 Apr 2023 01:05:20 +0300 Subject: [PATCH 16/60] Update uk-UA.rc --- src/win/languages/uk-UA.rc | 30 +++++++++++++++--------------- 1 file changed, 15 insertions(+), 15 deletions(-) diff --git a/src/win/languages/uk-UA.rc b/src/win/languages/uk-UA.rc index b3c7f4017..7c4b9ba62 100644 --- a/src/win/languages/uk-UA.rc +++ b/src/win/languages/uk-UA.rc @@ -250,7 +250,7 @@ END #define STR_CANCEL "Відміна" #define STR_GLOBAL "Зберегти ці параметри як &глобальні за замовчуванням" #define STR_DEFAULT "&За замовчуванням" -#define STR_LANGUAGE "Язык:" +#define STR_LANGUAGE "Мова:" #define STR_ICONSET "Набір іконок:" #define STR_GAIN "Посилення" @@ -306,11 +306,11 @@ END #define STR_NET_TYPE "Тип мережі:" #define STR_PCAP "Пристрій PCap:" -#define STR_NET "Мережева карта:" -#define STR_NET1 "Network card 1:" -#define STR_NET2 "Network card 2:" -#define STR_NET3 "Network card 3:" -#define STR_NET4 "Network card 4:" +#define STR_NET "Мережевий адаптер:" +#define STR_NET1 "Мережева карта 1:" +#define STR_NET2 "Мережева карта 2:" +#define STR_NET3 "Мережева карта 3:" +#define STR_NET4 "Мережева карта 4:" #define STR_COM1 "Пристрій COM1:" #define STR_COM2 "Пристрій COM2:" @@ -404,11 +404,11 @@ BEGIN IDS_2055 "Образи ZIP (*.IM?;*.ZDI)\0*.IM?;*.ZDI\0" IDS_2056 "86Box не зміг знайти жодного відповідного для використання файлу з ПЗУ.\n\nБудь ласка завантажте набір ПЗУ і витягніть його в каталог ""roms""." IDS_2057 "(порожньо)" - IDS_2058 "Образи ZIP (*.IM?;*.ZDI)\0*.IM?;*.ZDI\0Всі файли (*.*)\0*.*\0" + IDS_2058 "Образи ZIP (*.IM?;*.ZDI)\0*.IM?;*.ZDI\0Усі файли (*.*)\0*.*\0" IDS_2059 "Турбо" IDS_2060 "Увімк" IDS_2061 "Вимк" - IDS_2062 "Всі образи (*.86F;*.DSK;*.FLP;*.IM?;*.*FD?)\0*.86F;*.DSK;*.FLP;*.IM?;*.*FD?\0Прості посекторні образи (*.DSK;*.FLP;*.IM?;*.*FD?)\0*.DSK;*.FLP;*.IM?;*.IMG;*.*FD?\0Образ поверхні (*.86F)\0*.86F\0" + IDS_2062 "Усі образи (*.86F;*.DSK;*.FLP;*.IM?;*.*FD?)\0*.86F;*.DSK;*.FLP;*.IM?;*.*FD?\0Прості посекторні образи (*.DSK;*.FLP;*.IM?;*.*FD?)\0*.DSK;*.FLP;*.IM?;*.IMG;*.*FD?\0Образ поверхні (*.86F)\0*.86F\0" IDS_2063 "Системна плата ""%hs"" недоступна через відсутність файлу її ПЗУ в каталозі roms/machines. Переключення на доступну системну плату." END @@ -464,14 +464,14 @@ BEGIN IDS_2107 "%u" IDS_2108 "%u МБ (CHS: %i, %i, %i)" IDS_2109 "Дисковод %i (%s): %ls" - IDS_2110 "Всі образи (*.0??;*.1??;*.??0;*.86F;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.JSON;*.TD0;*.*FD?;*.MFM;*.XDF)\0*.0??;*.1??;*.??0;*.86F;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.JSON;*.TD0;*.*FD?;*.MFM;*.XDF\0Розширені образи секторів (*.IMD;*.JSON;*.TD0)\0*.IMD;*.JSON;*.TD0\0Основні образи секторів (*.0??;*.1??;*.??0;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.XDF;*.*FD?)\0*.0??;*.1??;*.??0;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.XDF;*.*FD?\0Образи Flux (*.FDI)\0*.FDI\0Образи Surface (*.86F;*.MFM)\0*.86F;*.MFM\0Всі файли (*.*)\0*.*\0" + IDS_2110 "Усі образи (*.0??;*.1??;*.??0;*.86F;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.JSON;*.TD0;*.*FD?;*.MFM;*.XDF)\0*.0??;*.1??;*.??0;*.86F;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.JSON;*.TD0;*.*FD?;*.MFM;*.XDF\0Розширені образи секторів (*.IMD;*.JSON;*.TD0)\0*.IMD;*.JSON;*.TD0\0Основні образи секторів (*.0??;*.1??;*.??0;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.XDF;*.*FD?)\0*.0??;*.1??;*.??0;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.XDF;*.*FD?\0Образи Flux (*.FDI)\0*.FDI\0Образи Surface (*.86F;*.MFM)\0*.86F;*.MFM\0Всі файли (*.*)\0*.*\0" IDS_2111 "Неможливо ініціалізувати FreeType" IDS_2112 "Неможливо ініціалізувати SDL, потрібно SDL2.dll" IDS_2113 "Ви впевнені, що хочете виконати холодне перезавантаження емульованої машини?" IDS_2114 "Ви впевнені, що хочете вийти з 86Box?" IDS_2115 "Неможливо ініціалізувати Ghostscript" IDS_2116 "Магнітооптичний %i (%ls): %ls" - IDS_2117 "Образи магнітооптичних дисків (*.IM?;*.MDI)\0*.IM?;*.MDI\0Все файлы (*.*)\0*.*\0" + IDS_2117 "Образи магнітооптичних дисків (*.IM?;*.MDI)\0*.IM?;*.MDI\0Усі файлі (*.*)\0*.*\0" IDS_2118 "Ласкаво просимо в 86Box!" IDS_2119 "Вбудований контролер" IDS_2120 "Вихід" @@ -503,7 +503,7 @@ BEGIN #else #define LIB_NAME_GS "libgs" #endif - IDS_2133 LIB_NAME_GS " потрібно для автоматичного перетворення файлів PostScript в PDF.\n\nВсі документи, відправлені на загальний принтер PostScript, будуть збережені у вигляді файлів PostScript (.ps)." + IDS_2133 LIB_NAME_GS " потрібно для автоматичного перетворення файлів PostScript в PDF.\n\nсі документи, відправлені на загальний принтер PostScript, будуть збережені у вигляді файлів PostScript (.ps)." #ifdef _WIN32 #define LIB_NAME_FLUIDSYNTH "libfluidsynth.dll" #else @@ -527,7 +527,7 @@ BEGIN IDS_2149 "Касета: %s" IDS_2150 "Образи касет (*.PCM;*.RAW;*.WAV;*.CAS)\0*.PCM;*.RAW;*.WAV;*.CAS\0Усі файли (*.*)\0*. *\0" IDS_2151 "Картридж %i: %ls" - IDS_2152 "Образи картриджів (*.A;*.B;*.JRC)\0*.A;*.B;*.JRC\0Всі файли (*.*)\0*.*\0" + IDS_2152 "Образи картриджів (*.A;*.B;*.JRC)\0*.A;*.B;*.JRC\0Усі файли (*.*)\0*.*\0" IDS_2153 "Помилка ініціалізації рендерера" IDS_2154 "Неможливо ініціалізувати рендерер OpenGL (3.0). Будь ласка, використовуйте інший рендерер." IDS_2155 "Відновити виконання" @@ -541,7 +541,7 @@ BEGIN IDS_2163 "No Dynarec" IDS_2164 "Old Dynarec" IDS_2165 "New Dynarec" - IDS_2166 "Video card #2 ""%hs"" is not available due to missing ROMs in the roms/video directory. Disabling the second video card." + IDS_2166 "Відеокарта #2 ""%hs"" недоступна через відсутність файлу її ПЗУ в каталозі roms/video. Відключення другої відеокарти." END STRINGTABLE DISCARDABLE @@ -556,7 +556,7 @@ BEGIN IDS_4103 "Вибрати існуючий жорсткий диск" IDS_4104 "Розмір образів дисків HDI не може перевищувати 4 ГБ." IDS_4105 "Розмір образів дисків не може перевищувати 127 ГБ." - IDS_4106 "Образи жорстких дисків (*.HD?;*.IM?;*.VHD)\0*.HD?;*.IM?;*.VHD\0Всі файли (*.*)\0*.*\0 " + IDS_4106 "Образи жорстких дисків (*.HD?;*.IM?;*.VHD)\0*.HD?;*.IM?;*.VHD\0Усі файли (*.*)\0*.*\0 " IDS_4107 "Неможливо прочитати файл" IDS_4108 "Неможливо записати файл" IDS_4109 "Образи HDI або HDX з розміром сектора, відмінним від 512, не підтримуються." @@ -580,7 +580,7 @@ BEGIN IDS_4127 "Диференційований образ VHD (.vhd)" IDS_4128 "Великі блоки (2 МБ)" IDS_4129 "Маленькі блоки (512 КБ)" - IDS_4130 "Файли VHD (*.VHD)\0*.VHD\0Всі файли (*.*)\0*.*\0" + IDS_4130 "Файли VHD (*.VHD)\0*.VHD\0Усі файли (*.*)\0*.*\0" IDS_4131 "Виберіть батьківський VHD" IDS_4132 "Це може означати, що батьківський образ був змінений після того, як було створено диференційований образ.\n\nЦе також може статися, якщо файли зображення були переміщені або скопійовані, або через помилку в програмі, що створила цей диск.\n \nВи хочете виправити тимчасові позначки?" IDS_4133 "Тимчасові мітки батьківського та дочірнього дисків не співпадають" From 3dbb03d6e418907698e697ee2ce5cc3bd1368e61 Mon Sep 17 00:00:00 2001 From: SuperMaxusa <41739128+SuperMaxusa@users.noreply.github.com> Date: Sun, 23 Apr 2023 01:07:52 +0300 Subject: [PATCH 17/60] Update uk-UA.po --- src/qt/languages/uk-UA.po | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/src/qt/languages/uk-UA.po b/src/qt/languages/uk-UA.po index 0ebe3e5cc..4193fe934 100644 --- a/src/qt/languages/uk-UA.po +++ b/src/qt/languages/uk-UA.po @@ -305,7 +305,7 @@ msgid "&Default" msgstr "&За замовчуванням" msgid "Language:" -msgstr "Язык:" +msgstr "Мова:" msgid "Icon set:" msgstr "Набір іконок:" @@ -446,7 +446,7 @@ msgid "PCap device:" msgstr "Пристрій PCap:" msgid "Network adapter:" -msgstr "Мережева карта:" +msgstr "Мережевий адаптер:" msgid "COM1 Device:" msgstr "Пристрій COM1:" From 9f55afc7a1b7ee85005904302444a9dc7c6347ba Mon Sep 17 00:00:00 2001 From: RichardG867 Date: Sat, 22 Apr 2023 21:37:41 -0300 Subject: [PATCH 18/60] Add LIKELY/UNLIKELY macros --- src/include/86box/86box.h | 8 ++++++++ 1 file changed, 8 insertions(+) diff --git a/src/include/86box/86box.h b/src/include/86box/86box.h index b88fa24ef..a4c0a5761 100644 --- a/src/include/86box/86box.h +++ b/src/include/86box/86box.h @@ -55,6 +55,14 @@ #define BCD16(x) ((((x) / 1000) << 12) | (((x) / 100) << 8) | BCD8(x)) #define BCD32(x) ((((x) / 10000000) << 28) | (((x) / 1000000) << 24) | (((x) / 100000) << 20) | (((x) / 10000) << 16) | BCD16(x)) +#if defined(__GNUC__) || defined(__clang__) +# define UNLIKELY(x) __builtin_expect((x), 0) +# define LIKELY(x) __builtin_expect((x), 1) +#else +# define UNLIKELY(x) (x) +# define LIKELY(x) (x) +#endif + #ifdef __cplusplus extern "C" { #endif From 4253c7bae73daa5658c6de4d13bc299e33981347 Mon Sep 17 00:00:00 2001 From: RichardG867 Date: Sat, 22 Apr 2023 22:28:18 -0300 Subject: [PATCH 19/60] 386_common: Handle IOPB segment limit corner case more like the old code --- src/cpu/386_common.c | 31 +++++++++++++++++-------------- 1 file changed, 17 insertions(+), 14 deletions(-) diff --git a/src/cpu/386_common.c b/src/cpu/386_common.c index 454815de0..25afccc95 100644 --- a/src/cpu/386_common.c +++ b/src/cpu/386_common.c @@ -1053,13 +1053,13 @@ enter_smm(int in_hlt) memset(saved_state, 0x00, SMM_SAVE_STATE_MAP_SIZE * sizeof(uint32_t)); - if (is_cxsmm) /* Cx6x86 */ + if (is_cxsmm) /* Cx6x86 */ smram_save_state_cyrix(saved_state, in_hlt); else if (is_pentium || is_am486) /* Am486 / 5x86 / Intel P5 (Pentium) */ smram_save_state_p5(saved_state, in_hlt); - else if (is_k5 || is_k6) /* AMD K5 and K6 */ + else if (is_k5 || is_k6) /* AMD K5 and K6 */ smram_save_state_amd_k(saved_state, in_hlt); - else if (is_p6) /* Intel P6 (Pentium Pro, Pentium II, Celeron) */ + else if (is_p6) /* Intel P6 (Pentium Pro, Pentium II, Celeron) */ smram_save_state_p6(saved_state, in_hlt); cr0 &= ~0x8000000d; @@ -1224,13 +1224,13 @@ leave_smm(void) } x386_common_log("New SMBASE: %08X (%08X)\n", saved_state[SMRAM_FIELD_P5_SMBASE_OFFSET], saved_state[66]); - if (is_cxsmm) /* Cx6x86 */ + if (is_cxsmm) /* Cx6x86 */ smram_restore_state_cyrix(saved_state); else if (is_pentium || is_am486) /* Am486 / 5x86 / Intel P5 (Pentium) */ smram_restore_state_p5(saved_state); - else if (is_k5 || is_k6) /* AMD K5 and K6 */ + else if (is_k5 || is_k6) /* AMD K5 and K6 */ smram_restore_state_amd_k(saved_state); - else if (is_p6) /* Intel P6 (Pentium Pro, Pentium II, Celeron) */ + else if (is_p6) /* Intel P6 (Pentium Pro, Pentium II, Celeron) */ smram_restore_state_p6(saved_state); in_smm = 0; @@ -1429,24 +1429,27 @@ x86illegal(void) int checkio(uint32_t port, int mask) { - uint16_t t; + uint32_t t; cpl_override = 1; t = readmemw(tr.base, 0x66); - if (cpu_state.abrt) { + if (UNLIKELY(cpu_state.abrt)) { cpl_override = 0; return 0; } - if ((t + (port >> 3UL) + 1) > tr.limit) { - cpl_override = 0; - return mask; + t += (port >> 3UL); + mask <<= (port & 7); + if (UNLIKELY(mask & 0xff00)) { + if (LIKELY(t < tr.limit)) + mask &= readmemwl(tr.base + t); + } else { + if (LIKELY(t <= tr.limit)) + mask &= readmembl(tr.base + t); } - - t = readmemwl(tr.base + t + (port >> 3)); cpl_override = 0; - return (t >> (port & 7)) & mask; + return mask; } #ifdef OLD_DIVEXCP From 982c3a4f38cc63bc5d729ee9a7f98613566e98f2 Mon Sep 17 00:00:00 2001 From: Cacodemon345 Date: Sun, 23 Apr 2023 16:39:56 +0600 Subject: [PATCH 20/60] qt_d3d9renderer: HiDPI and stability fixes --- src/qt/qt_d3d9renderer.cpp | 10 +++++----- 1 file changed, 5 insertions(+), 5 deletions(-) diff --git a/src/qt/qt_d3d9renderer.cpp b/src/qt/qt_d3d9renderer.cpp index fed8e72b3..bbbb80e59 100644 --- a/src/qt/qt_d3d9renderer.cpp +++ b/src/qt/qt_d3d9renderer.cpp @@ -80,7 +80,7 @@ D3D9Renderer::showEvent(QShowEvent *event) params.BackBufferCount = 1; params.FullScreen_RefreshRateInHz = D3DPRESENT_RATE_DEFAULT; params.PresentationInterval = D3DPRESENT_INTERVAL_IMMEDIATE; - params.hDeviceWindow = windowHandle; + params.hDeviceWindow = (HWND) winId(); HRESULT result = d3d9->CreateDeviceEx(D3DADAPTER_DEFAULT, D3DDEVTYPE_HAL, windowHandle, D3DCREATE_MULTITHREADED | D3DCREATE_HARDWARE_VERTEXPROCESSING, ¶ms, nullptr, &d3d9dev); if (FAILED(result)) @@ -118,10 +118,10 @@ D3D9Renderer::paintEvent(QPaintEvent *event) srcRect.bottom = source.bottom(); srcRect.left = source.left(); srcRect.right = source.right(); - dstRect.top = destination.top(); - dstRect.bottom = destination.bottom(); - dstRect.left = destination.left(); - dstRect.right = destination.right(); + dstRect.top = destination.top() * devicePixelRatioF(); + dstRect.bottom = destination.bottom() * devicePixelRatioF(); + dstRect.left = destination.left() * devicePixelRatioF(); + dstRect.right = destination.right() * devicePixelRatioF(); d3d9dev->BeginScene(); d3d9dev->Clear(0, nullptr, D3DCLEAR_TARGET, 0xFF000000, 0, 0); while (surfaceInUse) { } From 46cd82e54f3b2c15bb8e59be2f090824e4c40495 Mon Sep 17 00:00:00 2001 From: SuperMaxusa <41739128+SuperMaxusa@users.noreply.github.com> Date: Sun, 23 Apr 2023 15:27:10 +0300 Subject: [PATCH 21/60] small fix in uk-UA.rc --- src/win/languages/uk-UA.rc | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/win/languages/uk-UA.rc b/src/win/languages/uk-UA.rc index 7c4b9ba62..df9350364 100644 --- a/src/win/languages/uk-UA.rc +++ b/src/win/languages/uk-UA.rc @@ -464,7 +464,7 @@ BEGIN IDS_2107 "%u" IDS_2108 "%u МБ (CHS: %i, %i, %i)" IDS_2109 "Дисковод %i (%s): %ls" - IDS_2110 "Усі образи (*.0??;*.1??;*.??0;*.86F;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.JSON;*.TD0;*.*FD?;*.MFM;*.XDF)\0*.0??;*.1??;*.??0;*.86F;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.JSON;*.TD0;*.*FD?;*.MFM;*.XDF\0Розширені образи секторів (*.IMD;*.JSON;*.TD0)\0*.IMD;*.JSON;*.TD0\0Основні образи секторів (*.0??;*.1??;*.??0;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.XDF;*.*FD?)\0*.0??;*.1??;*.??0;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.XDF;*.*FD?\0Образи Flux (*.FDI)\0*.FDI\0Образи Surface (*.86F;*.MFM)\0*.86F;*.MFM\0Всі файли (*.*)\0*.*\0" + IDS_2110 "Усі образи (*.0??;*.1??;*.??0;*.86F;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.JSON;*.TD0;*.*FD?;*.MFM;*.XDF)\0*.0??;*.1??;*.??0;*.86F;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.JSON;*.TD0;*.*FD?;*.MFM;*.XDF\0Розширені образи секторів (*.IMD;*.JSON;*.TD0)\0*.IMD;*.JSON;*.TD0\0Основні образи секторів (*.0??;*.1??;*.??0;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.XDF;*.*FD?)\0*.0??;*.1??;*.??0;*.BIN;*.CQ?;*.D??;*.FLP;*.HDM;*.IM?;*.XDF;*.*FD?\0Образи Flux (*.FDI)\0*.FDI\0Образи Surface (*.86F;*.MFM)\0*.86F;*.MFM\0Усі файли (*.*)\0*.*\0" IDS_2111 "Неможливо ініціалізувати FreeType" IDS_2112 "Неможливо ініціалізувати SDL, потрібно SDL2.dll" IDS_2113 "Ви впевнені, що хочете виконати холодне перезавантаження емульованої машини?" From 2d222f22c7b7d41252b4cbb4adf6a4444ad9a514 Mon Sep 17 00:00:00 2001 From: Cacodemon345 Date: Sun, 23 Apr 2023 20:39:34 +0600 Subject: [PATCH 22/60] qt: Destroy existing Direct3D 9 devices if it exists --- src/qt/qt_d3d9renderer.cpp | 6 ++++++ 1 file changed, 6 insertions(+) diff --git a/src/qt/qt_d3d9renderer.cpp b/src/qt/qt_d3d9renderer.cpp index bbbb80e59..f2c9fe9f4 100644 --- a/src/qt/qt_d3d9renderer.cpp +++ b/src/qt/qt_d3d9renderer.cpp @@ -24,11 +24,16 @@ D3D9Renderer::D3D9Renderer(QWidget *parent, int monitor_index) windowHandle = (HWND) winId(); surfaceInUse = true; + finalized = true; RendererCommon::parentWidget = parent; this->setSizePolicy(QSizePolicy::Expanding, QSizePolicy::Expanding); this->m_monitor_index = monitor_index; + + d3d9surface = nullptr; + d3d9dev = nullptr; + d3d9 = nullptr; } D3D9Renderer::~D3D9Renderer() @@ -67,6 +72,7 @@ D3D9Renderer::hideEvent(QHideEvent *event) void D3D9Renderer::showEvent(QShowEvent *event) { + if (d3d9) finalize(); params = {}; if (FAILED(Direct3DCreate9Ex(D3D_SDK_VERSION, &d3d9))) { From 3b54cb085eca1ef674604ae10c29cfa3349ecba7 Mon Sep 17 00:00:00 2001 From: OBattler Date: Mon, 24 Apr 2023 02:47:17 +0200 Subject: [PATCH 23/60] Some minor bugfixes. --- src/chipset/ali1543.c | 13 +++++++++---- src/device/kbc_at.c | 26 ++++++++++++++++++++++++-- src/device/kbc_at_dev.c | 2 +- src/device/mouse_ps2.c | 3 +-- src/sio/sio_ali5123.c | 4 ++++ 5 files changed, 39 insertions(+), 9 deletions(-) diff --git a/src/chipset/ali1543.c b/src/chipset/ali1543.c index 0b5fe5761..f3296bd20 100644 --- a/src/chipset/ali1543.c +++ b/src/chipset/ali1543.c @@ -151,11 +151,13 @@ ali1533_write(int func, int addr, uint8_t val, void *priv) break; case 0x41: - /* TODO: Bit 7 selects keyboard controller type: - 0 = AT, 1 = PS/2 */ pic_kbd_latch(1); - pic_mouse_latch(!!(val & 0x40)); - dev->pci_conf[addr] = val & 0xbf; + // pic_kbd_latch(!!(val & 0x80)); + if (dev->type == 1) + pic_mouse_latch(!!(val & 0x40) || !(dev->pci_conf[0x78] & 0x02)); + else + pic_mouse_latch(!!(val & 0x40)); + dev->pci_conf[addr] = val; break; case 0x42: /* ISA Bus Speed */ @@ -431,6 +433,7 @@ ali1533_write(int func, int addr, uint8_t val, void *priv) if (dev->type == 1) { ali1543_log("PCI78 = %02X\n", val); dev->pci_conf[addr] = val & 0x33; + pic_mouse_latch(!!(dev->pci_conf[0x41] & 0x40) || !(val & 0x02)); } break; @@ -1520,6 +1523,8 @@ ali1543_reset(void *priv) ali1533_write(0, 0x74, 0x00, dev); ali1533_write(0, 0x75, 0x00, dev); ali1533_write(0, 0x76, 0x00, dev); + if (dev->type == 1) + ali1533_write(0, 0x78, 0x00, dev); unmask_a20_in_smm = 1; } diff --git a/src/device/kbc_at.c b/src/device/kbc_at.c index 2c9433bd9..9b8a3de3d 100644 --- a/src/device/kbc_at.c +++ b/src/device/kbc_at.c @@ -801,12 +801,30 @@ write64_generic(void *priv, uint8_t val) IBM PS/1: xxxxxxxx IBM PS/2 MCA: xxxxx1xx Intel AMI Pentium BIOS'es with AMI MegaKey KB-5 keyboard controller: x1x1xxxx - Acer: xxx0x0xx + Acer: xxxxx0xx Packard Bell PB450: xxxxx1xx P6RP4: xx1xx1xx Epson Action Tower 2600: xxxx01xx TriGem Hawk: xxxx11xx + Machine input based on current code: 11111111 + Everything non-Green: Pull down bit 7 if not PS/2 and keyboard is inhibited. + Pull down bit 6 if primary display is CGA. + Xi8088: Pull down bit 6 if primary display is MDA. + Acer: Pull down bit 6 if primary display is MDA. + Pull down bit 2 always (must be so to enable CMOS Setup). + IBM PS/1: Pull down bit 6 if current floppy drive is 3.5". + Epson Action Tower 2600: Pull down bit 3 always (for Epson logo). + NCR: Pull down bit 5 always (power-on default speed = high). + Pull down bit 3 if there is no FPU. + Pull down bits 1 and 0 always? + Compaq: Pull down bit 6 if Compaq dual-scan display is in use. + Pull down bit 5 if system board DIP switch is ON. + Pull down bit 4 if CPU speed selected is auto. + Pull down bit 3 if CPU speed selected is slow (4 MHz). + Pull down bit 2 if FPU is present. + Pull down bits 1 and 0 always? + Bit 7: AT KBC only - keyboard inhibited (often physical lock): 0 = yes, 1 = no (also Compaq); Bit 6: Mostly, display: 0 = CGA, 1 = MDA, inverted on Xi8088 and Acer KBC's; Intel AMI MegaKey KB-5: Used for green features, SMM handler expects it to be set; @@ -817,7 +835,6 @@ write64_generic(void *priv, uint8_t val) Compaq: System board DIP switch 5: 0 = ON, 1 = OFF. Bit 4: (Which board?): RAM on motherboard: 0 = 512 kB, 1 = 256 kB; NCR: RAM on motherboard: 0 = unsupported, 1 = 512 kB; - Acer: Must be 0; Intel AMI MegaKey KB-5: Must be 1; IBM PS/1: Ignored; Compaq: 0 = Auto speed selected, 1 = High speed selected. @@ -851,6 +868,7 @@ write64_generic(void *priv, uint8_t val) fixed_bits |= 0x40; if (kbc_ven == KBC_VEN_IBM_PS1) { current_drive = fdc_get_current_drive(); + /* (B0 or F0) | (fdd_is_525(current_drive) on bit 6) */ add_to_kbc_queue_front(dev, dev->p1 | fixed_bits | (fdd_is_525(current_drive) ? 0x40 : 0x00), 0, 0x00); } else if (kbc_ven == KBC_VEN_NCR) { @@ -864,6 +882,7 @@ write64_generic(void *priv, uint8_t val) * bit 1: high/auto speed * bit 0: dma mode */ + /* (B0 or F0) | 0x04 | (display on bit 6) | (fpu on bit 3) */ add_to_kbc_queue_front(dev, (dev->p1 | fixed_bits | (video_is_mda() ? 0x40 : 0x00) | (hasfpu ? 0x08 : 0x00)) & 0xdf, 0, 0x00); } else if (kbc_ven == KBC_VEN_TRIGEM_AMI) { @@ -874,10 +893,13 @@ write64_generic(void *priv, uint8_t val) 0, 0: Generic AMI logo. */ if (dev->misc_flags & FLAG_PCI) fixed_bits |= 8; + /* (B0 or F0) | (0x04 or 0x0c) */ add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); } else if (((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) && ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_GREEN)) + /* (B0 or F0) | (0x08 or 0x0c) */ add_to_kbc_queue_front(dev, ((dev->p1 | fixed_bits) & 0xf0) | (((dev->flags & KBC_VEN_MASK) == KBC_VEN_ACER) ? 0x08 : 0x0c), 0, 0x00); else + /* (B0 or F0) | (0x04 or 0x44) */ add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc); return 0; diff --git a/src/device/kbc_at_dev.c b/src/device/kbc_at_dev.c index 87fdd51c6..ca3dc1361 100644 --- a/src/device/kbc_at_dev.c +++ b/src/device/kbc_at_dev.c @@ -119,7 +119,7 @@ kbc_at_dev_poll(void *priv) case DEV_STATE_MAIN_2: /* Output from scan queue if needed and then return to main loop #1. */ if (*dev->scan && (dev->port->out_new == -1) && (dev->queue_start != dev->queue_end)) { - kbc_at_dev_log("%s %1: %02X (DATA) on channel 1\n", dev->name, dev->inst, dev->queue[dev->queue_start]); + kbc_at_dev_log("%s: %02X (DATA) on channel 1\n", dev->name, dev->queue[dev->queue_start]); dev->port->out_new = dev->queue[dev->queue_start]; dev->queue_start = (dev->queue_start + 1) & 0xf; } diff --git a/src/device/mouse_ps2.c b/src/device/mouse_ps2.c index 4027c6173..5563909ba 100644 --- a/src/device/mouse_ps2.c +++ b/src/device/mouse_ps2.c @@ -135,6 +135,7 @@ ps2_set_defaults(atkbc_dev_t *dev) dev->mode = MODE_STREAM; dev->rate = 1; dev->flags &= 0x88; + mouse_scan = 0; } static void @@ -144,8 +145,6 @@ ps2_bat(void *priv) ps2_set_defaults(dev); - mouse_scan = 1; - kbc_at_dev_queue_add(dev, 0xaa, 0); kbc_at_dev_queue_add(dev, 0x00, 0); } diff --git a/src/sio/sio_ali5123.c b/src/sio/sio_ali5123.c index 33e4022c6..54949a125 100644 --- a/src/sio/sio_ali5123.c +++ b/src/sio/sio_ali5123.c @@ -174,6 +174,7 @@ ali5123_reset(ali5123_t *dev) serial_setup(dev->uart[1], 0x03e8, dev->ld_regs[5][0x70]); /* Logical device 7: Keyboard */ + dev->ld_regs[7][0x30] = 1; dev->ld_regs[7][0x70] = 1; /* TODO: Register F0 bit 6: 0 = PS/2, 1 = AT */ @@ -253,6 +254,9 @@ ali5123_write(uint16_t port, uint8_t val, void *priv) case 0x06: case 0x08 ... 0x0a: return; + case 0x07: + if (dev->cur_reg == 0xf0) + val &= 0xbf; } dev->ld_regs[cur_ld][dev->cur_reg] = val; } From 78a897f07aaf24c9e3b0cbcfa52fe0f6678df5b9 Mon Sep 17 00:00:00 2001 From: OBattler Date: Wed, 26 Apr 2023 01:42:23 +0200 Subject: [PATCH 24/60] Some minor fixes, the PS/2 mouse command F0h (set remote mode) is now implemented, the PS/2 mouse command F3h (set sample rate) now actually changes the host mouse polling rate, and the Intel SIO IB and ZB now forcibly initialize a keyboard and mouse IRQ latch if the board has a PS/2 keyboard controller, to simulate the presence of a latch external to the chip. --- src/chipset/intel_sio.c | 20 +++++++++++++++++--- src/device/kbc_at.c | 3 ++- src/device/kbc_at_dev.c | 4 ++-- src/device/mouse.c | 24 ++++++++++++++++++------ src/device/mouse_ps2.c | 14 +++++++++++++- src/include/86box/mouse.h | 2 ++ src/pic.c | 4 ++-- 7 files changed, 56 insertions(+), 15 deletions(-) diff --git a/src/chipset/intel_sio.c b/src/chipset/intel_sio.c index eb7aad983..3f253d832 100644 --- a/src/chipset/intel_sio.c +++ b/src/chipset/intel_sio.c @@ -200,9 +200,11 @@ sio_write(int func, int addr, uint8_t val, void *priv) dev->regs[addr] = val; break; case 0x4c: + dev->regs[addr] = (val & 0x7f); + break; case 0x4d: dev->regs[addr] = (val & 0x7f); - pic_mouse_latch(!!(val & 0x10)); + // pic_mouse_latch(!!(val & 0x10)); break; case 0x4f: dev->regs[addr] = val; @@ -394,7 +396,7 @@ sio_reset_hard(void *priv) dev->regs[0x4b] = 0x0f; dev->regs[0x4c] = 0x56; dev->regs[0x4d] = 0x40; - pic_mouse_latch(0x00); + // pic_mouse_latch(0x00); dev->regs[0x4e] = 0x07; dev->regs[0x4f] = 0x4f; dev->regs[0x57] = 0x04; @@ -544,7 +546,19 @@ sio_init(const device_t *info) // device_add(&i8254_sec_device); - pic_kbd_latch(0x01); + // pic_kbd_latch(0x01); + + /* The situation is as follow: SIO.AB has the IRQ 1 latch but SIO.IB and SIO.ZB do not, + and I suspect that because of that, the IRQ 12 latch on SIO.IB and SIO.ZB, while + evidently planned and documented in the datashet, was basically non-functional, and + motherboard manufacturers had to install their own latches to use PS/2 keyboards + and/or mice. One such example is the AMI Excalibur PCI Pentium, which never enables + the SIO.ZB's IRQ 12 latch but clearly expects one since otherwise, the PS/2 mouse + behaves erractically in the WinBIOS CMOS Setup. */ + if (machine_has_bus(machine, MACHINE_BUS_PS2)) { + pic_kbd_latch(0x01); + pic_mouse_latch(0x01); + } return dev; } diff --git a/src/device/kbc_at.c b/src/device/kbc_at.c index 9b8a3de3d..24121e699 100644 --- a/src/device/kbc_at.c +++ b/src/device/kbc_at.c @@ -1024,7 +1024,7 @@ write64_ami(void *priv, uint8_t val) kbc_at_queue_add(dev, 0x28); kbc_at_queue_add(dev, 0x00); dev->state = STATE_KBC_OUT; - break; + return 0; case 0xa1: /* get controller version */ kbc_at_log("ATkbc: AMI - get controller version\n"); @@ -1118,6 +1118,7 @@ write64_ami(void *priv, uint8_t val) add_to_kbc_queue_front(dev, 0x00, 0, 0x00); return 0; + /* TODO: The ICS SB486PV sends command B4 but expects to read *TWO* bytes. */ case 0xb4: case 0xb5: /* set KBC lines P22-P23 (P2 bits 2-3) low */ kbc_at_log("ATkbc: set KBC lines P22-P23 (P2 bits 2-3) low\n"); diff --git a/src/device/kbc_at_dev.c b/src/device/kbc_at_dev.c index ca3dc1361..71a0b4e08 100644 --- a/src/device/kbc_at_dev.c +++ b/src/device/kbc_at_dev.c @@ -173,9 +173,9 @@ kbc_at_dev_reset(atkbc_dev_t *dev, int do_fa) if (do_fa) kbc_at_dev_queue_add(dev, 0xfa, 0); - dev->execute_bat(dev); - dev->state = DEV_STATE_MAIN_OUT; + + dev->execute_bat(dev); } atkbc_dev_t * diff --git a/src/device/mouse.c b/src/device/mouse.c index 13d9999c7..0ee714377 100644 --- a/src/device/mouse.c +++ b/src/device/mouse.c @@ -102,6 +102,8 @@ static int mouse_nbut; static int (*mouse_dev_poll)(int x, int y, int z, int b, void *priv); static void (*mouse_poll_ex)(void) = NULL; +static double sample_rate = 200.0; + #ifdef ENABLE_MOUSE_LOG int mouse_do_log = ENABLE_MOUSE_LOG; @@ -153,7 +155,7 @@ static void mouse_timer_poll(void *priv) { /* Poll at 255 Hz, maximum supported by PS/2 mic. */ - timer_on_auto(&mouse_timer, 1000000.0 / 255.0); + timer_on_auto(&mouse_timer, 1000000.0 / sample_rate); #ifdef USE_GDBSTUB /* avoid a KBC FIFO overflow when CPU emulation is stalled */ if (gdbstub_step == GDBSTUB_EXEC) @@ -161,6 +163,15 @@ mouse_timer_poll(void *priv) mouse_process(); } +void +mouse_set_sample_rate(double new_rate) +{ + timer_stop(&mouse_timer); + + sample_rate = new_rate; + timer_on_auto(&mouse_timer, 1000000.0 / sample_rate); +} + void mouse_reset(void) { @@ -179,15 +190,16 @@ mouse_reset(void) if (mouse_type == 0) return; + timer_add(&mouse_timer, mouse_timer_poll, NULL, 0); + + /* Poll at 100 Hz, the default of a PS/2 mouse. */ + sample_rate = 100.0; + timer_on_auto(&mouse_timer, 1000000.0 / sample_rate); + mouse_curr = mouse_devices[mouse_type].device; if (mouse_curr != NULL) mouse_priv = device_add(mouse_curr); - - timer_add(&mouse_timer, mouse_timer_poll, NULL, 0); - - /* Poll at 255 Hz, maximum supported by PS/2 mic. */ - timer_on_auto(&mouse_timer, 1000000.0 / 255.0); } /* Callback from the hardware driver. */ diff --git a/src/device/mouse_ps2.c b/src/device/mouse_ps2.c index 5563909ba..7d9730f28 100644 --- a/src/device/mouse_ps2.c +++ b/src/device/mouse_ps2.c @@ -133,7 +133,9 @@ static void ps2_set_defaults(atkbc_dev_t *dev) { dev->mode = MODE_STREAM; - dev->rate = 1; + dev->rate = 100; + mouse_set_sample_rate(100.0); + dev->resolution = 2; dev->flags &= 0x88; mouse_scan = 0; } @@ -177,6 +179,7 @@ ps2_write(void *priv) case 0xf3: /* set sample rate */ dev->rate = val; + mouse_set_sample_rate((double) val); kbc_at_dev_queue_add(dev, 0xfa, 0); /* Command response */ mouse_ps2_log("%s: Set sample rate [%02X]\n", dev->name, val); break; @@ -227,6 +230,7 @@ ps2_write(void *priv) case 0xea: /* set stream */ mouse_ps2_log("%s: Set stream\n", dev->name); dev->flags &= ~FLAG_CTRLDAT; + dev->mode = MODE_STREAM; mouse_scan = 1; kbc_at_dev_queue_add(dev, 0xfa, 0); /* ACK for command byte */ break; @@ -238,6 +242,14 @@ ps2_write(void *priv) ps2_report_coordinates(dev, 0); break; + case 0xf0: /* set remote */ + mouse_ps2_log("%s: Set remote\n", dev->name); + dev->flags &= ~FLAG_CTRLDAT; + dev->mode = MODE_REMOTE; + mouse_scan = 1; + kbc_at_dev_queue_add(dev, 0xfa, 0); /* ACK for command byte */ + break; + case 0xf2: /* read ID */ mouse_ps2_log("%s: Read ID\n", dev->name); kbc_at_dev_queue_add(dev, 0xfa, 0); diff --git a/src/include/86box/mouse.h b/src/include/86box/mouse.h index 317e267a0..b697c5d38 100644 --- a/src/include/86box/mouse.h +++ b/src/include/86box/mouse.h @@ -80,6 +80,8 @@ extern void mouse_poll(void); extern void mouse_bus_set_irq(void *priv, int irq); +extern void mouse_set_sample_rate(double new_rate); + extern char *mouse_get_name(int mouse); extern char *mouse_get_internal_name(int mouse); extern int mouse_get_from_internal_name(char *s); diff --git a/src/pic.c b/src/pic.c index 25a90e1c7..4f9b8aa8f 100644 --- a/src/pic.c +++ b/src/pic.c @@ -202,7 +202,7 @@ find_best_interrupt(pic_t *dev) intr = dev->interrupt = (ret == -1) ? 0x17 : ret; - if (dev->at && (ret != 1)) { + if (dev->at && (ret != -1)) { if (dev == &pic2) intr += 8; @@ -644,7 +644,7 @@ picint_common(uint16_t num, int level, int set) pic2.lines |= (num >> 8); /* Latch IRQ 12 if the mouse latch is enabled. */ - if (mouse_latch && (num & 0x1000)) + if ((num & 0x1000) && mouse_latch) pic2.lines |= 0x10; pic2.irr |= (num >> 8); From 9874efcbf5151741fb523602059ed904f6805612 Mon Sep 17 00:00:00 2001 From: Moonif Fatayri Date: Wed, 26 Apr 2023 19:27:04 +0400 Subject: [PATCH 25/60] Update README.md --- README.md | 1 + 1 file changed, 1 insertion(+) diff --git a/README.md b/README.md index 05a2a9ed2..158a8677f 100644 --- a/README.md +++ b/README.md @@ -28,6 +28,7 @@ It is also recommended to use a manager application with 86Box for easier handli * [86Box Manager](https://github.com/86Box/86BoxManager) by [Overdoze](https://github.com/daviunic) (Windows only) * [86Box Manager Lite](https://github.com/insanemal/86box_manager_py) by [Insanemal](https://github.com/insanemal) * [WinBox for 86Box](https://github.com/86Box/WinBox-for-86Box) by Laci bá' (Windows only) +* [MacBox for 86Box](https://github.com/Moonif/MacBox) by [Moonif](https://github.com/Moonif) (MacOs only) It is also possible to use 86Box on its own with the `--vmpath`/`-P` command line option. From 5d0304d52023d9f677ff6443e99e1f6723568c6a Mon Sep 17 00:00:00 2001 From: Moonif Fatayri Date: Wed, 26 Apr 2023 19:29:23 +0400 Subject: [PATCH 26/60] Update README.md --- README.md | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/README.md b/README.md index 158a8677f..72cd0c9d9 100644 --- a/README.md +++ b/README.md @@ -28,7 +28,7 @@ It is also recommended to use a manager application with 86Box for easier handli * [86Box Manager](https://github.com/86Box/86BoxManager) by [Overdoze](https://github.com/daviunic) (Windows only) * [86Box Manager Lite](https://github.com/insanemal/86box_manager_py) by [Insanemal](https://github.com/insanemal) * [WinBox for 86Box](https://github.com/86Box/WinBox-for-86Box) by Laci bá' (Windows only) -* [MacBox for 86Box](https://github.com/Moonif/MacBox) by [Moonif](https://github.com/Moonif) (MacOs only) +* [MacBox for 86Box](https://github.com/Moonif/MacBox) by [Moonif](https://github.com/Moonif) (MacOS only) It is also possible to use 86Box on its own with the `--vmpath`/`-P` command line option. From 0f2301c9bf5eeea55a8d2c326319a3b32304acc0 Mon Sep 17 00:00:00 2001 From: OBattler Date: Fri, 28 Apr 2023 23:38:55 +0200 Subject: [PATCH 27/60] The SiS 50x now initializes the PS/2 keyboard and mouse IRQ latch if a PS/2 keyboard controller is present, needed for the AMI WinBIOS CMOS setup on the Excalibur PCI II. --- src/chipset/sis_85c50x.c | 6 ++++++ 1 file changed, 6 insertions(+) diff --git a/src/chipset/sis_85c50x.c b/src/chipset/sis_85c50x.c index 56d3a0a30..ebd166d60 100644 --- a/src/chipset/sis_85c50x.c +++ b/src/chipset/sis_85c50x.c @@ -29,6 +29,7 @@ #include <86box/timer.h> #include <86box/apm.h> +#include <86box/machine.h> #include <86box/mem.h> #include <86box/smram.h> #include <86box/pci.h> @@ -416,6 +417,11 @@ sis_85c50x_init(const device_t *info) sis_85c50x_reset(dev); + if (machine_has_bus(machine, MACHINE_BUS_PS2)) { + pic_kbd_latch(0x01); + pic_mouse_latch(0x01); + } + return dev; } From 310dbd1079d6023ef8a6a7128c07c36d2ac91134 Mon Sep 17 00:00:00 2001 From: cartifanwlr <109605173+cartifanwlr@users.noreply.github.com> Date: Sat, 29 Apr 2023 12:12:50 +0300 Subject: [PATCH 28/60] Fix build by adding pic.h include in sis_85c50x.c --- src/chipset/sis_85c50x.c | 1 + 1 file changed, 1 insertion(+) diff --git a/src/chipset/sis_85c50x.c b/src/chipset/sis_85c50x.c index ebd166d60..ebb895db7 100644 --- a/src/chipset/sis_85c50x.c +++ b/src/chipset/sis_85c50x.c @@ -30,6 +30,7 @@ #include <86box/apm.h> #include <86box/machine.h> +#include <86box/pic.h> #include <86box/mem.h> #include <86box/smram.h> #include <86box/pci.h> From 19ce34787d30cc35848063c5d225de980106c8bd Mon Sep 17 00:00:00 2001 From: OBattler Date: Sat, 29 Apr 2023 18:05:20 +0200 Subject: [PATCH 29/60] Implemented the x87 instruction FXTRACT. --- src/cpu/x87_ops.h | 21 ++++++++++++++++----- src/cpu/x87_ops_misc.h | 14 ++++++++++++++ 2 files changed, 30 insertions(+), 5 deletions(-) diff --git a/src/cpu/x87_ops.h b/src/cpu/x87_ops.h index c00cdff16..faac0ea60 100644 --- a/src/cpu/x87_ops.h +++ b/src/cpu/x87_ops.h @@ -46,6 +46,17 @@ static int rounding_modes[4] = { FE_TONEAREST, FE_DOWNWARD, FE_UPWARD, FE_TOWARD #define STATUS_ZERODIVIDE 4 +typedef union +{ + double d; + + struct { + unsigned int mantissa:52; + unsigned int exponent:11; + unsigned int negative:1; + }; +} double_decompose; + #if defined(_MSC_VER) && !defined(__clang__) # if defined i386 || defined __i386 || defined __i386__ || defined _X86_ || defined _M_IX86 # define X87_INLINE_ASM @@ -570,7 +581,7 @@ const OpFn OP_TABLE(fpu_8087_d9)[256] = { ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a16, ILLEGAL_a16, opFTST, opFXAM, ILLEGAL_a16, ILLEGAL_a16, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a16, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, ILLEGAL_a16, ILLEGAL_a16, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, ILLEGAL_a16, opFRNDINT, opFSCALE, ILLEGAL_a16, ILLEGAL_a16 // clang-format on }; @@ -839,7 +850,7 @@ const OpFn OP_TABLE(fpu_287_d9_a16)[256] = { ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a16, ILLEGAL_a16, opFTST, opFXAM, ILLEGAL_a16, ILLEGAL_a16, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a16, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, ILLEGAL_a16, opFPREM1, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, opFSINCOS, opFRNDINT, opFSCALE, opFSIN, opFCOS // clang-format on }; @@ -879,7 +890,7 @@ const OpFn OP_TABLE(fpu_287_d9_a32)[256] = { ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a32, ILLEGAL_a32, opFTST, opFXAM, ILLEGAL_a32, ILLEGAL_a32, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a32, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, ILLEGAL_a32, opFPREM1, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, opFSINCOS, opFRNDINT, opFSCALE, opFSIN, opFCOS // clang-format on }; @@ -919,7 +930,7 @@ const OpFn OP_TABLE(fpu_d9_a16)[256] = { opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a16, ILLEGAL_a16, opFTST, opFXAM, ILLEGAL_a16, ILLEGAL_a16, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a16, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, ILLEGAL_a16, opFPREM1, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, opFSINCOS, opFRNDINT, opFSCALE, opFSIN, opFCOS // clang-format on }; @@ -959,7 +970,7 @@ const OpFn OP_TABLE(fpu_d9_a32)[256] = { opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a32, ILLEGAL_a32, opFTST, opFXAM, ILLEGAL_a32, ILLEGAL_a32, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a32, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, ILLEGAL_a32, opFPREM1, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, opFSINCOS, opFRNDINT, opFSCALE, opFSIN, opFCOS // clang-format on }; diff --git a/src/cpu/x87_ops_misc.h b/src/cpu/x87_ops_misc.h index 091d7cc31..a7295b0a3 100644 --- a/src/cpu/x87_ops_misc.h +++ b/src/cpu/x87_ops_misc.h @@ -33,6 +33,20 @@ opFNOP(uint32_t fetchdat) return 0; } +static int +opFXTRACT(uint32_t fetchdat) +{ + double_decompose_t temp = (double_decompose_t) ST(0); + + FP_ENTER(); + cpu_state.pc++; + ST(0) = (double) temp.exponent; + x87_push((double) temp.mantissa); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fxtract) : (x87_timings.fxtract * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fxtract) : (x87_concurrency.fxtract * cpu_multi)); + return 0; +} + static int opFCLEX(uint32_t fetchdat) { From 4aedbc44be31d796645299a2c72655e4c9651a89 Mon Sep 17 00:00:00 2001 From: OBattler Date: Sat, 29 Apr 2023 18:08:36 +0200 Subject: [PATCH 30/60] Removed a now obsolete #ifdef. --- src/cpu/x87_ops_misc.h | 2 -- 1 file changed, 2 deletions(-) diff --git a/src/cpu/x87_ops_misc.h b/src/cpu/x87_ops_misc.h index a7295b0a3..3a528f847 100644 --- a/src/cpu/x87_ops_misc.h +++ b/src/cpu/x87_ops_misc.h @@ -755,7 +755,6 @@ opFPREM(uint32_t fetchdat) CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fprem) : (x87_concurrency.fprem * cpu_multi)); return 0; } -#ifndef FPU_8087 static int opFPREM1(uint32_t fetchdat) { @@ -776,7 +775,6 @@ opFPREM1(uint32_t fetchdat) CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fprem1) : (x87_concurrency.fprem1 * cpu_multi)); return 0; } -#endif static int opFSQRT(uint32_t fetchdat) From 6e853aa7569d74569108508c3d5a399e514934dd Mon Sep 17 00:00:00 2001 From: OBattler Date: Sat, 29 Apr 2023 18:14:44 +0200 Subject: [PATCH 31/60] Use uint64_t's, they can actually hold that many bits. --- src/cpu/x87_ops.h | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/src/cpu/x87_ops.h b/src/cpu/x87_ops.h index faac0ea60..1a729475c 100644 --- a/src/cpu/x87_ops.h +++ b/src/cpu/x87_ops.h @@ -51,9 +51,9 @@ typedef union double d; struct { - unsigned int mantissa:52; - unsigned int exponent:11; - unsigned int negative:1; + uint64_t mantissa:52; + uint64_t exponent:11; + uint64_t negative:1; }; } double_decompose; From 071c05e65fc300dd4c408ca28ee90ec4a15bfe00 Mon Sep 17 00:00:00 2001 From: OBattler Date: Sat, 29 Apr 2023 18:16:41 +0200 Subject: [PATCH 32/60] Fixed the typedef's name. --- src/cpu/x87_ops.h | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/cpu/x87_ops.h b/src/cpu/x87_ops.h index 1a729475c..b2b082107 100644 --- a/src/cpu/x87_ops.h +++ b/src/cpu/x87_ops.h @@ -55,7 +55,7 @@ typedef union uint64_t exponent:11; uint64_t negative:1; }; -} double_decompose; +} double_decompose_t; #if defined(_MSC_VER) && !defined(__clang__) # if defined i386 || defined __i386 || defined __i386__ || defined _X86_ || defined _M_IX86 From 61c0999d57a8dca08298c60d8d2fe07b9b040b6b Mon Sep 17 00:00:00 2001 From: Cacodemon345 Date: Sat, 29 Apr 2023 22:43:29 +0600 Subject: [PATCH 33/60] OHCI: Replace magic numbers with named enums --- src/usb.c | 216 +++++++++++++++++++++++++++++------------------------- 1 file changed, 118 insertions(+), 98 deletions(-) diff --git a/src/usb.c b/src/usb.c index 75e60d438..eecb2902c 100644 --- a/src/usb.c +++ b/src/usb.c @@ -131,6 +131,35 @@ uhci_update_io_mapping(usb_t *dev, uint8_t base_l, uint8_t base_h, int enable) io_sethandler(dev->uhci_io_base, 0x20, uhci_reg_read, NULL, NULL, uhci_reg_write, uhci_reg_writew, NULL, dev); } +/* OHCI registers */ +enum +{ + OHCI_HcRevision = 0x00, + OHCI_HcControl = 0x04, + OHCI_HcCommandStatus = 0x08, + OHCI_HcInterruptStatus = 0x0C, + OHCI_HcInterruptEnable = 0x10, + OHCI_HcInterruptDisable = 0x14, + OHCI_HcHCCA = 0x18, + OHCI_HcPeriodCurrentED = 0x1C, + OHCI_HcControlHeadED = 0x20, + OHCI_HcControlCurrentED = 0x24, + OHCI_HcBulkHeadED = 0x28, + OHCI_HcBulkCurrentED = 0x2C, + OHCI_HcDoneHead = 0x30, + OHCI_HcFMInterval = 0x34, + OHCI_HcFmRemaining = 0x38, + OHCI_HcFmNumber = 0x3C, + OHCI_HcPeriodicStart = 0x40, + OHCI_HcLSThreshold = 0x44, + OHCI_HcRhDescriptorA = 0x48, + OHCI_HcRhDescriptorB = 0x4C, + OHCI_HcRhStatus = 0x50, + OHCI_HcRhPortStatus1 = 0x54, + OHCI_HcRhPortStatus2 = 0x58, + OHCI_HcRhPortStatus3 = 0x5C +}; + static uint8_t ohci_mmio_read(uint32_t addr, void *p) { @@ -156,132 +185,132 @@ ohci_mmio_write(uint32_t addr, uint8_t val, void *p) addr &= 0x00000fff; switch (addr) { - case 0x04: + case OHCI_HcControl: if ((val & 0xc0) == 0x00) { /* UsbReset */ - dev->ohci_mmio[0x56] = dev->ohci_mmio[0x5a] = 0x16; + dev->ohci_mmio[OHCI_HcRhPortStatus1 + 2] = dev->ohci_mmio[OHCI_HcRhPortStatus2 + 2] = 0x16; } break; - case 0x08: /* HCCOMMANDSTATUS */ + case OHCI_HcCommandStatus: /* bit OwnershipChangeRequest triggers an ownership change (SMM <-> OS) */ if (val & 0x08) { - dev->ohci_mmio[0x0f] = 0x40; - if ((dev->ohci_mmio[0x13] & 0xc0) == 0xc0) + dev->ohci_mmio[OHCI_HcInterruptStatus + 3] = 0x40; + if ((dev->ohci_mmio[OHCI_HcInterruptEnable + 3] & 0xc0) == 0xc0) smi_raise(); } /* bit HostControllerReset must be cleared for the controller to be seen as initialized */ if (val & 0x01) { memset(dev->ohci_mmio, 0x00, 4096); - dev->ohci_mmio[0x00] = 0x10; - dev->ohci_mmio[0x01] = 0x01; - dev->ohci_mmio[0x48] = 0x02; + dev->ohci_mmio[OHCI_HcRevision] = 0x10; + dev->ohci_mmio[OHCI_HcRevision + 1] = 0x01; + dev->ohci_mmio[OHCI_HcRhDescriptorA] = 0x02; val &= ~0x01; } break; - case 0x0c: + case OHCI_HcInterruptStatus: dev->ohci_mmio[addr] &= ~(val & 0x7f); return; - case 0x0d: - case 0x0e: + case OHCI_HcInterruptStatus + 1: + case OHCI_HcInterruptStatus + 2: return; - case 0x0f: + case OHCI_HcInterruptStatus + 3: dev->ohci_mmio[addr] &= ~(val & 0x40); return; - case 0x3b: + case OHCI_HcFmRemaining + 3: dev->ohci_mmio[addr] = (val & 0x80); return; - case 0x39: - case 0x41: + case OHCI_HcFmRemaining + 1: + case OHCI_HcPeriodicStart + 1: dev->ohci_mmio[addr] = (val & 0x3f); return; - case 0x45: + case OHCI_HcLSThreshold + 1: dev->ohci_mmio[addr] = (val & 0x0f); return; - case 0x3a: - case 0x3e: - case 0x3f: - case 0x42: - case 0x43: - case 0x46: - case 0x47: - case 0x48: - case 0x4a: + case OHCI_HcFmRemaining + 2: + case OHCI_HcFmNumber + 2: + case OHCI_HcFmNumber + 3: + case OHCI_HcPeriodicStart + 2: + case OHCI_HcPeriodicStart + 3: + case OHCI_HcLSThreshold + 2: + case OHCI_HcLSThreshold + 3: + case OHCI_HcRhDescriptorA: + case OHCI_HcRhDescriptorA + 2: return; - case 0x49: + case OHCI_HcRhDescriptorA + 1: dev->ohci_mmio[addr] = (val & 0x1b); if (val & 0x02) { - dev->ohci_mmio[0x55] |= 0x01; - dev->ohci_mmio[0x59] |= 0x01; + dev->ohci_mmio[OHCI_HcRhPortStatus1 + 1] |= 0x01; + dev->ohci_mmio[OHCI_HcRhPortStatus2 + 1] |= 0x01; } return; - case 0x4b: + case OHCI_HcRhDescriptorA + 3: dev->ohci_mmio[addr] = (val & 0x03); return; - case 0x4c: - case 0x4e: + case OHCI_HcRhDescriptorB: + case OHCI_HcRhDescriptorB + 2: dev->ohci_mmio[addr] = (val & 0x06); - if ((addr == 0x4c) && !(val & 0x04)) { - if (!(dev->ohci_mmio[0x58] & 0x01)) - dev->ohci_mmio[0x5a] |= 0x01; - dev->ohci_mmio[0x58] |= 0x01; + if ((addr == OHCI_HcRhDescriptorB) && !(val & 0x04)) { + if (!(dev->ohci_mmio[OHCI_HcRhPortStatus2] & 0x01)) + dev->ohci_mmio[OHCI_HcRhPortStatus2 + 2] |= 0x01; + dev->ohci_mmio[OHCI_HcRhPortStatus2] |= 0x01; } - if ((addr == 0x4c) && !(val & 0x02)) { - if (!(dev->ohci_mmio[0x54] & 0x01)) - dev->ohci_mmio[0x56] |= 0x01; - dev->ohci_mmio[0x54] |= 0x01; + if ((addr == OHCI_HcRhDescriptorB) && !(val & 0x02)) { + if (!(dev->ohci_mmio[OHCI_HcRhPortStatus1] & 0x01)) + dev->ohci_mmio[OHCI_HcRhPortStatus1 + 2] |= 0x01; + dev->ohci_mmio[OHCI_HcRhPortStatus1] |= 0x01; } return; - case 0x4d: - case 0x4f: + case OHCI_HcRhDescriptorB + 1: + case OHCI_HcRhDescriptorB + 3: return; - case 0x50: + case OHCI_HcRhStatus: if (val & 0x01) { - if ((dev->ohci_mmio[0x49] & 0x03) == 0x00) { - dev->ohci_mmio[0x55] &= ~0x01; - dev->ohci_mmio[0x54] &= ~0x17; - dev->ohci_mmio[0x56] &= ~0x17; - dev->ohci_mmio[0x59] &= ~0x01; - dev->ohci_mmio[0x58] &= ~0x17; - dev->ohci_mmio[0x5a] &= ~0x17; - } else if ((dev->ohci_mmio[0x49] & 0x03) == 0x01) { - if (!(dev->ohci_mmio[0x4e] & 0x02)) { - dev->ohci_mmio[0x55] &= ~0x01; - dev->ohci_mmio[0x54] &= ~0x17; - dev->ohci_mmio[0x56] &= ~0x17; + if ((dev->ohci_mmio[OHCI_HcRhDescriptorA + 1] & 0x03) == 0x00) { + dev->ohci_mmio[OHCI_HcRhPortStatus1 + 1] &= ~0x01; + dev->ohci_mmio[OHCI_HcRhPortStatus1] &= ~0x17; + dev->ohci_mmio[OHCI_HcRhPortStatus1 + 2] &= ~0x17; + dev->ohci_mmio[OHCI_HcRhPortStatus2 + 1] &= ~0x01; + dev->ohci_mmio[OHCI_HcRhPortStatus2] &= ~0x17; + dev->ohci_mmio[OHCI_HcRhPortStatus2 + 2] &= ~0x17; + } else if ((dev->ohci_mmio[OHCI_HcRhDescriptorA + 1] & 0x03) == 0x01) { + if (!(dev->ohci_mmio[OHCI_HcRhDescriptorB + 2] & 0x02)) { + dev->ohci_mmio[OHCI_HcRhPortStatus1 + 1] &= ~0x01; + dev->ohci_mmio[OHCI_HcRhPortStatus1] &= ~0x17; + dev->ohci_mmio[OHCI_HcRhPortStatus1 + 2] &= ~0x17; } - if (!(dev->ohci_mmio[0x4e] & 0x04)) { - dev->ohci_mmio[0x59] &= ~0x01; - dev->ohci_mmio[0x58] &= ~0x17; - dev->ohci_mmio[0x5a] &= ~0x17; + if (!(dev->ohci_mmio[OHCI_HcRhDescriptorB + 2] & 0x04)) { + dev->ohci_mmio[OHCI_HcRhPortStatus2 + 1] &= ~0x01; + dev->ohci_mmio[OHCI_HcRhPortStatus2] &= ~0x17; + dev->ohci_mmio[OHCI_HcRhPortStatus2 + 2] &= ~0x17; } } } return; - case 0x51: + case OHCI_HcRhStatus + 1: if (val & 0x80) dev->ohci_mmio[addr] |= 0x80; return; - case 0x52: + case OHCI_HcRhStatus + 2: dev->ohci_mmio[addr] &= ~(val & 0x02); if (val & 0x01) { - if ((dev->ohci_mmio[0x49] & 0x03) == 0x00) { - dev->ohci_mmio[0x55] |= 0x01; - dev->ohci_mmio[0x59] |= 0x01; - } else if ((dev->ohci_mmio[0x49] & 0x03) == 0x01) { - if (!(dev->ohci_mmio[0x4e] & 0x02)) - dev->ohci_mmio[0x55] |= 0x01; - if (!(dev->ohci_mmio[0x4e] & 0x04)) - dev->ohci_mmio[0x59] |= 0x01; + if ((dev->ohci_mmio[OHCI_HcRhDescriptorA + 1] & 0x03) == 0x00) { + dev->ohci_mmio[OHCI_HcRhPortStatus1 + 1] |= 0x01; + dev->ohci_mmio[OHCI_HcRhPortStatus2 + 1] |= 0x01; + } else if ((dev->ohci_mmio[OHCI_HcRhDescriptorA + 1] & 0x03) == 0x01) { + if (!(dev->ohci_mmio[OHCI_HcRhDescriptorB + 2] & 0x02)) + dev->ohci_mmio[OHCI_HcRhPortStatus1 + 1] |= 0x01; + if (!(dev->ohci_mmio[OHCI_HcRhDescriptorB + 2] & 0x04)) + dev->ohci_mmio[OHCI_HcRhPortStatus2 + 1] |= 0x01; } } return; - case 0x53: + case OHCI_HcRhStatus + 3: if (val & 0x80) - dev->ohci_mmio[0x51] &= ~0x80; + dev->ohci_mmio[OHCI_HcRhStatus + 1] &= ~0x80; return; - case 0x54: - case 0x58: + case OHCI_HcRhPortStatus1: + case OHCI_HcRhPortStatus2: old = dev->ohci_mmio[addr]; if (val & 0x10) { @@ -315,30 +344,30 @@ ohci_mmio_write(uint32_t addr, uint8_t val, void *p) /* if (!(dev->ohci_mmio[addr] & 0x02)) dev->ohci_mmio[addr + 2] |= 0x02; */ return; - case 0x55: - if ((val & 0x02) && ((dev->ohci_mmio[0x49] & 0x03) == 0x00) && (dev->ohci_mmio[0x4e] & 0x02)) { + case OHCI_HcRhPortStatus1 + 1: + if ((val & 0x02) && ((dev->ohci_mmio[OHCI_HcRhDescriptorA + 1] & 0x03) == 0x00) && (dev->ohci_mmio[OHCI_HcRhDescriptorB + 2] & 0x02)) { dev->ohci_mmio[addr] &= ~0x01; - dev->ohci_mmio[0x54] &= ~0x17; - dev->ohci_mmio[0x56] &= ~0x17; + dev->ohci_mmio[OHCI_HcRhPortStatus1] &= ~0x17; + dev->ohci_mmio[OHCI_HcRhPortStatus1 + 2] &= ~0x17; } - if ((val & 0x01) && ((dev->ohci_mmio[0x49] & 0x03) == 0x00) && (dev->ohci_mmio[0x4e] & 0x02)) { + if ((val & 0x01) && ((dev->ohci_mmio[OHCI_HcRhDescriptorA + 1] & 0x03) == 0x00) && (dev->ohci_mmio[OHCI_HcRhDescriptorB + 2] & 0x02)) { dev->ohci_mmio[addr] |= 0x01; - dev->ohci_mmio[0x58] &= ~0x17; - dev->ohci_mmio[0x5a] &= ~0x17; + dev->ohci_mmio[OHCI_HcRhPortStatus2] &= ~0x17; + dev->ohci_mmio[OHCI_HcRhPortStatus2 + 2] &= ~0x17; } return; - case 0x59: - if ((val & 0x02) && ((dev->ohci_mmio[0x49] & 0x03) == 0x00) && (dev->ohci_mmio[0x4e] & 0x04)) + case OHCI_HcRhPortStatus2 + 1: + if ((val & 0x02) && ((dev->ohci_mmio[OHCI_HcRhDescriptorA + 1] & 0x03) == 0x00) && (dev->ohci_mmio[OHCI_HcRhDescriptorB + 2] & 0x04)) dev->ohci_mmio[addr] &= ~0x01; - if ((val & 0x01) && ((dev->ohci_mmio[0x49] & 0x03) == 0x00) && (dev->ohci_mmio[0x4e] & 0x04)) + if ((val & 0x01) && ((dev->ohci_mmio[OHCI_HcRhDescriptorA + 1] & 0x03) == 0x00) && (dev->ohci_mmio[OHCI_HcRhDescriptorB + 2] & 0x04)) dev->ohci_mmio[addr] |= 0x01; return; - case 0x56: - case 0x5a: + case OHCI_HcRhPortStatus1 + 2: + case OHCI_HcRhPortStatus2 + 2: dev->ohci_mmio[addr] &= ~(val & 0x1f); return; - case 0x57: - case 0x5b: + case OHCI_HcRhPortStatus1 + 3: + case OHCI_HcRhPortStatus2 + 3: return; } @@ -368,9 +397,9 @@ usb_reset(void *priv) dev->uhci_io[0x10] = dev->uhci_io[0x12] = 0x80; memset(dev->ohci_mmio, 0x00, 4096); - dev->ohci_mmio[0x00] = 0x10; - dev->ohci_mmio[0x01] = 0x01; - dev->ohci_mmio[0x48] = 0x02; + dev->ohci_mmio[OHCI_HcRevision] = 0x10; + dev->ohci_mmio[OHCI_HcRevision + 1] = 0x01; + dev->ohci_mmio[OHCI_HcRhDescriptorA] = 0x02; io_removehandler(dev->uhci_io_base, 0x20, uhci_reg_read, NULL, NULL, uhci_reg_write, uhci_reg_writew, NULL, dev); dev->uhci_enable = 0; @@ -397,15 +426,6 @@ usb_init(const device_t *info) return (NULL); memset(dev, 0x00, sizeof(usb_t)); - memset(dev->uhci_io, 0x00, 128); - dev->uhci_io[0x0c] = 0x40; - dev->uhci_io[0x10] = dev->uhci_io[0x12] = 0x80; - - memset(dev->ohci_mmio, 0x00, 4096); - dev->ohci_mmio[0x00] = 0x10; - dev->ohci_mmio[0x01] = 0x01; - dev->ohci_mmio[0x48] = 0x02; - mem_mapping_add(&dev->ohci_mmio_mapping, 0, 0, ohci_mmio_read, NULL, NULL, ohci_mmio_write, NULL, NULL, From 7a53e1de453a9eeb8e5493c16767336e804909c9 Mon Sep 17 00:00:00 2001 From: TC1995 Date: Sat, 29 Apr 2023 18:56:57 +0200 Subject: [PATCH 34/60] Initial softfloat port from Bochs to 86box, currently selectable only on QT. --- src/86box.c | 1 + src/config.c | 2 + src/cpu/808x.c | 82 +- src/cpu/CMakeLists.txt | 3 + src/cpu/cpu.c | 203 +- src/cpu/cpu.h | 19 + src/cpu/softfloat/CMakeLists.txt | 17 + src/cpu/softfloat/config.h | 46 + src/cpu/softfloat/f2xm1.cc | 182 + src/cpu/softfloat/fpatan.cc | 288 ++ src/cpu/softfloat/fprem.cc | 196 + src/cpu/softfloat/fpu_constant.h | 82 + src/cpu/softfloat/fsincos.cc | 441 +++ src/cpu/softfloat/fyl2x.cc | 363 ++ src/cpu/softfloat/poly.cc | 89 + src/cpu/softfloat/softfloat-compare.h | 496 +++ src/cpu/softfloat/softfloat-macros.h | 686 ++++ src/cpu/softfloat/softfloat-muladd.cc | 558 +++ src/cpu/softfloat/softfloat-round-pack.cc | 896 +++++ src/cpu/softfloat/softfloat-round-pack.h | 309 ++ src/cpu/softfloat/softfloat-specialize.cc | 187 + src/cpu/softfloat/softfloat-specialize.h | 788 ++++ src/cpu/softfloat/softfloat.cc | 4012 +++++++++++++++++++++ src/cpu/softfloat/softfloat.h | 488 +++ src/cpu/softfloat/softfloat16.cc | 129 + src/cpu/softfloat/softfloatx80.cc | 367 ++ src/cpu/softfloat/softfloatx80.h | 113 + src/cpu/softfloat/x87_ops_arith.h | 750 ++++ src/cpu/softfloat/x87_ops_compare.h | 489 +++ src/cpu/softfloat/x87_ops_const.h | 131 + src/cpu/softfloat/x87_ops_load_store.h | 1314 +++++++ src/cpu/softfloat/x87_ops_misc.h | 134 + src/cpu/softfloat/x87_ops_other.h | 593 +++ src/cpu/softfloat/x87_ops_trans.h | 418 +++ src/cpu/x86_ops.h | 40 + src/cpu/x86_ops_fpu.h | 9 + src/cpu/x87.c | 340 +- src/cpu/x87.h | 189 +- src/cpu/x87_ops.h | 1537 +++++++- src/cpu/x87_ops_misc.h | 29 +- src/include/86box/86box.h | 3 +- src/qt/qt_settingsmachine.cpp | 11 + src/qt/qt_settingsmachine.ui | 13 + src/win/Makefile.mingw | 6 +- 44 files changed, 16934 insertions(+), 115 deletions(-) create mode 100644 src/cpu/softfloat/CMakeLists.txt create mode 100644 src/cpu/softfloat/config.h create mode 100644 src/cpu/softfloat/f2xm1.cc create mode 100644 src/cpu/softfloat/fpatan.cc create mode 100644 src/cpu/softfloat/fprem.cc create mode 100644 src/cpu/softfloat/fpu_constant.h create mode 100644 src/cpu/softfloat/fsincos.cc create mode 100644 src/cpu/softfloat/fyl2x.cc create mode 100644 src/cpu/softfloat/poly.cc create mode 100644 src/cpu/softfloat/softfloat-compare.h create mode 100644 src/cpu/softfloat/softfloat-macros.h create mode 100644 src/cpu/softfloat/softfloat-muladd.cc create mode 100644 src/cpu/softfloat/softfloat-round-pack.cc create mode 100644 src/cpu/softfloat/softfloat-round-pack.h create mode 100644 src/cpu/softfloat/softfloat-specialize.cc create mode 100644 src/cpu/softfloat/softfloat-specialize.h create mode 100644 src/cpu/softfloat/softfloat.cc create mode 100644 src/cpu/softfloat/softfloat.h create mode 100644 src/cpu/softfloat/softfloat16.cc create mode 100644 src/cpu/softfloat/softfloatx80.cc create mode 100644 src/cpu/softfloat/softfloatx80.h create mode 100644 src/cpu/softfloat/x87_ops_arith.h create mode 100644 src/cpu/softfloat/x87_ops_compare.h create mode 100644 src/cpu/softfloat/x87_ops_const.h create mode 100644 src/cpu/softfloat/x87_ops_load_store.h create mode 100644 src/cpu/softfloat/x87_ops_misc.h create mode 100644 src/cpu/softfloat/x87_ops_other.h create mode 100644 src/cpu/softfloat/x87_ops_trans.h diff --git a/src/86box.c b/src/86box.c index 3c96d88a4..73f8a67ee 100644 --- a/src/86box.c +++ b/src/86box.c @@ -180,6 +180,7 @@ uint32_t isa_mem_size = 0; /* (C) memory int cpu_use_dynarec = 0; /* (C) cpu uses/needs Dyna */ int cpu = 0; /* (C) cpu type */ int fpu_type = 0; /* (C) fpu type */ +int fpu_softfloat = 0; /* (C) fpu uses softfloat */ int time_sync = 0; /* (C) enable time sync */ int confirm_reset = 1; /* (C) enable reset confirmation */ int confirm_exit = 1; /* (C) enable exit confirmation */ diff --git a/src/config.c b/src/config.c index 7641c637c..a83512bde 100644 --- a/src/config.c +++ b/src/config.c @@ -504,6 +504,7 @@ load_machine(void) mem_size = machine_get_max_ram(machine); cpu_use_dynarec = !!ini_section_get_int(cat, "cpu_use_dynarec", 0); + fpu_softfloat = !!ini_section_get_int(cat, "fpu_softfloat", 0); p = ini_section_get_string(cat, "time_sync", NULL); if (p != NULL) { @@ -2244,6 +2245,7 @@ save_machine(void) ini_section_set_int(cat, "mem_size", mem_size); ini_section_set_int(cat, "cpu_use_dynarec", cpu_use_dynarec); + ini_section_set_int(cat, "fpu_softfloat", fpu_softfloat); if (time_sync & TIME_SYNC_ENABLED) if (time_sync & TIME_SYNC_UTC) diff --git a/src/cpu/808x.c b/src/cpu/808x.c index 1a842dd9c..d7e50b0b5 100644 --- a/src/cpu/808x.c +++ b/src/cpu/808x.c @@ -3178,33 +3178,63 @@ execx86(int cycs) tempw = cpu_state.pc; if (!hasfpu) geteaw(); - else - switch (opcode) { - case 0xD8: - ops_fpu_8087_d8[(rmdat >> 3) & 0x1f]((uint32_t) rmdat); - break; - case 0xD9: - ops_fpu_8087_d9[rmdat & 0xff]((uint32_t) rmdat); - break; - case 0xDA: - ops_fpu_8087_da[rmdat & 0xff]((uint32_t) rmdat); - break; - case 0xDB: - ops_fpu_8087_db[rmdat & 0xff]((uint32_t) rmdat); - break; - case 0xDC: - ops_fpu_8087_dc[(rmdat >> 3) & 0x1f]((uint32_t) rmdat); - break; - case 0xDD: - ops_fpu_8087_dd[rmdat & 0xff]((uint32_t) rmdat); - break; - case 0xDE: - ops_fpu_8087_de[rmdat & 0xff]((uint32_t) rmdat); - break; - case 0xDF: - ops_fpu_8087_df[rmdat & 0xff]((uint32_t) rmdat); - break; + else { + if (fpu_softfloat) { + switch (opcode) { + case 0xD8: + ops_sf_fpu_8087_d8[(rmdat >> 3) & 0x1f]((uint32_t) rmdat); + break; + case 0xD9: + ops_sf_fpu_8087_d9[rmdat & 0xff]((uint32_t) rmdat); + break; + case 0xDA: + ops_sf_fpu_8087_da[rmdat & 0xff]((uint32_t) rmdat); + break; + case 0xDB: + ops_sf_fpu_8087_db[rmdat & 0xff]((uint32_t) rmdat); + break; + case 0xDC: + ops_sf_fpu_8087_dc[(rmdat >> 3) & 0x1f]((uint32_t) rmdat); + break; + case 0xDD: + ops_sf_fpu_8087_dd[rmdat & 0xff]((uint32_t) rmdat); + break; + case 0xDE: + ops_sf_fpu_8087_de[rmdat & 0xff]((uint32_t) rmdat); + break; + case 0xDF: + ops_sf_fpu_8087_df[rmdat & 0xff]((uint32_t) rmdat); + break; + } + } else { + switch (opcode) { + case 0xD8: + ops_fpu_8087_d8[(rmdat >> 3) & 0x1f]((uint32_t) rmdat); + break; + case 0xD9: + ops_fpu_8087_d9[rmdat & 0xff]((uint32_t) rmdat); + break; + case 0xDA: + ops_fpu_8087_da[rmdat & 0xff]((uint32_t) rmdat); + break; + case 0xDB: + ops_fpu_8087_db[rmdat & 0xff]((uint32_t) rmdat); + break; + case 0xDC: + ops_fpu_8087_dc[(rmdat >> 3) & 0x1f]((uint32_t) rmdat); + break; + case 0xDD: + ops_fpu_8087_dd[rmdat & 0xff]((uint32_t) rmdat); + break; + case 0xDE: + ops_fpu_8087_de[rmdat & 0xff]((uint32_t) rmdat); + break; + case 0xDF: + ops_fpu_8087_df[rmdat & 0xff]((uint32_t) rmdat); + break; + } } + } cpu_state.pc = tempw; /* Do this as the x87 code advances it, which is needed on the 286+ core, but not here. */ wait(1, 0); diff --git a/src/cpu/CMakeLists.txt b/src/cpu/CMakeLists.txt index 68baaf293..18aa06023 100644 --- a/src/cpu/CMakeLists.txt +++ b/src/cpu/CMakeLists.txt @@ -32,3 +32,6 @@ if(DYNAREC) codegen_timing_pentium.c codegen_timing_p6.c codegen_timing_winchip.c codegen_timing_winchip2.c) endif() + +add_subdirectory(softfloat) +target_link_libraries(86Box softfloat) diff --git a/src/cpu/cpu.c b/src/cpu/cpu.c index 102f9f56c..f70c2155a 100644 --- a/src/cpu/cpu.c +++ b/src/cpu/cpu.c @@ -74,6 +74,7 @@ enum { /* Make sure this is as low as possible. */ cpu_state_t cpu_state; +fpu_state_t fpu_state; /* Place this immediately after. */ uint32_t abrt_error; @@ -201,6 +202,8 @@ void cpu_set_edx(void) { EDX = cpu_s->edx_reset; + if (!cpu_use_dynarec && fpu_softfloat) + SF_FPU_reset(); } cpu_family_t * @@ -344,6 +347,23 @@ cpu_family_is_eligible(const cpu_family_t *cpu_family, int machine) return 0; } +void +SF_FPU_reset(void) +{ + if (fpu_type != FPU_NONE) { + fpu_state.cwd = 0x0040; + fpu_state.swd = 0; + fpu_state.tos = 0; + fpu_state.tag = 0x5555; + fpu_state.foo = 0; + fpu_state.fip = 0; + fpu_state.fcs = 0; + fpu_state.fds = 0; + fpu_state.fdp = 0; + memset(fpu_state.st_space, 0, sizeof(floatx80)*8); + } +} + void cpu_set(void) { @@ -454,22 +474,41 @@ cpu_set(void) x86_dynarec_opcodes_df_a16 = dynarec_ops_fpu_df_a16; x86_dynarec_opcodes_df_a32 = dynarec_ops_fpu_df_a32; #endif - x86_opcodes_d8_a16 = ops_fpu_d8_a16; - x86_opcodes_d8_a32 = ops_fpu_d8_a32; - x86_opcodes_d9_a16 = ops_fpu_d9_a16; - x86_opcodes_d9_a32 = ops_fpu_d9_a32; - x86_opcodes_da_a16 = ops_fpu_da_a16; - x86_opcodes_da_a32 = ops_fpu_da_a32; - x86_opcodes_db_a16 = ops_fpu_db_a16; - x86_opcodes_db_a32 = ops_fpu_db_a32; - x86_opcodes_dc_a16 = ops_fpu_dc_a16; - x86_opcodes_dc_a32 = ops_fpu_dc_a32; - x86_opcodes_dd_a16 = ops_fpu_dd_a16; - x86_opcodes_dd_a32 = ops_fpu_dd_a32; - x86_opcodes_de_a16 = ops_fpu_de_a16; - x86_opcodes_de_a32 = ops_fpu_de_a32; - x86_opcodes_df_a16 = ops_fpu_df_a16; - x86_opcodes_df_a32 = ops_fpu_df_a32; + if (fpu_softfloat) { + x86_opcodes_d8_a16 = ops_sf_fpu_d8_a16; + x86_opcodes_d8_a32 = ops_sf_fpu_d8_a32; + x86_opcodes_d9_a16 = ops_sf_fpu_d9_a16; + x86_opcodes_d9_a32 = ops_sf_fpu_d9_a32; + x86_opcodes_da_a16 = ops_sf_fpu_da_a16; + x86_opcodes_da_a32 = ops_sf_fpu_da_a32; + x86_opcodes_db_a16 = ops_sf_fpu_db_a16; + x86_opcodes_db_a32 = ops_sf_fpu_db_a32; + x86_opcodes_dc_a16 = ops_sf_fpu_dc_a16; + x86_opcodes_dc_a32 = ops_sf_fpu_dc_a32; + x86_opcodes_dd_a16 = ops_sf_fpu_dd_a16; + x86_opcodes_dd_a32 = ops_sf_fpu_dd_a32; + x86_opcodes_de_a16 = ops_sf_fpu_de_a16; + x86_opcodes_de_a32 = ops_sf_fpu_de_a32; + x86_opcodes_df_a16 = ops_sf_fpu_df_a16; + x86_opcodes_df_a32 = ops_sf_fpu_df_a32; + } else { + x86_opcodes_d8_a16 = ops_fpu_d8_a16; + x86_opcodes_d8_a32 = ops_fpu_d8_a32; + x86_opcodes_d9_a16 = ops_fpu_d9_a16; + x86_opcodes_d9_a32 = ops_fpu_d9_a32; + x86_opcodes_da_a16 = ops_fpu_da_a16; + x86_opcodes_da_a32 = ops_fpu_da_a32; + x86_opcodes_db_a16 = ops_fpu_db_a16; + x86_opcodes_db_a32 = ops_fpu_db_a32; + x86_opcodes_dc_a16 = ops_fpu_dc_a16; + x86_opcodes_dc_a32 = ops_fpu_dc_a32; + x86_opcodes_dd_a16 = ops_fpu_dd_a16; + x86_opcodes_dd_a32 = ops_fpu_dd_a32; + x86_opcodes_de_a16 = ops_fpu_de_a16; + x86_opcodes_de_a32 = ops_fpu_de_a32; + x86_opcodes_df_a16 = ops_fpu_df_a16; + x86_opcodes_df_a32 = ops_fpu_df_a32; + } } else { #ifdef USE_DYNAREC x86_dynarec_opcodes_d8_a16 = dynarec_ops_nofpu_a16; @@ -557,20 +596,37 @@ cpu_set(void) x86_dynarec_opcodes_df_a16 = dynarec_ops_fpu_287_df_a16; x86_dynarec_opcodes_df_a32 = dynarec_ops_fpu_287_df_a32; #endif - x86_opcodes_d9_a16 = ops_fpu_287_d9_a16; - x86_opcodes_d9_a32 = ops_fpu_287_d9_a32; - x86_opcodes_da_a16 = ops_fpu_287_da_a16; - x86_opcodes_da_a32 = ops_fpu_287_da_a32; - x86_opcodes_db_a16 = ops_fpu_287_db_a16; - x86_opcodes_db_a32 = ops_fpu_287_db_a32; - x86_opcodes_dc_a16 = ops_fpu_287_dc_a16; - x86_opcodes_dc_a32 = ops_fpu_287_dc_a32; - x86_opcodes_dd_a16 = ops_fpu_287_dd_a16; - x86_opcodes_dd_a32 = ops_fpu_287_dd_a32; - x86_opcodes_de_a16 = ops_fpu_287_de_a16; - x86_opcodes_de_a32 = ops_fpu_287_de_a32; - x86_opcodes_df_a16 = ops_fpu_287_df_a16; - x86_opcodes_df_a32 = ops_fpu_287_df_a32; + if (fpu_softfloat) { + x86_opcodes_d9_a16 = ops_sf_fpu_287_d9_a16; + x86_opcodes_d9_a32 = ops_sf_fpu_287_d9_a32; + x86_opcodes_da_a16 = ops_sf_fpu_287_da_a16; + x86_opcodes_da_a32 = ops_sf_fpu_287_da_a32; + x86_opcodes_db_a16 = ops_sf_fpu_287_db_a16; + x86_opcodes_db_a32 = ops_sf_fpu_287_db_a32; + x86_opcodes_dc_a16 = ops_sf_fpu_287_dc_a16; + x86_opcodes_dc_a32 = ops_sf_fpu_287_dc_a32; + x86_opcodes_dd_a16 = ops_sf_fpu_287_dd_a16; + x86_opcodes_dd_a32 = ops_sf_fpu_287_dd_a32; + x86_opcodes_de_a16 = ops_sf_fpu_287_de_a16; + x86_opcodes_de_a32 = ops_sf_fpu_287_de_a32; + x86_opcodes_df_a16 = ops_sf_fpu_287_df_a16; + x86_opcodes_df_a32 = ops_sf_fpu_287_df_a32; + } else { + x86_opcodes_d9_a16 = ops_fpu_287_d9_a16; + x86_opcodes_d9_a32 = ops_fpu_287_d9_a32; + x86_opcodes_da_a16 = ops_fpu_287_da_a16; + x86_opcodes_da_a32 = ops_fpu_287_da_a32; + x86_opcodes_db_a16 = ops_fpu_287_db_a16; + x86_opcodes_db_a32 = ops_fpu_287_db_a32; + x86_opcodes_dc_a16 = ops_fpu_287_dc_a16; + x86_opcodes_dc_a32 = ops_fpu_287_dc_a32; + x86_opcodes_dd_a16 = ops_fpu_287_dd_a16; + x86_opcodes_dd_a32 = ops_fpu_287_dd_a32; + x86_opcodes_de_a16 = ops_fpu_287_de_a16; + x86_opcodes_de_a32 = ops_fpu_287_de_a32; + x86_opcodes_df_a16 = ops_fpu_287_df_a16; + x86_opcodes_df_a32 = ops_fpu_287_df_a32; + } } timing_rr = 2; /* register dest - register src */ @@ -633,20 +689,37 @@ cpu_set(void) x86_dynarec_opcodes_df_a16 = dynarec_ops_fpu_287_df_a16; x86_dynarec_opcodes_df_a32 = dynarec_ops_fpu_287_df_a32; #endif - x86_opcodes_d9_a16 = ops_fpu_287_d9_a16; - x86_opcodes_d9_a32 = ops_fpu_287_d9_a32; - x86_opcodes_da_a16 = ops_fpu_287_da_a16; - x86_opcodes_da_a32 = ops_fpu_287_da_a32; - x86_opcodes_db_a16 = ops_fpu_287_db_a16; - x86_opcodes_db_a32 = ops_fpu_287_db_a32; - x86_opcodes_dc_a16 = ops_fpu_287_dc_a16; - x86_opcodes_dc_a32 = ops_fpu_287_dc_a32; - x86_opcodes_dd_a16 = ops_fpu_287_dd_a16; - x86_opcodes_dd_a32 = ops_fpu_287_dd_a32; - x86_opcodes_de_a16 = ops_fpu_287_de_a16; - x86_opcodes_de_a32 = ops_fpu_287_de_a32; - x86_opcodes_df_a16 = ops_fpu_287_df_a16; - x86_opcodes_df_a32 = ops_fpu_287_df_a32; + if (fpu_softfloat) { + x86_opcodes_d9_a16 = ops_sf_fpu_287_d9_a16; + x86_opcodes_d9_a32 = ops_sf_fpu_287_d9_a32; + x86_opcodes_da_a16 = ops_sf_fpu_287_da_a16; + x86_opcodes_da_a32 = ops_sf_fpu_287_da_a32; + x86_opcodes_db_a16 = ops_sf_fpu_287_db_a16; + x86_opcodes_db_a32 = ops_sf_fpu_287_db_a32; + x86_opcodes_dc_a16 = ops_sf_fpu_287_dc_a16; + x86_opcodes_dc_a32 = ops_sf_fpu_287_dc_a32; + x86_opcodes_dd_a16 = ops_sf_fpu_287_dd_a16; + x86_opcodes_dd_a32 = ops_sf_fpu_287_dd_a32; + x86_opcodes_de_a16 = ops_sf_fpu_287_de_a16; + x86_opcodes_de_a32 = ops_sf_fpu_287_de_a32; + x86_opcodes_df_a16 = ops_sf_fpu_287_df_a16; + x86_opcodes_df_a32 = ops_sf_fpu_287_df_a32; + } else { + x86_opcodes_d9_a16 = ops_fpu_287_d9_a16; + x86_opcodes_d9_a32 = ops_fpu_287_d9_a32; + x86_opcodes_da_a16 = ops_fpu_287_da_a16; + x86_opcodes_da_a32 = ops_fpu_287_da_a32; + x86_opcodes_db_a16 = ops_fpu_287_db_a16; + x86_opcodes_db_a32 = ops_fpu_287_db_a32; + x86_opcodes_dc_a16 = ops_fpu_287_dc_a16; + x86_opcodes_dc_a32 = ops_fpu_287_dc_a32; + x86_opcodes_dd_a16 = ops_fpu_287_dd_a16; + x86_opcodes_dd_a32 = ops_fpu_287_dd_a32; + x86_opcodes_de_a16 = ops_fpu_287_de_a16; + x86_opcodes_de_a32 = ops_fpu_287_de_a32; + x86_opcodes_df_a16 = ops_fpu_287_df_a16; + x86_opcodes_df_a32 = ops_fpu_287_df_a32; + } } timing_rr = 2; /* register dest - register src */ @@ -1048,12 +1121,21 @@ cpu_set(void) x86_dynarec_opcodes_df_a16 = dynarec_ops_fpu_686_df_a16; x86_dynarec_opcodes_df_a32 = dynarec_ops_fpu_686_df_a32; # endif - x86_opcodes_da_a16 = ops_fpu_686_da_a16; - x86_opcodes_da_a32 = ops_fpu_686_da_a32; - x86_opcodes_db_a16 = ops_fpu_686_db_a16; - x86_opcodes_db_a32 = ops_fpu_686_db_a32; - x86_opcodes_df_a16 = ops_fpu_686_df_a16; - x86_opcodes_df_a32 = ops_fpu_686_df_a32; + if (fpu_softfloat) { + x86_opcodes_da_a16 = ops_sf_fpu_686_da_a16; + x86_opcodes_da_a32 = ops_sf_fpu_686_da_a32; + x86_opcodes_db_a16 = ops_sf_fpu_686_db_a16; + x86_opcodes_db_a32 = ops_sf_fpu_686_db_a32; + x86_opcodes_df_a16 = ops_sf_fpu_686_df_a16; + x86_opcodes_df_a32 = ops_sf_fpu_686_df_a32; + } else { + x86_opcodes_da_a16 = ops_fpu_686_da_a16; + x86_opcodes_da_a32 = ops_fpu_686_da_a32; + x86_opcodes_db_a16 = ops_fpu_686_db_a16; + x86_opcodes_db_a32 = ops_fpu_686_db_a32; + x86_opcodes_df_a16 = ops_fpu_686_df_a16; + x86_opcodes_df_a32 = ops_fpu_686_df_a32; + } } # ifdef USE_DYNAREC @@ -1256,12 +1338,21 @@ cpu_set(void) else x86_setopcodes(ops_386, ops_pentium2_0f); #endif - x86_opcodes_da_a16 = ops_fpu_686_da_a16; - x86_opcodes_da_a32 = ops_fpu_686_da_a32; - x86_opcodes_db_a16 = ops_fpu_686_db_a16; - x86_opcodes_db_a32 = ops_fpu_686_db_a32; - x86_opcodes_df_a16 = ops_fpu_686_df_a16; - x86_opcodes_df_a32 = ops_fpu_686_df_a32; + if (fpu_softfloat) { + x86_opcodes_da_a16 = ops_sf_fpu_686_da_a16; + x86_opcodes_da_a32 = ops_sf_fpu_686_da_a32; + x86_opcodes_db_a16 = ops_sf_fpu_686_db_a16; + x86_opcodes_db_a32 = ops_sf_fpu_686_db_a32; + x86_opcodes_df_a16 = ops_sf_fpu_686_df_a16; + x86_opcodes_df_a32 = ops_sf_fpu_686_df_a32; + } else { + x86_opcodes_da_a16 = ops_fpu_686_da_a16; + x86_opcodes_da_a32 = ops_fpu_686_da_a32; + x86_opcodes_db_a16 = ops_fpu_686_db_a16; + x86_opcodes_db_a32 = ops_fpu_686_db_a32; + x86_opcodes_df_a16 = ops_fpu_686_df_a16; + x86_opcodes_df_a32 = ops_fpu_686_df_a32; + } timing_rr = 1; /* register dest - register src */ timing_rm = 2; /* register dest - memory src */ diff --git a/src/cpu/cpu.h b/src/cpu/cpu.h index f8ffaced3..b93e6aa2e 100644 --- a/src/cpu/cpu.h +++ b/src/cpu/cpu.h @@ -21,6 +21,8 @@ #ifndef EMU_CPU_H #define EMU_CPU_H +#include "softfloat/softfloat.h" + enum { FPU_NONE, FPU_8087, @@ -404,6 +406,20 @@ typedef struct { uint8_t inside_emulation_mode; } cpu_state_t; +typedef struct { + uint16_t cwd; + uint16_t swd; + uint16_t tag; + uint16_t foo; + uint32_t fip; + uint32_t fdp; + uint16_t fcs; + uint16_t fds; + floatx80 st_space[8]; + unsigned char tos; + unsigned char align1, align2, align3; +} fpu_state_t; + #define in_smm cpu_state._in_smm #define smi_line cpu_state._smi_line @@ -484,6 +500,7 @@ COMPILE_TIME_ASSERT(sizeof(cpu_state_t) <= 128) /* Global variables. */ extern cpu_state_t cpu_state; +extern fpu_state_t fpu_state; extern const cpu_family_t cpu_families[]; extern const cpu_legacy_machine_t cpu_legacy_table[]; @@ -738,6 +755,8 @@ extern uint32_t custom_nmi_vector; extern void (*cpu_exec)(int cycs); extern uint8_t do_translate, do_translate2; +extern void SF_FPU_reset(void); + extern void reset_808x(int hard); extern void interrupt_808x(uint16_t addr); diff --git a/src/cpu/softfloat/CMakeLists.txt b/src/cpu/softfloat/CMakeLists.txt new file mode 100644 index 000000000..62458aada --- /dev/null +++ b/src/cpu/softfloat/CMakeLists.txt @@ -0,0 +1,17 @@ +# +# 86Box A hypervisor and IBM PC system emulator that specializes in +# running old operating systems and software designed for IBM +# PC systems and compatibles from 1981 through fairly recent +# system designs based on the PCI bus. +# +# This file is part of the 86Box distribution. +# +# CMake build script. +# +# Authors: David Hrdlička, +# +# Copyright 2020-2021 David Hrdlička. +# + +add_library(softfloat OBJECT f2xm1.cc fpatan.cc fprem.cc fsincos.cc fyl2x.cc poly.cc softfloat.cc softfloat16.cc + softfloat-muladd.cc softfloat-round-pack.cc softfloat-specialize.cc softfloatx80.cc) diff --git a/src/cpu/softfloat/config.h b/src/cpu/softfloat/config.h new file mode 100644 index 000000000..3889b5c02 --- /dev/null +++ b/src/cpu/softfloat/config.h @@ -0,0 +1,46 @@ +#include + +typedef int8_t flag; +typedef uint8_t uint8; +typedef int8_t int8; +typedef uint16_t uint16; +typedef int16_t int16; +typedef uint32_t uint32; +typedef int32_t int32; +typedef uint64_t uint64; +typedef int64_t int64; + +/*---------------------------------------------------------------------------- +| Each of the following `typedef's defines a type that holds integers +| of _exactly_ the number of bits specified. For instance, for most +| implementation of C, `bits16' and `sbits16' should be `typedef'ed to +| `unsigned short int' and `signed short int' (or `short int'), respectively. +*----------------------------------------------------------------------------*/ +typedef uint8_t bits8; +typedef int8_t sbits8; +typedef uint16_t bits16; +typedef int16_t sbits16; +typedef uint32_t bits32; +typedef int32_t sbits32; +typedef uint64_t bits64; +typedef int64_t sbits64; + +typedef uint8_t Bit8u; +typedef int8_t Bit8s; +typedef uint16_t Bit16u; +typedef int16_t Bit16s; +typedef uint32_t Bit32u; +typedef int32_t Bit32s; +typedef uint64_t Bit64u; +typedef int64_t Bit64s; + +/*---------------------------------------------------------------------------- +| The `LIT64' macro takes as its argument a textual integer literal and +| if necessary ``marks'' the literal as having a 64-bit integer type. +| For example, the GNU C Compiler (`gcc') requires that 64-bit literals be +| appended with the letters `LL' standing for `long long', which is `gcc's +| name for the 64-bit integer type. Some compilers may allow `LIT64' to be +| defined as the identity macro: `#define LIT64( a ) a'. +*----------------------------------------------------------------------------*/ +#define BX_CONST64(a) a##LL +#define BX_CPP_INLINE static __inline diff --git a/src/cpu/softfloat/f2xm1.cc b/src/cpu/softfloat/f2xm1.cc new file mode 100644 index 000000000..ed4af1d12 --- /dev/null +++ b/src/cpu/softfloat/f2xm1.cc @@ -0,0 +1,182 @@ +/*============================================================================ +This source file is an extension to the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b, written for Bochs (x86 achitecture simulator) +floating point emulation. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Written for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#define FLOAT128 + +#include "softfloatx80.h" +#include "softfloat-round-pack.h" + +static const floatx80 floatx80_negone = packFloatx80(1, 0x3fff, BX_CONST64(0x8000000000000000)); +static const floatx80 floatx80_neghalf = packFloatx80(1, 0x3ffe, BX_CONST64(0x8000000000000000)); +static const float128 float128_ln2 = + packFloat128(BX_CONST64(0x3ffe62e42fefa39e), BX_CONST64(0xf35793c7673007e6)); + +#ifdef BETTER_THAN_PENTIUM + +#define LN2_SIG_HI BX_CONST64(0xb17217f7d1cf79ab) +#define LN2_SIG_LO BX_CONST64(0xc9e3b39800000000) /* 96 bit precision */ + +#else + +#define LN2_SIG_HI BX_CONST64(0xb17217f7d1cf79ab) +#define LN2_SIG_LO BX_CONST64(0xc000000000000000) /* 67-bit precision */ + +#endif + +#define EXP_ARR_SIZE 15 + +static float128 exp_arr[EXP_ARR_SIZE] = +{ + PACK_FLOAT_128(0x3fff000000000000, 0x0000000000000000), /* 1 */ + PACK_FLOAT_128(0x3ffe000000000000, 0x0000000000000000), /* 2 */ + PACK_FLOAT_128(0x3ffc555555555555, 0x5555555555555555), /* 3 */ + PACK_FLOAT_128(0x3ffa555555555555, 0x5555555555555555), /* 4 */ + PACK_FLOAT_128(0x3ff8111111111111, 0x1111111111111111), /* 5 */ + PACK_FLOAT_128(0x3ff56c16c16c16c1, 0x6c16c16c16c16c17), /* 6 */ + PACK_FLOAT_128(0x3ff2a01a01a01a01, 0xa01a01a01a01a01a), /* 7 */ + PACK_FLOAT_128(0x3fefa01a01a01a01, 0xa01a01a01a01a01a), /* 8 */ + PACK_FLOAT_128(0x3fec71de3a556c73, 0x38faac1c88e50017), /* 9 */ + PACK_FLOAT_128(0x3fe927e4fb7789f5, 0xc72ef016d3ea6679), /* 10 */ + PACK_FLOAT_128(0x3fe5ae64567f544e, 0x38fe747e4b837dc7), /* 11 */ + PACK_FLOAT_128(0x3fe21eed8eff8d89, 0x7b544da987acfe85), /* 12 */ + PACK_FLOAT_128(0x3fde6124613a86d0, 0x97ca38331d23af68), /* 13 */ + PACK_FLOAT_128(0x3fda93974a8c07c9, 0xd20badf145dfa3e5), /* 14 */ + PACK_FLOAT_128(0x3fd6ae7f3e733b81, 0xf11d8656b0ee8cb0) /* 15 */ +}; + +extern float128 EvalPoly(float128 x, float128 *arr, int n, struct float_status_t *status); + +/* required -1 < x < 1 */ +static float128 poly_exp(float128 x, struct float_status_t *status) +{ +/* + // 2 3 4 5 6 7 8 9 + // x x x x x x x x x + // e - 1 ~ x + --- + --- + --- + --- + --- + --- + --- + --- + ... + // 2! 3! 4! 5! 6! 7! 8! 9! + // + // 2 3 4 5 6 7 8 + // x x x x x x x x + // = x [ 1 + --- + --- + --- + --- + --- + --- + --- + --- + ... ] + // 2! 3! 4! 5! 6! 7! 8! 9! + // + // 8 8 + // -- 2k -- 2k+1 + // p(x) = > C * x q(x) = > C * x + // -- 2k -- 2k+1 + // k=0 k=0 + // + // x + // e - 1 ~ x * [ p(x) + x * q(x) ] + // +*/ + float128 t = EvalPoly(x, exp_arr, EXP_ARR_SIZE, status); + return float128_mul(t, x, status); +} + +// ================================================= +// x +// FX2M1 Compute 2 - 1 +// ================================================= + +// +// Uses the following identities: +// +// 1. ---------------------------------------------------------- +// x x*ln(2) +// 2 = e +// +// 2. ---------------------------------------------------------- +// 2 3 4 5 n +// x x x x x x x +// e = 1 + --- + --- + --- + --- + --- + ... + --- + ... +// 1! 2! 3! 4! 5! n! +// + +floatx80 f2xm1(floatx80 a, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + Bit64u zSig0, zSig1, zSig2; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a)) + { + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + Bit64u aSig = extractFloatx80Frac(a); + Bit32s aExp = extractFloatx80Exp(a); + int aSign = extractFloatx80Sign(a); + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1)) + return propagateFloatx80NaNOne(a, status); + + return (aSign) ? floatx80_negone : a; + } + + if (aExp == 0) { + if (aSig == 0) return a; + float_raise(status, float_flag_denormal | float_flag_inexact); + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + + tiny_argument: + mul128By64To192(LN2_SIG_HI, LN2_SIG_LO, aSig, &zSig0, &zSig1, &zSig2); + if (0 < (Bit64s) zSig0) { + shortShift128Left(zSig0, zSig1, 1, &zSig0, &zSig1); + --aExp; + } + return + roundAndPackFloatx80(80, aSign, aExp, zSig0, zSig1, status); + } + + float_raise(status, float_flag_inexact); + + if (aExp < 0x3FFF) + { + if (aExp < FLOATX80_EXP_BIAS-68) + goto tiny_argument; + + /* ******************************** */ + /* using float128 for approximation */ + /* ******************************** */ + + float128 x = floatx80_to_float128(a, status); + x = float128_mul(x, float128_ln2, status); + x = poly_exp(x, status); + return float128_to_floatx80(x, status); + } + else + { + if (a.exp == 0xBFFF && ! (aSig<<1)) + return floatx80_neghalf; + + return a; + } +} diff --git a/src/cpu/softfloat/fpatan.cc b/src/cpu/softfloat/fpatan.cc new file mode 100644 index 000000000..f33a3ff66 --- /dev/null +++ b/src/cpu/softfloat/fpatan.cc @@ -0,0 +1,288 @@ +/*============================================================================ +This source file is an extension to the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b, written for Bochs (x86 achitecture simulator) +floating point emulation. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Written for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#define FLOAT128 + +#include "softfloatx80.h" +#include "softfloat-round-pack.h" +#include "fpu_constant.h" + +#define FPATAN_ARR_SIZE 11 + +static const float128 float128_one = + packFloat128(BX_CONST64(0x3fff000000000000), BX_CONST64(0x0000000000000000)); +static const float128 float128_sqrt3 = + packFloat128(BX_CONST64(0x3fffbb67ae8584ca), BX_CONST64(0xa73b25742d7078b8)); +static const floatx80 floatx80_pi = + packFloatx80(0, 0x4000, BX_CONST64(0xc90fdaa22168c235)); + +static const float128 float128_pi2 = + packFloat128(BX_CONST64(0x3fff921fb54442d1), BX_CONST64(0x8469898CC5170416)); +static const float128 float128_pi4 = + packFloat128(BX_CONST64(0x3ffe921fb54442d1), BX_CONST64(0x8469898CC5170416)); +static const float128 float128_pi6 = + packFloat128(BX_CONST64(0x3ffe0c152382d736), BX_CONST64(0x58465BB32E0F580F)); + +static float128 atan_arr[FPATAN_ARR_SIZE] = +{ + PACK_FLOAT_128(0x3fff000000000000, 0x0000000000000000), /* 1 */ + PACK_FLOAT_128(0xbffd555555555555, 0x5555555555555555), /* 3 */ + PACK_FLOAT_128(0x3ffc999999999999, 0x999999999999999a), /* 5 */ + PACK_FLOAT_128(0xbffc249249249249, 0x2492492492492492), /* 7 */ + PACK_FLOAT_128(0x3ffbc71c71c71c71, 0xc71c71c71c71c71c), /* 9 */ + PACK_FLOAT_128(0xbffb745d1745d174, 0x5d1745d1745d1746), /* 11 */ + PACK_FLOAT_128(0x3ffb3b13b13b13b1, 0x3b13b13b13b13b14), /* 13 */ + PACK_FLOAT_128(0xbffb111111111111, 0x1111111111111111), /* 15 */ + PACK_FLOAT_128(0x3ffae1e1e1e1e1e1, 0xe1e1e1e1e1e1e1e2), /* 17 */ + PACK_FLOAT_128(0xbffaaf286bca1af2, 0x86bca1af286bca1b), /* 19 */ + PACK_FLOAT_128(0x3ffa861861861861, 0x8618618618618618) /* 21 */ +}; + +extern float128 OddPoly(float128 x, float128 *arr, int n, struct float_status_t *status); + +/* |x| < 1/4 */ +static float128 poly_atan(float128 x1, struct float_status_t *status) +{ +/* + // 3 5 7 9 11 13 15 17 + // x x x x x x x x + // atan(x) ~ x - --- + --- - --- + --- - ---- + ---- - ---- + ---- + // 3 5 7 9 11 13 15 17 + // + // 2 4 6 8 10 12 14 16 + // x x x x x x x x + // = x * [ 1 - --- + --- - --- + --- - ---- + ---- - ---- + ---- ] + // 3 5 7 9 11 13 15 17 + // + // 5 5 + // -- 4k -- 4k+2 + // p(x) = > C * x q(x) = > C * x + // -- 2k -- 2k+1 + // k=0 k=0 + // + // 2 + // atan(x) ~ x * [ p(x) + x * q(x) ] + // +*/ + return OddPoly(x1, atan_arr, FPATAN_ARR_SIZE, status); +} + +// ================================================= +// FPATAN Compute y * log (x) +// 2 +// ================================================= + +// +// Uses the following identities: +// +// 1. ---------------------------------------------------------- +// +// atan(-x) = -atan(x) +// +// 2. ---------------------------------------------------------- +// +// x + y +// atan(x) + atan(y) = atan -------, xy < 1 +// 1-xy +// +// x + y +// atan(x) + atan(y) = atan ------- + PI, x > 0, xy > 1 +// 1-xy +// +// x + y +// atan(x) + atan(y) = atan ------- - PI, x < 0, xy > 1 +// 1-xy +// +// 3. ---------------------------------------------------------- +// +// atan(x) = atan(INF) + atan(- 1/x) +// +// x-1 +// atan(x) = PI/4 + atan( ----- ) +// x+1 +// +// x * sqrt(3) - 1 +// atan(x) = PI/6 + atan( ----------------- ) +// x + sqrt(3) +// +// 4. ---------------------------------------------------------- +// 3 5 7 9 2n+1 +// x x x x n x +// atan(x) = x - --- + --- - --- + --- - ... + (-1) ------ + ... +// 3 5 7 9 2n+1 +// + +floatx80 fpatan(floatx80 a, floatx80 b, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a) || floatx80_is_unsupported(b)) { + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + Bit64u aSig = extractFloatx80Frac(a); + Bit32s aExp = extractFloatx80Exp(a); + int aSign = extractFloatx80Sign(a); + Bit64u bSig = extractFloatx80Frac(b); + Bit32s bExp = extractFloatx80Exp(b); + int bSign = extractFloatx80Sign(b); + + int zSign = aSign ^ bSign; + + if (bExp == 0x7FFF) + { + if ((Bit64u) (bSig<<1)) + return propagateFloatx80NaN(a, b, status); + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1)) + return propagateFloatx80NaN(a, b, status); + + if (aSign) { /* return 3PI/4 */ + return roundAndPackFloatx80(80, bSign, + FLOATX80_3PI4_EXP, FLOAT_3PI4_HI, FLOAT_3PI4_LO, status); + } + else { /* return PI/4 */ + return roundAndPackFloatx80(80, bSign, + FLOATX80_PI4_EXP, FLOAT_PI_HI, FLOAT_PI_LO, status); + } + } + + if (aSig && (aExp == 0)) + float_raise(status, float_flag_denormal); + + /* return PI/2 */ + return roundAndPackFloatx80(80, bSign, FLOATX80_PI2_EXP, FLOAT_PI_HI, FLOAT_PI_LO, status); + } + if (aExp == 0x7FFF) + { + if ((Bit64u) (aSig<<1)) + return propagateFloatx80NaN(a, b, status); + + if (bSig && (bExp == 0)) + float_raise(status, float_flag_denormal); + +return_PI_or_ZERO: + + if (aSign) { /* return PI */ + return roundAndPackFloatx80(80, bSign, FLOATX80_PI_EXP, FLOAT_PI_HI, FLOAT_PI_LO, status); + } else { /* return 0 */ + return packFloatx80(bSign, 0, 0); + } + } + if (bExp == 0) + { + if (bSig == 0) { + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + goto return_PI_or_ZERO; + } + + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + } + if (aExp == 0) + { + if (aSig == 0) /* return PI/2 */ + return roundAndPackFloatx80(80, bSign, FLOATX80_PI2_EXP, FLOAT_PI_HI, FLOAT_PI_LO, status); + + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + } + + float_raise(status, float_flag_inexact); + + /* |a| = |b| ==> return PI/4 */ + if (aSig == bSig && aExp == bExp) + return roundAndPackFloatx80(80, bSign, FLOATX80_PI4_EXP, FLOAT_PI_HI, FLOAT_PI_LO, status); + + /* ******************************** */ + /* using float128 for approximation */ + /* ******************************** */ + + float128 a128 = normalizeRoundAndPackFloat128(0, aExp-0x10, aSig, 0, status); + float128 b128 = normalizeRoundAndPackFloat128(0, bExp-0x10, bSig, 0, status); + float128 x; + int swap = 0, add_pi6 = 0, add_pi4 = 0; + + if (aExp > bExp || (aExp == bExp && aSig > bSig)) + { + x = float128_div(b128, a128, status); + } + else { + x = float128_div(a128, b128, status); + swap = 1; + } + + Bit32s xExp = extractFloat128Exp(x); + + if (xExp <= FLOATX80_EXP_BIAS-40) + goto approximation_completed; + + if (x.hi >= BX_CONST64(0x3ffe800000000000)) // 3/4 < x < 1 + { + /* + arctan(x) = arctan((x-1)/(x+1)) + pi/4 + */ + float128 t1 = float128_sub(x, float128_one, status); + float128 t2 = float128_add(x, float128_one, status); + x = float128_div(t1, t2, status); + add_pi4 = 1; + } + else + { + /* argument correction */ + if (xExp >= 0x3FFD) // 1/4 < x < 3/4 + { + /* + arctan(x) = arctan((x*sqrt(3)-1)/(x+sqrt(3))) + pi/6 + */ + float128 t1 = float128_mul(x, float128_sqrt3, status); + float128 t2 = float128_add(x, float128_sqrt3, status); + x = float128_sub(t1, float128_one, status); + x = float128_div(x, t2, status); + add_pi6 = 1; + } + } + + x = poly_atan(x, status); + if (add_pi6) x = float128_add(x, float128_pi6, status); + if (add_pi4) x = float128_add(x, float128_pi4, status); + +approximation_completed: + if (swap) x = float128_sub(float128_pi2, x, status); + floatx80 result = float128_to_floatx80(x, status); + if (zSign) floatx80_chs(result); + int rSign = extractFloatx80Sign(result); + if (!bSign && rSign) + return floatx80_add(result, floatx80_pi, status); + if (bSign && !rSign) + return floatx80_sub(result, floatx80_pi, status); + return result; +} diff --git a/src/cpu/softfloat/fprem.cc b/src/cpu/softfloat/fprem.cc new file mode 100644 index 000000000..26637c5c5 --- /dev/null +++ b/src/cpu/softfloat/fprem.cc @@ -0,0 +1,196 @@ +/*============================================================================ +This source file is an extension to the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b, written for Bochs (x86 achitecture simulator) +floating point emulation. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Written for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#include "softfloatx80.h" +#include "softfloat-round-pack.h" +#define USE_estimateDiv128To64 +#include "softfloat-macros.h" + +/* executes single exponent reduction cycle */ +static Bit64u remainder_kernel(Bit64u aSig0, Bit64u bSig, int expDiff, Bit64u *zSig0, Bit64u *zSig1) +{ + Bit64u term0, term1; + Bit64u aSig1 = 0; + + shortShift128Left(aSig1, aSig0, expDiff, &aSig1, &aSig0); + Bit64u q = estimateDiv128To64(aSig1, aSig0, bSig); + mul64To128(bSig, q, &term0, &term1); + sub128(aSig1, aSig0, term0, term1, zSig1, zSig0); + while ((Bit64s)(*zSig1) < 0) { + --q; + add128(*zSig1, *zSig0, 0, bSig, zSig1, zSig0); + } + return q; +} + +static int do_fprem(floatx80 a, floatx80 b, floatx80 *r, Bit64u *q, int rounding_mode, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + Bit32s aExp, bExp, zExp, expDiff; + Bit64u aSig0, aSig1, bSig; + int aSign; + *q = 0; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a) || floatx80_is_unsupported(b)) + { + float_raise(status, float_flag_invalid); + *r = floatx80_default_nan; + return -1; + } + + aSig0 = extractFloatx80Frac(a); + aExp = extractFloatx80Exp(a); + aSign = extractFloatx80Sign(a); + bSig = extractFloatx80Frac(b); + bExp = extractFloatx80Exp(b); + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig0<<1) || ((bExp == 0x7FFF) && (Bit64u) (bSig<<1))) { + *r = propagateFloatx80NaN(a, b, status); + return -1; + } + float_raise(status, float_flag_invalid); + *r = floatx80_default_nan; + return -1; + } + if (bExp == 0x7FFF) { + if ((Bit64u) (bSig<<1)) { + *r = propagateFloatx80NaN(a, b, status); + return -1; + } + if (aExp == 0 && aSig0) { + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig0, &aExp, &aSig0); + *r = (a.fraction & BX_CONST64(0x8000000000000000)) ? + packFloatx80(aSign, aExp, aSig0) : a; + return 0; + } + *r = a; + return 0; + + } + if (bExp == 0) { + if (bSig == 0) { + float_raise(status, float_flag_invalid); + *r = floatx80_default_nan; + return -1; + } + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + } + if (aExp == 0) { + if (aSig0 == 0) { + *r = a; + return 0; + } + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig0, &aExp, &aSig0); + } + expDiff = aExp - bExp; + aSig1 = 0; + + Bit32u overflow = 0; + + if (expDiff >= 64) { + int n = (expDiff & 0x1f) | 0x20; + remainder_kernel(aSig0, bSig, n, &aSig0, &aSig1); + zExp = aExp - n; + overflow = 1; + } + else { + zExp = bExp; + + if (expDiff < 0) { + if (expDiff < -1) { + *r = (a.fraction & BX_CONST64(0x8000000000000000)) ? + packFloatx80(aSign, aExp, aSig0) : a; + return 0; + } + shift128Right(aSig0, 0, 1, &aSig0, &aSig1); + expDiff = 0; + } + + if (expDiff > 0) { + *q = remainder_kernel(aSig0, bSig, expDiff, &aSig0, &aSig1); + } + else { + if (bSig <= aSig0) { + aSig0 -= bSig; + *q = 1; + } + } + + if (rounding_mode == float_round_nearest_even) + { + Bit64u term0, term1; + shift128Right(bSig, 0, 1, &term0, &term1); + + if (! lt128(aSig0, aSig1, term0, term1)) + { + int lt = lt128(term0, term1, aSig0, aSig1); + int eq = eq128(aSig0, aSig1, term0, term1); + + if ((eq && ((*q) & 1)) || lt) { + aSign = !aSign; + ++(*q); + } + if (lt) sub128(bSig, 0, aSig0, aSig1, &aSig0, &aSig1); + } + } + } + + *r = normalizeRoundAndPackFloatx80(80, aSign, zExp, aSig0, aSig1, status); + return overflow; +} + +/*---------------------------------------------------------------------------- +| Returns the remainder of the extended double-precision floating-point value +| `a' with respect to the corresponding value `b'. The operation is performed +| according to the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +int floatx80_ieee754_remainder(floatx80 a, floatx80 b, floatx80 *r, Bit64u *q, struct float_status_t *status) +{ + return do_fprem(a, b, r, q, float_round_nearest_even, status); +} + +/*---------------------------------------------------------------------------- +| Returns the remainder of the extended double-precision floating-point value +| `a' with respect to the corresponding value `b'. Unlike previous function +| the function does not compute the remainder specified in the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic. This function operates +| differently from the previous function in the way that it rounds the +| quotient of 'a' divided by 'b' to an integer. +*----------------------------------------------------------------------------*/ + +int floatx80_remainder(floatx80 a, floatx80 b, floatx80 *r, Bit64u *q, struct float_status_t *status) +{ + return do_fprem(a, b, r, q, float_round_to_zero, status); +} diff --git a/src/cpu/softfloat/fpu_constant.h b/src/cpu/softfloat/fpu_constant.h new file mode 100644 index 000000000..7a7fc6f1a --- /dev/null +++ b/src/cpu/softfloat/fpu_constant.h @@ -0,0 +1,82 @@ +/*============================================================================ +This source file is an extension to the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b, written for Bochs (x86 achitecture simulator) +floating point emulation. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +#ifndef _FPU_CONSTANTS_H_ +#define _FPU_CONSTANTS_H_ + +#include "config.h" + +// Pentium CPU uses only 68-bit precision M_PI approximation +//#define BETTER_THAN_PENTIUM + +/*============================================================================ + * Written for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +////////////////////////////// +// PI, PI/2, PI/4 constants +////////////////////////////// + +#define FLOATX80_PI_EXP (0x4000) + +// 128-bit PI fraction +#ifdef BETTER_THAN_PENTIUM +#define FLOAT_PI_HI (BX_CONST64(0xc90fdaa22168c234)) +#define FLOAT_PI_LO (BX_CONST64(0xc4c6628b80dc1cd1)) +#else +#define FLOAT_PI_HI (BX_CONST64(0xc90fdaa22168c234)) +#define FLOAT_PI_LO (BX_CONST64(0xC000000000000000)) +#endif + +#define FLOATX80_PI2_EXP (0x3FFF) +#define FLOATX80_PI4_EXP (0x3FFE) + +////////////////////////////// +// 3PI/4 constant +////////////////////////////// + +#define FLOATX80_3PI4_EXP (0x4000) + +// 128-bit 3PI/4 fraction +#ifdef BETTER_THAN_PENTIUM +#define FLOAT_3PI4_HI (BX_CONST64(0x96cbe3f9990e91a7)) +#define FLOAT_3PI4_LO (BX_CONST64(0x9394c9e8a0a5159c)) +#else +#define FLOAT_3PI4_HI (BX_CONST64(0x96cbe3f9990e91a7)) +#define FLOAT_3PI4_LO (BX_CONST64(0x9000000000000000)) +#endif + +////////////////////////////// +// 1/LN2 constant +////////////////////////////// + +#define FLOAT_LN2INV_EXP (0x3FFF) + +// 128-bit 1/LN2 fraction +#ifdef BETTER_THAN_PENTIUM +#define FLOAT_LN2INV_HI (BX_CONST64(0xb8aa3b295c17f0bb)) +#define FLOAT_LN2INV_LO (BX_CONST64(0xbe87fed0691d3e89)) +#else +#define FLOAT_LN2INV_HI (BX_CONST64(0xb8aa3b295c17f0bb)) +#define FLOAT_LN2INV_LO (BX_CONST64(0xC000000000000000)) +#endif + +#endif diff --git a/src/cpu/softfloat/fsincos.cc b/src/cpu/softfloat/fsincos.cc new file mode 100644 index 000000000..f5b33a823 --- /dev/null +++ b/src/cpu/softfloat/fsincos.cc @@ -0,0 +1,441 @@ +/*============================================================================ +This source file is an extension to the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b, written for Bochs (x86 achitecture simulator) +floating point emulation. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Written for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#define FLOAT128 + +#define USE_estimateDiv128To64 +#include "softfloatx80.h" +#include "softfloat-round-pack.h" +#include "fpu_constant.h" + +static const floatx80 floatx80_one = packFloatx80(0, 0x3fff, BX_CONST64(0x8000000000000000)); + +/* reduce trigonometric function argument using 128-bit precision + M_PI approximation */ +static Bit64u argument_reduction_kernel(Bit64u aSig0, int Exp, Bit64u *zSig0, Bit64u *zSig1) +{ + Bit64u term0, term1, term2; + Bit64u aSig1 = 0; + + shortShift128Left(aSig1, aSig0, Exp, &aSig1, &aSig0); + Bit64u q = estimateDiv128To64(aSig1, aSig0, FLOAT_PI_HI); + mul128By64To192(FLOAT_PI_HI, FLOAT_PI_LO, q, &term0, &term1, &term2); + sub128(aSig1, aSig0, term0, term1, zSig1, zSig0); + while ((Bit64s)(*zSig1) < 0) { + --q; + add192(*zSig1, *zSig0, term2, 0, FLOAT_PI_HI, FLOAT_PI_LO, zSig1, zSig0, &term2); + } + *zSig1 = term2; + return q; +} + +static int reduce_trig_arg(int expDiff, int *zSign, Bit64u *aSig0, Bit64u *aSig1) +{ + Bit64u term0, term1, q = 0; + + if (expDiff < 0) { + shift128Right(*aSig0, 0, 1, aSig0, aSig1); + expDiff = 0; + } + if (expDiff > 0) { + q = argument_reduction_kernel(*aSig0, expDiff, aSig0, aSig1); + } + else { + if (FLOAT_PI_HI <= *aSig0) { + *aSig0 -= FLOAT_PI_HI; + q = 1; + } + } + + shift128Right(FLOAT_PI_HI, FLOAT_PI_LO, 1, &term0, &term1); + if (! lt128(*aSig0, *aSig1, term0, term1)) + { + int lt = lt128(term0, term1, *aSig0, *aSig1); + int eq = eq128(*aSig0, *aSig1, term0, term1); + + if ((eq && (q & 1)) || lt) { + *zSign = !(*zSign); + ++q; + } + if (lt) sub128(FLOAT_PI_HI, FLOAT_PI_LO, *aSig0, *aSig1, aSig0, aSig1); + } + + return (int)(q & 3); +} + +#define SIN_ARR_SIZE 11 +#define COS_ARR_SIZE 11 + +static float128 sin_arr[SIN_ARR_SIZE] = +{ + PACK_FLOAT_128(0x3fff000000000000, 0x0000000000000000), /* 1 */ + PACK_FLOAT_128(0xbffc555555555555, 0x5555555555555555), /* 3 */ + PACK_FLOAT_128(0x3ff8111111111111, 0x1111111111111111), /* 5 */ + PACK_FLOAT_128(0xbff2a01a01a01a01, 0xa01a01a01a01a01a), /* 7 */ + PACK_FLOAT_128(0x3fec71de3a556c73, 0x38faac1c88e50017), /* 9 */ + PACK_FLOAT_128(0xbfe5ae64567f544e, 0x38fe747e4b837dc7), /* 11 */ + PACK_FLOAT_128(0x3fde6124613a86d0, 0x97ca38331d23af68), /* 13 */ + PACK_FLOAT_128(0xbfd6ae7f3e733b81, 0xf11d8656b0ee8cb0), /* 15 */ + PACK_FLOAT_128(0x3fce952c77030ad4, 0xa6b2605197771b00), /* 17 */ + PACK_FLOAT_128(0xbfc62f49b4681415, 0x724ca1ec3b7b9675), /* 19 */ + PACK_FLOAT_128(0x3fbd71b8ef6dcf57, 0x18bef146fcee6e45) /* 21 */ +}; + +static float128 cos_arr[COS_ARR_SIZE] = +{ + PACK_FLOAT_128(0x3fff000000000000, 0x0000000000000000), /* 0 */ + PACK_FLOAT_128(0xbffe000000000000, 0x0000000000000000), /* 2 */ + PACK_FLOAT_128(0x3ffa555555555555, 0x5555555555555555), /* 4 */ + PACK_FLOAT_128(0xbff56c16c16c16c1, 0x6c16c16c16c16c17), /* 6 */ + PACK_FLOAT_128(0x3fefa01a01a01a01, 0xa01a01a01a01a01a), /* 8 */ + PACK_FLOAT_128(0xbfe927e4fb7789f5, 0xc72ef016d3ea6679), /* 10 */ + PACK_FLOAT_128(0x3fe21eed8eff8d89, 0x7b544da987acfe85), /* 12 */ + PACK_FLOAT_128(0xbfda93974a8c07c9, 0xd20badf145dfa3e5), /* 14 */ + PACK_FLOAT_128(0x3fd2ae7f3e733b81, 0xf11d8656b0ee8cb0), /* 16 */ + PACK_FLOAT_128(0xbfca6827863b97d9, 0x77bb004886a2c2ab), /* 18 */ + PACK_FLOAT_128(0x3fc1e542ba402022, 0x507a9cad2bf8f0bb) /* 20 */ +}; + +extern float128 OddPoly (float128 x, float128 *arr, int n, struct float_status_t *status); + +/* 0 <= x <= pi/4 */ +BX_CPP_INLINE float128 poly_sin(float128 x, struct float_status_t *status) +{ + // 3 5 7 9 11 13 15 + // x x x x x x x + // sin (x) ~ x - --- + --- - --- + --- - ---- + ---- - ---- = + // 3! 5! 7! 9! 11! 13! 15! + // + // 2 4 6 8 10 12 14 + // x x x x x x x + // = x * [ 1 - --- + --- - --- + --- - ---- + ---- - ---- ] = + // 3! 5! 7! 9! 11! 13! 15! + // + // 3 3 + // -- 4k -- 4k+2 + // p(x) = > C * x > 0 q(x) = > C * x < 0 + // -- 2k -- 2k+1 + // k=0 k=0 + // + // 2 + // sin(x) ~ x * [ p(x) + x * q(x) ] + // + + return OddPoly(x, sin_arr, SIN_ARR_SIZE, status); +} + +extern float128 EvenPoly(float128 x, float128 *arr, int n, struct float_status_t *status); + +/* 0 <= x <= pi/4 */ +BX_CPP_INLINE float128 poly_cos(float128 x, struct float_status_t *status) +{ + // 2 4 6 8 10 12 14 + // x x x x x x x + // cos (x) ~ 1 - --- + --- - --- + --- - ---- + ---- - ---- + // 2! 4! 6! 8! 10! 12! 14! + // + // 3 3 + // -- 4k -- 4k+2 + // p(x) = > C * x > 0 q(x) = > C * x < 0 + // -- 2k -- 2k+1 + // k=0 k=0 + // + // 2 + // cos(x) ~ [ p(x) + x * q(x) ] + // + + return EvenPoly(x, cos_arr, COS_ARR_SIZE, status); +} + +BX_CPP_INLINE void sincos_invalid(floatx80 *sin_a, floatx80 *cos_a, floatx80 a) +{ + if (sin_a) *sin_a = a; + if (cos_a) *cos_a = a; +} + +BX_CPP_INLINE void sincos_tiny_argument(floatx80 *sin_a, floatx80 *cos_a, floatx80 a) +{ + if (sin_a) *sin_a = a; + if (cos_a) *cos_a = floatx80_one; +} + +static floatx80 sincos_approximation(int neg, float128 r, Bit64u quotient, struct float_status_t *status) +{ + if (quotient & 0x1) { + r = poly_cos(r, status); + neg = 0; + } else { + r = poly_sin(r, status); + } + + floatx80 result = float128_to_floatx80(r, status); + if (quotient & 0x2) + neg = ! neg; + + if (neg) + floatx80_chs(result); + + return result; +} + +// ================================================= +// FSINCOS Compute sin(x) and cos(x) +// ================================================= + +// +// Uses the following identities: +// ---------------------------------------------------------- +// +// sin(-x) = -sin(x) +// cos(-x) = cos(x) +// +// sin(x+y) = sin(x)*cos(y)+cos(x)*sin(y) +// cos(x+y) = sin(x)*sin(y)+cos(x)*cos(y) +// +// sin(x+ pi/2) = cos(x) +// sin(x+ pi) = -sin(x) +// sin(x+3pi/2) = -cos(x) +// sin(x+2pi) = sin(x) +// + +int fsincos(floatx80 a, floatx80 *sin_a, floatx80 *cos_a, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + Bit64u aSig0, aSig1 = 0; + Bit32s aExp, zExp, expDiff; + int aSign, zSign; + int q = 0; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a)) { + goto invalid; + } + + aSig0 = extractFloatx80Frac(a); + aExp = extractFloatx80Exp(a); + aSign = extractFloatx80Sign(a); + + /* invalid argument */ + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig0<<1)) { + sincos_invalid(sin_a, cos_a, propagateFloatx80NaNOne(a, status)); + return 0; + } + + invalid: + float_raise(status, float_flag_invalid); + sincos_invalid(sin_a, cos_a, floatx80_default_nan); + return 0; + } + + if (aExp == 0) { + if (aSig0 == 0) { + sincos_tiny_argument(sin_a, cos_a, a); + return 0; + } + + float_raise(status, float_flag_denormal); + + /* handle pseudo denormals */ + if (! (aSig0 & BX_CONST64(0x8000000000000000))) + { + float_raise(status, float_flag_inexact); + if (sin_a) + float_raise(status, float_flag_underflow); + sincos_tiny_argument(sin_a, cos_a, a); + return 0; + } + + normalizeFloatx80Subnormal(aSig0, &aExp, &aSig0); + } + + zSign = aSign; + zExp = FLOATX80_EXP_BIAS; + expDiff = aExp - zExp; + + /* argument is out-of-range */ + if (expDiff >= 63) + return -1; + + float_raise(status, float_flag_inexact); + + if (expDiff < -1) { // doesn't require reduction + if (expDiff <= -68) { + a = packFloatx80(aSign, aExp, aSig0); + sincos_tiny_argument(sin_a, cos_a, a); + return 0; + } + zExp = aExp; + } + else { + q = reduce_trig_arg(expDiff, &zSign, &aSig0, &aSig1); + } + + /* **************************** */ + /* argument reduction completed */ + /* **************************** */ + + /* using float128 for approximation */ + float128 r = normalizeRoundAndPackFloat128(0, zExp-0x10, aSig0, aSig1, status); + + if (aSign) q = -q; + if (sin_a) *sin_a = sincos_approximation(zSign, r, q, status); + if (cos_a) *cos_a = sincos_approximation(zSign, r, q+1, status); + + return 0; +} + +int fsin(floatx80 *a, struct float_status_t *status) +{ + return fsincos(*a, a, 0, status); +} + +int fcos(floatx80 *a, struct float_status_t *status) +{ + return fsincos(*a, 0, a, status); +} + +// ================================================= +// FPTAN Compute tan(x) +// ================================================= + +// +// Uses the following identities: +// +// 1. ---------------------------------------------------------- +// +// sin(-x) = -sin(x) +// cos(-x) = cos(x) +// +// sin(x+y) = sin(x)*cos(y)+cos(x)*sin(y) +// cos(x+y) = sin(x)*sin(y)+cos(x)*cos(y) +// +// sin(x+ pi/2) = cos(x) +// sin(x+ pi) = -sin(x) +// sin(x+3pi/2) = -cos(x) +// sin(x+2pi) = sin(x) +// +// 2. ---------------------------------------------------------- +// +// sin(x) +// tan(x) = ------ +// cos(x) +// + +int ftan(floatx80 *a, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + Bit64u aSig0, aSig1 = 0; + Bit32s aExp, zExp, expDiff; + int aSign, zSign; + int q = 0; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(*a)) { + goto invalid; + } + + aSig0 = extractFloatx80Frac(*a); + aExp = extractFloatx80Exp(*a); + aSign = extractFloatx80Sign(*a); + + /* invalid argument */ + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig0<<1)) + { + *a = propagateFloatx80NaNOne(*a, status); + return 0; + } + + invalid: + float_raise(status, float_flag_invalid); + *a = floatx80_default_nan; + return 0; + } + + if (aExp == 0) { + if (aSig0 == 0) return 0; + float_raise(status, float_flag_denormal); + /* handle pseudo denormals */ + if (! (aSig0 & BX_CONST64(0x8000000000000000))) + { + float_raise(status, float_flag_inexact | float_flag_underflow); + return 0; + } + normalizeFloatx80Subnormal(aSig0, &aExp, &aSig0); + } + + zSign = aSign; + zExp = FLOATX80_EXP_BIAS; + expDiff = aExp - zExp; + + /* argument is out-of-range */ + if (expDiff >= 63) + return -1; + + float_raise(status, float_flag_inexact); + + if (expDiff < -1) { // doesn't require reduction + if (expDiff <= -68) { + *a = packFloatx80(aSign, aExp, aSig0); + return 0; + } + zExp = aExp; + } + else { + q = reduce_trig_arg(expDiff, &zSign, &aSig0, &aSig1); + } + + /* **************************** */ + /* argument reduction completed */ + /* **************************** */ + + /* using float128 for approximation */ + float128 r = normalizeRoundAndPackFloat128(0, zExp-0x10, aSig0, aSig1, status); + + float128 sin_r = poly_sin(r, status); + float128 cos_r = poly_cos(r, status); + + if (q & 0x1) { + r = float128_div(cos_r, sin_r, status); + zSign = ! zSign; + } else { + r = float128_div(sin_r, cos_r, status); + } + + *a = float128_to_floatx80(r, status); + if (zSign) + floatx80_chs(*a); + + return 0; +} diff --git a/src/cpu/softfloat/fyl2x.cc b/src/cpu/softfloat/fyl2x.cc new file mode 100644 index 000000000..875f866a9 --- /dev/null +++ b/src/cpu/softfloat/fyl2x.cc @@ -0,0 +1,363 @@ +/*============================================================================ +This source file is an extension to the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b, written for Bochs (x86 achitecture simulator) +floating point emulation. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Written for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#define FLOAT128 + +#include "softfloatx80.h" +#include "softfloat-round-pack.h" +#include "fpu_constant.h" + +static const floatx80 floatx80_one = + packFloatx80(0, 0x3fff, BX_CONST64(0x8000000000000000)); + +static const float128 float128_one = + packFloat128(BX_CONST64(0x3fff000000000000), BX_CONST64(0x0000000000000000)); +static const float128 float128_two = + packFloat128(BX_CONST64(0x4000000000000000), BX_CONST64(0x0000000000000000)); + +static const float128 float128_ln2inv2 = + packFloat128(BX_CONST64(0x400071547652b82f), BX_CONST64(0xe1777d0ffda0d23a)); + +#define SQRT2_HALF_SIG BX_CONST64(0xb504f333f9de6484) + +extern float128 OddPoly(float128 x, float128 *arr, int n, struct float_status_t *status); + +#define L2_ARR_SIZE 9 + +static float128 ln_arr[L2_ARR_SIZE] = +{ + PACK_FLOAT_128(0x3fff000000000000, 0x0000000000000000), /* 1 */ + PACK_FLOAT_128(0x3ffd555555555555, 0x5555555555555555), /* 3 */ + PACK_FLOAT_128(0x3ffc999999999999, 0x999999999999999a), /* 5 */ + PACK_FLOAT_128(0x3ffc249249249249, 0x2492492492492492), /* 7 */ + PACK_FLOAT_128(0x3ffbc71c71c71c71, 0xc71c71c71c71c71c), /* 9 */ + PACK_FLOAT_128(0x3ffb745d1745d174, 0x5d1745d1745d1746), /* 11 */ + PACK_FLOAT_128(0x3ffb3b13b13b13b1, 0x3b13b13b13b13b14), /* 13 */ + PACK_FLOAT_128(0x3ffb111111111111, 0x1111111111111111), /* 15 */ + PACK_FLOAT_128(0x3ffae1e1e1e1e1e1, 0xe1e1e1e1e1e1e1e2) /* 17 */ +}; + +static float128 poly_ln(float128 x1, struct float_status_t *status) +{ +/* + // + // 3 5 7 9 11 13 15 + // 1+u u u u u u u u + // 1/2 ln --- ~ u + --- + --- + --- + --- + ---- + ---- + ---- = + // 1-u 3 5 7 9 11 13 15 + // + // 2 4 6 8 10 12 14 + // u u u u u u u + // = u * [ 1 + --- + --- + --- + --- + ---- + ---- + ---- ] = + // 3 5 7 9 11 13 15 + // + // 3 3 + // -- 4k -- 4k+2 + // p(u) = > C * u q(u) = > C * u + // -- 2k -- 2k+1 + // k=0 k=0 + // + // 1+u 2 + // 1/2 ln --- ~ u * [ p(u) + u * q(u) ] + // 1-u + // +*/ + return OddPoly(x1, ln_arr, L2_ARR_SIZE, status); +} + +/* required sqrt(2)/2 < x < sqrt(2) */ +static float128 poly_l2(float128 x, struct float_status_t *status) +{ + /* using float128 for approximation */ + float128 x_p1 = float128_add(x, float128_one, status); + float128 x_m1 = float128_sub(x, float128_one, status); + x = float128_div(x_m1, x_p1, status); + x = poly_ln(x, status); + x = float128_mul(x, float128_ln2inv2, status); + return x; +} + +static float128 poly_l2p1(float128 x, struct float_status_t *status) +{ + /* using float128 for approximation */ + float128 x_p2 = float128_add(x, float128_two, status); + x = float128_div(x, x_p2, status); + x = poly_ln(x, status); + x = float128_mul(x, float128_ln2inv2, status); + return x; +} + +// ================================================= +// FYL2X Compute y * log (x) +// 2 +// ================================================= + +// +// Uses the following identities: +// +// 1. ---------------------------------------------------------- +// ln(x) +// log (x) = -------, ln (x*y) = ln(x) + ln(y) +// 2 ln(2) +// +// 2. ---------------------------------------------------------- +// 1+u x-1 +// ln (x) = ln -----, when u = ----- +// 1-u x+1 +// +// 3. ---------------------------------------------------------- +// 3 5 7 2n+1 +// 1+u u u u u +// ln ----- = 2 [ u + --- + --- + --- + ... + ------ + ... ] +// 1-u 3 5 7 2n+1 +// + +floatx80 fyl2x(floatx80 a, floatx80 b, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a) || floatx80_is_unsupported(b)) { +invalid: + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + Bit64u aSig = extractFloatx80Frac(a); + Bit32s aExp = extractFloatx80Exp(a); + int aSign = extractFloatx80Sign(a); + Bit64u bSig = extractFloatx80Frac(b); + Bit32s bExp = extractFloatx80Exp(b); + int bSign = extractFloatx80Sign(b); + + int zSign = bSign ^ 1; + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1) + || ((bExp == 0x7FFF) && (Bit64u) (bSig<<1))) + { + return propagateFloatx80NaN(a, b, status); + } + if (aSign) goto invalid; + else { + if (bExp == 0) { + if (bSig == 0) goto invalid; + float_raise(status, float_flag_denormal); + } + return packFloatx80(bSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + } + if (bExp == 0x7FFF) + { + if ((Bit64u) (bSig<<1)) return propagateFloatx80NaN(a, b, status); + if (aSign && (Bit64u)(aExp | aSig)) goto invalid; + if (aSig && (aExp == 0)) + float_raise(status, float_flag_denormal); + if (aExp < 0x3FFF) { + return packFloatx80(zSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (aExp == 0x3FFF && ((Bit64u) (aSig<<1) == 0)) goto invalid; + return packFloatx80(bSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (aExp == 0) { + if (aSig == 0) { + if ((bExp | bSig) == 0) goto invalid; + float_raise(status, float_flag_divbyzero); + return packFloatx80(zSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (aSign) goto invalid; + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + } + if (aSign) goto invalid; + if (bExp == 0) { + if (bSig == 0) { + if (aExp < 0x3FFF) return packFloatx80(zSign, 0, 0); + return packFloatx80(bSign, 0, 0); + } + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + } + if (aExp == 0x3FFF && ((Bit64u) (aSig<<1) == 0)) + return packFloatx80(bSign, 0, 0); + + float_raise(status, float_flag_inexact); + + int ExpDiff = aExp - 0x3FFF; + aExp = 0; + if (aSig >= SQRT2_HALF_SIG) { + ExpDiff++; + aExp--; + } + + /* ******************************** */ + /* using float128 for approximation */ + /* ******************************** */ + + Bit64u zSig0, zSig1; + shift128Right(aSig<<1, 0, 16, &zSig0, &zSig1); + float128 x = packFloat128Four(0, aExp+0x3FFF, zSig0, zSig1); + x = poly_l2(x, status); + x = float128_add(x, int64_to_float128((Bit64s) ExpDiff), status); + return floatx80_128_mul(b, x, status); +} + +// ================================================= +// FYL2XP1 Compute y * log (x + 1) +// 2 +// ================================================= + +// +// Uses the following identities: +// +// 1. ---------------------------------------------------------- +// ln(x) +// log (x) = ------- +// 2 ln(2) +// +// 2. ---------------------------------------------------------- +// 1+u x +// ln (x+1) = ln -----, when u = ----- +// 1-u x+2 +// +// 3. ---------------------------------------------------------- +// 3 5 7 2n+1 +// 1+u u u u u +// ln ----- = 2 [ u + --- + --- + --- + ... + ------ + ... ] +// 1-u 3 5 7 2n+1 +// + +floatx80 fyl2xp1(floatx80 a, floatx80 b, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + Bit32s aExp, bExp; + Bit64u aSig, bSig, zSig0, zSig1, zSig2; + int aSign, bSign; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a) || floatx80_is_unsupported(b)) { +invalid: + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + aSig = extractFloatx80Frac(a); + aExp = extractFloatx80Exp(a); + aSign = extractFloatx80Sign(a); + bSig = extractFloatx80Frac(b); + bExp = extractFloatx80Exp(b); + bSign = extractFloatx80Sign(b); + int zSign = aSign ^ bSign; + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1) + || ((bExp == 0x7FFF) && (Bit64u) (bSig<<1))) + { + return propagateFloatx80NaN(a, b, status); + } + if (aSign) goto invalid; + else { + if (bExp == 0) { + if (bSig == 0) goto invalid; + float_raise(status, float_flag_denormal); + } + return packFloatx80(bSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + } + if (bExp == 0x7FFF) + { + if ((Bit64u) (bSig<<1)) + return propagateFloatx80NaN(a, b, status); + + if (aExp == 0) { + if (aSig == 0) goto invalid; + float_raise(status, float_flag_denormal); + } + + return packFloatx80(zSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (aExp == 0) { + if (aSig == 0) { + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return packFloatx80(zSign, 0, 0); + } + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + } + if (bExp == 0) { + if (bSig == 0) return packFloatx80(zSign, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + } + + float_raise(status, float_flag_inexact); + + if (aSign && aExp >= 0x3FFF) + return a; + + if (aExp >= 0x3FFC) // big argument + { + return fyl2x(floatx80_add(a, floatx80_one, status), b, status); + } + + // handle tiny argument + if (aExp < FLOATX80_EXP_BIAS-70) + { + // first order approximation, return (a*b)/ln(2) + Bit32s zExp = aExp + FLOAT_LN2INV_EXP - 0x3FFE; + + mul128By64To192(FLOAT_LN2INV_HI, FLOAT_LN2INV_LO, aSig, &zSig0, &zSig1, &zSig2); + if (0 < (Bit64s) zSig0) { + shortShift128Left(zSig0, zSig1, 1, &zSig0, &zSig1); + --zExp; + } + + zExp = zExp + bExp - 0x3FFE; + mul128By64To192(zSig0, zSig1, bSig, &zSig0, &zSig1, &zSig2); + if (0 < (Bit64s) zSig0) { + shortShift128Left(zSig0, zSig1, 1, &zSig0, &zSig1); + --zExp; + } + + return + roundAndPackFloatx80(80, aSign ^ bSign, zExp, zSig0, zSig1, status); + } + + /* ******************************** */ + /* using float128 for approximation */ + /* ******************************** */ + + shift128Right(aSig<<1, 0, 16, &zSig0, &zSig1); + float128 x = packFloat128Four(aSign, aExp, zSig0, zSig1); + x = poly_l2p1(x, status); + return floatx80_128_mul(b, x, status); +} diff --git a/src/cpu/softfloat/poly.cc b/src/cpu/softfloat/poly.cc new file mode 100644 index 000000000..5c7079353 --- /dev/null +++ b/src/cpu/softfloat/poly.cc @@ -0,0 +1,89 @@ +/*============================================================================ +This source file is an extension to the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b, written for Bochs (x86 achitecture simulator) +floating point emulation. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Written for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#define FLOAT128 + +#include +#include "softfloat.h" + +// 2 3 4 n +// f(x) ~ C + (C * x) + (C * x) + (C * x) + (C * x) + ... + (C * x) +// 0 1 2 3 4 n +// +// -- 2k -- 2k+1 +// p(x) = > C * x q(x) = > C * x +// -- 2k -- 2k+1 +// +// f(x) ~ [ p(x) + x * q(x) ] +// + +float128 EvalPoly(float128 x, float128 *arr, int n, struct float_status_t *status) +{ + float128 r = arr[--n]; + + do { + r = float128_mul(r, x, status); + r = float128_add(r, arr[--n], status); + } while (n > 0); + + return r; +} + +// 2 4 6 8 2n +// f(x) ~ C + (C * x) + (C * x) + (C * x) + (C * x) + ... + (C * x) +// 0 1 2 3 4 n +// +// -- 4k -- 4k+2 +// p(x) = > C * x q(x) = > C * x +// -- 2k -- 2k+1 +// +// 2 +// f(x) ~ [ p(x) + x * q(x) ] +// + +float128 EvenPoly(float128 x, float128 *arr, int n, struct float_status_t *status) +{ + return EvalPoly(float128_mul(x, x, status), arr, n, status); +} + +// 3 5 7 9 2n+1 +// f(x) ~ (C * x) + (C * x) + (C * x) + (C * x) + (C * x) + ... + (C * x) +// 0 1 2 3 4 n +// 2 4 6 8 2n +// = x * [ C + (C * x) + (C * x) + (C * x) + (C * x) + ... + (C * x) +// 0 1 2 3 4 n +// +// -- 4k -- 4k+2 +// p(x) = > C * x q(x) = > C * x +// -- 2k -- 2k+1 +// +// 2 +// f(x) ~ x * [ p(x) + x * q(x) ] +// + +float128 OddPoly(float128 x, float128 *arr, int n, struct float_status_t *status) +{ + return float128_mul(x, EvenPoly(x, arr, n, status), status); +} diff --git a/src/cpu/softfloat/softfloat-compare.h b/src/cpu/softfloat/softfloat-compare.h new file mode 100644 index 000000000..8b9821460 --- /dev/null +++ b/src/cpu/softfloat/softfloat-compare.h @@ -0,0 +1,496 @@ +/*============================================================================ +This C header file is part of the SoftFloat IEC/IEEE Floating-point Arithmetic +Package, Release 2b. + +Written by John R. Hauser. This work was made possible in part by the +International Computer Science Institute, located at Suite 600, 1947 Center +Street, Berkeley, California 94704. Funding was partially provided by the +National Science Foundation under grant MIP-9311980. The original version +of this code was written as part of a project to build a fixed-point vector +processor in collaboration with the University of California at Berkeley, +overseen by Profs. Nelson Morgan and John Wawrzynek. More information +is available through the Web page `http://www.cs.berkeley.edu/~jhauser/ +arithmetic/SoftFloat.html'. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Adapted for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#ifndef _SOFTFLOAT_COMPARE_H_ +#define _SOFTFLOAT_COMPARE_H_ + +#include "softfloat.h" + +// ======= float32 ======= // + +typedef int (*float32_compare_method)(float32, float32, struct float_status_t *status); + +// 0x00 +BX_CPP_INLINE int float32_eq_ordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation == float_relation_equal); +} + +// 0x01 +BX_CPP_INLINE int float32_lt_ordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation == float_relation_less); +} + +// 0x02 +BX_CPP_INLINE int float32_le_ordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation == float_relation_less) || (relation == float_relation_equal); +} + +// 0x03 +BX_CPP_INLINE int float32_unordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation == float_relation_unordered); +} + +// 0x04 +BX_CPP_INLINE int float32_neq_unordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation != float_relation_equal); +} + +// 0x05 +BX_CPP_INLINE int float32_nlt_unordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation != float_relation_less); +} + +// 0x06 +BX_CPP_INLINE int float32_nle_unordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation != float_relation_less) && (relation != float_relation_equal); +} + +// 0x07 +BX_CPP_INLINE int float32_ordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation != float_relation_unordered); +} + +// 0x08 +BX_CPP_INLINE int float32_eq_unordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation == float_relation_equal) || (relation == float_relation_unordered); +} + +// 0x09 +BX_CPP_INLINE int float32_nge_unordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation == float_relation_less) || (relation == float_relation_unordered); +} + +// 0x0a +BX_CPP_INLINE int float32_ngt_unordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation != float_relation_greater); +} + +// 0x0b +BX_CPP_INLINE int float32_false_quiet(float32 a, float32 b, struct float_status_t *status) +{ + float32_compare_quiet(a, b, status); + return 0; +} + +// 0x0c +BX_CPP_INLINE int float32_neq_ordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation != float_relation_equal) && (relation != float_relation_unordered); +} + +// 0x0d +BX_CPP_INLINE int float32_ge_ordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation == float_relation_greater) || (relation == float_relation_equal); +} + +// 0x0e +BX_CPP_INLINE int float32_gt_ordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation == float_relation_greater); +} + +// 0x0f +BX_CPP_INLINE int float32_true_quiet(float32 a, float32 b, struct float_status_t *status) +{ + float32_compare_quiet(a, b, status); + return 1; +} + +// 0x10 +BX_CPP_INLINE int float32_eq_ordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation == float_relation_equal); +} + +// 0x11 +BX_CPP_INLINE int float32_lt_ordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation == float_relation_less); +} + +// 0x12 +BX_CPP_INLINE int float32_le_ordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation == float_relation_less) || (relation == float_relation_equal); +} + +// 0x13 +BX_CPP_INLINE int float32_unordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation == float_relation_unordered); +} + +// 0x14 +BX_CPP_INLINE int float32_neq_unordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation != float_relation_equal); +} + +// 0x15 +BX_CPP_INLINE int float32_nlt_unordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation != float_relation_less); +} + +// 0x16 +BX_CPP_INLINE int float32_nle_unordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation != float_relation_less) && (relation != float_relation_equal); +} + +// 0x17 +BX_CPP_INLINE int float32_ordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation != float_relation_unordered); +} + +// 0x18 +BX_CPP_INLINE int float32_eq_unordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation == float_relation_equal) || (relation == float_relation_unordered); +} + +// 0x19 +BX_CPP_INLINE int float32_nge_unordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation == float_relation_less) || (relation == float_relation_unordered); +} + +// 0x1a +BX_CPP_INLINE int float32_ngt_unordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation != float_relation_greater); +} + +// 0x1b +BX_CPP_INLINE int float32_false_signalling(float32 a, float32 b, struct float_status_t *status) +{ + float32_compare_two(a, b, status); + return 0; +} + +// 0x1c +BX_CPP_INLINE int float32_neq_ordered_signalling(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_two(a, b, status); + return (relation != float_relation_equal) && (relation != float_relation_unordered); +} + +// 0x1d +BX_CPP_INLINE int float32_ge_ordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation == float_relation_greater) || (relation == float_relation_equal); +} + +// 0x1e +BX_CPP_INLINE int float32_gt_ordered_quiet(float32 a, float32 b, struct float_status_t *status) +{ + int relation = float32_compare_quiet(a, b, status); + return (relation == float_relation_greater); +} + +// 0x1f +BX_CPP_INLINE int float32_true_signalling(float32 a, float32 b, struct float_status_t *status) +{ + float32_compare_two(a, b, status); + return 1; +} + +// ======= float64 ======= // + +typedef int (*float64_compare_method)(float64, float64, struct float_status_t *status); + +// 0x00 +BX_CPP_INLINE int float64_eq_ordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation == float_relation_equal); +} + +// 0x01 +BX_CPP_INLINE int float64_lt_ordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation == float_relation_less); +} + +// 0x02 +BX_CPP_INLINE int float64_le_ordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation == float_relation_less) || (relation == float_relation_equal); +} + +// 0x03 +BX_CPP_INLINE int float64_unordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation == float_relation_unordered); +} + +// 0x04 +BX_CPP_INLINE int float64_neq_unordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation != float_relation_equal); +} + +// 0x05 +BX_CPP_INLINE int float64_nlt_unordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation != float_relation_less); +} + +// 0x06 +BX_CPP_INLINE int float64_nle_unordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation != float_relation_less) && (relation != float_relation_equal); +} + +// 0x07 +BX_CPP_INLINE int float64_ordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation != float_relation_unordered); +} + +// 0x08 +BX_CPP_INLINE int float64_eq_unordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation == float_relation_equal) || (relation == float_relation_unordered); +} + +// 0x09 +BX_CPP_INLINE int float64_nge_unordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation == float_relation_less) || (relation == float_relation_unordered); +} + +// 0x0a +BX_CPP_INLINE int float64_ngt_unordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation != float_relation_greater); +} + +// 0x0b +BX_CPP_INLINE int float64_false_quiet(float64 a, float64 b, struct float_status_t *status) +{ + float64_compare_quiet(a, b, status); + return 0; +} + +// 0x0c +BX_CPP_INLINE int float64_neq_ordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation != float_relation_equal) && (relation != float_relation_unordered); +} + +// 0x0d +BX_CPP_INLINE int float64_ge_ordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation == float_relation_greater) || (relation == float_relation_equal); +} + +// 0x0e +BX_CPP_INLINE int float64_gt_ordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation == float_relation_greater); +} + +// 0x0f +BX_CPP_INLINE int float64_true_quiet(float64 a, float64 b, struct float_status_t *status) +{ + float64_compare_quiet(a, b, status); + return 1; +} + +// 0x10 +BX_CPP_INLINE int float64_eq_ordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation == float_relation_equal); +} + +// 0x11 +BX_CPP_INLINE int float64_lt_ordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation == float_relation_less); +} + +// 0x12 +BX_CPP_INLINE int float64_le_ordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation == float_relation_less) || (relation == float_relation_equal); +} + +// 0x13 +BX_CPP_INLINE int float64_unordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation == float_relation_unordered); +} + +// 0x14 +BX_CPP_INLINE int float64_neq_unordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation != float_relation_equal); +} + +// 0x15 +BX_CPP_INLINE int float64_nlt_unordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation != float_relation_less); +} + +// 0x16 +BX_CPP_INLINE int float64_nle_unordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation != float_relation_less) && (relation != float_relation_equal); +} + +// 0x17 +BX_CPP_INLINE int float64_ordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation != float_relation_unordered); +} + +// 0x18 +BX_CPP_INLINE int float64_eq_unordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation == float_relation_equal) || (relation == float_relation_unordered); +} + +// 0x19 +BX_CPP_INLINE int float64_nge_unordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation == float_relation_less) || (relation == float_relation_unordered); +} + +// 0x1a +BX_CPP_INLINE int float64_ngt_unordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation != float_relation_greater); +} + +// 0x1b +BX_CPP_INLINE int float64_false_signalling(float64 a, float64 b, struct float_status_t *status) +{ + float64_compare_two(a, b, status); + return 0; +} + +// 0x1c +BX_CPP_INLINE int float64_neq_ordered_signalling(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_two(a, b, status); + return (relation != float_relation_equal) && (relation != float_relation_unordered); +} + +// 0x1d +BX_CPP_INLINE int float64_ge_ordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation == float_relation_greater) || (relation == float_relation_equal); +} + +// 0x1e +BX_CPP_INLINE int float64_gt_ordered_quiet(float64 a, float64 b, struct float_status_t *status) +{ + int relation = float64_compare_quiet(a, b, status); + return (relation == float_relation_greater); +} + +// 0x1f +BX_CPP_INLINE int float64_true_signalling(float64 a, float64 b, struct float_status_t *status) +{ + float64_compare_two(a, b, status); + return 1; +} + +#endif diff --git a/src/cpu/softfloat/softfloat-macros.h b/src/cpu/softfloat/softfloat-macros.h new file mode 100644 index 000000000..cb867bf5d --- /dev/null +++ b/src/cpu/softfloat/softfloat-macros.h @@ -0,0 +1,686 @@ +/*============================================================================ +This C source fragment is part of the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b. + +Written by John R. Hauser. This work was made possible in part by the +International Computer Science Institute, located at Suite 600, 1947 Center +Street, Berkeley, California 94704. Funding was partially provided by the +National Science Foundation under grant MIP-9311980. The original version +of this code was written as part of a project to build a fixed-point vector +processor in collaboration with the University of California at Berkeley, +overseen by Profs. Nelson Morgan and John Wawrzynek. More information +is available through the Web page `http://www.cs.berkeley.edu/~jhauser/ +arithmetic/SoftFloat.html'. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal notice) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Adapted for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#ifndef _SOFTFLOAT_MACROS_H_ +#define _SOFTFLOAT_MACROS_H_ + +/*---------------------------------------------------------------------------- +| Shifts `a' right by the number of bits given in `count'. If any nonzero +| bits are shifted off, they are ``jammed'' into the least significant bit of +| the result by setting the least significant bit to 1. The value of `count' +| can be arbitrarily large; in particular, if `count' is greater than 16, the +| result will be either 0 or 1, depending on whether `a' is zero or nonzero. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit16u shift16RightJamming(Bit16u a, int count) +{ + Bit16u z; + + if (count == 0) { + z = a; + } + else if (count < 16) { + z = (a>>count) | ((a<<((-count) & 15)) != 0); + } + else { + z = (a != 0); + } + + return z; +} + +/*---------------------------------------------------------------------------- +| Shifts `a' right by the number of bits given in `count'. If any nonzero +| bits are shifted off, they are ``jammed'' into the least significant bit of +| the result by setting the least significant bit to 1. The value of `count' +| can be arbitrarily large; in particular, if `count' is greater than 32, the +| result will be either 0 or 1, depending on whether `a' is zero or nonzero. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit32u shift32RightJamming(Bit32u a, int count) +{ + Bit32u z; + + if (count == 0) { + z = a; + } + else if (count < 32) { + z = (a>>count) | ((a<<((-count) & 31)) != 0); + } + else { + z = (a != 0); + } + + return z; +} + +/*---------------------------------------------------------------------------- +| Shifts `a' right by the number of bits given in `count'. If any nonzero +| bits are shifted off, they are ``jammed'' into the least significant bit of +| the result by setting the least significant bit to 1. The value of `count' +| can be arbitrarily large; in particular, if `count' is greater than 64, the +| result will be either 0 or 1, depending on whether `a' is zero or nonzero. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit64u shift64RightJamming(Bit64u a, int count) +{ + Bit64u z; + + if (count == 0) { + z = a; + } + else if (count < 64) { + z = (a>>count) | ((a << ((-count) & 63)) != 0); + } + else { + z = (a != 0); + } + + return z; +} + +/*---------------------------------------------------------------------------- +| Shifts the 128-bit value formed by concatenating `a0' and `a1' right by 64 +| _plus_ the number of bits given in `count'. The shifted result is at most +| 64 nonzero bits; this is stored at the location pointed to by `z0Ptr'. The +| bits shifted off form a second 64-bit result as follows: The _last_ bit +| shifted off is the most-significant bit of the extra result, and the other +| 63 bits of the extra result are all zero if and only if _all_but_the_last_ +| bits shifted off were all zero. This extra result is stored in the location +| pointed to by `z1Ptr'. The value of `count' can be arbitrarily large. +| (This routine makes more sense if `a0' and `a1' are considered to form +| a fixed-point value with binary point between `a0' and `a1'. This fixed- +| point value is shifted right by the number of bits given in `count', and +| the integer part of the result is returned at the location pointed to by +| `z0Ptr'. The fractional part of the result may be slightly corrupted as +| described above, and is returned at the location pointed to by `z1Ptr'.) +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void shift64ExtraRightJamming(Bit64u a0, Bit64u a1, int count, Bit64u *z0Ptr, Bit64u *z1Ptr) +{ + Bit64u z0, z1; + int negCount = (-count) & 63; + + if (count == 0) { + z1 = a1; + z0 = a0; + } + else if (count < 64) { + z1 = (a0<>count; + } + else { + if (count == 64) { + z1 = a0 | (a1 != 0); + } + else { + z1 = ((a0 | a1) != 0); + } + z0 = 0; + } + *z1Ptr = z1; + *z0Ptr = z0; +} + +/*---------------------------------------------------------------------------- +| Adds the 128-bit value formed by concatenating `a0' and `a1' to the 128-bit +| value formed by concatenating `b0' and `b1'. Addition is modulo 2^128, so +| any carry out is lost. The result is broken into two 64-bit pieces which +| are stored at the locations pointed to by `z0Ptr' and `z1Ptr'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void add128(Bit64u a0, Bit64u a1, Bit64u b0, Bit64u b1, Bit64u *z0Ptr, Bit64u *z1Ptr) +{ + Bit64u z1 = a1 + b1; + *z1Ptr = z1; + *z0Ptr = a0 + b0 + (z1 < a1); +} + +/*---------------------------------------------------------------------------- +| Subtracts the 128-bit value formed by concatenating `b0' and `b1' from the +| 128-bit value formed by concatenating `a0' and `a1'. Subtraction is modulo +| 2^128, so any borrow out (carry out) is lost. The result is broken into two +| 64-bit pieces which are stored at the locations pointed to by `z0Ptr' and +| `z1Ptr'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void + sub128(Bit64u a0, Bit64u a1, Bit64u b0, Bit64u b1, Bit64u *z0Ptr, Bit64u *z1Ptr) +{ + *z1Ptr = a1 - b1; + *z0Ptr = a0 - b0 - (a1 < b1); +} + +/*---------------------------------------------------------------------------- +| Multiplies `a' by `b' to obtain a 128-bit product. The product is broken +| into two 64-bit pieces which are stored at the locations pointed to by +| `z0Ptr' and `z1Ptr'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void mul64To128(Bit64u a, Bit64u b, Bit64u *z0Ptr, Bit64u *z1Ptr) +{ + Bit32u aHigh, aLow, bHigh, bLow; + Bit64u z0, zMiddleA, zMiddleB, z1; + + aLow = (Bit32u) a; + aHigh = (Bit32u)(a>>32); + bLow = (Bit32u) b; + bHigh = (Bit32u)(b>>32); + z1 = ((Bit64u) aLow) * bLow; + zMiddleA = ((Bit64u) aLow) * bHigh; + zMiddleB = ((Bit64u) aHigh) * bLow; + z0 = ((Bit64u) aHigh) * bHigh; + zMiddleA += zMiddleB; + z0 += (((Bit64u) (zMiddleA < zMiddleB))<<32) + (zMiddleA>>32); + zMiddleA <<= 32; + z1 += zMiddleA; + z0 += (z1 < zMiddleA); + *z1Ptr = z1; + *z0Ptr = z0; +} + +/*---------------------------------------------------------------------------- +| Returns an approximation to the 64-bit integer quotient obtained by dividing +| `b' into the 128-bit value formed by concatenating `a0' and `a1'. The +| divisor `b' must be at least 2^63. If q is the exact quotient truncated +| toward zero, the approximation returned lies between q and q + 2 inclusive. +| If the exact quotient q is larger than 64 bits, the maximum positive 64-bit +| unsigned integer is returned. +*----------------------------------------------------------------------------*/ + +#ifdef USE_estimateDiv128To64 +static Bit64u estimateDiv128To64(Bit64u a0, Bit64u a1, Bit64u b) +{ + Bit64u b0, b1; + Bit64u rem0, rem1, term0, term1; + Bit64u z; + + if (b <= a0) return BX_CONST64(0xFFFFFFFFFFFFFFFF); + b0 = b>>32; + z = (b0<<32 <= a0) ? BX_CONST64(0xFFFFFFFF00000000) : (a0 / b0)<<32; + mul64To128(b, z, &term0, &term1); + sub128(a0, a1, term0, term1, &rem0, &rem1); + while (((Bit64s) rem0) < 0) { + z -= BX_CONST64(0x100000000); + b1 = b<<32; + add128(rem0, rem1, b0, b1, &rem0, &rem1); + } + rem0 = (rem0<<32) | (rem1>>32); + z |= (b0<<32 <= rem0) ? 0xFFFFFFFF : rem0 / b0; + return z; +} +#endif + +/*---------------------------------------------------------------------------- +| Returns an approximation to the square root of the 32-bit significand given +| by `a'. Considered as an integer, `a' must be at least 2^31. If bit 0 of +| `aExp' (the least significant bit) is 1, the integer returned approximates +| 2^31*sqrt(`a'/2^31), where `a' is considered an integer. If bit 0 of `aExp' +| is 0, the integer returned approximates 2^31*sqrt(`a'/2^30). In either +| case, the approximation returned lies strictly within +/-2 of the exact +| value. +*----------------------------------------------------------------------------*/ + +#ifdef USE_estimateSqrt32 +static Bit32u estimateSqrt32(Bit16s aExp, Bit32u a) +{ + static const Bit16u sqrtOddAdjustments[] = { + 0x0004, 0x0022, 0x005D, 0x00B1, 0x011D, 0x019F, 0x0236, 0x02E0, + 0x039C, 0x0468, 0x0545, 0x0631, 0x072B, 0x0832, 0x0946, 0x0A67 + }; + static const Bit16u sqrtEvenAdjustments[] = { + 0x0A2D, 0x08AF, 0x075A, 0x0629, 0x051A, 0x0429, 0x0356, 0x029E, + 0x0200, 0x0179, 0x0109, 0x00AF, 0x0068, 0x0034, 0x0012, 0x0002 + }; + Bit32u z; + + int index = (a>>27) & 15; + if (aExp & 1) { + z = 0x4000 + (a>>17) - sqrtOddAdjustments[index]; + z = ((a / z)<<14) + (z<<15); + a >>= 1; + } + else { + z = 0x8000 + (a>>17) - sqrtEvenAdjustments[index]; + z = a / z + z; + z = (0x20000 <= z) ? 0xFFFF8000 : (z<<15); + if (z <= a) return (Bit32u) (((Bit32s) a)>>1); + } + return ((Bit32u) ((((Bit64u) a)<<31) / z)) + (z>>1); +} +#endif + +static const int countLeadingZeros8[] = { + 8, 7, 6, 6, 5, 5, 5, 5, 4, 4, 4, 4, 4, 4, 4, 4, + 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, + 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, + 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 +}; + +#ifdef FLOAT16 + +/*---------------------------------------------------------------------------- +| Returns the number of leading 0 bits before the most-significant 1 bit of +| `a'. If `a' is zero, 16 is returned. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int countLeadingZeros16(Bit16u a) +{ + int shiftCount = 0; + if (a < 0x100) { + shiftCount += 8; + a <<= 8; + } + shiftCount += countLeadingZeros8[a>>8]; + return shiftCount; +} + +#endif + +/*---------------------------------------------------------------------------- +| Returns the number of leading 0 bits before the most-significant 1 bit of +| `a'. If `a' is zero, 32 is returned. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int countLeadingZeros32(Bit32u a) +{ + int shiftCount = 0; + if (a < 0x10000) { + shiftCount += 16; + a <<= 16; + } + if (a < 0x1000000) { + shiftCount += 8; + a <<= 8; + } + shiftCount += countLeadingZeros8[a>>24]; + return shiftCount; +} + +/*---------------------------------------------------------------------------- +| Returns the number of leading 0 bits before the most-significant 1 bit of +| `a'. If `a' is zero, 64 is returned. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int countLeadingZeros64(Bit64u a) +{ + int shiftCount = 0; + if (a < BX_CONST64(0x100000000)) { + shiftCount += 32; + } + else { + a >>= 32; + } + shiftCount += countLeadingZeros32((Bit32u)(a)); + return shiftCount; +} + +#ifdef FLOATX80 + +/*---------------------------------------------------------------------------- +| Shifts the 128-bit value formed by concatenating `a0' and `a1' right by the +| number of bits given in `count'. Any bits shifted off are lost. The value +| of `count' can be arbitrarily large; in particular, if `count' is greater +| than 128, the result will be 0. The result is broken into two 64-bit pieces +| which are stored at the locations pointed to by `z0Ptr' and `z1Ptr'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void shift128Right(Bit64u a0, Bit64u a1, int count, Bit64u *z0Ptr, Bit64u *z1Ptr) +{ + Bit64u z0, z1; + int negCount = (-count) & 63; + + if (count == 0) { + z1 = a1; + z0 = a0; + } + else if (count < 64) { + z1 = (a0<>count); + z0 = a0>>count; + } + else { + z1 = (count < 128) ? (a0>>(count & 63)) : 0; + z0 = 0; + } + *z1Ptr = z1; + *z0Ptr = z0; +} + +/*---------------------------------------------------------------------------- +| Shifts the 128-bit value formed by concatenating `a0' and `a1' right by the +| number of bits given in `count'. If any nonzero bits are shifted off, they +| are ``jammed'' into the least significant bit of the result by setting the +| least significant bit to 1. The value of `count' can be arbitrarily large; +| in particular, if `count' is greater than 128, the result will be either +| 0 or 1, depending on whether the concatenation of `a0' and `a1' is zero or +| nonzero. The result is broken into two 64-bit pieces which are stored at +| the locations pointed to by `z0Ptr' and `z1Ptr'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void shift128RightJamming(Bit64u a0, Bit64u a1, int count, Bit64u *z0Ptr, Bit64u *z1Ptr) +{ + Bit64u z0, z1; + int negCount = (-count) & 63; + + if (count == 0) { + z1 = a1; + z0 = a0; + } + else if (count < 64) { + z1 = (a0<>count) | ((a1<>count; + } + else { + if (count == 64) { + z1 = a0 | (a1 != 0); + } + else if (count < 128) { + z1 = (a0>>(count & 63)) | (((a0<>((-count) & 63)); +} + +/*---------------------------------------------------------------------------- +| Adds the 192-bit value formed by concatenating `a0', `a1', and `a2' to the +| 192-bit value formed by concatenating `b0', `b1', and `b2'. Addition is +| modulo 2^192, so any carry out is lost. The result is broken into three +| 64-bit pieces which are stored at the locations pointed to by `z0Ptr', +| `z1Ptr', and `z2Ptr'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void add192( + Bit64u a0, + Bit64u a1, + Bit64u a2, + Bit64u b0, + Bit64u b1, + Bit64u b2, + Bit64u *z0Ptr, + Bit64u *z1Ptr, + Bit64u *z2Ptr +) +{ + Bit64u z0, z1, z2; + unsigned carry0, carry1; + + z2 = a2 + b2; + carry1 = (z2 < a2); + z1 = a1 + b1; + carry0 = (z1 < a1); + z0 = a0 + b0; + z1 += carry1; + z0 += (z1 < carry1); + z0 += carry0; + *z2Ptr = z2; + *z1Ptr = z1; + *z0Ptr = z0; +} + +/*---------------------------------------------------------------------------- +| Subtracts the 192-bit value formed by concatenating `b0', `b1', and `b2' +| from the 192-bit value formed by concatenating `a0', `a1', and `a2'. +| Subtraction is modulo 2^192, so any borrow out (carry out) is lost. The +| result is broken into three 64-bit pieces which are stored at the locations +| pointed to by `z0Ptr', `z1Ptr', and `z2Ptr'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void sub192( + Bit64u a0, + Bit64u a1, + Bit64u a2, + Bit64u b0, + Bit64u b1, + Bit64u b2, + Bit64u *z0Ptr, + Bit64u *z1Ptr, + Bit64u *z2Ptr +) +{ + Bit64u z0, z1, z2; + unsigned borrow0, borrow1; + + z2 = a2 - b2; + borrow1 = (a2 < b2); + z1 = a1 - b1; + borrow0 = (a1 < b1); + z0 = a0 - b0; + z0 -= (z1 < borrow1); + z1 -= borrow1; + z0 -= borrow0; + *z2Ptr = z2; + *z1Ptr = z1; + *z0Ptr = z0; +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the 128-bit value formed by concatenating `a0' and `a1' +| is equal to the 128-bit value formed by concatenating `b0' and `b1'. +| Otherwise, returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int eq128(Bit64u a0, Bit64u a1, Bit64u b0, Bit64u b1) +{ + return (a0 == b0) && (a1 == b1); +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the 128-bit value formed by concatenating `a0' and `a1' is less +| than or equal to the 128-bit value formed by concatenating `b0' and `b1'. +| Otherwise, returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int le128(Bit64u a0, Bit64u a1, Bit64u b0, Bit64u b1) +{ + return (a0 < b0) || ((a0 == b0) && (a1 <= b1)); +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the 128-bit value formed by concatenating `a0' and `a1' is less +| than the 128-bit value formed by concatenating `b0' and `b1'. Otherwise, +| returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int lt128(Bit64u a0, Bit64u a1, Bit64u b0, Bit64u b1) +{ + return (a0 < b0) || ((a0 == b0) && (a1 < b1)); +} + +#endif /* FLOATX80 */ + +/*---------------------------------------------------------------------------- +| Multiplies the 128-bit value formed by concatenating `a0' and `a1' by +| `b' to obtain a 192-bit product. The product is broken into three 64-bit +| pieces which are stored at the locations pointed to by `z0Ptr', `z1Ptr', and +| `z2Ptr'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void mul128By64To192( + Bit64u a0, + Bit64u a1, + Bit64u b, + Bit64u *z0Ptr, + Bit64u *z1Ptr, + Bit64u *z2Ptr +) +{ + Bit64u z0, z1, z2, more1; + + mul64To128(a1, b, &z1, &z2); + mul64To128(a0, b, &z0, &more1); + add128(z0, more1, 0, z1, &z0, &z1); + *z2Ptr = z2; + *z1Ptr = z1; + *z0Ptr = z0; +} + +#ifdef FLOAT128 + +/*---------------------------------------------------------------------------- +| Multiplies the 128-bit value formed by concatenating `a0' and `a1' to the +| 128-bit value formed by concatenating `b0' and `b1' to obtain a 256-bit +| product. The product is broken into four 64-bit pieces which are stored at +| the locations pointed to by `z0Ptr', `z1Ptr', `z2Ptr', and `z3Ptr'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void mul128To256( + Bit64u a0, + Bit64u a1, + Bit64u b0, + Bit64u b1, + Bit64u *z0Ptr, + Bit64u *z1Ptr, + Bit64u *z2Ptr, + Bit64u *z3Ptr +) +{ + Bit64u z0, z1, z2, z3; + Bit64u more1, more2; + + mul64To128(a1, b1, &z2, &z3); + mul64To128(a1, b0, &z1, &more2); + add128(z1, more2, 0, z2, &z1, &z2); + mul64To128(a0, b0, &z0, &more1); + add128(z0, more1, 0, z1, &z0, &z1); + mul64To128(a0, b1, &more1, &more2); + add128(more1, more2, 0, z2, &more1, &z2); + add128(z0, z1, 0, more1, &z0, &z1); + *z3Ptr = z3; + *z2Ptr = z2; + *z1Ptr = z1; + *z0Ptr = z0; +} + + +/*---------------------------------------------------------------------------- +| Shifts the 192-bit value formed by concatenating `a0', `a1', and `a2' right +| by 64 _plus_ the number of bits given in `count'. The shifted result is +| at most 128 nonzero bits; these are broken into two 64-bit pieces which are +| stored at the locations pointed to by `z0Ptr' and `z1Ptr'. The bits shifted +| off form a third 64-bit result as follows: The _last_ bit shifted off is +| the most-significant bit of the extra result, and the other 63 bits of the +| extra result are all zero if and only if _all_but_the_last_ bits shifted off +| were all zero. This extra result is stored in the location pointed to by +| `z2Ptr'. The value of `count' can be arbitrarily large. +| (This routine makes more sense if `a0', `a1', and `a2' are considered +| to form a fixed-point value with binary point between `a1' and `a2'. This +| fixed-point value is shifted right by the number of bits given in `count', +| and the integer part of the result is returned at the locations pointed to +| by `z0Ptr' and `z1Ptr'. The fractional part of the result may be slightly +| corrupted as described above, and is returned at the location pointed to by +| `z2Ptr'.) +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void shift128ExtraRightJamming( + Bit64u a0, + Bit64u a1, + Bit64u a2, + int count, + Bit64u *z0Ptr, + Bit64u *z1Ptr, + Bit64u *z2Ptr +) +{ + Bit64u z0, z1, z2; + int negCount = (-count) & 63; + + if (count == 0) { + z2 = a2; + z1 = a1; + z0 = a0; + } + else { + if (count < 64) { + z2 = a1<>count); + z0 = a0>>count; + } + else { + if (count == 64) { + z2 = a1; + z1 = a0; + } + else { + a2 |= a1; + if (count < 128) { + z2 = a0<>(count & 63); + } + else { + z2 = (count == 128) ? a0 : (a0 != 0); + z1 = 0; + } + } + z0 = 0; + } + z2 |= (a2 != 0); + } + *z2Ptr = z2; + *z1Ptr = z1; + *z0Ptr = z0; +} + +#endif /* FLOAT128 */ + +#endif diff --git a/src/cpu/softfloat/softfloat-muladd.cc b/src/cpu/softfloat/softfloat-muladd.cc new file mode 100644 index 000000000..7c9fec70e --- /dev/null +++ b/src/cpu/softfloat/softfloat-muladd.cc @@ -0,0 +1,558 @@ +/*============================================================================ +This C source file is part of the SoftFloat IEC/IEEE Floating-point Arithmetic +Package, Release 2b. + +Written by John R. Hauser. This work was made possible in part by the +International Computer Science Institute, located at Suite 600, 1947 Center +Street, Berkeley, California 94704. Funding was partially provided by the +National Science Foundation under grant MIP-9311980. The original version +of this code was written as part of a project to build a fixed-point vector +processor in collaboration with the University of California at Berkeley, +overseen by Profs. Nelson Morgan and John Wawrzynek. More information +is available through the Web page `http://www.cs.berkeley.edu/~jhauser/ +arithmetic/SoftFloat.html'. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * This code is based on QEMU patch by Peter Maydell + * Adapted for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#include "softfloat.h" +#include "softfloat-round-pack.h" + +/*---------------------------------------------------------------------------- +| Primitive arithmetic functions, including multi-word arithmetic, and +| division and square root approximations. (Can be specialized to target +| if desired). +*----------------------------------------------------------------------------*/ +#include "softfloat-macros.h" + +/*---------------------------------------------------------------------------- +| Functions and definitions to determine: (1) whether tininess for underflow +| is detected before or after rounding by default, (2) what (if anything) +| happens when exceptions are raised, (3) how signaling NaNs are distinguished +| from quiet NaNs, (4) the default generated quiet NaNs, and (5) how NaNs +| are propagated from function inputs to output. These details are target- +| specific. +*----------------------------------------------------------------------------*/ +#include "softfloat-specialize.h" + +/*---------------------------------------------------------------------------- +| Takes three single-precision floating-point values `a', `b' and `c', one of +| which is a NaN, and returns the appropriate NaN result. If any of `a', +| `b' or `c' is a signaling NaN, the invalid exception is raised. +| The input infzero indicates whether a*b was 0*inf or inf*0 (in which case +| obviously c is a NaN, and whether to propagate c or some other NaN is +| implementation defined). +*----------------------------------------------------------------------------*/ + +static float32 propagateFloat32MulAddNaN(float32 a, float32 b, float32 c, struct float_status_t *status) +{ + int aIsNaN = float32_is_nan(a); + int bIsNaN = float32_is_nan(b); + + int aIsSignalingNaN = float32_is_signaling_nan(a); + int bIsSignalingNaN = float32_is_signaling_nan(b); + int cIsSignalingNaN = float32_is_signaling_nan(c); + + a |= 0x00400000; + b |= 0x00400000; + c |= 0x00400000; + + if (aIsSignalingNaN | bIsSignalingNaN | cIsSignalingNaN) + float_raise(status, float_flag_invalid); + + // operate according to float_first_operand_nan mode + if (aIsSignalingNaN | aIsNaN) { + return a; + } + else { + return (bIsSignalingNaN | bIsNaN) ? b : c; + } +} + +/*---------------------------------------------------------------------------- +| Takes three double-precision floating-point values `a', `b' and `c', one of +| which is a NaN, and returns the appropriate NaN result. If any of `a', +| `b' or `c' is a signaling NaN, the invalid exception is raised. +| The input infzero indicates whether a*b was 0*inf or inf*0 (in which case +| obviously c is a NaN, and whether to propagate c or some other NaN is +| implementation defined). +*----------------------------------------------------------------------------*/ + +static float64 propagateFloat64MulAddNaN(float64 a, float64 b, float64 c, struct float_status_t *status) +{ + int aIsNaN = float64_is_nan(a); + int bIsNaN = float64_is_nan(b); + + int aIsSignalingNaN = float64_is_signaling_nan(a); + int bIsSignalingNaN = float64_is_signaling_nan(b); + int cIsSignalingNaN = float64_is_signaling_nan(c); + + a |= BX_CONST64(0x0008000000000000); + b |= BX_CONST64(0x0008000000000000); + c |= BX_CONST64(0x0008000000000000); + + if (aIsSignalingNaN | bIsSignalingNaN | cIsSignalingNaN) + float_raise(status, float_flag_invalid); + + // operate according to float_first_operand_nan mode + if (aIsSignalingNaN | aIsNaN) { + return a; + } + else { + return (bIsSignalingNaN | bIsNaN) ? b : c; + } +} + +/*---------------------------------------------------------------------------- +| Returns the result of multiplying the single-precision floating-point values +| `a' and `b' then adding 'c', with no intermediate rounding step after the +| multiplication. The operation is performed according to the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic 754-2008. +| The flags argument allows the caller to select negation of the +| addend, the intermediate product, or the final result. (The difference +| between this and having the caller do a separate negation is that negating +| externally will flip the sign bit on NaNs.) +*----------------------------------------------------------------------------*/ + +float32 float32_muladd(float32 a, float32 b, float32 c, int flags, struct float_status_t *status) +{ + int aSign, bSign, cSign, zSign; + Bit16s aExp, bExp, cExp, pExp, zExp; + Bit32u aSig, bSig, cSig; + int pInf, pZero, pSign; + Bit64u pSig64, cSig64, zSig64; + Bit32u pSig; + int shiftcount; + + aSig = extractFloat32Frac(a); + aExp = extractFloat32Exp(a); + aSign = extractFloat32Sign(a); + bSig = extractFloat32Frac(b); + bExp = extractFloat32Exp(b); + bSign = extractFloat32Sign(b); + cSig = extractFloat32Frac(c); + cExp = extractFloat32Exp(c); + cSign = extractFloat32Sign(c); + + /* It is implementation-defined whether the cases of (0,inf,qnan) + * and (inf,0,qnan) raise InvalidOperation or not (and what QNaN + * they return if they do), so we have to hand this information + * off to the target-specific pick-a-NaN routine. + */ + if (((aExp == 0xff) && aSig) || + ((bExp == 0xff) && bSig) || + ((cExp == 0xff) && cSig)) { + return propagateFloat32MulAddNaN(a, b, c, status); + } + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + if (cExp == 0) cSig = 0; + } + + int infzero = ((aExp == 0 && aSig == 0 && bExp == 0xff && bSig == 0) || + (aExp == 0xff && aSig == 0 && bExp == 0 && bSig == 0)); + + if (infzero) { + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + + if (flags & float_muladd_negate_c) { + cSign ^= 1; + } + + /* Work out the sign and type of the product */ + pSign = aSign ^ bSign; + if (flags & float_muladd_negate_product) { + pSign ^= 1; + } + pInf = (aExp == 0xff) || (bExp == 0xff); + pZero = ((aExp | aSig) == 0) || ((bExp | bSig) == 0); + + if (cExp == 0xff) { + if (pInf && (pSign ^ cSign)) { + /* addition of opposite-signed infinities => InvalidOperation */ + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + /* Otherwise generate an infinity of the same sign */ + if ((aSig && aExp == 0) || (bSig && bExp == 0)) { + float_raise(status, float_flag_denormal); + } + return packFloat32(cSign, 0xff, 0); + } + + if (pInf) { + if ((aSig && aExp == 0) || (bSig && bExp == 0) || (cSig && cExp == 0)) { + float_raise(status, float_flag_denormal); + } + return packFloat32(pSign, 0xff, 0); + } + + if (pZero) { + if (cExp == 0) { + if (cSig == 0) { + /* Adding two exact zeroes */ + if (pSign == cSign) { + zSign = pSign; + } else if (get_float_rounding_mode(status) == float_round_down) { + zSign = 1; + } else { + zSign = 0; + } + return packFloat32(zSign, 0, 0); + } + /* Exact zero plus a denormal */ + float_raise(status, float_flag_denormal); + if (get_flush_underflow_to_zero(status)) { + float_raise(status, float_flag_underflow | float_flag_inexact); + return packFloat32(cSign, 0, 0); + } + } + /* Zero plus something non-zero */ + return packFloat32(cSign, cExp, cSig); + } + + if (aExp == 0) { + float_raise(status, float_flag_denormal); + normalizeFloat32Subnormal(aSig, &aExp, &aSig); + } + if (bExp == 0) { + float_raise(status, float_flag_denormal); + normalizeFloat32Subnormal(bSig, &bExp, &bSig); + } + + /* Calculate the actual result a * b + c */ + + /* Multiply first; this is easy. */ + /* NB: we subtract 0x7e where float32_mul() subtracts 0x7f + * because we want the true exponent, not the "one-less-than" + * flavour that roundAndPackFloat32() takes. + */ + pExp = aExp + bExp - 0x7e; + aSig = (aSig | 0x00800000) << 7; + bSig = (bSig | 0x00800000) << 8; + pSig64 = (Bit64u)aSig * bSig; + if ((Bit64s)(pSig64 << 1) >= 0) { + pSig64 <<= 1; + pExp--; + } + + zSign = pSign; + + /* Now pSig64 is the significand of the multiply, with the explicit bit in + * position 62. + */ + if (cExp == 0) { + if (!cSig) { + /* Throw out the special case of c being an exact zero now */ + pSig = (Bit32u) shift64RightJamming(pSig64, 32); + return roundAndPackFloat32(zSign, pExp - 1, pSig, status); + } + float_raise(status, float_flag_denormal); + normalizeFloat32Subnormal(cSig, &cExp, &cSig); + } + + cSig64 = (Bit64u)cSig << 39; + cSig64 |= BX_CONST64(0x4000000000000000); + int expDiff = pExp - cExp; + + if (pSign == cSign) { + /* Addition */ + if (expDiff > 0) { + /* scale c to match p */ + cSig64 = shift64RightJamming(cSig64, expDiff); + zExp = pExp; + } else if (expDiff < 0) { + /* scale p to match c */ + pSig64 = shift64RightJamming(pSig64, -expDiff); + zExp = cExp; + } else { + /* no scaling needed */ + zExp = cExp; + } + /* Add significands and make sure explicit bit ends up in posn 62 */ + zSig64 = pSig64 + cSig64; + if ((Bit64s)zSig64 < 0) { + zSig64 = shift64RightJamming(zSig64, 1); + } else { + zExp--; + } + zSig64 = shift64RightJamming(zSig64, 32); + return roundAndPackFloat32(zSign, zExp, zSig64, status); + } else { + /* Subtraction */ + if (expDiff > 0) { + cSig64 = shift64RightJamming(cSig64, expDiff); + zSig64 = pSig64 - cSig64; + zExp = pExp; + } else if (expDiff < 0) { + pSig64 = shift64RightJamming(pSig64, -expDiff); + zSig64 = cSig64 - pSig64; + zExp = cExp; + zSign ^= 1; + } else { + zExp = pExp; + if (cSig64 < pSig64) { + zSig64 = pSig64 - cSig64; + } else if (pSig64 < cSig64) { + zSig64 = cSig64 - pSig64; + zSign ^= 1; + } else { + /* Exact zero */ + return packFloat32(get_float_rounding_mode(status) == float_round_down, 0, 0); + } + } + --zExp; + /* Do the equivalent of normalizeRoundAndPackFloat32() but + * starting with the significand in a Bit64u. + */ + shiftcount = countLeadingZeros64(zSig64) - 1; + zSig64 <<= shiftcount; + zExp -= shiftcount; + zSig64 = shift64RightJamming(zSig64, 32); + return roundAndPackFloat32(zSign, zExp, zSig64, status); + } +} + +/*---------------------------------------------------------------------------- +| Returns the result of multiplying the double-precision floating-point values +| `a' and `b' then adding 'c', with no intermediate rounding step after the +| multiplication. The operation is performed according to the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic 754-2008. +| The flags argument allows the caller to select negation of the +| addend, the intermediate product, or the final result. (The difference +| between this and having the caller do a separate negation is that negating +| externally will flip the sign bit on NaNs.) +*----------------------------------------------------------------------------*/ + +float64 float64_muladd(float64 a, float64 b, float64 c, int flags, struct float_status_t *status) +{ + int aSign, bSign, cSign, zSign; + Bit16s aExp, bExp, cExp, pExp, zExp; + Bit64u aSig, bSig, cSig; + int pInf, pZero, pSign; + Bit64u pSig0, pSig1, cSig0, cSig1, zSig0, zSig1; + int shiftcount; + + aSig = extractFloat64Frac(a); + aExp = extractFloat64Exp(a); + aSign = extractFloat64Sign(a); + bSig = extractFloat64Frac(b); + bExp = extractFloat64Exp(b); + bSign = extractFloat64Sign(b); + cSig = extractFloat64Frac(c); + cExp = extractFloat64Exp(c); + cSign = extractFloat64Sign(c); + + /* It is implementation-defined whether the cases of (0,inf,qnan) + * and (inf,0,qnan) raise InvalidOperation or not (and what QNaN + * they return if they do), so we have to hand this information + * off to the target-specific pick-a-NaN routine. + */ + if (((aExp == 0x7ff) && aSig) || + ((bExp == 0x7ff) && bSig) || + ((cExp == 0x7ff) && cSig)) { + return propagateFloat64MulAddNaN(a, b, c, status); + } + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + if (cExp == 0) cSig = 0; + } + + int infzero = ((aExp == 0 && aSig == 0 && bExp == 0x7ff && bSig == 0) || + (aExp == 0x7ff && aSig == 0 && bExp == 0 && bSig == 0)); + + if (infzero) { + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + + if (flags & float_muladd_negate_c) { + cSign ^= 1; + } + + /* Work out the sign and type of the product */ + pSign = aSign ^ bSign; + if (flags & float_muladd_negate_product) { + pSign ^= 1; + } + pInf = (aExp == 0x7ff) || (bExp == 0x7ff); + pZero = ((aExp | aSig) == 0) || ((bExp | bSig) == 0); + + if (cExp == 0x7ff) { + if (pInf && (pSign ^ cSign)) { + /* addition of opposite-signed infinities => InvalidOperation */ + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + /* Otherwise generate an infinity of the same sign */ + if ((aSig && aExp == 0) || (bSig && bExp == 0)) { + float_raise(status, float_flag_denormal); + } + return packFloat64(cSign, 0x7ff, 0); + } + + if (pInf) { + if ((aSig && aExp == 0) || (bSig && bExp == 0) || (cSig && cExp == 0)) { + float_raise(status, float_flag_denormal); + } + return packFloat64(pSign, 0x7ff, 0); + } + + if (pZero) { + if (cExp == 0) { + if (cSig == 0) { + /* Adding two exact zeroes */ + if (pSign == cSign) { + zSign = pSign; + } else if (get_float_rounding_mode(status) == float_round_down) { + zSign = 1; + } else { + zSign = 0; + } + return packFloat64(zSign, 0, 0); + } + /* Exact zero plus a denormal */ + float_raise(status, float_flag_denormal); + if (get_flush_underflow_to_zero(status)) { + float_raise(status, float_flag_underflow | float_flag_inexact); + return packFloat64(cSign, 0, 0); + } + } + /* Zero plus something non-zero */ + return packFloat64(cSign, cExp, cSig); + } + + if (aExp == 0) { + float_raise(status, float_flag_denormal); + normalizeFloat64Subnormal(aSig, &aExp, &aSig); + } + if (bExp == 0) { + float_raise(status, float_flag_denormal); + normalizeFloat64Subnormal(bSig, &bExp, &bSig); + } + + /* Calculate the actual result a * b + c */ + + /* Multiply first; this is easy. */ + /* NB: we subtract 0x3fe where float64_mul() subtracts 0x3ff + * because we want the true exponent, not the "one-less-than" + * flavour that roundAndPackFloat64() takes. + */ + pExp = aExp + bExp - 0x3fe; + aSig = (aSig | BX_CONST64(0x0010000000000000))<<10; + bSig = (bSig | BX_CONST64(0x0010000000000000))<<11; + mul64To128(aSig, bSig, &pSig0, &pSig1); + if ((Bit64s)(pSig0 << 1) >= 0) { + shortShift128Left(pSig0, pSig1, 1, &pSig0, &pSig1); + pExp--; + } + + zSign = pSign; + + /* Now [pSig0:pSig1] is the significand of the multiply, with the explicit + * bit in position 126. + */ + if (cExp == 0) { + if (!cSig) { + /* Throw out the special case of c being an exact zero now */ + shift128RightJamming(pSig0, pSig1, 64, &pSig0, &pSig1); + return roundAndPackFloat64(zSign, pExp - 1, pSig1, status); + } + float_raise(status, float_flag_denormal); + normalizeFloat64Subnormal(cSig, &cExp, &cSig); + } + + cSig0 = cSig << 10; + cSig1 = 0; + cSig0 |= BX_CONST64(0x4000000000000000); + int expDiff = pExp - cExp; + + if (pSign == cSign) { + /* Addition */ + if (expDiff > 0) { + /* scale c to match p */ + shift128RightJamming(cSig0, cSig1, expDiff, &cSig0, &cSig1); + zExp = pExp; + } else if (expDiff < 0) { + /* scale p to match c */ + shift128RightJamming(pSig0, pSig1, -expDiff, &pSig0, &pSig1); + zExp = cExp; + } else { + /* no scaling needed */ + zExp = cExp; + } + /* Add significands and make sure explicit bit ends up in posn 126 */ + add128(pSig0, pSig1, cSig0, cSig1, &zSig0, &zSig1); + if ((Bit64s)zSig0 < 0) { + shift128RightJamming(zSig0, zSig1, 1, &zSig0, &zSig1); + } else { + zExp--; + } + shift128RightJamming(zSig0, zSig1, 64, &zSig0, &zSig1); + return roundAndPackFloat64(zSign, zExp, zSig1, status); + } else { + /* Subtraction */ + if (expDiff > 0) { + shift128RightJamming(cSig0, cSig1, expDiff, &cSig0, &cSig1); + sub128(pSig0, pSig1, cSig0, cSig1, &zSig0, &zSig1); + zExp = pExp; + } else if (expDiff < 0) { + shift128RightJamming(pSig0, pSig1, -expDiff, &pSig0, &pSig1); + sub128(cSig0, cSig1, pSig0, pSig1, &zSig0, &zSig1); + zExp = cExp; + zSign ^= 1; + } else { + zExp = pExp; + if (lt128(cSig0, cSig1, pSig0, pSig1)) { + sub128(pSig0, pSig1, cSig0, cSig1, &zSig0, &zSig1); + } else if (lt128(pSig0, pSig1, cSig0, cSig1)) { + sub128(cSig0, cSig1, pSig0, pSig1, &zSig0, &zSig1); + zSign ^= 1; + } else { + /* Exact zero */ + return packFloat64(get_float_rounding_mode(status) == float_round_down, 0, 0); + } + } + --zExp; + /* Do the equivalent of normalizeRoundAndPackFloat64() but + * starting with the significand in a pair of Bit64u. + */ + if (zSig0) { + shiftcount = countLeadingZeros64(zSig0) - 1; + shortShift128Left(zSig0, zSig1, shiftcount, &zSig0, &zSig1); + if (zSig1) { + zSig0 |= 1; + } + zExp -= shiftcount; + } else { + shiftcount = countLeadingZeros64(zSig1) - 1; + zSig0 = zSig1 << shiftcount; + zExp -= (shiftcount + 64); + } + return roundAndPackFloat64(zSign, zExp, zSig0, status); + } +} diff --git a/src/cpu/softfloat/softfloat-round-pack.cc b/src/cpu/softfloat/softfloat-round-pack.cc new file mode 100644 index 000000000..2b3965840 --- /dev/null +++ b/src/cpu/softfloat/softfloat-round-pack.cc @@ -0,0 +1,896 @@ +/*============================================================================ +This C source file is part of the SoftFloat IEC/IEEE Floating-point Arithmetic +Package, Release 2b. + +Written by John R. Hauser. This work was made possible in part by the +International Computer Science Institute, located at Suite 600, 1947 Center +Street, Berkeley, California 94704. Funding was partially provided by the +National Science Foundation under grant MIP-9311980. The original version +of this code was written as part of a project to build a fixed-point vector +processor in collaboration with the University of California at Berkeley, +overseen by Profs. Nelson Morgan and John Wawrzynek. More information +is available through the Web page `http://www.cs.berkeley.edu/~jhauser/ +arithmetic/SoftFloat.html'. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +#define FLOAT128 + +/*============================================================================ + * Adapted for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#include "softfloat.h" +#include "softfloat-round-pack.h" + +/*---------------------------------------------------------------------------- +| Primitive arithmetic functions, including multi-word arithmetic, and +| division and square root approximations. (Can be specialized to target +| if desired). +*----------------------------------------------------------------------------*/ +#include "softfloat-macros.h" + +/*---------------------------------------------------------------------------- +| Functions and definitions to determine: (1) whether tininess for underflow +| is detected before or after rounding by default, (2) what (if anything) +| happens when exceptions are raised, (3) how signaling NaNs are distinguished +| from quiet NaNs, (4) the default generated quiet NaNs, and (5) how NaNs +| are propagated from function inputs to output. These details are target- +| specific. +*----------------------------------------------------------------------------*/ +#include "softfloat-specialize.h" + +/*---------------------------------------------------------------------------- +| Takes a 64-bit fixed-point value `absZ' with binary point between bits 6 +| and 7, and returns the properly rounded 32-bit integer corresponding to the +| input. If `zSign' is 1, the input is negated before being converted to an +| integer. Bit 63 of `absZ' must be zero. Ordinarily, the fixed-point input +| is simply rounded to an integer, with the inexact exception raised if the +| input cannot be represented exactly as an integer. However, if the fixed- +| point input is too large, the invalid exception is raised and the integer +| indefinite value is returned. +*----------------------------------------------------------------------------*/ + +Bit32s roundAndPackInt32(int zSign, Bit64u exactAbsZ, struct float_status_t *status) +{ + int roundingMode = get_float_rounding_mode(status); + int roundNearestEven = (roundingMode == float_round_nearest_even); + int roundIncrement = 0x40; + if (! roundNearestEven) { + if (roundingMode == float_round_to_zero) roundIncrement = 0; + else { + roundIncrement = 0x7F; + if (zSign) { + if (roundingMode == float_round_up) roundIncrement = 0; + } + else { + if (roundingMode == float_round_down) roundIncrement = 0; + } + } + } + int roundBits = (int)(exactAbsZ & 0x7F); + Bit64u absZ = (exactAbsZ + roundIncrement)>>7; + absZ &= ~(((roundBits ^ 0x40) == 0) & roundNearestEven); + Bit32s z = (Bit32s) absZ; + if (zSign) z = -z; + if ((absZ>>32) || (z && ((z < 0) ^ zSign))) { + float_raise(status, float_flag_invalid); + return (Bit32s)(int32_indefinite); + } + if (roundBits) { + float_raise(status, float_flag_inexact); + if ((absZ << 7) > exactAbsZ) + set_float_rounding_up(status); + } + return z; +} + +/*---------------------------------------------------------------------------- +| Takes the 128-bit fixed-point value formed by concatenating `absZ0' and +| `absZ1', with binary point between bits 63 and 64 (between the input words), +| and returns the properly rounded 64-bit integer corresponding to the input. +| If `zSign' is 1, the input is negated before being converted to an integer. +| Ordinarily, the fixed-point input is simply rounded to an integer, with +| the inexact exception raised if the input cannot be represented exactly as +| an integer. However, if the fixed-point input is too large, the invalid +| exception is raised and the integer indefinite value is returned. +*----------------------------------------------------------------------------*/ + +Bit64s roundAndPackInt64(int zSign, Bit64u absZ0, Bit64u absZ1, struct float_status_t *status) +{ + Bit64s z; + int roundingMode = get_float_rounding_mode(status); + int roundNearestEven = (roundingMode == float_round_nearest_even); + int increment = ((Bit64s) absZ1 < 0); + if (! roundNearestEven) { + if (roundingMode == float_round_to_zero) increment = 0; + else { + if (zSign) { + increment = (roundingMode == float_round_down) && absZ1; + } + else { + increment = (roundingMode == float_round_up) && absZ1; + } + } + } + Bit64u exactAbsZ0 = absZ0; + if (increment) { + ++absZ0; + if (absZ0 == 0) goto overflow; + absZ0 &= ~(((Bit64u) (absZ1<<1) == 0) & roundNearestEven); + } + z = absZ0; + if (zSign) z = -z; + if (z && ((z < 0) ^ zSign)) { + overflow: + float_raise(status, float_flag_invalid); + return (Bit64s)(int64_indefinite); + } + if (absZ1) { + float_raise(status, float_flag_inexact); + if (absZ0 > exactAbsZ0) + set_float_rounding_up(status); + } + return z; +} + +/*---------------------------------------------------------------------------- +| Takes the 128-bit fixed-point value formed by concatenating `absZ0' and +| `absZ1', with binary point between bits 63 and 64 (between the input words), +| and returns the properly rounded 64-bit unsigned integer corresponding to the +| input. Ordinarily, the fixed-point input is simply rounded to an integer, +| with the inexact exception raised if the input cannot be represented exactly +| as an integer. However, if the fixed-point input is too large, the invalid +| exception is raised and the largest unsigned integer is returned. +*----------------------------------------------------------------------------*/ + +Bit64u roundAndPackUint64(int zSign, Bit64u absZ0, Bit64u absZ1, struct float_status_t *status) +{ + int roundingMode = get_float_rounding_mode(status); + int roundNearestEven = (roundingMode == float_round_nearest_even); + int increment = ((Bit64s) absZ1 < 0); + if (!roundNearestEven) { + if (roundingMode == float_round_to_zero) { + increment = 0; + } else if (absZ1) { + if (zSign) { + increment = (roundingMode == float_round_down) && absZ1; + } else { + increment = (roundingMode == float_round_up) && absZ1; + } + } + } + if (increment) { + ++absZ0; + if (absZ0 == 0) { + float_raise(status, float_flag_invalid); + return uint64_indefinite; + } + absZ0 &= ~(((Bit64u) (absZ1<<1) == 0) & roundNearestEven); + } + + if (zSign && absZ0) { + float_raise(status, float_flag_invalid); + return uint64_indefinite; + } + + if (absZ1) { + float_raise(status, float_flag_inexact); + } + return absZ0; +} + +#ifdef FLOAT16 + +/*---------------------------------------------------------------------------- +| Normalizes the subnormal half-precision floating-point value represented +| by the denormalized significand `aSig'. The normalized exponent and +| significand are stored at the locations pointed to by `zExpPtr' and +| `zSigPtr', respectively. +*----------------------------------------------------------------------------*/ + +void normalizeFloat16Subnormal(Bit16u aSig, Bit16s *zExpPtr, Bit16u *zSigPtr) +{ + int shiftCount = countLeadingZeros16(aSig) - 5; + *zSigPtr = aSig<> 4; + zSigRound &= ~(((roundBits ^ 0x10) == 0) & roundNearestEven); + if (zSigRound == 0) zExp = 0; + return packFloat16(zSign, zExp, zSigRound); +} + +#endif + +/*---------------------------------------------------------------------------- +| Normalizes the subnormal single-precision floating-point value represented +| by the denormalized significand `aSig'. The normalized exponent and +| significand are stored at the locations pointed to by `zExpPtr' and +| `zSigPtr', respectively. +*----------------------------------------------------------------------------*/ + +void normalizeFloat32Subnormal(Bit32u aSig, Bit16s *zExpPtr, Bit32u *zSigPtr) +{ + int shiftCount = countLeadingZeros32(aSig) - 8; + *zSigPtr = aSig<> 7; + zSigRound &= ~(((roundBits ^ 0x40) == 0) & roundNearestEven); + if (zSigRound == 0) zExp = 0; + if (roundBits) { + float_raise(status, float_flag_inexact); + if ((zSigRound << 7) > zSig) set_float_rounding_up(status); + } + return packFloat32(zSign, zExp, zSigRound); +} + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and significand `zSig', and returns the proper single-precision floating- +| point value corresponding to the abstract input. This routine is just like +| `roundAndPackFloat32' except that `zSig' does not have to be normalized. +| Bit 31 of `zSig' must be zero, and `zExp' must be 1 less than the ``true'' +| floating-point exponent. +*----------------------------------------------------------------------------*/ + +float32 normalizeRoundAndPackFloat32(int zSign, Bit16s zExp, Bit32u zSig, struct float_status_t *status) +{ + int shiftCount = countLeadingZeros32(zSig) - 1; + return roundAndPackFloat32(zSign, zExp - shiftCount, zSig<>10; + zSigRound &= ~(((roundBits ^ 0x200) == 0) & roundNearestEven); + if (zSigRound == 0) zExp = 0; + if (roundBits) { + float_raise(status, float_flag_inexact); + if ((zSigRound << 10) > zSig) set_float_rounding_up(status); + } + return packFloat64(zSign, zExp, zSigRound); +} + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and significand `zSig', and returns the proper double-precision floating- +| point value corresponding to the abstract input. This routine is just like +| `roundAndPackFloat64' except that `zSig' does not have to be normalized. +| Bit 63 of `zSig' must be zero, and `zExp' must be 1 less than the ``true'' +| floating-point exponent. +*----------------------------------------------------------------------------*/ + +float64 normalizeRoundAndPackFloat64(int zSign, Bit16s zExp, Bit64u zSig, struct float_status_t *status) +{ + int shiftCount = countLeadingZeros64(zSig) - 1; + return roundAndPackFloat64(zSign, zExp - shiftCount, zSig< zSigExact) set_float_rounding_up(status); + } + return packFloatx80(zSign, zExp, zSig0); + } + } + if (roundBits) float_raise(status, float_flag_inexact); + zSigExact = zSig0; + zSig0 += roundIncrement; + if (zSig0 < roundIncrement) { + // Basically scale by shifting right and keep overflow + ++zExp; + zSig0 = BX_CONST64(0x8000000000000000); + zSigExact >>= 1; // must scale also, or else later tests will fail + } + roundIncrement = roundMask + 1; + if (roundNearestEven && (roundBits<<1 == roundIncrement)) + roundMask |= roundIncrement; + zSig0 &= ~roundMask; + if (zSig0 > zSigExact) set_float_rounding_up(status); + if (zSig0 == 0) zExp = 0; + return packFloatx80(zSign, zExp, zSig0); + precision80: + increment = ((Bit64s) zSig1 < 0); + if (! roundNearestEven) { + if (roundingMode == float_round_to_zero) increment = 0; + else { + if (zSign) { + increment = (roundingMode == float_round_down) && zSig1; + } + else { + increment = (roundingMode == float_round_up) && zSig1; + } + } + } + if (0x7FFD <= (Bit32u) (zExp - 1)) { + if ((0x7FFE < zExp) + || ((zExp == 0x7FFE) + && (zSig0 == BX_CONST64(0xFFFFFFFFFFFFFFFF)) + && increment)) + { + roundMask = 0; + overflow: + float_raise(status, float_flag_overflow | float_flag_inexact); + if ((roundingMode == float_round_to_zero) + || (zSign && (roundingMode == float_round_up)) + || (! zSign && (roundingMode == float_round_down))) + { + return packFloatx80(zSign, 0x7FFE, ~roundMask); + } + set_float_rounding_up(status); + return packFloatx80(zSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (zExp <= 0) { + int isTiny = (zExp < 0) || (! increment) + || (zSig0 < BX_CONST64(0xFFFFFFFFFFFFFFFF)); + shift64ExtraRightJamming(zSig0, zSig1, 1 - zExp, &zSig0, &zSig1); + zExp = 0; + if (isTiny) { + if (zSig1 || (zSig0 && !float_exception_masked(status, float_flag_underflow))) + float_raise(status, float_flag_underflow); + } + if (zSig1) float_raise(status, float_flag_inexact); + if (roundNearestEven) increment = ((Bit64s) zSig1 < 0); + else { + if (zSign) { + increment = (roundingMode == float_round_down) && zSig1; + } else { + increment = (roundingMode == float_round_up) && zSig1; + } + } + if (increment) { + zSigExact = zSig0++; + zSig0 &= ~(((Bit64u) (zSig1<<1) == 0) & roundNearestEven); + if (zSig0 > zSigExact) set_float_rounding_up(status); + if ((Bit64s) zSig0 < 0) zExp = 1; + } + return packFloatx80(zSign, zExp, zSig0); + } + } + if (zSig1) float_raise(status, float_flag_inexact); + if (increment) { + zSigExact = zSig0++; + if (zSig0 == 0) { + zExp++; + zSig0 = BX_CONST64(0x8000000000000000); + zSigExact >>= 1; // must scale also, or else later tests will fail + } + else { + zSig0 &= ~(((Bit64u) (zSig1<<1) == 0) & roundNearestEven); + } + if (zSig0 > zSigExact) set_float_rounding_up(status); + } + else { + if (zSig0 == 0) zExp = 0; + } + return packFloatx80(zSign, zExp, zSig0); +} + +floatx80 roundAndPackFloatx80(int roundingPrecision, + int zSign, Bit32s zExp, Bit64u zSig0, Bit64u zSig1, struct float_status_t *status) +{ + struct float_status_t *round_status = status; + floatx80 result = SoftFloatRoundAndPackFloatx80(roundingPrecision, zSign, zExp, zSig0, zSig1, status); + + // bias unmasked undeflow + if (status->float_exception_flags & ~status->float_exception_masks & float_flag_underflow) { + float_raise(round_status, float_flag_underflow); + return SoftFloatRoundAndPackFloatx80(roundingPrecision, zSign, zExp + 0x6000, zSig0, zSig1, status = round_status); + } + + // bias unmasked overflow + if (status->float_exception_flags & ~status->float_exception_masks & float_flag_overflow) { + float_raise(round_status, float_flag_overflow); + return SoftFloatRoundAndPackFloatx80(roundingPrecision, zSign, zExp - 0x6000, zSig0, zSig1, status = round_status); + } + + return result; +} + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent +| `zExp', and significand formed by the concatenation of `zSig0' and `zSig1', +| and returns the proper extended double-precision floating-point value +| corresponding to the abstract input. This routine is just like +| `roundAndPackFloatx80' except that the input significand does not have to be +| normalized. +*----------------------------------------------------------------------------*/ + +floatx80 normalizeRoundAndPackFloatx80(int roundingPrecision, + int zSign, Bit32s zExp, Bit64u zSig0, Bit64u zSig1, struct float_status_t *status) +{ + if (zSig0 == 0) { + zSig0 = zSig1; + zSig1 = 0; + zExp -= 64; + } + int shiftCount = countLeadingZeros64(zSig0); + shortShift128Left(zSig0, zSig1, shiftCount, &zSig0, &zSig1); + zExp -= shiftCount; + return + roundAndPackFloatx80(roundingPrecision, zSign, zExp, zSig0, zSig1, status); +} + +#endif + +#ifdef FLOAT128 + +/*---------------------------------------------------------------------------- +| Normalizes the subnormal quadruple-precision floating-point value +| represented by the denormalized significand formed by the concatenation of +| `aSig0' and `aSig1'. The normalized exponent is stored at the location +| pointed to by `zExpPtr'. The most significant 49 bits of the normalized +| significand are stored at the location pointed to by `zSig0Ptr', and the +| least significant 64 bits of the normalized significand are stored at the +| location pointed to by `zSig1Ptr'. +*----------------------------------------------------------------------------*/ + +void normalizeFloat128Subnormal( + Bit64u aSig0, Bit64u aSig1, Bit32s *zExpPtr, Bit64u *zSig0Ptr, Bit64u *zSig1Ptr) +{ + int shiftCount; + + if (aSig0 == 0) { + shiftCount = countLeadingZeros64(aSig1) - 15; + if (shiftCount < 0) { + *zSig0Ptr = aSig1 >>(-shiftCount); + *zSig1Ptr = aSig1 << (shiftCount & 63); + } + else { + *zSig0Ptr = aSig1 << shiftCount; + *zSig1Ptr = 0; + } + *zExpPtr = - shiftCount - 63; + } + else { + shiftCount = countLeadingZeros64(aSig0) - 15; + shortShift128Left(aSig0, aSig1, shiftCount, zSig0Ptr, zSig1Ptr); + *zExpPtr = 1 - shiftCount; + } +} + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and extended significand formed by the concatenation of `zSig0', `zSig1', +| and `zSig2', and returns the proper quadruple-precision floating-point value +| corresponding to the abstract input. Ordinarily, the abstract value is +| simply rounded and packed into the quadruple-precision format, with the +| inexact exception raised if the abstract input cannot be represented +| exactly. However, if the abstract value is too large, the overflow and +| inexact exceptions are raised and an infinity or maximal finite value is +| returned. If the abstract value is too small, the input value is rounded to +| a subnormal number, and the underflow and inexact exceptions are raised if +| the abstract input cannot be represented exactly as a subnormal quadruple- +| precision floating-point number. +| The input significand must be normalized or smaller. If the input +| significand is not normalized, `zExp' must be 0; in that case, the result +| returned is a subnormal number, and it must not require rounding. In the +| usual case that the input significand is normalized, `zExp' must be 1 less +| than the ``true'' floating-point exponent. The handling of underflow and +| overflow follows the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float128 roundAndPackFloat128( + int zSign, Bit32s zExp, Bit64u zSig0, Bit64u zSig1, Bit64u zSig2, struct float_status_t *status) +{ + int increment = ((Bit64s) zSig2 < 0); + if (0x7FFD <= (Bit32u) zExp) { + if ((0x7FFD < zExp) + || ((zExp == 0x7FFD) + && eq128(BX_CONST64(0x0001FFFFFFFFFFFF), + BX_CONST64(0xFFFFFFFFFFFFFFFF), zSig0, zSig1) + && increment)) + { + float_raise(status, float_flag_overflow | float_flag_inexact); + return packFloat128Four(zSign, 0x7FFF, 0, 0); + } + if (zExp < 0) { + int isTiny = (zExp < -1) + || ! increment + || lt128(zSig0, zSig1, + BX_CONST64(0x0001FFFFFFFFFFFF), + BX_CONST64(0xFFFFFFFFFFFFFFFF)); + shift128ExtraRightJamming( + zSig0, zSig1, zSig2, -zExp, &zSig0, &zSig1, &zSig2); + zExp = 0; + if (isTiny && zSig2) float_raise(status, float_flag_underflow); + increment = ((Bit64s) zSig2 < 0); + } + } + if (zSig2) float_raise(status, float_flag_inexact); + if (increment) { + add128(zSig0, zSig1, 0, 1, &zSig0, &zSig1); + zSig1 &= ~((zSig2 + zSig2 == 0) & 1); + } + else { + if ((zSig0 | zSig1) == 0) zExp = 0; + } + return packFloat128Four(zSign, zExp, zSig0, zSig1); +} + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and significand formed by the concatenation of `zSig0' and `zSig1', and +| returns the proper quadruple-precision floating-point value corresponding +| to the abstract input. This routine is just like `roundAndPackFloat128' +| except that the input significand has fewer bits and does not have to be +| normalized. In all cases, `zExp' must be 1 less than the ``true'' floating- +| point exponent. +*----------------------------------------------------------------------------*/ + +float128 normalizeRoundAndPackFloat128( + int zSign, Bit32s zExp, Bit64u zSig0, Bit64u zSig1, struct float_status_t *status) +{ + Bit64u zSig2; + + if (zSig0 == 0) { + zSig0 = zSig1; + zSig1 = 0; + zExp -= 64; + } + int shiftCount = countLeadingZeros64(zSig0) - 15; + if (0 <= shiftCount) { + zSig2 = 0; + shortShift128Left(zSig0, zSig1, shiftCount, &zSig0, &zSig1); + } + else { + shift128ExtraRightJamming( + zSig0, zSig1, 0, -shiftCount, &zSig0, &zSig1, &zSig2); + } + zExp -= shiftCount; + return roundAndPackFloat128(zSign, zExp, zSig0, zSig1, zSig2, status); +} + +#endif diff --git a/src/cpu/softfloat/softfloat-round-pack.h b/src/cpu/softfloat/softfloat-round-pack.h new file mode 100644 index 000000000..1422aaea6 --- /dev/null +++ b/src/cpu/softfloat/softfloat-round-pack.h @@ -0,0 +1,309 @@ +/*============================================================================ +This C source file is part of the SoftFloat IEC/IEEE Floating-point Arithmetic +Package, Release 2b. + +Written by John R. Hauser. This work was made possible in part by the +International Computer Science Institute, located at Suite 600, 1947 Center +Street, Berkeley, California 94704. Funding was partially provided by the +National Science Foundation under grant MIP-9311980. The original version +of this code was written as part of a project to build a fixed-point vector +processor in collaboration with the University of California at Berkeley, +overseen by Profs. Nelson Morgan and John Wawrzynek. More information +is available through the Web page `http://www.cs.berkeley.edu/~jhauser/ +arithmetic/SoftFloat.html'. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Adapted for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#ifndef _SOFTFLOAT_ROUND_PACK_H_ +#define _SOFTFLOAT_ROUND_PACK_H_ + +#include "softfloat.h" + +/*---------------------------------------------------------------------------- +| Takes a 64-bit fixed-point value `absZ' with binary point between bits 6 +| and 7, and returns the properly rounded 32-bit integer corresponding to the +| input. If `zSign' is 1, the input is negated before being converted to an +| integer. Bit 63 of `absZ' must be zero. Ordinarily, the fixed-point input +| is simply rounded to an integer, with the inexact exception raised if the +| input cannot be represented exactly as an integer. However, if the fixed- +| point input is too large, the invalid exception is raised and the integer +| indefinite value is returned. +*----------------------------------------------------------------------------*/ + +Bit32s roundAndPackInt32(int zSign, Bit64u absZ, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Takes the 128-bit fixed-point value formed by concatenating `absZ0' and +| `absZ1', with binary point between bits 63 and 64 (between the input words), +| and returns the properly rounded 64-bit integer corresponding to the input. +| If `zSign' is 1, the input is negated before being converted to an integer. +| Ordinarily, the fixed-point input is simply rounded to an integer, with +| the inexact exception raised if the input cannot be represented exactly as +| an integer. However, if the fixed-point input is too large, the invalid +| exception is raised and the integer indefinite value is returned. +*----------------------------------------------------------------------------*/ + +Bit64s roundAndPackInt64(int zSign, Bit64u absZ0, Bit64u absZ1, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Takes the 128-bit fixed-point value formed by concatenating `absZ0' and +| `absZ1', with binary point between bits 63 and 64 (between the input words), +| and returns the properly rounded 64-bit unsigned integer corresponding to the +| input. Ordinarily, the fixed-point input is simply rounded to an integer, +| with the inexact exception raised if the input cannot be represented exactly +| as an integer. However, if the fixed-point input is too large, the invalid +| exception is raised and the largest unsigned integer is returned. +*----------------------------------------------------------------------------*/ + +Bit64u roundAndPackUint64(int zSign, Bit64u absZ0, Bit64u absZ1, struct float_status_t *status); + +#ifdef FLOAT16 + +/*---------------------------------------------------------------------------- +| Normalizes the subnormal half-precision floating-point value represented +| by the denormalized significand `aSig'. The normalized exponent and +| significand are stored at the locations pointed to by `zExpPtr' and +| `zSigPtr', respectively. +*----------------------------------------------------------------------------*/ + +void normalizeFloat16Subnormal(Bit16u aSig, Bit16s *zExpPtr, Bit16u *zSigPtr); + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and significand `zSig', and returns the proper half-precision floating- +| point value corresponding to the abstract input. Ordinarily, the abstract +| value is simply rounded and packed into the half-precision format, with +| the inexact exception raised if the abstract input cannot be represented +| exactly. However, if the abstract value is too large, the overflow and +| inexact exceptions are raised and an infinity or maximal finite value is +| returned. If the abstract value is too small, the input value is rounded to +| a subnormal number, and the underflow and inexact exceptions are raised if +| the abstract input cannot be represented exactly as a subnormal single- +| precision floating-point number. +| The input significand `zSig' has its binary point between bits 14 +| and 13, which is 4 bits to the left of the usual location. This shifted +| significand must be normalized or smaller. If `zSig' is not normalized, +| `zExp' must be 0; in that case, the result returned is a subnormal number, +| and it must not require rounding. In the usual case that `zSig' is +| normalized, `zExp' must be 1 less than the ``true'' floating-point exponent. +| The handling of underflow and overflow follows the IEC/IEEE Standard for +| Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float16 roundAndPackFloat16(int zSign, Bit16s zExp, Bit16u zSig, struct float_status_t *status); + +#endif + +/*---------------------------------------------------------------------------- +| Normalizes the subnormal single-precision floating-point value represented +| by the denormalized significand `aSig'. The normalized exponent and +| significand are stored at the locations pointed to by `zExpPtr' and +| `zSigPtr', respectively. +*----------------------------------------------------------------------------*/ + +void normalizeFloat32Subnormal(Bit32u aSig, Bit16s *zExpPtr, Bit32u *zSigPtr); + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and significand `zSig', and returns the proper single-precision floating- +| point value corresponding to the abstract input. Ordinarily, the abstract +| value is simply rounded and packed into the single-precision format, with +| the inexact exception raised if the abstract input cannot be represented +| exactly. However, if the abstract value is too large, the overflow and +| inexact exceptions are raised and an infinity or maximal finite value is +| returned. If the abstract value is too small, the input value is rounded to +| a subnormal number, and the underflow and inexact exceptions are raised if +| the abstract input cannot be represented exactly as a subnormal single- +| precision floating-point number. +| The input significand `zSig' has its binary point between bits 30 +| and 29, which is 7 bits to the left of the usual location. This shifted +| significand must be normalized or smaller. If `zSig' is not normalized, +| `zExp' must be 0; in that case, the result returned is a subnormal number, +| and it must not require rounding. In the usual case that `zSig' is +| normalized, `zExp' must be 1 less than the ``true'' floating-point exponent. +| The handling of underflow and overflow follows the IEC/IEEE Standard for +| Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 roundAndPackFloat32(int zSign, Bit16s zExp, Bit32u zSig, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and significand `zSig', and returns the proper single-precision floating- +| point value corresponding to the abstract input. This routine is just like +| `roundAndPackFloat32' except that `zSig' does not have to be normalized. +| Bit 31 of `zSig' must be zero, and `zExp' must be 1 less than the ``true'' +| floating-point exponent. +*----------------------------------------------------------------------------*/ + +float32 normalizeRoundAndPackFloat32(int zSign, Bit16s zExp, Bit32u zSig, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Normalizes the subnormal double-precision floating-point value represented +| by the denormalized significand `aSig'. The normalized exponent and +| significand are stored at the locations pointed to by `zExpPtr' and +| `zSigPtr', respectively. +*----------------------------------------------------------------------------*/ + +void normalizeFloat64Subnormal(Bit64u aSig, Bit16s *zExpPtr, Bit64u *zSigPtr); + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and significand `zSig', and returns the proper double-precision floating- +| point value corresponding to the abstract input. Ordinarily, the abstract +| value is simply rounded and packed into the double-precision format, with +| the inexact exception raised if the abstract input cannot be represented +| exactly. However, if the abstract value is too large, the overflow and +| inexact exceptions are raised and an infinity or maximal finite value is +| returned. If the abstract value is too small, the input value is rounded +| to a subnormal number, and the underflow and inexact exceptions are raised +| if the abstract input cannot be represented exactly as a subnormal double- +| precision floating-point number. +| The input significand `zSig' has its binary point between bits 62 +| and 61, which is 10 bits to the left of the usual location. This shifted +| significand must be normalized or smaller. If `zSig' is not normalized, +| `zExp' must be 0; in that case, the result returned is a subnormal number, +| and it must not require rounding. In the usual case that `zSig' is +| normalized, `zExp' must be 1 less than the ``true'' floating-point exponent. +| The handling of underflow and overflow follows the IEC/IEEE Standard for +| Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 roundAndPackFloat64(int zSign, Bit16s zExp, Bit64u zSig, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and significand `zSig', and returns the proper double-precision floating- +| point value corresponding to the abstract input. This routine is just like +| `roundAndPackFloat64' except that `zSig' does not have to be normalized. +| Bit 63 of `zSig' must be zero, and `zExp' must be 1 less than the ``true'' +| floating-point exponent. +*----------------------------------------------------------------------------*/ + +float64 normalizeRoundAndPackFloat64(int zSign, Bit16s zExp, Bit64u zSig, struct float_status_t *status); + +#ifdef FLOATX80 + +/*---------------------------------------------------------------------------- +| Normalizes the subnormal extended double-precision floating-point value +| represented by the denormalized significand `aSig'. The normalized exponent +| and significand are stored at the locations pointed to by `zExpPtr' and +| `zSigPtr', respectively. +*----------------------------------------------------------------------------*/ + +void normalizeFloatx80Subnormal(Bit64u aSig, Bit32s *zExpPtr, Bit64u *zSigPtr); + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and extended significand formed by the concatenation of `zSig0' and `zSig1', +| and returns the proper extended double-precision floating-point value +| corresponding to the abstract input. Ordinarily, the abstract value is +| rounded and packed into the extended double-precision format, with the +| inexact exception raised if the abstract input cannot be represented +| exactly. However, if the abstract value is too large, the overflow and +| inexact exceptions are raised and an infinity or maximal finite value is +| returned. If the abstract value is too small, the input value is rounded to +| a subnormal number, and the underflow and inexact exceptions are raised if +| the abstract input cannot be represented exactly as a subnormal extended +| double-precision floating-point number. +| If `roundingPrecision' is 32 or 64, the result is rounded to the same +| number of bits as single or double precision, respectively. Otherwise, the +| result is rounded to the full precision of the extended double-precision +| format. +| The input significand must be normalized or smaller. If the input +| significand is not normalized, `zExp' must be 0; in that case, the result +| returned is a subnormal number, and it must not require rounding. The +| handling of underflow and overflow follows the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +floatx80 roundAndPackFloatx80(int roundingPrecision, + int zSign, Bit32s zExp, Bit64u zSig0, Bit64u zSig1, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent +| `zExp', and significand formed by the concatenation of `zSig0' and `zSig1', +| and returns the proper extended double-precision floating-point value +| corresponding to the abstract input. This routine is just like +| `roundAndPackFloatx80' except that the input significand does not have to be +| normalized. +*----------------------------------------------------------------------------*/ + +floatx80 normalizeRoundAndPackFloatx80(int roundingPrecision, + int zSign, Bit32s zExp, Bit64u zSig0, Bit64u zSig1, struct float_status_t *status); + +#endif // FLOATX80 + +#ifdef FLOAT128 + +/*---------------------------------------------------------------------------- +| Normalizes the subnormal quadruple-precision floating-point value +| represented by the denormalized significand formed by the concatenation of +| `aSig0' and `aSig1'. The normalized exponent is stored at the location +| pointed to by `zExpPtr'. The most significant 49 bits of the normalized +| significand are stored at the location pointed to by `zSig0Ptr', and the +| least significant 64 bits of the normalized significand are stored at the +| location pointed to by `zSig1Ptr'. +*----------------------------------------------------------------------------*/ + +void normalizeFloat128Subnormal( + Bit64u aSig0, Bit64u aSig1, Bit32s *zExpPtr, Bit64u *zSig0Ptr, Bit64u *zSig1Ptr); + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and extended significand formed by the concatenation of `zSig0', `zSig1', +| and `zSig2', and returns the proper quadruple-precision floating-point value +| corresponding to the abstract input. Ordinarily, the abstract value is +| simply rounded and packed into the quadruple-precision format, with the +| inexact exception raised if the abstract input cannot be represented +| exactly. However, if the abstract value is too large, the overflow and +| inexact exceptions are raised and an infinity or maximal finite value is +| returned. If the abstract value is too small, the input value is rounded to +| a subnormal number, and the underflow and inexact exceptions are raised if +| the abstract input cannot be represented exactly as a subnormal quadruple- +| precision floating-point number. +| The input significand must be normalized or smaller. If the input +| significand is not normalized, `zExp' must be 0; in that case, the result +| returned is a subnormal number, and it must not require rounding. In the +| usual case that the input significand is normalized, `zExp' must be 1 less +| than the ``true'' floating-point exponent. The handling of underflow and +| overflow follows the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float128 roundAndPackFloat128( + int zSign, Bit32s zExp, Bit64u zSig0, Bit64u zSig1, Bit64u zSig2, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Takes an abstract floating-point value having sign `zSign', exponent `zExp', +| and significand formed by the concatenation of `zSig0' and `zSig1', and +| returns the proper quadruple-precision floating-point value corresponding +| to the abstract input. This routine is just like `roundAndPackFloat128' +| except that the input significand has fewer bits and does not have to be +| normalized. In all cases, `zExp' must be 1 less than the ``true'' floating- +| point exponent. +*----------------------------------------------------------------------------*/ + +float128 normalizeRoundAndPackFloat128( + int zSign, Bit32s zExp, Bit64u zSig0, Bit64u zSig1, struct float_status_t *status); + +#endif // FLOAT128 + +#endif diff --git a/src/cpu/softfloat/softfloat-specialize.cc b/src/cpu/softfloat/softfloat-specialize.cc new file mode 100644 index 000000000..bf0d11144 --- /dev/null +++ b/src/cpu/softfloat/softfloat-specialize.cc @@ -0,0 +1,187 @@ +/*============================================================================ +This C source fragment is part of the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b. + +Written by John R. Hauser. This work was made possible in part by the +International Computer Science Institute, located at Suite 600, 1947 Center +Street, Berkeley, California 94704. Funding was partially provided by the +National Science Foundation under grant MIP-9311980. The original version +of this code was written as part of a project to build a fixed-point vector +processor in collaboration with the University of California at Berkeley, +overseen by Profs. Nelson Morgan and John Wawrzynek. More information +is available through the Web page `http://www.cs.berkeley.edu/~jhauser/ +arithmetic/SoftFloat.html'. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +#define FLOAT128 + +/*============================================================================ + * Adapted for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#include "softfloat.h" +#include "softfloat-specialize.h" + +/*---------------------------------------------------------------------------- +| Takes two single-precision floating-point values `a' and `b', one of which +| is a NaN, and returns the appropriate NaN result. If either `a' or `b' is a +| signaling NaN, the invalid exception is raised. +*----------------------------------------------------------------------------*/ + +float32 propagateFloat32NaN(float32 a, float32 b, struct float_status_t *status) +{ + int aIsNaN, aIsSignalingNaN, bIsNaN, bIsSignalingNaN; + + aIsNaN = float32_is_nan(a); + aIsSignalingNaN = float32_is_signaling_nan(a); + bIsNaN = float32_is_nan(b); + bIsSignalingNaN = float32_is_signaling_nan(b); + a |= 0x00400000; + b |= 0x00400000; + if (aIsSignalingNaN | bIsSignalingNaN) float_raise(status, float_flag_invalid); + if (get_float_nan_handling_mode(status) == float_larger_significand_nan) { + if (aIsSignalingNaN) { + if (bIsSignalingNaN) goto returnLargerSignificand; + return bIsNaN ? b : a; + } + else if (aIsNaN) { + if (bIsSignalingNaN | ! bIsNaN) return a; + returnLargerSignificand: + if ((Bit32u) (a<<1) < (Bit32u) (b<<1)) return b; + if ((Bit32u) (b<<1) < (Bit32u) (a<<1)) return a; + return (a < b) ? a : b; + } + else { + return b; + } + } else { + return (aIsSignalingNaN | aIsNaN) ? a : b; + } +} + +/*---------------------------------------------------------------------------- +| Takes two double-precision floating-point values `a' and `b', one of which +| is a NaN, and returns the appropriate NaN result. If either `a' or `b' is a +| signaling NaN, the invalid exception is raised. +*----------------------------------------------------------------------------*/ + +float64 propagateFloat64NaN(float64 a, float64 b, struct float_status_t *status) +{ + int aIsNaN = float64_is_nan(a); + int aIsSignalingNaN = float64_is_signaling_nan(a); + int bIsNaN = float64_is_nan(b); + int bIsSignalingNaN = float64_is_signaling_nan(b); + a |= BX_CONST64(0x0008000000000000); + b |= BX_CONST64(0x0008000000000000); + if (aIsSignalingNaN | bIsSignalingNaN) float_raise(status, float_flag_invalid); + if (get_float_nan_handling_mode(status) == float_larger_significand_nan) { + if (aIsSignalingNaN) { + if (bIsSignalingNaN) goto returnLargerSignificand; + return bIsNaN ? b : a; + } + else if (aIsNaN) { + if (bIsSignalingNaN | ! bIsNaN) return a; + returnLargerSignificand: + if ((Bit64u) (a<<1) < (Bit64u) (b<<1)) return b; + if ((Bit64u) (b<<1) < (Bit64u) (a<<1)) return a; + return (a < b) ? a : b; + } + else { + return b; + } + } else { + return (aIsSignalingNaN | aIsNaN) ? a : b; + } +} + +#ifdef FLOATX80 + +/*---------------------------------------------------------------------------- +| Takes two extended double-precision floating-point values `a' and `b', one +| of which is a NaN, and returns the appropriate NaN result. If either `a' or +| `b' is a signaling NaN, the invalid exception is raised. +*----------------------------------------------------------------------------*/ + +floatx80 propagateFloatx80NaN(floatx80 a, floatx80 b, struct float_status_t *status) +{ + int aIsNaN = floatx80_is_nan(a); + int aIsSignalingNaN = floatx80_is_signaling_nan(a); + int bIsNaN = floatx80_is_nan(b); + int bIsSignalingNaN = floatx80_is_signaling_nan(b); + a.fraction |= BX_CONST64(0xC000000000000000); + b.fraction |= BX_CONST64(0xC000000000000000); + if (aIsSignalingNaN | bIsSignalingNaN) float_raise(status, float_flag_invalid); + if (aIsSignalingNaN) { + if (bIsSignalingNaN) goto returnLargerSignificand; + return bIsNaN ? b : a; + } + else if (aIsNaN) { + if (bIsSignalingNaN | ! bIsNaN) return a; + returnLargerSignificand: + if (a.fraction < b.fraction) return b; + if (b.fraction < a.fraction) return a; + return (a.exp < b.exp) ? a : b; + } + else { + return b; + } +} + +#endif /* FLOATX80 */ + +#ifdef FLOAT128 + +/*---------------------------------------------------------------------------- +| Takes two quadruple-precision floating-point values `a' and `b', one of +| which is a NaN, and returns the appropriate NaN result. If either `a' or +| `b' is a signaling NaN, the invalid exception is raised. +*----------------------------------------------------------------------------*/ + +float128 propagateFloat128NaN(float128 a, float128 b, struct float_status_t *status) +{ + int aIsNaN, aIsSignalingNaN, bIsNaN, bIsSignalingNaN; + aIsNaN = float128_is_nan(a); + aIsSignalingNaN = float128_is_signaling_nan(a); + bIsNaN = float128_is_nan(b); + bIsSignalingNaN = float128_is_signaling_nan(b); + a.hi |= BX_CONST64(0x0000800000000000); + b.hi |= BX_CONST64(0x0000800000000000); + if (aIsSignalingNaN | bIsSignalingNaN) float_raise(status, float_flag_invalid); + if (aIsSignalingNaN) { + if (bIsSignalingNaN) goto returnLargerSignificand; + return bIsNaN ? b : a; + } + else if (aIsNaN) { + if (bIsSignalingNaN | !bIsNaN) return a; + returnLargerSignificand: + if (lt128(a.hi<<1, a.lo, b.hi<<1, b.lo)) return b; + if (lt128(b.hi<<1, b.lo, a.hi<<1, a.lo)) return a; + return (a.hi < b.hi) ? a : b; + } + else { + return b; + } +} + +/*---------------------------------------------------------------------------- +| The pattern for a default generated quadruple-precision NaN. +*----------------------------------------------------------------------------*/ +const float128 float128_default_nan = + packFloat128(float128_default_nan_hi, float128_default_nan_lo); + +#endif /* FLOAT128 */ diff --git a/src/cpu/softfloat/softfloat-specialize.h b/src/cpu/softfloat/softfloat-specialize.h new file mode 100644 index 000000000..11326ecb6 --- /dev/null +++ b/src/cpu/softfloat/softfloat-specialize.h @@ -0,0 +1,788 @@ +/*============================================================================ +This C source fragment is part of the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b. + +Written by John R. Hauser. This work was made possible in part by the +International Computer Science Institute, located at Suite 600, 1947 Center +Street, Berkeley, California 94704. Funding was partially provided by the +National Science Foundation under grant MIP-9311980. The original version +of this code was written as part of a project to build a fixed-point vector +processor in collaboration with the University of California at Berkeley, +overseen by Profs. Nelson Morgan and John Wawrzynek. More information +is available through the Web page `http://www.cs.berkeley.edu/~jhauser/ +arithmetic/SoftFloat.html'. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +#ifndef _SOFTFLOAT_SPECIALIZE_H_ +#define _SOFTFLOAT_SPECIALIZE_H_ + +#include "softfloat.h" + +/*============================================================================ + * Adapted for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#define int16_indefinite ((Bit16s)0x8000) +#define int32_indefinite ((Bit32s)0x80000000) +#define int64_indefinite BX_CONST64(0x8000000000000000) + +#define uint16_indefinite (0xffff) +#define uint32_indefinite (0xffffffff) +#define uint64_indefinite BX_CONST64(0xffffffffffffffff) + +/*---------------------------------------------------------------------------- +| Internal canonical NaN format. +*----------------------------------------------------------------------------*/ + +typedef struct { + int sign; + Bit64u hi, lo; +} commonNaNT; + +#ifdef FLOAT16 + +/*---------------------------------------------------------------------------- +| The pattern for a default generated half-precision NaN. +*----------------------------------------------------------------------------*/ +extern const float16 float16_default_nan; + +#define float16_fraction extractFloat16Frac +#define float16_exp extractFloat16Exp +#define float16_sign extractFloat16Sign + +/*---------------------------------------------------------------------------- +| Returns the fraction bits of the half-precision floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit16u extractFloat16Frac(float16 a) +{ + return a & 0x3FF; +} + +/*---------------------------------------------------------------------------- +| Returns the exponent bits of the half-precision floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit16s extractFloat16Exp(float16 a) +{ + return (a>>10) & 0x1F; +} + +/*---------------------------------------------------------------------------- +| Returns the sign bit of the half-precision floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int extractFloat16Sign(float16 a) +{ + return a>>15; +} + +/*---------------------------------------------------------------------------- +| Packs the sign `zSign', exponent `zExp', and significand `zSig' into a +| single-precision floating-point value, returning the result. After being +| shifted into the proper positions, the three fields are simply added +| together to form the result. This means that any integer portion of `zSig' +| will be added into the exponent. Since a properly normalized significand +| will have an integer portion equal to 1, the `zExp' input should be 1 less +| than the desired result exponent whenever `zSig' is a complete, normalized +| significand. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float16 packFloat16(int zSign, int zExp, Bit16u zSig) +{ + return (((Bit16u) zSign)<<15) + (((Bit16u) zExp)<<10) + zSig; +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the half-precision floating-point value `a' is a NaN; +| otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float16_is_nan(float16 a) +{ + return (0xF800 < (Bit16u) (a<<1)); +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the half-precision floating-point value `a' is a signaling +| NaN; otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float16_is_signaling_nan(float16 a) +{ + return (((a>>9) & 0x3F) == 0x3E) && (a & 0x1FF); +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the half-precision floating-point value `a' is denormal; +| otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float16_is_denormal(float16 a) +{ + return (extractFloat16Exp(a) == 0) && (extractFloat16Frac(a) != 0); +} + +/*---------------------------------------------------------------------------- +| Convert float16 denormals to zero. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float16 float16_denormal_to_zero(float16 a) +{ + if (float16_is_denormal(a)) a &= 0x8000; + return a; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the half-precision floating-point NaN +| `a' to the canonical NaN format. If `a' is a signaling NaN, the invalid +| exception is raised. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE commonNaNT float16ToCommonNaN(float16 a, struct float_status_t *status) +{ + commonNaNT z; + if (float16_is_signaling_nan(a)) float_raise(status, float_flag_invalid); + z.sign = a>>15; + z.lo = 0; + z.hi = ((Bit64u) a)<<54; + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the canonical NaN `a' to the half- +| precision floating-point format. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float16 commonNaNToFloat16(commonNaNT a) +{ + return (((Bit16u) a.sign)<<15) | 0x7E00 | (Bit16u)(a.hi>>54); +} + +#endif + +/*---------------------------------------------------------------------------- +| Commonly used single-precision floating point constants +*----------------------------------------------------------------------------*/ +extern const float32 float32_negative_inf; +extern const float32 float32_positive_inf; +extern const float32 float32_negative_zero; +extern const float32 float32_positive_zero; +extern const float32 float32_negative_one; +extern const float32 float32_positive_one; +extern const float32 float32_max_float; +extern const float32 float32_min_float; + +/*---------------------------------------------------------------------------- +| The pattern for a default generated single-precision NaN. +*----------------------------------------------------------------------------*/ +extern const float32 float32_default_nan; + +#define float32_fraction extractFloat32Frac +#define float32_exp extractFloat32Exp +#define float32_sign extractFloat32Sign + +#define FLOAT32_EXP_BIAS 0x7F + +/*---------------------------------------------------------------------------- +| Returns the fraction bits of the single-precision floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit32u extractFloat32Frac(float32 a) +{ + return a & 0x007FFFFF; +} + +/*---------------------------------------------------------------------------- +| Returns the exponent bits of the single-precision floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit16s extractFloat32Exp(float32 a) +{ + return (a>>23) & 0xFF; +} + +/*---------------------------------------------------------------------------- +| Returns the sign bit of the single-precision floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int extractFloat32Sign(float32 a) +{ + return a>>31; +} + +/*---------------------------------------------------------------------------- +| Packs the sign `zSign', exponent `zExp', and significand `zSig' into a +| single-precision floating-point value, returning the result. After being +| shifted into the proper positions, the three fields are simply added +| together to form the result. This means that any integer portion of `zSig' +| will be added into the exponent. Since a properly normalized significand +| will have an integer portion equal to 1, the `zExp' input should be 1 less +| than the desired result exponent whenever `zSig' is a complete, normalized +| significand. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float32 packFloat32(int zSign, Bit16s zExp, Bit32u zSig) +{ + return (((Bit32u) zSign)<<31) + (((Bit32u) zExp)<<23) + zSig; +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the single-precision floating-point value `a' is a NaN; +| otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float32_is_nan(float32 a) +{ + return (0xFF000000 < (Bit32u) (a<<1)); +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the single-precision floating-point value `a' is a signaling +| NaN; otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float32_is_signaling_nan(float32 a) +{ + return (((a>>22) & 0x1FF) == 0x1FE) && (a & 0x003FFFFF); +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the single-precision floating-point value `a' is denormal; +| otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float32_is_denormal(float32 a) +{ + return (extractFloat32Exp(a) == 0) && (extractFloat32Frac(a) != 0); +} + +/*---------------------------------------------------------------------------- +| Convert float32 denormals to zero. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float32 float32_denormal_to_zero(float32 a) +{ + if (float32_is_denormal(a)) a &= 0x80000000; + return a; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the single-precision floating-point NaN +| `a' to the canonical NaN format. If `a' is a signaling NaN, the invalid +| exception is raised. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE commonNaNT float32ToCommonNaN(float32 a, struct float_status_t *status) +{ + commonNaNT z; + if (float32_is_signaling_nan(a)) float_raise(status, float_flag_invalid); + z.sign = a>>31; + z.lo = 0; + z.hi = ((Bit64u) a)<<41; + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the canonical NaN `a' to the single- +| precision floating-point format. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float32 commonNaNToFloat32(commonNaNT a) +{ + return (((Bit32u) a.sign)<<31) | 0x7FC00000 | (Bit32u)(a.hi>>41); +} + +/*---------------------------------------------------------------------------- +| Takes two single-precision floating-point values `a' and `b', one of which +| is a NaN, and returns the appropriate NaN result. If either `a' or `b' is a +| signaling NaN, the invalid exception is raised. +*----------------------------------------------------------------------------*/ + +float32 propagateFloat32NaN(float32 a, float32 b, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Takes single-precision floating-point NaN `a' and returns the appropriate +| NaN result. If `a' is a signaling NaN, the invalid exception is raised. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float32 propagateFloat32NaNOne(float32 a, struct float_status_t *status) +{ + if (float32_is_signaling_nan(a)) + float_raise(status, float_flag_invalid); + + return a | 0x00400000; +} + +/*---------------------------------------------------------------------------- +| Commonly used single-precision floating point constants +*----------------------------------------------------------------------------*/ +extern const float64 float64_negative_inf; +extern const float64 float64_positive_inf; +extern const float64 float64_negative_zero; +extern const float64 float64_positive_zero; +extern const float64 float64_negative_one; +extern const float64 float64_positive_one; +extern const float64 float64_max_float; +extern const float64 float64_min_float; + +/*---------------------------------------------------------------------------- +| The pattern for a default generated double-precision NaN. +*----------------------------------------------------------------------------*/ +extern const float64 float64_default_nan; + +#define float64_fraction extractFloat64Frac +#define float64_exp extractFloat64Exp +#define float64_sign extractFloat64Sign + +#define FLOAT64_EXP_BIAS 0x3FF + +/*---------------------------------------------------------------------------- +| Returns the fraction bits of the double-precision floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit64u extractFloat64Frac(float64 a) +{ + return a & BX_CONST64(0x000FFFFFFFFFFFFF); +} + +/*---------------------------------------------------------------------------- +| Returns the exponent bits of the double-precision floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit16s extractFloat64Exp(float64 a) +{ + return (Bit16s)(a>>52) & 0x7FF; +} + +/*---------------------------------------------------------------------------- +| Returns the sign bit of the double-precision floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int extractFloat64Sign(float64 a) +{ + return (int)(a>>63); +} + +/*---------------------------------------------------------------------------- +| Packs the sign `zSign', exponent `zExp', and significand `zSig' into a +| double-precision floating-point value, returning the result. After being +| shifted into the proper positions, the three fields are simply added +| together to form the result. This means that any integer portion of `zSig' +| will be added into the exponent. Since a properly normalized significand +| will have an integer portion equal to 1, the `zExp' input should be 1 less +| than the desired result exponent whenever `zSig' is a complete, normalized +| significand. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float64 packFloat64(int zSign, Bit16s zExp, Bit64u zSig) +{ + return (((Bit64u) zSign)<<63) + (((Bit64u) zExp)<<52) + zSig; +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the double-precision floating-point value `a' is a NaN; +| otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float64_is_nan(float64 a) +{ + return (BX_CONST64(0xFFE0000000000000) < (Bit64u) (a<<1)); +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the double-precision floating-point value `a' is a signaling +| NaN; otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float64_is_signaling_nan(float64 a) +{ + return (((a>>51) & 0xFFF) == 0xFFE) && (a & BX_CONST64(0x0007FFFFFFFFFFFF)); +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the double-precision floating-point value `a' is denormal; +| otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float64_is_denormal(float64 a) +{ + return (extractFloat64Exp(a) == 0) && (extractFloat64Frac(a) != 0); +} + +/*---------------------------------------------------------------------------- +| Convert float64 denormals to zero. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float64 float64_denormal_to_zero(float64 a) +{ + if (float64_is_denormal(a)) a &= ((Bit64u)(1) << 63); + return a; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the double-precision floating-point NaN +| `a' to the canonical NaN format. If `a' is a signaling NaN, the invalid +| exception is raised. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE commonNaNT float64ToCommonNaN(float64 a, struct float_status_t *status) +{ + commonNaNT z; + if (float64_is_signaling_nan(a)) float_raise(status, float_flag_invalid); + z.sign = (int)(a>>63); + z.lo = 0; + z.hi = a<<12; + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the canonical NaN `a' to the double- +| precision floating-point format. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float64 commonNaNToFloat64(commonNaNT a) +{ + return (((Bit64u) a.sign)<<63) | BX_CONST64(0x7FF8000000000000) | (a.hi>>12); +} + +/*---------------------------------------------------------------------------- +| Takes two double-precision floating-point values `a' and `b', one of which +| is a NaN, and returns the appropriate NaN result. If either `a' or `b' is a +| signaling NaN, the invalid exception is raised. +*----------------------------------------------------------------------------*/ + +float64 propagateFloat64NaN(float64 a, float64 b, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Takes double-precision floating-point NaN `a' and returns the appropriate +| NaN result. If `a' is a signaling NaN, the invalid exception is raised. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float64 propagateFloat64NaNOne(float64 a, struct float_status_t *status) +{ + if (float64_is_signaling_nan(a)) + float_raise(status, float_flag_invalid); + + return a | BX_CONST64(0x0008000000000000); +} + +#ifdef FLOATX80 + +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. The +| `high' and `low' values hold the most- and least-significant bits, +| respectively. +*----------------------------------------------------------------------------*/ +#define floatx80_default_nan_exp 0xFFFF +#define floatx80_default_nan_fraction BX_CONST64(0xC000000000000000) + +#define floatx80_fraction extractFloatx80Frac +#define floatx80_exp extractFloatx80Exp +#define floatx80_sign extractFloatx80Sign + +#define FLOATX80_EXP_BIAS 0x3FFF + +/*---------------------------------------------------------------------------- +| Returns the fraction bits of the extended double-precision floating-point +| value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit64u extractFloatx80Frac(floatx80 a) +{ + return a.fraction; +} + +/*---------------------------------------------------------------------------- +| Returns the exponent bits of the extended double-precision floating-point +| value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit32s extractFloatx80Exp(floatx80 a) +{ + return a.exp & 0x7FFF; +} + +/*---------------------------------------------------------------------------- +| Returns the sign bit of the extended double-precision floating-point value +| `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int extractFloatx80Sign(floatx80 a) +{ + return a.exp>>15; +} + +/*---------------------------------------------------------------------------- +| Packs the sign `zSign', exponent `zExp', and significand `zSig' into an +| extended double-precision floating-point value, returning the result. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE floatx80 packFloatx80(int zSign, Bit32s zExp, Bit64u zSig) +{ + floatx80 z; + z.fraction = zSig; + z.exp = (zSign << 15) + zExp; + return z; +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the extended double-precision floating-point value `a' is a +| NaN; otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int floatx80_is_nan(floatx80 a) +{ + return ((a.exp & 0x7FFF) == 0x7FFF) && (Bit64s) (a.fraction<<1); +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the extended double-precision floating-point value `a' is a +| signaling NaN; otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int floatx80_is_signaling_nan(floatx80 a) +{ + Bit64u aLow = a.fraction & ~BX_CONST64(0x4000000000000000); + return ((a.exp & 0x7FFF) == 0x7FFF) && + ((Bit64u) (aLow<<1)) && (a.fraction == aLow); +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the extended double-precision floating-point value `a' is an +| unsupported; otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int floatx80_is_unsupported(floatx80 a) +{ + return ((a.exp & 0x7FFF) && !(a.fraction & BX_CONST64(0x8000000000000000))); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the extended double-precision floating- +| point NaN `a' to the canonical NaN format. If `a' is a signaling NaN, the +| invalid exception is raised. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE commonNaNT floatx80ToCommonNaN(floatx80 a, struct float_status_t *status) +{ + commonNaNT z; + if (floatx80_is_signaling_nan(a)) float_raise(status, float_flag_invalid); + z.sign = a.exp >> 15; + z.lo = 0; + z.hi = a.fraction << 1; + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the canonical NaN `a' to the extended +| double-precision floating-point format. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE floatx80 commonNaNToFloatx80(commonNaNT a) +{ + floatx80 z; + z.fraction = BX_CONST64(0xC000000000000000) | (a.hi>>1); + z.exp = (((Bit16u) a.sign)<<15) | 0x7FFF; + return z; +} + +/*---------------------------------------------------------------------------- +| Takes two extended double-precision floating-point values `a' and `b', one +| of which is a NaN, and returns the appropriate NaN result. If either `a' or +| `b' is a signaling NaN, the invalid exception is raised. +*----------------------------------------------------------------------------*/ + +floatx80 propagateFloatx80NaN(floatx80 a, floatx80 b, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Takes extended double-precision floating-point NaN `a' and returns the +| appropriate NaN result. If `a' is a signaling NaN, the invalid exception +| is raised. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE floatx80 propagateFloatx80NaNOne(floatx80 a, struct float_status_t *status) +{ + if (floatx80_is_signaling_nan(a)) + float_raise(status, float_flag_invalid); + + a.fraction |= BX_CONST64(0xC000000000000000); + + return a; +} + +#endif /* FLOATX80 */ + +#ifdef FLOAT128 + +#include "softfloat-macros.h" + +/*---------------------------------------------------------------------------- +| The pattern for a default generated quadruple-precision NaN. The `high' and +| `low' values hold the most- and least-significant bits, respectively. +*----------------------------------------------------------------------------*/ +#define float128_default_nan_hi BX_CONST64(0xFFFF800000000000) +#define float128_default_nan_lo BX_CONST64(0x0000000000000000) + +#define float128_exp extractFloat128Exp + +/*---------------------------------------------------------------------------- +| Returns the least-significant 64 fraction bits of the quadruple-precision +| floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit64u extractFloat128Frac1(float128 a) +{ + return a.lo; +} + +/*---------------------------------------------------------------------------- +| Returns the most-significant 48 fraction bits of the quadruple-precision +| floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit64u extractFloat128Frac0(float128 a) +{ + return a.hi & BX_CONST64(0x0000FFFFFFFFFFFF); +} + +/*---------------------------------------------------------------------------- +| Returns the exponent bits of the quadruple-precision floating-point value +| `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE Bit32s extractFloat128Exp(float128 a) +{ + return ((Bit32s)(a.hi>>48)) & 0x7FFF; +} + +/*---------------------------------------------------------------------------- +| Returns the sign bit of the quadruple-precision floating-point value `a'. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int extractFloat128Sign(float128 a) +{ + return (int)(a.hi >> 63); +} + +/*---------------------------------------------------------------------------- +| Packs the sign `zSign', the exponent `zExp', and the significand formed +| by the concatenation of `zSig0' and `zSig1' into a quadruple-precision +| floating-point value, returning the result. After being shifted into the +| proper positions, the three fields `zSign', `zExp', and `zSig0' are simply +| added together to form the most significant 32 bits of the result. This +| means that any integer portion of `zSig0' will be added into the exponent. +| Since a properly normalized significand will have an integer portion equal +| to 1, the `zExp' input should be 1 less than the desired result exponent +| whenever `zSig0' and `zSig1' concatenated form a complete, normalized +| significand. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float128 packFloat128Four(int zSign, Bit32s zExp, Bit64u zSig0, Bit64u zSig1) +{ + float128 z; + z.lo = zSig1; + z.hi = (((Bit64u) zSign)<<63) + (((Bit64u) zExp)<<48) + zSig0; + return z; +} + +/*---------------------------------------------------------------------------- +| Packs two 64-bit precision integers into into the quadruple-precision +| floating-point value, returning the result. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float128 packFloat128(Bit64u zHi, Bit64u zLo) +{ + float128 z; + z.lo = zLo; + z.hi = zHi; + return z; +} + +#ifdef _MSC_VER +#define PACK_FLOAT_128(hi,lo) { lo, hi } +#else +#define PACK_FLOAT_128(hi,lo) packFloat128(BX_CONST64(hi),BX_CONST64(lo)) +#endif + +/*---------------------------------------------------------------------------- +| Returns 1 if the quadruple-precision floating-point value `a' is a NaN; +| otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float128_is_nan(float128 a) +{ + return (BX_CONST64(0xFFFE000000000000) <= (Bit64u) (a.hi<<1)) + && (a.lo || (a.hi & BX_CONST64(0x0000FFFFFFFFFFFF))); +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the quadruple-precision floating-point value `a' is a +| signaling NaN; otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float128_is_signaling_nan(float128 a) +{ + return (((a.hi>>47) & 0xFFFF) == 0xFFFE) + && (a.lo || (a.hi & BX_CONST64(0x00007FFFFFFFFFFF))); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the quadruple-precision floating-point NaN +| `a' to the canonical NaN format. If `a' is a signaling NaN, the invalid +| exception is raised. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE commonNaNT float128ToCommonNaN(float128 a, struct float_status_t *status) +{ + commonNaNT z; + if (float128_is_signaling_nan(a)) float_raise(status, float_flag_invalid); + z.sign = (int)(a.hi>>63); + shortShift128Left(a.hi, a.lo, 16, &z.hi, &z.lo); + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the canonical NaN `a' to the quadruple- +| precision floating-point format. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE float128 commonNaNToFloat128(commonNaNT a) +{ + float128 z; + shift128Right(a.hi, a.lo, 16, &z.hi, &z.lo); + z.hi |= (((Bit64u) a.sign)<<63) | BX_CONST64(0x7FFF800000000000); + return z; +} + +/*---------------------------------------------------------------------------- +| Takes two quadruple-precision floating-point values `a' and `b', one of +| which is a NaN, and returns the appropriate NaN result. If either `a' or +| `b' is a signaling NaN, the invalid exception is raised. +*----------------------------------------------------------------------------*/ + +float128 propagateFloat128NaN(float128 a, float128 b, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| The pattern for a default generated quadruple-precision NaN. +*----------------------------------------------------------------------------*/ +extern const float128 float128_default_nan; + +#endif /* FLOAT128 */ + +#endif diff --git a/src/cpu/softfloat/softfloat.cc b/src/cpu/softfloat/softfloat.cc new file mode 100644 index 000000000..0802089b9 --- /dev/null +++ b/src/cpu/softfloat/softfloat.cc @@ -0,0 +1,4012 @@ +/*============================================================================ +This C source file is part of the SoftFloat IEC/IEEE Floating-point Arithmetic +Package, Release 2b. + +Written by John R. Hauser. This work was made possible in part by the +International Computer Science Institute, located at Suite 600, 1947 Center +Street, Berkeley, California 94704. Funding was partially provided by the +National Science Foundation under grant MIP-9311980. The original version +of this code was written as part of a project to build a fixed-point vector +processor in collaboration with the University of California at Berkeley, +overseen by Profs. Nelson Morgan and John Wawrzynek. More information +is available through the Web page `http://www.cs.berkeley.edu/~jhauser/ +arithmetic/SoftFloat.html'. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +#define FLOAT128 + +/*============================================================================ + * Adapted for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#include "softfloat.h" +#include "softfloat-round-pack.h" + +/*---------------------------------------------------------------------------- +| Primitive arithmetic functions, including multi-word arithmetic, and +| division and square root approximations. (Can be specialized to target +| if desired). +*----------------------------------------------------------------------------*/ +#define USE_estimateDiv128To64 +#define USE_estimateSqrt32 +#include "softfloat-macros.h" + +/*---------------------------------------------------------------------------- +| Functions and definitions to determine: (1) whether tininess for underflow +| is detected before or after rounding by default, (2) what (if anything) +| happens when exceptions are raised, (3) how signaling NaNs are distinguished +| from quiet NaNs, (4) the default generated quiet NaNs, and (5) how NaNs +| are propagated from function inputs to output. These details are target- +| specific. +*----------------------------------------------------------------------------*/ +#include "softfloat-specialize.h" + +/*---------------------------------------------------------------------------- +| Returns the result of converting the 32-bit two's complement integer `a' +| to the single-precision floating-point format. The conversion is performed +| according to the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +const unsigned float_all_exceptions_mask = 0x3f; + +float32 int32_to_float32(Bit32s a, struct float_status_t *status) +{ + if (a == 0) return 0; + if (a == (Bit32s) 0x80000000) return packFloat32(1, 0x9E, 0); + int zSign = (a < 0); + return normalizeRoundAndPackFloat32(zSign, 0x9C, zSign ? -a : a, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the 32-bit two's complement integer `a' +| to the double-precision floating-point format. The conversion is performed +| according to the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 int32_to_float64(Bit32s a) +{ + if (a == 0) return 0; + int zSign = (a < 0); + Bit32u absA = zSign ? -a : a; + int shiftCount = countLeadingZeros32(absA) + 21; + Bit64u zSig = absA; + return packFloat64(zSign, 0x432 - shiftCount, zSig<> 1, status); + return normalizeRoundAndPackFloat32(0, 0x9C, a, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the 32-bit unsigned integer `a' to the +| double-precision floating-point format. The conversion is performed +| according to the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 uint32_to_float64(Bit32u a) +{ + if (a == 0) return 0; + int shiftCount = countLeadingZeros32(a) + 21; + Bit64u zSig = a; + return packFloat64(0, 0x432 - shiftCount, zSig<> 1, status); + return normalizeRoundAndPackFloat64(0, 0x43C, a, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the single-precision floating-point value +| `a' to the 32-bit two's complement integer format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic - which means in particular that the conversion is rounded +| according to the current rounding mode. If `a' is a NaN or the +| conversion overflows the integer indefinite value is returned. +*----------------------------------------------------------------------------*/ + +Bit32s float32_to_int32(float32 a, struct float_status_t *status) +{ + Bit32u aSig = extractFloat32Frac(a); + Bit16s aExp = extractFloat32Exp(a); + int aSign = extractFloat32Sign(a); + if ((aExp == 0xFF) && aSig) aSign = 0; + if (aExp) aSig |= 0x00800000; + else { + if (get_denormals_are_zeros(status)) aSig = 0; + } + int shiftCount = 0xAF - aExp; + Bit64u aSig64 = Bit64u(aSig) << 32; + if (0 < shiftCount) aSig64 = shift64RightJamming(aSig64, shiftCount); + return roundAndPackInt32(aSign, aSig64, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the single-precision floating-point value +| `a' to the 32-bit two's complement integer format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic, except that the conversion is always rounded toward zero. +| If `a' is a NaN or the conversion overflows, the integer indefinite +| value is returned. +*----------------------------------------------------------------------------*/ + +Bit32s float32_to_int32_round_to_zero(float32 a, struct float_status_t *status) +{ + int aSign; + Bit16s aExp; + Bit32u aSig; + Bit32s z; + + aSig = extractFloat32Frac(a); + aExp = extractFloat32Exp(a); + aSign = extractFloat32Sign(a); + int shiftCount = aExp - 0x9E; + if (0 <= shiftCount) { + if (a != 0xCF000000) { + float_raise(status, float_flag_invalid); + } + return (Bit32s)(int32_indefinite); + } + else if (aExp <= 0x7E) { + if (get_denormals_are_zeros(status) && aExp == 0) aSig = 0; + if (aExp | aSig) float_raise(status, float_flag_inexact); + return 0; + } + aSig = (aSig | 0x800000)<<8; + z = aSig>>(-shiftCount); + if ((Bit32u) (aSig<<(shiftCount & 31))) { + float_raise(status, float_flag_inexact); + } + if (aSign) z = -z; + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the single-precision floating-point value +| `a' to the 32-bit unsigned integer format. The conversion is performed +| according to the IEC/IEEE Standard for Binary Floating-point Arithmetic, +| except that the conversion is always rounded toward zero. If `a' is a NaN +| or conversion overflows, the largest positive integer is returned. +*----------------------------------------------------------------------------*/ + +Bit32u float32_to_uint32_round_to_zero(float32 a, struct float_status_t *status) +{ + int aSign; + Bit16s aExp; + Bit32u aSig; + + aSig = extractFloat32Frac(a); + aExp = extractFloat32Exp(a); + aSign = extractFloat32Sign(a); + int shiftCount = aExp - 0x9E; + + if (aExp <= 0x7E) { + if (get_denormals_are_zeros(status) && aExp == 0) aSig = 0; + if (aExp | aSig) float_raise(status, float_flag_inexact); + return 0; + } + else if (0 < shiftCount || aSign) { + float_raise(status, float_flag_invalid); + return uint32_indefinite; + } + + aSig = (aSig | 0x800000)<<8; + Bit32u z = aSig >> (-shiftCount); + if (aSig << (shiftCount & 31)) { + float_raise(status, float_flag_inexact); + } + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the single-precision floating-point value +| `a' to the 64-bit two's complement integer format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic - which means in particular that the conversion is rounded +| according to the current rounding mode. If `a' is a NaN or the +| conversion overflows, the integer indefinite value is returned. +*----------------------------------------------------------------------------*/ + +Bit64s float32_to_int64(float32 a, struct float_status_t *status) +{ + Bit64u aSig64, aSigExtra; + + Bit32u aSig = extractFloat32Frac(a); + Bit16s aExp = extractFloat32Exp(a); + int aSign = extractFloat32Sign(a); + + int shiftCount = 0xBE - aExp; + if (shiftCount < 0) { + float_raise(status, float_flag_invalid); + return (Bit64s)(int64_indefinite); + } + if (aExp) aSig |= 0x00800000; + else { + if (get_denormals_are_zeros(status)) aSig = 0; + } + aSig64 = aSig; + aSig64 <<= 40; + shift64ExtraRightJamming(aSig64, 0, shiftCount, &aSig64, &aSigExtra); + return roundAndPackInt64(aSign, aSig64, aSigExtra, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the single-precision floating-point value +| `a' to the 64-bit two's complement integer format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic, except that the conversion is always rounded toward zero. +| If `a' is a NaN or the conversion overflows, the integer indefinite +| value is returned. +*----------------------------------------------------------------------------*/ + +Bit64s float32_to_int64_round_to_zero(float32 a, struct float_status_t *status) +{ + int aSign; + Bit16s aExp; + Bit32u aSig; + Bit64u aSig64; + Bit64s z; + + aSig = extractFloat32Frac(a); + aExp = extractFloat32Exp(a); + aSign = extractFloat32Sign(a); + int shiftCount = aExp - 0xBE; + if (0 <= shiftCount) { + if (a != 0xDF000000) { + float_raise(status, float_flag_invalid); + } + return (Bit64s)(int64_indefinite); + } + else if (aExp <= 0x7E) { + if (get_denormals_are_zeros(status) && aExp == 0) aSig = 0; + if (aExp | aSig) float_raise(status, float_flag_inexact); + return 0; + } + aSig64 = aSig | 0x00800000; + aSig64 <<= 40; + z = aSig64>>(-shiftCount); + if ((Bit64u) (aSig64<<(shiftCount & 63))) { + float_raise(status, float_flag_inexact); + } + if (aSign) z = -z; + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the single-precision floating-point value +| `a' to the 64-bit unsigned integer format. The conversion is performed +| according to the IEC/IEEE Standard for Binary Floating-Point Arithmetic, +| except that the conversion is always rounded toward zero. If `a' is a NaN +| or the conversion overflows, the largest unsigned integer is returned. +*----------------------------------------------------------------------------*/ + +Bit64u float32_to_uint64_round_to_zero(float32 a, struct float_status_t *status) +{ + int aSign; + Bit16s aExp; + Bit32u aSig; + Bit64u aSig64; + + aSig = extractFloat32Frac(a); + aExp = extractFloat32Exp(a); + aSign = extractFloat32Sign(a); + int shiftCount = aExp - 0xBE; + + if (aExp <= 0x7E) { + if (get_denormals_are_zeros(status) && aExp == 0) aSig = 0; + if (aExp | aSig) float_raise(status, float_flag_inexact); + return 0; + } + else if (0 < shiftCount || aSign) { + float_raise(status, float_flag_invalid); + return uint64_indefinite; + } + + aSig64 = aSig | 0x00800000; + aSig64 <<= 40; + Bit64u z = aSig64>>(-shiftCount); + if ((Bit64u) (aSig64<<(shiftCount & 63))) { + float_raise(status, float_flag_inexact); + } + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the single-precision floating-point value +| `a' to the 64-bit unsigned integer format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic---which means in particular that the conversion is rounded +| according to the current rounding mode. If `a' is a NaN or the conversion +| overflows, the largest unsigned integer is returned. +*----------------------------------------------------------------------------*/ + +Bit64u float32_to_uint64(float32 a, struct float_status_t *status) +{ + int aSign; + Bit16s aExp, shiftCount; + Bit32u aSig; + Bit64u aSig64, aSigExtra; + + aSig = extractFloat32Frac(a); + aExp = extractFloat32Exp(a); + aSign = extractFloat32Sign(a); + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + } + + if ((aSign) && (aExp > 0x7E)) { + float_raise(status, float_flag_invalid); + return uint64_indefinite; + } + + shiftCount = 0xBE - aExp; + if (aExp) aSig |= 0x00800000; + + if (shiftCount < 0) { + float_raise(status, float_flag_invalid); + return uint64_indefinite; + } + + aSig64 = aSig; + aSig64 <<= 40; + shift64ExtraRightJamming(aSig64, 0, shiftCount, &aSig64, &aSigExtra); + return roundAndPackUint64(aSign, aSig64, aSigExtra, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the single-precision floating-point value +| `a' to the 32-bit unsigned integer format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic---which means in particular that the conversion is rounded +| according to the current rounding mode. If `a' is a NaN or the conversion +| overflows, the largest unsigned integer is returned. +*----------------------------------------------------------------------------*/ + +Bit32u float32_to_uint32(float32 a, struct float_status_t *status) +{ + Bit64u val_64 = float32_to_uint64(a, status); + + if (val_64 > 0xffffffff) { + status->float_exception_flags = float_flag_invalid; // throw away other flags + return uint32_indefinite; + } + + return (Bit32u) val_64; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the single-precision floating-point value +| `a' to the double-precision floating-point format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float32_to_float64(float32 a, struct float_status_t *status) +{ + Bit32u aSig = extractFloat32Frac(a); + Bit16s aExp = extractFloat32Exp(a); + int aSign = extractFloat32Sign(a); + + if (aExp == 0xFF) { + if (aSig) return commonNaNToFloat64(float32ToCommonNaN(a, status)); + return packFloat64(aSign, 0x7FF, 0); + } + if (aExp == 0) { + if (aSig == 0 || get_denormals_are_zeros(status)) + return packFloat64(aSign, 0, 0); + + float_raise(status, float_flag_denormal); + normalizeFloat32Subnormal(aSig, &aExp, &aSig); + --aExp; + } + return packFloat64(aSign, aExp + 0x380, ((Bit64u) aSig)<<29); +} + +/*---------------------------------------------------------------------------- +| Rounds the single-precision floating-point value `a' to an integer, and +| returns the result as a single-precision floating-point value. The +| operation is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float32_round_to_int(float32 a, Bit8u scale, struct float_status_t *status) +{ + Bit32u lastBitMask, roundBitsMask; + int roundingMode = get_float_rounding_mode(status); + Bit16s aExp = extractFloat32Exp(a); + scale &= 0xf; + + if ((aExp == 0xFF) && extractFloat32Frac(a)) { + return propagateFloat32NaNOne(a, status); + } + + aExp += scale; // scale the exponent + + if (0x96 <= aExp) { + return a; + } + + if (get_denormals_are_zeros(status)) { + a = float32_denormal_to_zero(a); + } + + if (aExp <= 0x7E) { + if ((Bit32u) (a<<1) == 0) return a; + float_raise(status, float_flag_inexact); + int aSign = extractFloat32Sign(a); + switch (roundingMode) { + case float_round_nearest_even: + if ((aExp == 0x7E) && extractFloat32Frac(a)) { + return packFloat32(aSign, 0x7F - scale, 0); + } + break; + case float_round_down: + return aSign ? packFloat32(1, 0x7F - scale, 0) : float32_positive_zero; + case float_round_up: + return aSign ? float32_negative_zero : packFloat32(0, 0x7F - scale, 0); + } + return packFloat32(aSign, 0, 0); + } + + lastBitMask = 1; + lastBitMask <<= 0x96 - aExp; + roundBitsMask = lastBitMask - 1; + float32 z = a; + if (roundingMode == float_round_nearest_even) { + z += lastBitMask>>1; + if ((z & roundBitsMask) == 0) z &= ~lastBitMask; + } + else if (roundingMode != float_round_to_zero) { + if (extractFloat32Sign(z) ^ (roundingMode == float_round_up)) { + z += roundBitsMask; + } + } + z &= ~roundBitsMask; + if (z != a) float_raise(status, float_flag_inexact); + return z; +} + +/*---------------------------------------------------------------------------- +| Extracts the fractional portion of single-precision floating-point value `a', +| and returns the result as a single-precision floating-point value. The +| fractional results are precise. The operation is performed according to the +| IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float32_frc(float32 a, struct float_status_t *status) +{ + int roundingMode = get_float_rounding_mode(status); + + Bit16s aExp = extractFloat32Exp(a); + Bit32u aSig = extractFloat32Frac(a); + int aSign = extractFloat32Sign(a); + + if (aExp == 0xFF) { + if (aSig) return propagateFloat32NaNOne(a, status); + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + + if (aExp >= 0x96) { + return packFloat32(roundingMode == float_round_down, 0, 0); + } + + if (aExp < 0x7F) { + if (aExp == 0) { + if (aSig == 0 || get_denormals_are_zeros(status)) + return packFloat32(roundingMode == float_round_down, 0, 0); + + float_raise(status, float_flag_denormal); + if (! float_exception_masked(status, float_flag_underflow)) + float_raise(status, float_flag_underflow); + + if(get_flush_underflow_to_zero(status)) { + float_raise(status, float_flag_underflow | float_flag_inexact); + return packFloat32(aSign, 0, 0); + } + } + return a; + } + + Bit32u lastBitMask = 1 << (0x96 - aExp); + Bit32u roundBitsMask = lastBitMask - 1; + + aSig &= roundBitsMask; + aSig <<= 7; + aExp--; + + if (aSig == 0) + return packFloat32(roundingMode == float_round_down, 0, 0); + + return normalizeRoundAndPackFloat32(aSign, aExp, aSig, status); +} + +/*---------------------------------------------------------------------------- +| Extracts the exponent portion of single-precision floating-point value 'a', +| and returns the result as a single-precision floating-point value +| representing unbiased integer exponent. The operation is performed according +| to the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float32_getexp(float32 a, struct float_status_t *status) +{ + Bit16s aExp = extractFloat32Exp(a); + Bit32u aSig = extractFloat32Frac(a); + + if (aExp == 0xFF) { + if (aSig) return propagateFloat32NaNOne(a, status); + return float32_positive_inf; + } + + if (aExp == 0) { + if (aSig == 0 || get_denormals_are_zeros(status)) + return float32_negative_inf; + + float_raise(status, float_flag_denormal); + normalizeFloat32Subnormal(aSig, &aExp, &aSig); + } + + return int32_to_float32(aExp - 0x7F, status); +} + +/*---------------------------------------------------------------------------- +| Extracts the mantissa of single-precision floating-point value 'a' and +| returns the result as a single-precision floating-point after applying +| the mantissa interval normalization and sign control. The operation is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float32_getmant(float32 a, struct float_status_t *status, int sign_ctrl, int interv) +{ + Bit16s aExp = extractFloat32Exp(a); + Bit32u aSig = extractFloat32Frac(a); + int aSign = extractFloat32Sign(a); + + if (aExp == 0xFF) { + if (aSig) return propagateFloat32NaNOne(a, status); + if (aSign) { + if (sign_ctrl & 0x2) { + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + } + return packFloat32(~sign_ctrl & aSign, 0x7F, 0); + } + + if (aExp == 0 && (aSig == 0 || get_denormals_are_zeros(status))) { + return packFloat32(~sign_ctrl & aSign, 0x7F, 0); + } + + if (aSign) { + if (sign_ctrl & 0x2) { + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + } + + if (aExp == 0) { + float_raise(status, float_flag_denormal); + normalizeFloat32Subnormal(aSig, &aExp, &aSig); +// aExp += 0x7E; + aSig &= 0x7FFFFF; + } + + switch(interv) { + case 0x0: // interval [1,2) + aExp = 0x7F; + break; + case 0x1: // interval [1/2,2) + aExp -= 0x7F; + aExp = 0x7F - (aExp & 0x1); + break; + case 0x2: // interval [1/2,1) + aExp = 0x7E; + break; + case 0x3: // interval [3/4,3/2) + aExp = 0x7F - ((aSig >> 22) & 0x1); + break; + } + + return packFloat32(~sign_ctrl & aSign, aExp, aSig); +} + +/*---------------------------------------------------------------------------- +| Return the result of a floating point scale of the single-precision floating +| point value `a' by multiplying it by 2 power of the single-precision +| floating point value 'b' converted to integral value. If the result cannot +| be represented in single precision, then the proper overflow response (for +| positive scaling operand), or the proper underflow response (for negative +| scaling operand) is issued. The operation is performed according to the +| IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float32_scalef(float32 a, float32 b, struct float_status_t *status) +{ + Bit32u aSig = extractFloat32Frac(a); + Bit16s aExp = extractFloat32Exp(a); + int aSign = extractFloat32Sign(a); + Bit32u bSig = extractFloat32Frac(b); + Bit16s bExp = extractFloat32Exp(b); + int bSign = extractFloat32Sign(b); + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + } + + if (bExp == 0xFF) { + if (bSig) return propagateFloat32NaN(a, b, status); + } + + if (aExp == 0xFF) { + if (aSig) { + int aIsSignalingNaN = (aSig & 0x00400000) == 0; + if (aIsSignalingNaN || bExp != 0xFF || bSig) + return propagateFloat32NaN(a, b, status); + + return bSign ? 0 : float32_positive_inf; + } + + if (bExp == 0xFF && bSign) { + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + return a; + } + + if (aExp == 0) { + if (aSig == 0) { + if (bExp == 0xFF && ! bSign) { + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + return a; + } + float_raise(status, float_flag_denormal); + } + + if ((bExp | bSig) == 0) return a; + + if (bExp == 0xFF) { + if (bSign) return packFloat32(aSign, 0, 0); + return packFloat32(aSign, 0xFF, 0); + } + + if (bExp >= 0x8E) { + // handle obvious overflow/underflow result + return roundAndPackFloat32(aSign, bSign ? -0x7F : 0xFF, aSig, status); + } + + int scale = 0; + + if (bExp <= 0x7E) { + if (bExp == 0) + float_raise(status, float_flag_denormal); + scale = -bSign; + } + else { + int shiftCount = bExp - 0x9E; + bSig = (bSig | 0x800000)<<8; + scale = bSig>>(-shiftCount); + + if (bSign) { + if ((Bit32u) (bSig<<(shiftCount & 31))) scale++; + scale = -scale; + } + + if (scale > 0x200) scale = 0x200; + if (scale < -0x200) scale = -0x200; + } + + if (aExp != 0) { + aSig |= 0x00800000; + } else { + aExp++; + } + + aExp += scale - 1; + aSig <<= 7; + return normalizeRoundAndPackFloat32(aSign, aExp, aSig, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of adding the absolute values of the single-precision +| floating-point values `a' and `b'. If `zSign' is 1, the sum is negated +| before being returned. `zSign' is ignored if the result is a NaN. +| The addition is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +static float32 addFloat32Sigs(float32 a, float32 b, int zSign, struct float_status_t *status) +{ + Bit16s aExp, bExp, zExp; + Bit32u aSig, bSig, zSig; + Bit16s expDiff; + + aSig = extractFloat32Frac(a); + aExp = extractFloat32Exp(a); + bSig = extractFloat32Frac(b); + bExp = extractFloat32Exp(b); + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + } + + expDiff = aExp - bExp; + aSig <<= 6; + bSig <<= 6; + + if (0 < expDiff) { + if (aExp == 0xFF) { + if (aSig) return propagateFloat32NaN(a, b, status); + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return a; + } + if ((aExp == 0) && aSig) + float_raise(status, float_flag_denormal); + + if (bExp == 0) { + if (bSig) float_raise(status, float_flag_denormal); + --expDiff; + } + else bSig |= 0x20000000; + + bSig = shift32RightJamming(bSig, expDiff); + zExp = aExp; + } + else if (expDiff < 0) { + if (bExp == 0xFF) { + if (bSig) return propagateFloat32NaN(a, b, status); + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + return packFloat32(zSign, 0xFF, 0); + } + if ((bExp == 0) && bSig) + float_raise(status, float_flag_denormal); + + if (aExp == 0) { + if (aSig) float_raise(status, float_flag_denormal); + ++expDiff; + } + else aSig |= 0x20000000; + + aSig = shift32RightJamming(aSig, -expDiff); + zExp = bExp; + } + else { + if (aExp == 0xFF) { + if (aSig | bSig) return propagateFloat32NaN(a, b, status); + return a; + } + if (aExp == 0) { + zSig = (aSig + bSig) >> 6; + if (aSig | bSig) { + float_raise(status, float_flag_denormal); + if (get_flush_underflow_to_zero(status) && (extractFloat32Frac(zSig) == zSig)) { + float_raise(status, float_flag_underflow | float_flag_inexact); + return packFloat32(zSign, 0, 0); + } + if (! float_exception_masked(status, float_flag_underflow)) { + if (extractFloat32Frac(zSig) == zSig) + float_raise(status, float_flag_underflow); + } + } + return packFloat32(zSign, 0, zSig); + } + zSig = 0x40000000 + aSig + bSig; + return roundAndPackFloat32(zSign, aExp, zSig, status); + } + aSig |= 0x20000000; + zSig = (aSig + bSig)<<1; + --zExp; + if ((Bit32s) zSig < 0) { + zSig = aSig + bSig; + ++zExp; + } + return roundAndPackFloat32(zSign, zExp, zSig, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of subtracting the absolute values of the single- +| precision floating-point values `a' and `b'. If `zSign' is 1, the +| difference is negated before being returned. `zSign' is ignored if the +| result is a NaN. The subtraction is performed according to the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +static float32 subFloat32Sigs(float32 a, float32 b, int zSign, struct float_status_t *status) +{ + Bit16s aExp, bExp, zExp; + Bit32u aSig, bSig, zSig; + Bit16s expDiff; + + aSig = extractFloat32Frac(a); + aExp = extractFloat32Exp(a); + bSig = extractFloat32Frac(b); + bExp = extractFloat32Exp(b); + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + } + + expDiff = aExp - bExp; + aSig <<= 7; + bSig <<= 7; + if (0 < expDiff) goto aExpBigger; + if (expDiff < 0) goto bExpBigger; + if (aExp == 0xFF) { + if (aSig | bSig) return propagateFloat32NaN(a, b, status); + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + if (aExp == 0) { + if (aSig | bSig) float_raise(status, float_flag_denormal); + aExp = 1; + bExp = 1; + } + if (bSig < aSig) goto aBigger; + if (aSig < bSig) goto bBigger; + return packFloat32(get_float_rounding_mode(status) == float_round_down, 0, 0); + bExpBigger: + if (bExp == 0xFF) { + if (bSig) return propagateFloat32NaN(a, b, status); + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + return packFloat32(zSign ^ 1, 0xFF, 0); + } + if ((bExp == 0) && bSig) + float_raise(status, float_flag_denormal); + + if (aExp == 0) { + if (aSig) float_raise(status, float_flag_denormal); + ++expDiff; + } + else aSig |= 0x40000000; + + aSig = shift32RightJamming(aSig, -expDiff); + bSig |= 0x40000000; + bBigger: + zSig = bSig - aSig; + zExp = bExp; + zSign ^= 1; + goto normalizeRoundAndPack; + aExpBigger: + if (aExp == 0xFF) { + if (aSig) return propagateFloat32NaN(a, b, status); + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return a; + } + if ((aExp == 0) && aSig) + float_raise(status, float_flag_denormal); + + if (bExp == 0) { + if (bSig) float_raise(status, float_flag_denormal); + --expDiff; + } + else bSig |= 0x40000000; + + bSig = shift32RightJamming(bSig, expDiff); + aSig |= 0x40000000; + aBigger: + zSig = aSig - bSig; + zExp = aExp; + normalizeRoundAndPack: + --zExp; + return normalizeRoundAndPackFloat32(zSign, zExp, zSig, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of adding the single-precision floating-point values `a' +| and `b'. The operation is performed according to the IEC/IEEE Standard for +| Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float32_add(float32 a, float32 b, struct float_status_t *status) +{ + int aSign = extractFloat32Sign(a); + int bSign = extractFloat32Sign(b); + + if (aSign == bSign) { + return addFloat32Sigs(a, b, aSign, status); + } + else { + return subFloat32Sigs(a, b, aSign, status); + } +} + +/*---------------------------------------------------------------------------- +| Returns the result of subtracting the single-precision floating-point values +| `a' and `b'. The operation is performed according to the IEC/IEEE Standard +| for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float32_sub(float32 a, float32 b, struct float_status_t *status) +{ + int aSign = extractFloat32Sign(a); + int bSign = extractFloat32Sign(b); + + if (aSign == bSign) { + return subFloat32Sigs(a, b, aSign, status); + } + else { + return addFloat32Sigs(a, b, aSign, status); + } +} + +/*---------------------------------------------------------------------------- +| Returns the result of multiplying the single-precision floating-point values +| `a' and `b'. The operation is performed according to the IEC/IEEE Standard +| for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float32_mul(float32 a, float32 b, struct float_status_t *status) +{ + int aSign, bSign, zSign; + Bit16s aExp, bExp, zExp; + Bit32u aSig, bSig; + Bit64u zSig64; + Bit32u zSig; + + aSig = extractFloat32Frac(a); + aExp = extractFloat32Exp(a); + aSign = extractFloat32Sign(a); + bSig = extractFloat32Frac(b); + bExp = extractFloat32Exp(b); + bSign = extractFloat32Sign(b); + zSign = aSign ^ bSign; + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + } + + if (aExp == 0xFF) { + if (aSig || ((bExp == 0xFF) && bSig)) + return propagateFloat32NaN(a, b, status); + + if ((bExp | bSig) == 0) { + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return packFloat32(zSign, 0xFF, 0); + } + if (bExp == 0xFF) { + if (bSig) return propagateFloat32NaN(a, b, status); + if ((aExp | aSig) == 0) { + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + return packFloat32(zSign, 0xFF, 0); + } + if (aExp == 0) { + if (aSig == 0) { + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return packFloat32(zSign, 0, 0); + } + float_raise(status, float_flag_denormal); + normalizeFloat32Subnormal(aSig, &aExp, &aSig); + } + if (bExp == 0) { + if (bSig == 0) return packFloat32(zSign, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloat32Subnormal(bSig, &bExp, &bSig); + } + zExp = aExp + bExp - 0x7F; + aSig = (aSig | 0x00800000)<<7; + bSig = (bSig | 0x00800000)<<8; + zSig64 = shift64RightJamming(((Bit64u) aSig) * bSig, 32); + zSig = (Bit32u) zSig64; + if (0 <= (Bit32s) (zSig<<1)) { + zSig <<= 1; + --zExp; + } + return roundAndPackFloat32(zSign, zExp, zSig, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of dividing the single-precision floating-point value `a' +| by the corresponding value `b'. The operation is performed according to the +| IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float32_div(float32 a, float32 b, struct float_status_t *status) +{ + int aSign, bSign, zSign; + Bit16s aExp, bExp, zExp; + Bit32u aSig, bSig, zSig; + + aSig = extractFloat32Frac(a); + aExp = extractFloat32Exp(a); + aSign = extractFloat32Sign(a); + bSig = extractFloat32Frac(b); + bExp = extractFloat32Exp(b); + bSign = extractFloat32Sign(b); + zSign = aSign ^ bSign; + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + } + + if (aExp == 0xFF) { + if (aSig) return propagateFloat32NaN(a, b, status); + if (bExp == 0xFF) { + if (bSig) return propagateFloat32NaN(a, b, status); + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return packFloat32(zSign, 0xFF, 0); + } + if (bExp == 0xFF) { + if (bSig) return propagateFloat32NaN(a, b, status); + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + return packFloat32(zSign, 0, 0); + } + if (bExp == 0) { + if (bSig == 0) { + if ((aExp | aSig) == 0) { + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + float_raise(status, float_flag_divbyzero); + return packFloat32(zSign, 0xFF, 0); + } + float_raise(status, float_flag_denormal); + normalizeFloat32Subnormal(bSig, &bExp, &bSig); + } + if (aExp == 0) { + if (aSig == 0) return packFloat32(zSign, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloat32Subnormal(aSig, &aExp, &aSig); + } + zExp = aExp - bExp + 0x7D; + aSig = (aSig | 0x00800000)<<7; + bSig = (bSig | 0x00800000)<<8; + if (bSig <= (aSig + aSig)) { + aSig >>= 1; + ++zExp; + } + zSig = (((Bit64u) aSig)<<32) / bSig; + if ((zSig & 0x3F) == 0) { + zSig |= ((Bit64u) bSig * zSig != ((Bit64u) aSig)<<32); + } + return roundAndPackFloat32(zSign, zExp, zSig, status); +} + +/*---------------------------------------------------------------------------- +| Returns the square root of the single-precision floating-point value `a'. +| The operation is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float32_sqrt(float32 a, struct float_status_t *status) +{ + int aSign; + Bit16s aExp, zExp; + Bit32u aSig, zSig; + Bit64u rem, term; + + aSig = extractFloat32Frac(a); + aExp = extractFloat32Exp(a); + aSign = extractFloat32Sign(a); + + if (aExp == 0xFF) { + if (aSig) return propagateFloat32NaNOne(a, status); + if (! aSign) return a; + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + } + + if (aSign) { + if ((aExp | aSig) == 0) return packFloat32(aSign, 0, 0); + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + if (aExp == 0) { + if (aSig == 0) return 0; + float_raise(status, float_flag_denormal); + normalizeFloat32Subnormal(aSig, &aExp, &aSig); + } + zExp = ((aExp - 0x7F)>>1) + 0x7E; + aSig = (aSig | 0x00800000)<<8; + zSig = estimateSqrt32(aExp, aSig) + 2; + if ((zSig & 0x7F) <= 5) { + if (zSig < 2) { + zSig = 0x7FFFFFFF; + goto roundAndPack; + } + aSig >>= aExp & 1; + term = ((Bit64u) zSig) * zSig; + rem = (((Bit64u) aSig)<<32) - term; + while ((Bit64s) rem < 0) { + --zSig; + rem += (((Bit64u) zSig)<<1) | 1; + } + zSig |= (rem != 0); + } + zSig = shift32RightJamming(zSig, 1); + roundAndPack: + return roundAndPackFloat32(0, zExp, zSig, status); +} + +/*---------------------------------------------------------------------------- +| Determine single-precision floating-point number class. +*----------------------------------------------------------------------------*/ + +float_class_t float32_class(float32 a) +{ + Bit16s aExp = extractFloat32Exp(a); + Bit32u aSig = extractFloat32Frac(a); + int aSign = extractFloat32Sign(a); + + if(aExp == 0xFF) { + if (aSig == 0) + return (aSign) ? float_negative_inf : float_positive_inf; + + return (aSig & 0x00400000) ? float_QNaN : float_SNaN; + } + + if(aExp == 0) { + if (aSig == 0) return float_zero; + return float_denormal; + } + + return float_normalized; +} + +/*---------------------------------------------------------------------------- +| Compare between two single precision floating point numbers. Returns +| 'float_relation_equal' if the operands are equal, 'float_relation_less' if +| the value 'a' is less than the corresponding value `b', +| 'float_relation_greater' if the value 'a' is greater than the corresponding +| value `b', or 'float_relation_unordered' otherwise. +*----------------------------------------------------------------------------*/ + +int float32_compare(float32 a, float32 b, int quiet, struct float_status_t *status) +{ + if (get_denormals_are_zeros(status)) { + a = float32_denormal_to_zero(a); + b = float32_denormal_to_zero(b); + } + + float_class_t aClass = float32_class(a); + float_class_t bClass = float32_class(b); + + if (aClass == float_SNaN || bClass == float_SNaN) { + float_raise(status, float_flag_invalid); + return float_relation_unordered; + } + + if (aClass == float_QNaN || bClass == float_QNaN) { + if (! quiet) float_raise(status, float_flag_invalid); + return float_relation_unordered; + } + + if (aClass == float_denormal || bClass == float_denormal) { + float_raise(status, float_flag_denormal); + } + + if ((a == b) || ((Bit32u) ((a | b)<<1) == 0)) return float_relation_equal; + + int aSign = extractFloat32Sign(a); + int bSign = extractFloat32Sign(b); + if (aSign != bSign) + return (aSign) ? float_relation_less : float_relation_greater; + + if (aSign ^ (a < b)) return float_relation_less; + return float_relation_greater; +} + +/*---------------------------------------------------------------------------- +| Compare between two single precision floating point numbers and return the +| smaller of them. +*----------------------------------------------------------------------------*/ + +float32 float32_min(float32 a, float32 b, struct float_status_t *status) +{ + if (get_denormals_are_zeros(status)) { + a = float32_denormal_to_zero(a); + b = float32_denormal_to_zero(b); + } + + return (float32_compare_two(a, b, status) == float_relation_less) ? a : b; +} + +/*---------------------------------------------------------------------------- +| Compare between two single precision floating point numbers and return the +| larger of them. +*----------------------------------------------------------------------------*/ + +float32 float32_max(float32 a, float32 b, struct float_status_t *status) +{ + if (get_denormals_are_zeros(status)) { + a = float32_denormal_to_zero(a); + b = float32_denormal_to_zero(b); + } + + return (float32_compare_two(a, b, status) == float_relation_greater) ? a : b; +} + +/*---------------------------------------------------------------------------- +| Compare between two single precision floating point numbers and return the +| smaller/larger of them. The operation is performed according to the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float32_minmax(float32 a, float32 b, int is_max, int is_abs, struct float_status_t *status) +{ + if (get_denormals_are_zeros(status)) { + a = float32_denormal_to_zero(a); + b = float32_denormal_to_zero(b); + } + + if (float32_is_nan(a) || float32_is_nan(b)) { + if (float32_is_signaling_nan(a)) { + return propagateFloat32NaNOne(a, status); + } + if (float32_is_signaling_nan(b) ) { + return propagateFloat32NaNOne(b, status); + } + if (! float32_is_nan(b)) { + if (float32_is_denormal(b)) + float_raise(status, float_flag_denormal); + return b; + } + if (! float32_is_nan(a)) { + if (float32_is_denormal(a)) + float_raise(status, float_flag_denormal); + return a; + } + return propagateFloat32NaN(a, b, status); + } + + float32 tmp_a = a, tmp_b = b; + if (is_abs) { + tmp_a &= ~0x80000000; // clear the sign bit + tmp_b &= ~0x80000000; + } + + int aSign = extractFloat32Sign(tmp_a); + int bSign = extractFloat32Sign(tmp_b); + + if (float32_is_denormal(a) || float32_is_denormal(b)) + float_raise(status, float_flag_denormal); + + if (aSign != bSign) { + if (! is_max) { + return aSign ? a : b; + } else { + return aSign ? b : a; + } + } else { + if (! is_max) { + return (aSign ^ (tmp_a < tmp_b)) ? a : b; + } else { + return (aSign ^ (tmp_a < tmp_b)) ? b : a; + } + } +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the double-precision floating-point value +| `a' to the 32-bit two's complement integer format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic - which means in particular that the conversion is rounded +| according to the current rounding mode. If `a' is a NaN or the +| conversion overflows, the integer indefinite value is returned. +*----------------------------------------------------------------------------*/ + +Bit32s float64_to_int32(float64 a, struct float_status_t *status) +{ + Bit64u aSig = extractFloat64Frac(a); + Bit16s aExp = extractFloat64Exp(a); + int aSign = extractFloat64Sign(a); + if ((aExp == 0x7FF) && aSig) aSign = 0; + if (aExp) aSig |= BX_CONST64(0x0010000000000000); + else { + if (get_denormals_are_zeros(status)) aSig = 0; + } + int shiftCount = 0x42C - aExp; + if (0 < shiftCount) aSig = shift64RightJamming(aSig, shiftCount); + return roundAndPackInt32(aSign, aSig, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the double-precision floating-point value +| `a' to the 32-bit two's complement integer format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic, except that the conversion is always rounded toward zero. +| If `a' is a NaN or the conversion overflows, the integer indefinite +| value is returned. +*----------------------------------------------------------------------------*/ + +Bit32s float64_to_int32_round_to_zero(float64 a, struct float_status_t *status) +{ + int aSign; + Bit16s aExp; + Bit64u aSig, savedASig; + Bit32s z; + int shiftCount; + + aSig = extractFloat64Frac(a); + aExp = extractFloat64Exp(a); + aSign = extractFloat64Sign(a); + if (0x41E < aExp) { + float_raise(status, float_flag_invalid); + return (Bit32s)(int32_indefinite); + } + else if (aExp < 0x3FF) { + if (get_denormals_are_zeros(status) && aExp == 0) aSig = 0; + if (aExp || aSig) float_raise(status, float_flag_inexact); + return 0; + } + aSig |= BX_CONST64(0x0010000000000000); + shiftCount = 0x433 - aExp; + savedASig = aSig; + aSig >>= shiftCount; + z = (Bit32s) aSig; + if (aSign) z = -z; + if ((z < 0) ^ aSign) { + float_raise(status, float_flag_invalid); + return (Bit32s)(int32_indefinite); + } + if ((aSig<>= shiftCount; + if ((aSig<>(-shiftCount); + if ((Bit64u) (aSig<<(shiftCount & 63))) { + float_raise(status, float_flag_inexact); + } + } + if (aSign) z = -z; + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the double-precision floating-point value +| `a' to the 64-bit unsigned integer format. The conversion is performed +| according to the IEC/IEEE Standard for Binary Floating-Point Arithmetic, +| except that the conversion is always rounded toward zero. If `a' is a NaN +| or the conversion overflows, the largest unsigned integer is returned. +*----------------------------------------------------------------------------*/ + +Bit64u float64_to_uint64_round_to_zero(float64 a, struct float_status_t *status) +{ + int aSign; + Bit16s aExp; + Bit64u aSig, z; + + aSig = extractFloat64Frac(a); + aExp = extractFloat64Exp(a); + aSign = extractFloat64Sign(a); + + if (aExp < 0x3FE) { + if (get_denormals_are_zeros(status) && aExp == 0) aSig = 0; + if (aExp | aSig) float_raise(status, float_flag_inexact); + return 0; + } + + if (0x43E <= aExp || aSign) { + float_raise(status, float_flag_invalid); + return uint64_indefinite; + } + + if (aExp) aSig |= BX_CONST64(0x0010000000000000); + int shiftCount = aExp - 0x433; + + if (0 <= shiftCount) { + z = aSig<>(-shiftCount); + if ((Bit64u) (aSig<<(shiftCount & 63))) { + float_raise(status, float_flag_inexact); + } + } + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the double-precision floating-point value +| `a' to the 32-bit unsigned integer format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic---which means in particular that the conversion is rounded +| according to the current rounding mode. If `a' is a NaN or the conversion +| overflows, the largest unsigned integer is returned. +*----------------------------------------------------------------------------*/ + +Bit32u float64_to_uint32(float64 a, struct float_status_t *status) +{ + Bit64u val_64 = float64_to_uint64(a, status); + + if (val_64 > 0xffffffff) { + status->float_exception_flags = float_flag_invalid; // throw away other flags + return uint32_indefinite; + } + + return (Bit32u) val_64; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the double-precision floating-point value +| `a' to the 64-bit unsigned integer format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic---which means in particular that the conversion is rounded +| according to the current rounding mode. If `a' is a NaN or the conversion +| overflows, the largest unsigned integer is returned. +*----------------------------------------------------------------------------*/ + +Bit64u float64_to_uint64(float64 a, struct float_status_t *status) +{ + int aSign; + Bit16s aExp, shiftCount; + Bit64u aSig, aSigExtra; + + aSig = extractFloat64Frac(a); + aExp = extractFloat64Exp(a); + aSign = extractFloat64Sign(a); + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + } + + if (aSign && (aExp > 0x3FE)) { + float_raise(status, float_flag_invalid); + return uint64_indefinite; + } + + if (aExp) { + aSig |= BX_CONST64(0x0010000000000000); + } + shiftCount = 0x433 - aExp; + if (shiftCount <= 0) { + if (0x43E < aExp) { + float_raise(status, float_flag_invalid); + return uint64_indefinite; + } + aSigExtra = 0; + aSig <<= -shiftCount; + } else { + shift64ExtraRightJamming(aSig, 0, shiftCount, &aSig, &aSigExtra); + } + + return roundAndPackUint64(aSign, aSig, aSigExtra, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the double-precision floating-point value +| `a' to the single-precision floating-point format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float64_to_float32(float64 a, struct float_status_t *status) +{ + int aSign; + Bit16s aExp; + Bit64u aSig; + Bit32u zSig; + + aSig = extractFloat64Frac(a); + aExp = extractFloat64Exp(a); + aSign = extractFloat64Sign(a); + if (aExp == 0x7FF) { + if (aSig) return commonNaNToFloat32(float64ToCommonNaN(a, status)); + return packFloat32(aSign, 0xFF, 0); + } + if (aExp == 0) { + if (aSig == 0 || get_denormals_are_zeros(status)) + return packFloat32(aSign, 0, 0); + float_raise(status, float_flag_denormal); + } + aSig = shift64RightJamming(aSig, 22); + zSig = (Bit32u) aSig; + if (aExp || zSig) { + zSig |= 0x40000000; + aExp -= 0x381; + } + return roundAndPackFloat32(aSign, aExp, zSig, status); +} + +/*---------------------------------------------------------------------------- +| Rounds the double-precision floating-point value `a' to an integer, and +| returns the result as a double-precision floating-point value. The +| operation is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float64_round_to_int(float64 a, Bit8u scale, struct float_status_t *status) +{ + Bit64u lastBitMask, roundBitsMask; + int roundingMode = get_float_rounding_mode(status); + Bit16s aExp = extractFloat64Exp(a); + scale &= 0xf; + + if ((aExp == 0x7FF) && extractFloat64Frac(a)) { + return propagateFloat64NaNOne(a, status); + } + + aExp += scale; // scale the exponent + + if (0x433 <= aExp) { + return a; + } + + if (get_denormals_are_zeros(status)) { + a = float64_denormal_to_zero(a); + } + + if (aExp < 0x3FF) { + if ((Bit64u) (a<<1) == 0) return a; + float_raise(status, float_flag_inexact); + int aSign = extractFloat64Sign(a); + switch (roundingMode) { + case float_round_nearest_even: + if ((aExp == 0x3FE) && extractFloat64Frac(a)) { + return packFloat64(aSign, 0x3FF - scale, 0); + } + break; + case float_round_down: + return aSign ? packFloat64(1, 0x3FF - scale, 0) : float64_positive_zero; + case float_round_up: + return aSign ? float64_negative_zero : packFloat64(0, 0x3FF - scale, 0); + } + return packFloat64(aSign, 0, 0); + } + + lastBitMask = 1; + lastBitMask <<= 0x433 - aExp; + roundBitsMask = lastBitMask - 1; + float64 z = a; + if (roundingMode == float_round_nearest_even) { + z += lastBitMask>>1; + if ((z & roundBitsMask) == 0) z &= ~lastBitMask; + } + else if (roundingMode != float_round_to_zero) { + if (extractFloat64Sign(z) ^ (roundingMode == float_round_up)) { + z += roundBitsMask; + } + } + z &= ~roundBitsMask; + if (z != a) float_raise(status, float_flag_inexact); + return z; +} + +/*---------------------------------------------------------------------------- +| Extracts the fractional portion of double-precision floating-point value `a', +| and returns the result as a double-precision floating-point value. The +| fractional results are precise. The operation is performed according to the +| IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float64_frc(float64 a, struct float_status_t *status) +{ + int roundingMode = get_float_rounding_mode(status); + + Bit64u aSig = extractFloat64Frac(a); + Bit16s aExp = extractFloat64Exp(a); + int aSign = extractFloat64Sign(a); + + if (aExp == 0x7FF) { + if (aSig) return propagateFloat64NaNOne(a, status); + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + + if (aExp >= 0x433) { + return packFloat64(roundingMode == float_round_down, 0, 0); + } + + if (aExp < 0x3FF) { + if (aExp == 0) { + if (aSig == 0 || get_denormals_are_zeros(status)) + return packFloat64(roundingMode == float_round_down, 0, 0); + + float_raise(status, float_flag_denormal); + if (! float_exception_masked(status, float_flag_underflow)) + float_raise(status, float_flag_underflow); + + if(get_flush_underflow_to_zero(status)) { + float_raise(status, float_flag_underflow | float_flag_inexact); + return packFloat64(aSign, 0, 0); + } + } + return a; + } + + Bit64u lastBitMask = BX_CONST64(1) << (0x433 - aExp); + Bit64u roundBitsMask = lastBitMask - 1; + + aSig &= roundBitsMask; + aSig <<= 10; + aExp--; + + if (aSig == 0) + return packFloat64(roundingMode == float_round_down, 0, 0); + + return normalizeRoundAndPackFloat64(aSign, aExp, aSig, status); +} + +/*---------------------------------------------------------------------------- +| Extracts the exponent portion of double-precision floating-point value 'a', +| and returns the result as a double-precision floating-point value +| representing unbiased integer exponent. The operation is performed according +| to the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float64_getexp(float64 a, struct float_status_t *status) +{ + Bit16s aExp = extractFloat64Exp(a); + Bit64u aSig = extractFloat64Frac(a); + + if (aExp == 0x7FF) { + if (aSig) return propagateFloat64NaNOne(a, status); + return float64_positive_inf; + } + + if (aExp == 0) { + if (aSig == 0 || get_denormals_are_zeros(status)) + return float64_negative_inf; + + float_raise(status, float_flag_denormal); + normalizeFloat64Subnormal(aSig, &aExp, &aSig); + } + + return int32_to_float64(aExp - 0x3FF); +} + +/*---------------------------------------------------------------------------- +| Extracts the mantissa of double-precision floating-point value 'a' and +| returns the result as a double-precision floating-point after applying +| the mantissa interval normalization and sign control. The operation is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float64_getmant(float64 a, struct float_status_t *status, int sign_ctrl, int interv) +{ + Bit16s aExp = extractFloat64Exp(a); + Bit64u aSig = extractFloat64Frac(a); + int aSign = extractFloat64Sign(a); + + if (aExp == 0x7FF) { + if (aSig) return propagateFloat64NaNOne(a, status); + if (aSign) { + if (sign_ctrl & 0x2) { + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + } + return packFloat64(~sign_ctrl & aSign, 0x3FF, 0); + } + + if (aExp == 0 && (aSig == 0 || get_denormals_are_zeros(status))) { + return packFloat64(~sign_ctrl & aSign, 0x3FF, 0); + } + + if (aSign) { + if (sign_ctrl & 0x2) { + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + } + + if (aExp == 0) { + float_raise(status, float_flag_denormal); + normalizeFloat64Subnormal(aSig, &aExp, &aSig); +// aExp += 0x3FE; + aSig &= BX_CONST64(0xFFFFFFFFFFFFFFFF); + } + + switch(interv) { + case 0x0: // interval [1,2) + aExp = 0x3FF; + break; + case 0x1: // interval [1/2,2) + aExp -= 0x3FF; + aExp = 0x3FF - (aExp & 0x1); + break; + case 0x2: // interval [1/2,1) + aExp = 0x3FE; + break; + case 0x3: // interval [3/4,3/2) + aExp = 0x3FF - ((aSig >> 51) & 0x1); + break; + } + + return packFloat64(~sign_ctrl & aSign, aExp, aSig); +} + +/*---------------------------------------------------------------------------- +| Return the result of a floating point scale of the double-precision floating +| point value `a' by multiplying it by 2 power of the double-precision +| floating point value 'b' converted to integral value. If the result cannot +| be represented in double precision, then the proper overflow response (for +| positive scaling operand), or the proper underflow response (for negative +| scaling operand) is issued. The operation is performed according to the +| IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float64_scalef(float64 a, float64 b, struct float_status_t *status) +{ + Bit64u aSig = extractFloat64Frac(a); + Bit16s aExp = extractFloat64Exp(a); + int aSign = extractFloat64Sign(a); + Bit64u bSig = extractFloat64Frac(b); + Bit16s bExp = extractFloat64Exp(b); + int bSign = extractFloat64Sign(b); + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + } + + if (bExp == 0x7FF) { + if (bSig) return propagateFloat64NaN(a, b, status); + } + + if (aExp == 0x7FF) { + if (aSig) { + int aIsSignalingNaN = (aSig & BX_CONST64(0x0008000000000000)) == 0; + if (aIsSignalingNaN || bExp != 0x7FF || bSig) + return propagateFloat64NaN(a, b, status); + + return bSign ? 0 : float64_positive_inf; + } + + if (bExp == 0x7FF && bSign) { + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + return a; + } + + if (aExp == 0) { + if (aSig == 0) { + if (bExp == 0x7FF && ! bSign) { + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + return a; + } + float_raise(status, float_flag_denormal); + } + + if ((bExp | bSig) == 0) return a; + + if (bExp == 0x7FF) { + if (bSign) return packFloat64(aSign, 0, 0); + return packFloat64(aSign, 0x7FF, 0); + } + + if (0x40F <= bExp) { + // handle obvious overflow/underflow result + return roundAndPackFloat64(aSign, bSign ? -0x3FF : 0x7FF, aSig, status); + } + + int scale = 0; + + if (bExp < 0x3FF) { + if (bExp == 0) + float_raise(status, float_flag_denormal); + scale = -bSign; + } + else { + bSig |= BX_CONST64(0x0010000000000000); + int shiftCount = 0x433 - bExp; + Bit64u savedBSig = bSig; + bSig >>= shiftCount; + scale = (Bit32s) bSig; + if (bSign) { + if ((bSig< 0x1000) scale = 0x1000; + if (scale < -0x1000) scale = -0x1000; + } + + if (aExp != 0) { + aSig |= BX_CONST64(0x0010000000000000); + } else { + aExp++; + } + + aExp += scale - 1; + aSig <<= 10; + return normalizeRoundAndPackFloat64(aSign, aExp, aSig, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of adding the absolute values of the double-precision +| floating-point values `a' and `b'. If `zSign' is 1, the sum is negated +| before being returned. `zSign' is ignored if the result is a NaN. +| The addition is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +static float64 addFloat64Sigs(float64 a, float64 b, int zSign, struct float_status_t *status) +{ + Bit16s aExp, bExp, zExp; + Bit64u aSig, bSig, zSig; + Bit16s expDiff; + + aSig = extractFloat64Frac(a); + aExp = extractFloat64Exp(a); + bSig = extractFloat64Frac(b); + bExp = extractFloat64Exp(b); + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + } + + expDiff = aExp - bExp; + aSig <<= 9; + bSig <<= 9; + if (0 < expDiff) { + if (aExp == 0x7FF) { + if (aSig) return propagateFloat64NaN(a, b, status); + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return a; + } + if ((aExp == 0) && aSig) + float_raise(status, float_flag_denormal); + + if (bExp == 0) { + if (bSig) float_raise(status, float_flag_denormal); + --expDiff; + } + else bSig |= BX_CONST64(0x2000000000000000); + + bSig = shift64RightJamming(bSig, expDiff); + zExp = aExp; + } + else if (expDiff < 0) { + if (bExp == 0x7FF) { + if (bSig) return propagateFloat64NaN(a, b, status); + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + return packFloat64(zSign, 0x7FF, 0); + } + if ((bExp == 0) && bSig) + float_raise(status, float_flag_denormal); + + if (aExp == 0) { + if (aSig) float_raise(status, float_flag_denormal); + ++expDiff; + } + else aSig |= BX_CONST64(0x2000000000000000); + + aSig = shift64RightJamming(aSig, -expDiff); + zExp = bExp; + } + else { + if (aExp == 0x7FF) { + if (aSig | bSig) return propagateFloat64NaN(a, b, status); + return a; + } + if (aExp == 0) { + zSig = (aSig + bSig) >> 9; + if (aSig | bSig) { + float_raise(status, float_flag_denormal); + if (get_flush_underflow_to_zero(status) && (extractFloat64Frac(zSig) == zSig)) { + float_raise(status, float_flag_underflow | float_flag_inexact); + return packFloat64(zSign, 0, 0); + } + if (! float_exception_masked(status, float_flag_underflow)) { + if (extractFloat64Frac(zSig) == zSig) + float_raise(status, float_flag_underflow); + } + } + return packFloat64(zSign, 0, zSig); + } + zSig = BX_CONST64(0x4000000000000000) + aSig + bSig; + return roundAndPackFloat64(zSign, aExp, zSig, status); + } + aSig |= BX_CONST64(0x2000000000000000); + zSig = (aSig + bSig)<<1; + --zExp; + if ((Bit64s) zSig < 0) { + zSig = aSig + bSig; + ++zExp; + } + return roundAndPackFloat64(zSign, zExp, zSig, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of subtracting the absolute values of the double- +| precision floating-point values `a' and `b'. If `zSign' is 1, the +| difference is negated before being returned. `zSign' is ignored if the +| result is a NaN. The subtraction is performed according to the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +static float64 subFloat64Sigs(float64 a, float64 b, int zSign, struct float_status_t *status) +{ + Bit16s aExp, bExp, zExp; + Bit64u aSig, bSig, zSig; + Bit16s expDiff; + + aSig = extractFloat64Frac(a); + aExp = extractFloat64Exp(a); + bSig = extractFloat64Frac(b); + bExp = extractFloat64Exp(b); + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + } + + expDiff = aExp - bExp; + aSig <<= 10; + bSig <<= 10; + if (0 < expDiff) goto aExpBigger; + if (expDiff < 0) goto bExpBigger; + if (aExp == 0x7FF) { + if (aSig | bSig) return propagateFloat64NaN(a, b, status); + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + if (aExp == 0) { + if (aSig | bSig) float_raise(status, float_flag_denormal); + aExp = 1; + bExp = 1; + } + if (bSig < aSig) goto aBigger; + if (aSig < bSig) goto bBigger; + return packFloat64(get_float_rounding_mode(status) == float_round_down, 0, 0); + bExpBigger: + if (bExp == 0x7FF) { + if (bSig) return propagateFloat64NaN(a, b, status); + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + return packFloat64(zSign ^ 1, 0x7FF, 0); + } + if ((bExp == 0) && bSig) + float_raise(status, float_flag_denormal); + + if (aExp == 0) { + if (aSig) float_raise(status, float_flag_denormal); + ++expDiff; + } + else aSig |= BX_CONST64(0x4000000000000000); + + aSig = shift64RightJamming(aSig, -expDiff); + bSig |= BX_CONST64(0x4000000000000000); + bBigger: + zSig = bSig - aSig; + zExp = bExp; + zSign ^= 1; + goto normalizeRoundAndPack; + aExpBigger: + if (aExp == 0x7FF) { + if (aSig) return propagateFloat64NaN(a, b, status); + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return a; + } + if ((aExp == 0) && aSig) + float_raise(status, float_flag_denormal); + + if (bExp == 0) { + if (bSig) float_raise(status, float_flag_denormal); + --expDiff; + } + else bSig |= BX_CONST64(0x4000000000000000); + + bSig = shift64RightJamming(bSig, expDiff); + aSig |= BX_CONST64(0x4000000000000000); + aBigger: + zSig = aSig - bSig; + zExp = aExp; + normalizeRoundAndPack: + --zExp; + return normalizeRoundAndPackFloat64(zSign, zExp, zSig, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of adding the double-precision floating-point values `a' +| and `b'. The operation is performed according to the IEC/IEEE Standard for +| Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float64_add(float64 a, float64 b, struct float_status_t *status) +{ + int aSign = extractFloat64Sign(a); + int bSign = extractFloat64Sign(b); + + if (aSign == bSign) { + return addFloat64Sigs(a, b, aSign, status); + } + else { + return subFloat64Sigs(a, b, aSign, status); + } +} + +/*---------------------------------------------------------------------------- +| Returns the result of subtracting the double-precision floating-point values +| `a' and `b'. The operation is performed according to the IEC/IEEE Standard +| for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float64_sub(float64 a, float64 b, struct float_status_t *status) +{ + int aSign = extractFloat64Sign(a); + int bSign = extractFloat64Sign(b); + + if (aSign == bSign) { + return subFloat64Sigs(a, b, aSign, status); + } + else { + return addFloat64Sigs(a, b, aSign, status); + } +} + +/*---------------------------------------------------------------------------- +| Returns the result of multiplying the double-precision floating-point values +| `a' and `b'. The operation is performed according to the IEC/IEEE Standard +| for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float64_mul(float64 a, float64 b, struct float_status_t *status) +{ + int aSign, bSign, zSign; + Bit16s aExp, bExp, zExp; + Bit64u aSig, bSig, zSig0, zSig1; + + aSig = extractFloat64Frac(a); + aExp = extractFloat64Exp(a); + aSign = extractFloat64Sign(a); + bSig = extractFloat64Frac(b); + bExp = extractFloat64Exp(b); + bSign = extractFloat64Sign(b); + zSign = aSign ^ bSign; + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + } + + if (aExp == 0x7FF) { + if (aSig || ((bExp == 0x7FF) && bSig)) { + return propagateFloat64NaN(a, b, status); + } + if ((bExp | bSig) == 0) { + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return packFloat64(zSign, 0x7FF, 0); + } + if (bExp == 0x7FF) { + if (bSig) return propagateFloat64NaN(a, b, status); + if ((aExp | aSig) == 0) { + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + return packFloat64(zSign, 0x7FF, 0); + } + if (aExp == 0) { + if (aSig == 0) { + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return packFloat64(zSign, 0, 0); + } + float_raise(status, float_flag_denormal); + normalizeFloat64Subnormal(aSig, &aExp, &aSig); + } + if (bExp == 0) { + if (bSig == 0) return packFloat64(zSign, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloat64Subnormal(bSig, &bExp, &bSig); + } + zExp = aExp + bExp - 0x3FF; + aSig = (aSig | BX_CONST64(0x0010000000000000))<<10; + bSig = (bSig | BX_CONST64(0x0010000000000000))<<11; + mul64To128(aSig, bSig, &zSig0, &zSig1); + zSig0 |= (zSig1 != 0); + if (0 <= (Bit64s) (zSig0<<1)) { + zSig0 <<= 1; + --zExp; + } + return roundAndPackFloat64(zSign, zExp, zSig0, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of dividing the double-precision floating-point value `a' +| by the corresponding value `b'. The operation is performed according to +| the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float64_div(float64 a, float64 b, struct float_status_t *status) +{ + int aSign, bSign, zSign; + Bit16s aExp, bExp, zExp; + Bit64u aSig, bSig, zSig; + Bit64u rem0, rem1; + Bit64u term0, term1; + + aSig = extractFloat64Frac(a); + aExp = extractFloat64Exp(a); + aSign = extractFloat64Sign(a); + bSig = extractFloat64Frac(b); + bExp = extractFloat64Exp(b); + bSign = extractFloat64Sign(b); + zSign = aSign ^ bSign; + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + if (bExp == 0) bSig = 0; + } + + if (aExp == 0x7FF) { + if (aSig) return propagateFloat64NaN(a, b, status); + if (bExp == 0x7FF) { + if (bSig) return propagateFloat64NaN(a, b, status); + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return packFloat64(zSign, 0x7FF, 0); + } + if (bExp == 0x7FF) { + if (bSig) return propagateFloat64NaN(a, b, status); + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + return packFloat64(zSign, 0, 0); + } + if (bExp == 0) { + if (bSig == 0) { + if ((aExp | aSig) == 0) { + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + float_raise(status, float_flag_divbyzero); + return packFloat64(zSign, 0x7FF, 0); + } + float_raise(status, float_flag_denormal); + normalizeFloat64Subnormal(bSig, &bExp, &bSig); + } + if (aExp == 0) { + if (aSig == 0) return packFloat64(zSign, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloat64Subnormal(aSig, &aExp, &aSig); + } + zExp = aExp - bExp + 0x3FD; + aSig = (aSig | BX_CONST64(0x0010000000000000))<<10; + bSig = (bSig | BX_CONST64(0x0010000000000000))<<11; + if (bSig <= (aSig + aSig)) { + aSig >>= 1; + ++zExp; + } + zSig = estimateDiv128To64(aSig, 0, bSig); + if ((zSig & 0x1FF) <= 2) { + mul64To128(bSig, zSig, &term0, &term1); + sub128(aSig, 0, term0, term1, &rem0, &rem1); + while ((Bit64s) rem0 < 0) { + --zSig; + add128(rem0, rem1, 0, bSig, &rem0, &rem1); + } + zSig |= (rem1 != 0); + } + return roundAndPackFloat64(zSign, zExp, zSig, status); +} + +/*---------------------------------------------------------------------------- +| Returns the square root of the double-precision floating-point value `a'. +| The operation is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float64_sqrt(float64 a, struct float_status_t *status) +{ + int aSign; + Bit16s aExp, zExp; + Bit64u aSig, zSig, doubleZSig; + Bit64u rem0, rem1, term0, term1; + + aSig = extractFloat64Frac(a); + aExp = extractFloat64Exp(a); + aSign = extractFloat64Sign(a); + + if (aExp == 0x7FF) { + if (aSig) return propagateFloat64NaNOne(a, status); + if (! aSign) return a; + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + + if (get_denormals_are_zeros(status)) { + if (aExp == 0) aSig = 0; + } + + if (aSign) { + if ((aExp | aSig) == 0) return packFloat64(aSign, 0, 0); + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + if (aExp == 0) { + if (aSig == 0) return 0; + float_raise(status, float_flag_denormal); + normalizeFloat64Subnormal(aSig, &aExp, &aSig); + } + zExp = ((aExp - 0x3FF)>>1) + 0x3FE; + aSig |= BX_CONST64(0x0010000000000000); + zSig = estimateSqrt32(aExp, (Bit32u)(aSig>>21)); + aSig <<= 9 - (aExp & 1); + zSig = estimateDiv128To64(aSig, 0, zSig<<32) + (zSig<<30); + if ((zSig & 0x1FF) <= 5) { + doubleZSig = zSig<<1; + mul64To128(zSig, zSig, &term0, &term1); + sub128(aSig, 0, term0, term1, &rem0, &rem1); + while ((Bit64s) rem0 < 0) { + --zSig; + doubleZSig -= 2; + add128(rem0, rem1, zSig>>63, doubleZSig | 1, &rem0, &rem1); + } + zSig |= ((rem0 | rem1) != 0); + } + return roundAndPackFloat64(0, zExp, zSig, status); +} + +/*---------------------------------------------------------------------------- +| Determine double-precision floating-point number class +*----------------------------------------------------------------------------*/ + +float_class_t float64_class(float64 a) +{ + Bit16s aExp = extractFloat64Exp(a); + Bit64u aSig = extractFloat64Frac(a); + int aSign = extractFloat64Sign(a); + + if(aExp == 0x7FF) { + if (aSig == 0) + return (aSign) ? float_negative_inf : float_positive_inf; + + return (aSig & BX_CONST64(0x0008000000000000)) ? float_QNaN : float_SNaN; + } + + if(aExp == 0) { + if (aSig == 0) + return float_zero; + return float_denormal; + } + + return float_normalized; +} + +/*---------------------------------------------------------------------------- +| Compare between two double precision floating point numbers. Returns +| 'float_relation_equal' if the operands are equal, 'float_relation_less' if +| the value 'a' is less than the corresponding value `b', +| 'float_relation_greater' if the value 'a' is greater than the corresponding +| value `b', or 'float_relation_unordered' otherwise. +*----------------------------------------------------------------------------*/ + +int float64_compare(float64 a, float64 b, int quiet, struct float_status_t *status) +{ + if (get_denormals_are_zeros(status)) { + a = float64_denormal_to_zero(a); + b = float64_denormal_to_zero(b); + } + + float_class_t aClass = float64_class(a); + float_class_t bClass = float64_class(b); + + if (aClass == float_SNaN || bClass == float_SNaN) { + float_raise(status, float_flag_invalid); + return float_relation_unordered; + } + + if (aClass == float_QNaN || bClass == float_QNaN) { + if (! quiet) float_raise(status, float_flag_invalid); + return float_relation_unordered; + } + + if (aClass == float_denormal || bClass == float_denormal) { + float_raise(status, float_flag_denormal); + } + + if ((a == b) || ((Bit64u) ((a | b)<<1) == 0)) return float_relation_equal; + + int aSign = extractFloat64Sign(a); + int bSign = extractFloat64Sign(b); + if (aSign != bSign) + return (aSign) ? float_relation_less : float_relation_greater; + + if (aSign ^ (a < b)) return float_relation_less; + return float_relation_greater; +} + +/*---------------------------------------------------------------------------- +| Compare between two double precision floating point numbers and return the +| smaller of them. +*----------------------------------------------------------------------------*/ + +float64 float64_min(float64 a, float64 b, struct float_status_t *status) +{ + if (get_denormals_are_zeros(status)) { + a = float64_denormal_to_zero(a); + b = float64_denormal_to_zero(b); + } + + return (float64_compare_two(a, b, status) == float_relation_less) ? a : b; +} + +/*---------------------------------------------------------------------------- +| Compare between two double precision floating point numbers and return the +| larger of them. +*----------------------------------------------------------------------------*/ + +float64 float64_max(float64 a, float64 b, struct float_status_t *status) +{ + if (get_denormals_are_zeros(status)) { + a = float64_denormal_to_zero(a); + b = float64_denormal_to_zero(b); + } + + return (float64_compare_two(a, b, status) == float_relation_greater) ? a : b; +} + +/*---------------------------------------------------------------------------- +| Compare between two double precision floating point numbers and return the +| smaller/larger of them. The operation is performed according to the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 float64_minmax(float64 a, float64 b, int is_max, int is_abs, struct float_status_t *status) +{ + if (get_denormals_are_zeros(status)) { + a = float64_denormal_to_zero(a); + b = float64_denormal_to_zero(b); + } + + if (float64_is_nan(a) || float64_is_nan(b)) { + if (float64_is_signaling_nan(a)) { + return propagateFloat64NaNOne(a, status); + } + if (float64_is_signaling_nan(b)) { + return propagateFloat64NaNOne(b, status); + } + if (! float64_is_nan(b)) { + if (float64_is_denormal(b)) + float_raise(status, float_flag_denormal); + return b; + } + if (! float64_is_nan(a)) { + if (float64_is_denormal(a)) + float_raise(status, float_flag_denormal); + return a; + } + return propagateFloat64NaN(a, b, status); + } + + float64 tmp_a = a, tmp_b = b; + if (is_abs) { + tmp_a &= ~BX_CONST64(0x8000000000000000); // clear the sign bit + tmp_b &= ~BX_CONST64(0x8000000000000000); + } + + int aSign = extractFloat64Sign(tmp_a); + int bSign = extractFloat64Sign(tmp_b); + + if (float64_is_denormal(a) || float64_is_denormal(b)) + float_raise(status, float_flag_denormal); + + if (aSign != bSign) { + if (! is_max) { + return aSign ? a : b; + } else { + return aSign ? b : a; + } + } else { + if (! is_max) { + return (aSign ^ (tmp_a < tmp_b)) ? a : b; + } else { + return (aSign ^ (tmp_a < tmp_b)) ? b : a; + } + } +} + +#ifdef FLOATX80 + +/*---------------------------------------------------------------------------- +| Returns the result of converting the 32-bit two's complement integer `a' +| to the extended double-precision floating-point format. The conversion +| is performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic. +*----------------------------------------------------------------------------*/ + +floatx80 int32_to_floatx80(Bit32s a) +{ + if (a == 0) return packFloatx80(0, 0, 0); + int zSign = (a < 0); + Bit32u absA = zSign ? -a : a; + int shiftCount = countLeadingZeros32(absA) + 32; + Bit64u zSig = absA; + return packFloatx80(zSign, 0x403E - shiftCount, zSig< 0x401E) { + float_raise(status, float_flag_invalid); + return (Bit32s)(int32_indefinite); + } + if (aExp < 0x3FFF) { + if (aExp || aSig) float_raise(status, float_flag_inexact); + return 0; + } + shiftCount = 0x403E - aExp; + savedASig = aSig; + aSig >>= shiftCount; + z = (Bit32s) aSig; + if (aSign) z = -z; + if ((z < 0) ^ aSign) { + float_raise(status, float_flag_invalid); + return (Bit32s)(int32_indefinite); + } + if ((aSig<>(-shiftCount); + if ((Bit64u) (aSig<<(shiftCount & 63))) { + float_raise(status, float_flag_inexact); + } + if (aSign) z = -z; + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the extended double-precision floating- +| point value `a' to the single-precision floating-point format. The +| conversion is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 floatx80_to_float32(floatx80 a, struct float_status_t *status) +{ + Bit64u aSig = extractFloatx80Frac(a); + Bit32s aExp = extractFloatx80Exp(a); + int aSign = extractFloatx80Sign(a); + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a)) + { + float_raise(status, float_flag_invalid); + return float32_default_nan; + } + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1)) + return commonNaNToFloat32(floatx80ToCommonNaN(a, status)); + + return packFloat32(aSign, 0xFF, 0); + } + aSig = shift64RightJamming(aSig, 33); + if (aExp || aSig) aExp -= 0x3F81; + return roundAndPackFloat32(aSign, aExp, (Bit32u) aSig, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the extended double-precision floating- +| point value `a' to the double-precision floating-point format. The +| conversion is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float64 floatx80_to_float64(floatx80 a, struct float_status_t *status) +{ + Bit32s aExp; + Bit64u aSig, zSig; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a)) + { + float_raise(status, float_flag_invalid); + return float64_default_nan; + } + + aSig = extractFloatx80Frac(a); + aExp = extractFloatx80Exp(a); + int aSign = extractFloatx80Sign(a); + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1)) { + return commonNaNToFloat64(floatx80ToCommonNaN(a, status)); + } + return packFloat64(aSign, 0x7FF, 0); + } + zSig = shift64RightJamming(aSig, 1); + if (aExp || aSig) aExp -= 0x3C01; + return roundAndPackFloat64(aSign, aExp, zSig, status); +} + +/*---------------------------------------------------------------------------- +| Rounds the extended double-precision floating-point value `a' to an integer, +| and returns the result as an extended double-precision floating-point +| value. The operation is performed according to the IEC/IEEE Standard for +| Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +floatx80 floatx80_round_to_int(floatx80 a, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + int aSign; + Bit64u lastBitMask, roundBitsMask; + int roundingMode = get_float_rounding_mode(status); + floatx80 z; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a)) + { + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + Bit32s aExp = extractFloatx80Exp(a); + Bit64u aSig = extractFloatx80Frac(a); + if (0x403E <= aExp) { + if ((aExp == 0x7FFF) && (Bit64u) (aSig<<1)) { + return propagateFloatx80NaNOne(a, status); + } + return a; + } + if (aExp < 0x3FFF) { + if (aExp == 0) { + if ((aSig<<1) == 0) return a; + float_raise(status, float_flag_denormal); + } + float_raise(status, float_flag_inexact); + aSign = extractFloatx80Sign(a); + switch (roundingMode) { + case float_round_nearest_even: + if ((aExp == 0x3FFE) && (Bit64u) (aSig<<1)) { + set_float_rounding_up(status); + return packFloatx80(aSign, 0x3FFF, BX_CONST64(0x8000000000000000)); + } + break; + case float_round_down: + if (aSign) { + set_float_rounding_up(status); + return packFloatx80(1, 0x3FFF, BX_CONST64(0x8000000000000000)); + } + else { + return packFloatx80(0, 0, 0); + } + case float_round_up: + if (aSign) { + return packFloatx80(1, 0, 0); + } + else { + set_float_rounding_up(status); + return packFloatx80(0, 0x3FFF, BX_CONST64(0x8000000000000000)); + } + } + return packFloatx80(aSign, 0, 0); + } + lastBitMask = 1; + lastBitMask <<= 0x403E - aExp; + roundBitsMask = lastBitMask - 1; + z = a; + if (roundingMode == float_round_nearest_even) { + z.fraction += lastBitMask>>1; + if ((z.fraction & roundBitsMask) == 0) z.fraction &= ~lastBitMask; + } + else if (roundingMode != float_round_to_zero) { + if (extractFloatx80Sign(z) ^ (roundingMode == float_round_up)) + z.fraction += roundBitsMask; + } + z.fraction &= ~roundBitsMask; + if (z.fraction == 0) { + z.exp++; + z.fraction = BX_CONST64(0x8000000000000000); + } + if (z.fraction != a.fraction) { + float_raise(status, float_flag_inexact); + if (z.fraction > a.fraction || z.exp > a.exp) + set_float_rounding_up(status); + } + return z; +} + +/*---------------------------------------------------------------------------- +| Returns the result of adding the absolute values of the extended double- +| precision floating-point values `a' and `b'. If `zSign' is 1, the sum is +| negated before being returned. `zSign' is ignored if the result is a NaN. +| The addition is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +static floatx80 addFloatx80Sigs(floatx80 a, floatx80 b, int zSign, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + Bit32s aExp, bExp, zExp; + Bit64u aSig, bSig, zSig0, zSig1; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a) || floatx80_is_unsupported(b)) + { + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + aSig = extractFloatx80Frac(a); + aExp = extractFloatx80Exp(a); + bSig = extractFloatx80Frac(b); + bExp = extractFloatx80Exp(b); + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1) || ((bExp == 0x7FFF) && (Bit64u) (bSig<<1))) + return propagateFloatx80NaN(a, b, status); + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return a; + } + if (bExp == 0x7FFF) { + if ((Bit64u) (bSig<<1)) return propagateFloatx80NaN(a, b, status); + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + return packFloatx80(zSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (aExp == 0) { + if (aSig == 0) { + if ((bExp == 0) && bSig) { + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + } + return roundAndPackFloatx80(get_float_rounding_precision(status), + zSign, bExp, bSig, 0, status); + } + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + } + if (bExp == 0) { + if (bSig == 0) + return roundAndPackFloatx80(get_float_rounding_precision(status), + zSign, aExp, aSig, 0, status); + + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + } + Bit32s expDiff = aExp - bExp; + zExp = aExp; + if (0 < expDiff) { + shift64ExtraRightJamming(bSig, 0, expDiff, &bSig, &zSig1); + } + else if (expDiff < 0) { + shift64ExtraRightJamming(aSig, 0, -expDiff, &aSig, &zSig1); + zExp = bExp; + } + else { + zSig0 = aSig + bSig; + zSig1 = 0; + goto shiftRight1; + } + zSig0 = aSig + bSig; + if ((Bit64s) zSig0 < 0) goto roundAndPack; + shiftRight1: + shift64ExtraRightJamming(zSig0, zSig1, 1, &zSig0, &zSig1); + zSig0 |= BX_CONST64(0x8000000000000000); + zExp++; + roundAndPack: + return + roundAndPackFloatx80(get_float_rounding_precision(status), + zSign, zExp, zSig0, zSig1, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of subtracting the absolute values of the extended +| double-precision floating-point values `a' and `b'. If `zSign' is 1, the +| difference is negated before being returned. `zSign' is ignored if the +| result is a NaN. The subtraction is performed according to the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +static floatx80 subFloatx80Sigs(floatx80 a, floatx80 b, int zSign, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + Bit32s aExp, bExp, zExp; + Bit64u aSig, bSig, zSig0, zSig1; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a) || floatx80_is_unsupported(b)) + { + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + aSig = extractFloatx80Frac(a); + aExp = extractFloatx80Exp(a); + bSig = extractFloatx80Frac(b); + bExp = extractFloatx80Exp(b); + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1)) return propagateFloatx80NaN(a, b, status); + if (bExp == 0x7FFF) { + if ((Bit64u) (bSig<<1)) return propagateFloatx80NaN(a, b, status); + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return a; + } + if (bExp == 0x7FFF) { + if ((Bit64u) (bSig<<1)) return propagateFloatx80NaN(a, b, status); + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + return packFloatx80(zSign ^ 1, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (aExp == 0) { + if (aSig == 0) { + if (bExp == 0) { + if (bSig) { + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + return roundAndPackFloatx80(get_float_rounding_precision(status), + zSign ^ 1, bExp, bSig, 0, status); + } + return packFloatx80(get_float_rounding_mode(status) == float_round_down, 0, 0); + } + return roundAndPackFloatx80(get_float_rounding_precision(status), + zSign ^ 1, bExp, bSig, 0, status); + } + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + } + if (bExp == 0) { + if (bSig == 0) + return roundAndPackFloatx80(get_float_rounding_precision(status), + zSign, aExp, aSig, 0, status); + + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + } + Bit32s expDiff = aExp - bExp; + if (0 < expDiff) { + shift128RightJamming(bSig, 0, expDiff, &bSig, &zSig1); + goto aBigger; + } + if (expDiff < 0) { + shift128RightJamming(aSig, 0, -expDiff, &aSig, &zSig1); + goto bBigger; + } + zSig1 = 0; + if (bSig < aSig) goto aBigger; + if (aSig < bSig) goto bBigger; + return packFloatx80(get_float_rounding_mode(status) == float_round_down, 0, 0); + bBigger: + sub128(bSig, 0, aSig, zSig1, &zSig0, &zSig1); + zExp = bExp; + zSign ^= 1; + goto normalizeRoundAndPack; + aBigger: + sub128(aSig, 0, bSig, zSig1, &zSig0, &zSig1); + zExp = aExp; + normalizeRoundAndPack: + return + normalizeRoundAndPackFloatx80(get_float_rounding_precision(status), + zSign, zExp, zSig0, zSig1, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of adding the extended double-precision floating-point +| values `a' and `b'. The operation is performed according to the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +floatx80 floatx80_add(floatx80 a, floatx80 b, struct float_status_t *status) +{ + int aSign = extractFloatx80Sign(a); + int bSign = extractFloatx80Sign(b); + + if (aSign == bSign) + return addFloatx80Sigs(a, b, aSign, status); + else + return subFloatx80Sigs(a, b, aSign, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of subtracting the extended double-precision floating- +| point values `a' and `b'. The operation is performed according to the +| IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +floatx80 floatx80_sub(floatx80 a, floatx80 b, struct float_status_t *status) +{ + int aSign = extractFloatx80Sign(a); + int bSign = extractFloatx80Sign(b); + + if (aSign == bSign) + return subFloatx80Sigs(a, b, aSign, status); + else + return addFloatx80Sigs(a, b, aSign, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of multiplying the extended double-precision floating- +| point values `a' and `b'. The operation is performed according to the +| IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +floatx80 floatx80_mul(floatx80 a, floatx80 b, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + int aSign, bSign, zSign; + Bit32s aExp, bExp, zExp; + Bit64u aSig, bSig, zSig0, zSig1; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a) || floatx80_is_unsupported(b)) + { + invalid: + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + aSig = extractFloatx80Frac(a); + aExp = extractFloatx80Exp(a); + aSign = extractFloatx80Sign(a); + bSig = extractFloatx80Frac(b); + bExp = extractFloatx80Exp(b); + bSign = extractFloatx80Sign(b); + zSign = aSign ^ bSign; + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1) || ((bExp == 0x7FFF) && (Bit64u) (bSig<<1))) { + return propagateFloatx80NaN(a, b, status); + } + if (bExp == 0) { + if (bSig == 0) goto invalid; + float_raise(status, float_flag_denormal); + } + return packFloatx80(zSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (bExp == 0x7FFF) { + if ((Bit64u) (bSig<<1)) return propagateFloatx80NaN(a, b, status); + if (aExp == 0) { + if (aSig == 0) goto invalid; + float_raise(status, float_flag_denormal); + } + return packFloatx80(zSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (aExp == 0) { + if (aSig == 0) { + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return packFloatx80(zSign, 0, 0); + } + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + } + if (bExp == 0) { + if (bSig == 0) return packFloatx80(zSign, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + } + zExp = aExp + bExp - 0x3FFE; + mul64To128(aSig, bSig, &zSig0, &zSig1); + if (0 < (Bit64s) zSig0) { + shortShift128Left(zSig0, zSig1, 1, &zSig0, &zSig1); + --zExp; + } + return + roundAndPackFloatx80(get_float_rounding_precision(status), + zSign, zExp, zSig0, zSig1, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of dividing the extended double-precision floating-point +| value `a' by the corresponding value `b'. The operation is performed +| according to the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +floatx80 floatx80_div(floatx80 a, floatx80 b, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + int aSign, bSign, zSign; + Bit32s aExp, bExp, zExp; + Bit64u aSig, bSig, zSig0, zSig1; + Bit64u rem0, rem1, rem2, term0, term1, term2; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a) || floatx80_is_unsupported(b)) + { + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + aSig = extractFloatx80Frac(a); + aExp = extractFloatx80Exp(a); + aSign = extractFloatx80Sign(a); + bSig = extractFloatx80Frac(b); + bExp = extractFloatx80Exp(b); + bSign = extractFloatx80Sign(b); + + zSign = aSign ^ bSign; + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1)) return propagateFloatx80NaN(a, b, status); + if (bExp == 0x7FFF) { + if ((Bit64u) (bSig<<1)) return propagateFloatx80NaN(a, b, status); + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return packFloatx80(zSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (bExp == 0x7FFF) { + if ((Bit64u) (bSig<<1)) return propagateFloatx80NaN(a, b, status); + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + return packFloatx80(zSign, 0, 0); + } + if (bExp == 0) { + if (bSig == 0) { + if ((aExp | aSig) == 0) { + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + float_raise(status, float_flag_divbyzero); + return packFloatx80(zSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + } + if (aExp == 0) { + if (aSig == 0) return packFloatx80(zSign, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + } + zExp = aExp - bExp + 0x3FFE; + rem1 = 0; + if (bSig <= aSig) { + shift128Right(aSig, 0, 1, &aSig, &rem1); + ++zExp; + } + zSig0 = estimateDiv128To64(aSig, rem1, bSig); + mul64To128(bSig, zSig0, &term0, &term1); + sub128(aSig, rem1, term0, term1, &rem0, &rem1); + while ((Bit64s) rem0 < 0) { + --zSig0; + add128(rem0, rem1, 0, bSig, &rem0, &rem1); + } + zSig1 = estimateDiv128To64(rem1, 0, bSig); + if ((Bit64u) (zSig1<<1) <= 8) { + mul64To128(bSig, zSig1, &term1, &term2); + sub128(rem1, 0, term1, term2, &rem1, &rem2); + while ((Bit64s) rem1 < 0) { + --zSig1; + add128(rem1, rem2, 0, bSig, &rem1, &rem2); + } + zSig1 |= ((rem1 | rem2) != 0); + } + return + roundAndPackFloatx80(get_float_rounding_precision(status), + zSign, zExp, zSig0, zSig1, status); +} + +/*---------------------------------------------------------------------------- +| Returns the square root of the extended double-precision floating-point +| value `a'. The operation is performed according to the IEC/IEEE Standard +| for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +floatx80 floatx80_sqrt(floatx80 a, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + int aSign; + Bit32s aExp, zExp; + Bit64u aSig0, aSig1, zSig0, zSig1, doubleZSig0; + Bit64u rem0, rem1, rem2, rem3, term0, term1, term2, term3; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a)) + { + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + aSig0 = extractFloatx80Frac(a); + aExp = extractFloatx80Exp(a); + aSign = extractFloatx80Sign(a); + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig0<<1)) return propagateFloatx80NaNOne(a, status); + if (! aSign) return a; + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + if (aSign) { + if ((aExp | aSig0) == 0) return a; + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + if (aExp == 0) { + if (aSig0 == 0) return packFloatx80(0, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig0, &aExp, &aSig0); + } + zExp = ((aExp - 0x3FFF)>>1) + 0x3FFF; + zSig0 = estimateSqrt32(aExp, aSig0>>32); + shift128Right(aSig0, 0, 2 + (aExp & 1), &aSig0, &aSig1); + zSig0 = estimateDiv128To64(aSig0, aSig1, zSig0<<32) + (zSig0<<30); + doubleZSig0 = zSig0<<1; + mul64To128(zSig0, zSig0, &term0, &term1); + sub128(aSig0, aSig1, term0, term1, &rem0, &rem1); + while ((Bit64s) rem0 < 0) { + --zSig0; + doubleZSig0 -= 2; + add128(rem0, rem1, zSig0>>63, doubleZSig0 | 1, &rem0, &rem1); + } + zSig1 = estimateDiv128To64(rem1, 0, doubleZSig0); + if ((zSig1 & BX_CONST64(0x3FFFFFFFFFFFFFFF)) <= 5) { + if (zSig1 == 0) zSig1 = 1; + mul64To128(doubleZSig0, zSig1, &term1, &term2); + sub128(rem1, 0, term1, term2, &rem1, &rem2); + mul64To128(zSig1, zSig1, &term2, &term3); + sub192(rem1, rem2, 0, 0, term2, term3, &rem1, &rem2, &rem3); + while ((Bit64s) rem1 < 0) { + --zSig1; + shortShift128Left(0, zSig1, 1, &term2, &term3); + term3 |= 1; + term2 |= doubleZSig0; + add192(rem1, rem2, rem3, 0, term2, term3, &rem1, &rem2, &rem3); + } + zSig1 |= ((rem1 | rem2 | rem3) != 0); + } + shortShift128Left(0, zSig1, 1, &zSig0, &zSig1); + zSig0 |= doubleZSig0; + return + roundAndPackFloatx80(get_float_rounding_precision(status), + 0, zExp, zSig0, zSig1, status); +} + +#endif + +#ifdef FLOAT128 + +/*---------------------------------------------------------------------------- +| Returns the result of converting the extended double-precision floating- +| point value `a' to the quadruple-precision floating-point format. The +| conversion is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float128 floatx80_to_float128(floatx80 a, struct float_status_t *status) +{ + Bit64u zSig0, zSig1; + + Bit64u aSig = extractFloatx80Frac(a); + Bit32s aExp = extractFloatx80Exp(a); + int aSign = extractFloatx80Sign(a); + + if ((aExp == 0x7FFF) && (Bit64u) (aSig<<1)) + return commonNaNToFloat128(floatx80ToCommonNaN(a, status)); + + shift128Right(aSig<<1, 0, 16, &zSig0, &zSig1); + return packFloat128Four(aSign, aExp, zSig0, zSig1); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the quadruple-precision floating-point +| value `a' to the extended double-precision floating-point format. The +| conversion is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +floatx80 float128_to_floatx80(float128 a, struct float_status_t *status) +{ + Bit32s aExp; + Bit64u aSig0, aSig1; + + aSig1 = extractFloat128Frac1(a); + aSig0 = extractFloat128Frac0(a); + aExp = extractFloat128Exp(a); + int aSign = extractFloat128Sign(a); + + if (aExp == 0x7FFF) { + if (aSig0 | aSig1) + return commonNaNToFloatx80(float128ToCommonNaN(a, status)); + + return packFloatx80(aSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + + if (aExp == 0) { + if ((aSig0 | aSig1) == 0) return packFloatx80(aSign, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloat128Subnormal(aSig0, aSig1, &aExp, &aSig0, &aSig1); + } + else aSig0 |= BX_CONST64(0x0001000000000000); + + shortShift128Left(aSig0, aSig1, 15, &aSig0, &aSig1); + return roundAndPackFloatx80(80, aSign, aExp, aSig0, aSig1, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of multiplying the extended double-precision floating- +| point value `a' and quadruple-precision floating point value `b'. The +| operation is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +floatx80 floatx80_128_mul(floatx80 a, float128 b, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + Bit32s aExp, bExp, zExp; + Bit64u aSig, bSig0, bSig1, zSig0, zSig1, zSig2; + int aSign, bSign, zSign; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a)) + { + invalid: + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + aSig = extractFloatx80Frac(a); + aExp = extractFloatx80Exp(a); + aSign = extractFloatx80Sign(a); + bSig0 = extractFloat128Frac0(b); + bSig1 = extractFloat128Frac1(b); + bExp = extractFloat128Exp(b); + bSign = extractFloat128Sign(b); + + zSign = aSign ^ bSign; + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1) + || ((bExp == 0x7FFF) && (bSig0 | bSig1))) + { + floatx80 r = commonNaNToFloatx80(float128ToCommonNaN(b, status)); + return propagateFloatx80NaN(a, r, status); + } + if (bExp == 0) { + if ((bSig0 | bSig1) == 0) goto invalid; + float_raise(status, float_flag_denormal); + } + return packFloatx80(zSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (bExp == 0x7FFF) { + if (bSig0 | bSig1) { + floatx80 r = commonNaNToFloatx80(float128ToCommonNaN(b, status)); + return propagateFloatx80NaN(a, r, status); + } + if (aExp == 0) { + if (aSig == 0) goto invalid; + float_raise(status, float_flag_denormal); + } + return packFloatx80(zSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (aExp == 0) { + if (aSig == 0) { + if ((bExp == 0) && (bSig0 | bSig1)) float_raise(status, float_flag_denormal); + return packFloatx80(zSign, 0, 0); + } + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + } + if (bExp == 0) { + if ((bSig0 | bSig1) == 0) return packFloatx80(zSign, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloat128Subnormal(bSig0, bSig1, &bExp, &bSig0, &bSig1); + } + else bSig0 |= BX_CONST64(0x0001000000000000); + + zExp = aExp + bExp - 0x3FFE; + shortShift128Left(bSig0, bSig1, 15, &bSig0, &bSig1); + mul128By64To192(bSig0, bSig1, aSig, &zSig0, &zSig1, &zSig2); + if (0 < (Bit64s) zSig0) { + shortShift128Left(zSig0, zSig1, 1, &zSig0, &zSig1); + --zExp; + } + return + roundAndPackFloatx80(get_float_rounding_precision(status), + zSign, zExp, zSig0, zSig1, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of adding the absolute values of the quadruple-precision +| floating-point values `a' and `b'. If `zSign' is 1, the sum is negated +| before being returned. `zSign' is ignored if the result is a NaN. +| The addition is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +static float128 addFloat128Sigs(float128 a, float128 b, int zSign, struct float_status_t *status) +{ + Bit32s aExp, bExp, zExp; + Bit64u aSig0, aSig1, bSig0, bSig1, zSig0, zSig1, zSig2; + Bit32s expDiff; + + aSig1 = extractFloat128Frac1(a); + aSig0 = extractFloat128Frac0(a); + aExp = extractFloat128Exp(a); + bSig1 = extractFloat128Frac1(b); + bSig0 = extractFloat128Frac0(b); + bExp = extractFloat128Exp(b); + expDiff = aExp - bExp; + + if (0 < expDiff) { + if (aExp == 0x7FFF) { + if (aSig0 | aSig1) return propagateFloat128NaN(a, b, status); + return a; + } + if (bExp == 0) --expDiff; + else bSig0 |= BX_CONST64(0x0001000000000000); + shift128ExtraRightJamming(bSig0, bSig1, 0, expDiff, &bSig0, &bSig1, &zSig2); + zExp = aExp; + } + else if (expDiff < 0) { + if (bExp == 0x7FFF) { + if (bSig0 | bSig1) return propagateFloat128NaN(a, b, status); + return packFloat128Four(zSign, 0x7FFF, 0, 0); + } + if (aExp == 0) ++expDiff; + else aSig0 |= BX_CONST64(0x0001000000000000); + shift128ExtraRightJamming(aSig0, aSig1, 0, -expDiff, &aSig0, &aSig1, &zSig2); + zExp = bExp; + } + else { + if (aExp == 0x7FFF) { + if (aSig0 | aSig1 | bSig0 | bSig1) + return propagateFloat128NaN(a, b, status); + + return a; + } + add128(aSig0, aSig1, bSig0, bSig1, &zSig0, &zSig1); + if (aExp == 0) return packFloat128Four(zSign, 0, zSig0, zSig1); + zSig2 = 0; + zSig0 |= BX_CONST64(0x0002000000000000); + zExp = aExp; + goto shiftRight1; + } + aSig0 |= BX_CONST64(0x0001000000000000); + add128(aSig0, aSig1, bSig0, bSig1, &zSig0, &zSig1); + --zExp; + if (zSig0 < BX_CONST64(0x0002000000000000)) goto roundAndPack; + ++zExp; + shiftRight1: + shift128ExtraRightJamming(zSig0, zSig1, zSig2, 1, &zSig0, &zSig1, &zSig2); + roundAndPack: + return roundAndPackFloat128(zSign, zExp, zSig0, zSig1, zSig2, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of subtracting the absolute values of the quadruple- +| precision floating-point values `a' and `b'. If `zSign' is 1, the +| difference is negated before being returned. `zSign' is ignored if the +| result is a NaN. The subtraction is performed according to the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +static float128 subFloat128Sigs(float128 a, float128 b, int zSign, struct float_status_t *status) +{ + Bit32s aExp, bExp, zExp; + Bit64u aSig0, aSig1, bSig0, bSig1, zSig0, zSig1; + Bit32s expDiff; + + aSig1 = extractFloat128Frac1(a); + aSig0 = extractFloat128Frac0(a); + aExp = extractFloat128Exp(a); + bSig1 = extractFloat128Frac1(b); + bSig0 = extractFloat128Frac0(b); + bExp = extractFloat128Exp(b); + + expDiff = aExp - bExp; + shortShift128Left(aSig0, aSig1, 14, &aSig0, &aSig1); + shortShift128Left(bSig0, bSig1, 14, &bSig0, &bSig1); + if (0 < expDiff) goto aExpBigger; + if (expDiff < 0) goto bExpBigger; + if (aExp == 0x7FFF) { + if (aSig0 | aSig1 | bSig0 | bSig1) + return propagateFloat128NaN(a, b, status); + + float_raise(status, float_flag_invalid); + return float128_default_nan; + } + if (aExp == 0) { + aExp = 1; + bExp = 1; + } + if (bSig0 < aSig0) goto aBigger; + if (aSig0 < bSig0) goto bBigger; + if (bSig1 < aSig1) goto aBigger; + if (aSig1 < bSig1) goto bBigger; + return packFloat128(0, 0); + + bExpBigger: + if (bExp == 0x7FFF) { + if (bSig0 | bSig1) return propagateFloat128NaN(a, b, status); + return packFloat128Four(zSign ^ 1, 0x7FFF, 0, 0); + } + if (aExp == 0) ++expDiff; + else { + aSig0 |= BX_CONST64(0x4000000000000000); + } + shift128RightJamming(aSig0, aSig1, - expDiff, &aSig0, &aSig1); + bSig0 |= BX_CONST64(0x4000000000000000); + bBigger: + sub128(bSig0, bSig1, aSig0, aSig1, &zSig0, &zSig1); + zExp = bExp; + zSign ^= 1; + goto normalizeRoundAndPack; + aExpBigger: + if (aExp == 0x7FFF) { + if (aSig0 | aSig1) return propagateFloat128NaN(a, b, status); + return a; + } + if (bExp == 0) --expDiff; + else { + bSig0 |= BX_CONST64(0x4000000000000000); + } + shift128RightJamming(bSig0, bSig1, expDiff, &bSig0, &bSig1); + aSig0 |= BX_CONST64(0x4000000000000000); + aBigger: + sub128(aSig0, aSig1, bSig0, bSig1, &zSig0, &zSig1); + zExp = aExp; + normalizeRoundAndPack: + --zExp; + return normalizeRoundAndPackFloat128(zSign, zExp - 14, zSig0, zSig1, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of adding the quadruple-precision floating-point values +| `a' and `b'. The operation is performed according to the IEC/IEEE Standard +| for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float128 float128_add(float128 a, float128 b, struct float_status_t *status) +{ + int aSign = extractFloat128Sign(a); + int bSign = extractFloat128Sign(b); + + if (aSign == bSign) { + return addFloat128Sigs(a, b, aSign, status); + } + else { + return subFloat128Sigs(a, b, aSign, status); + } +} + +/*---------------------------------------------------------------------------- +| Returns the result of subtracting the quadruple-precision floating-point +| values `a' and `b'. The operation is performed according to the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float128 float128_sub(float128 a, float128 b, struct float_status_t *status) +{ + int aSign = extractFloat128Sign(a); + int bSign = extractFloat128Sign(b); + + if (aSign == bSign) { + return subFloat128Sigs(a, b, aSign, status); + } + else { + return addFloat128Sigs(a, b, aSign, status); + } +} + +/*---------------------------------------------------------------------------- +| Returns the result of multiplying the quadruple-precision floating-point +| values `a' and `b'. The operation is performed according to the IEC/IEEE +| Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float128 float128_mul(float128 a, float128 b, struct float_status_t *status) +{ + int aSign, bSign, zSign; + Bit32s aExp, bExp, zExp; + Bit64u aSig0, aSig1, bSig0, bSig1, zSig0, zSig1, zSig2, zSig3; + + aSig1 = extractFloat128Frac1(a); + aSig0 = extractFloat128Frac0(a); + aExp = extractFloat128Exp(a); + aSign = extractFloat128Sign(a); + bSig1 = extractFloat128Frac1(b); + bSig0 = extractFloat128Frac0(b); + bExp = extractFloat128Exp(b); + bSign = extractFloat128Sign(b); + + zSign = aSign ^ bSign; + if (aExp == 0x7FFF) { + if ((aSig0 | aSig1) || ((bExp == 0x7FFF) && (bSig0 | bSig1))) { + return propagateFloat128NaN(a, b, status); + } + if ((bExp | bSig0 | bSig1) == 0) { + float_raise(status, float_flag_invalid); + return float128_default_nan; + } + return packFloat128Four(zSign, 0x7FFF, 0, 0); + } + if (bExp == 0x7FFF) { + if (bSig0 | bSig1) return propagateFloat128NaN(a, b, status); + if ((aExp | aSig0 | aSig1) == 0) { + float_raise(status, float_flag_invalid); + return float128_default_nan; + } + return packFloat128Four(zSign, 0x7FFF, 0, 0); + } + if (aExp == 0) { + if ((aSig0 | aSig1) == 0) return packFloat128Four(zSign, 0, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloat128Subnormal(aSig0, aSig1, &aExp, &aSig0, &aSig1); + } + if (bExp == 0) { + if ((bSig0 | bSig1) == 0) return packFloat128Four(zSign, 0, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloat128Subnormal(bSig0, bSig1, &bExp, &bSig0, &bSig1); + } + zExp = aExp + bExp - 0x4000; + aSig0 |= BX_CONST64(0x0001000000000000); + shortShift128Left(bSig0, bSig1, 16, &bSig0, &bSig1); + mul128To256(aSig0, aSig1, bSig0, bSig1, &zSig0, &zSig1, &zSig2, &zSig3); + add128(zSig0, zSig1, aSig0, aSig1, &zSig0, &zSig1); + zSig2 |= (zSig3 != 0); + if (BX_CONST64(0x0002000000000000) <= zSig0) { + shift128ExtraRightJamming(zSig0, zSig1, zSig2, 1, &zSig0, &zSig1, &zSig2); + ++zExp; + } + return roundAndPackFloat128(zSign, zExp, zSig0, zSig1, zSig2, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of dividing the quadruple-precision floating-point value +| `a' by the corresponding value `b'. The operation is performed according to +| the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float128 float128_div(float128 a, float128 b, struct float_status_t *status) +{ + int aSign, bSign, zSign; + Bit32s aExp, bExp, zExp; + Bit64u aSig0, aSig1, bSig0, bSig1, zSig0, zSig1, zSig2; + Bit64u rem0, rem1, rem2, rem3, term0, term1, term2, term3; + + aSig1 = extractFloat128Frac1(a); + aSig0 = extractFloat128Frac0(a); + aExp = extractFloat128Exp(a); + aSign = extractFloat128Sign(a); + bSig1 = extractFloat128Frac1(b); + bSig0 = extractFloat128Frac0(b); + bExp = extractFloat128Exp(b); + bSign = extractFloat128Sign(b); + + zSign = aSign ^ bSign; + if (aExp == 0x7FFF) { + if (aSig0 | aSig1) return propagateFloat128NaN(a, b, status); + if (bExp == 0x7FFF) { + if (bSig0 | bSig1) return propagateFloat128NaN(a, b, status); + float_raise(status, float_flag_invalid); + return float128_default_nan; + } + return packFloat128Four(zSign, 0x7FFF, 0, 0); + } + if (bExp == 0x7FFF) { + if (bSig0 | bSig1) return propagateFloat128NaN(a, b, status); + return packFloat128Four(zSign, 0, 0, 0); + } + if (bExp == 0) { + if ((bSig0 | bSig1) == 0) { + if ((aExp | aSig0 | aSig1) == 0) { + float_raise(status, float_flag_invalid); + return float128_default_nan; + } + float_raise(status, float_flag_divbyzero); + return packFloat128Four(zSign, 0x7FFF, 0, 0); + } + float_raise(status, float_flag_denormal); + normalizeFloat128Subnormal(bSig0, bSig1, &bExp, &bSig0, &bSig1); + } + if (aExp == 0) { + if ((aSig0 | aSig1) == 0) return packFloat128Four(zSign, 0, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloat128Subnormal(aSig0, aSig1, &aExp, &aSig0, &aSig1); + } + zExp = aExp - bExp + 0x3FFD; + shortShift128Left( + aSig0 | BX_CONST64(0x0001000000000000), aSig1, 15, &aSig0, &aSig1); + shortShift128Left( + bSig0 | BX_CONST64(0x0001000000000000), bSig1, 15, &bSig0, &bSig1); + if (le128(bSig0, bSig1, aSig0, aSig1)) { + shift128Right(aSig0, aSig1, 1, &aSig0, &aSig1); + ++zExp; + } + zSig0 = estimateDiv128To64(aSig0, aSig1, bSig0); + mul128By64To192(bSig0, bSig1, zSig0, &term0, &term1, &term2); + sub192(aSig0, aSig1, 0, term0, term1, term2, &rem0, &rem1, &rem2); + while ((Bit64s) rem0 < 0) { + --zSig0; + add192(rem0, rem1, rem2, 0, bSig0, bSig1, &rem0, &rem1, &rem2); + } + zSig1 = estimateDiv128To64(rem1, rem2, bSig0); + if ((zSig1 & 0x3FFF) <= 4) { + mul128By64To192(bSig0, bSig1, zSig1, &term1, &term2, &term3); + sub192(rem1, rem2, 0, term1, term2, term3, &rem1, &rem2, &rem3); + while ((Bit64s) rem1 < 0) { + --zSig1; + add192(rem1, rem2, rem3, 0, bSig0, bSig1, &rem1, &rem2, &rem3); + } + zSig1 |= ((rem1 | rem2 | rem3) != 0); + } + shift128ExtraRightJamming(zSig0, zSig1, 0, 15, &zSig0, &zSig1, &zSig2); + return roundAndPackFloat128(zSign, zExp, zSig0, zSig1, zSig2, status); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the 64-bit two's complement integer `a' to +| the quadruple-precision floating-point format. The conversion is performed +| according to the IEC/IEEE Standard for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +float128 int64_to_float128(Bit64s a) +{ + Bit64u zSig0, zSig1; + + if (a == 0) return packFloat128Four(0, 0, 0, 0); + int zSign = (a < 0); + Bit64u absA = zSign ? - a : a; + Bit8u shiftCount = countLeadingZeros64(absA) + 49; + Bit32s zExp = 0x406E - shiftCount; + if (64 <= shiftCount) { + zSig1 = 0; + zSig0 = absA; + shiftCount -= 64; + } + else { + zSig1 = absA; + zSig0 = 0; + } + shortShift128Left(zSig0, zSig1, shiftCount, &zSig0, &zSig1); + return packFloat128Four(zSign, zExp, zSig0, zSig1); +} + +#endif diff --git a/src/cpu/softfloat/softfloat.h b/src/cpu/softfloat/softfloat.h new file mode 100644 index 000000000..1d1b0f08f --- /dev/null +++ b/src/cpu/softfloat/softfloat.h @@ -0,0 +1,488 @@ +/*============================================================================ +This C header file is part of the SoftFloat IEC/IEEE Floating-point Arithmetic +Package, Release 2b. + +Written by John R. Hauser. This work was made possible in part by the +International Computer Science Institute, located at Suite 600, 1947 Center +Street, Berkeley, California 94704. Funding was partially provided by the +National Science Foundation under grant MIP-9311980. The original version +of this code was written as part of a project to build a fixed-point vector +processor in collaboration with the University of California at Berkeley, +overseen by Profs. Nelson Morgan and John Wawrzynek. More information +is available through the Web page `http://www.cs.berkeley.edu/~jhauser/ +arithmetic/SoftFloat.html'. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Adapted for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#include "config.h" /* generated by configure script from config.h.in */ + +#ifndef _SOFTFLOAT_H_ +#define _SOFTFLOAT_H_ + +#define FLOAT16 +#define FLOATX80 + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE floating-point types. +*----------------------------------------------------------------------------*/ +#ifdef FLOAT16 +typedef Bit16u float16; +#endif +typedef Bit32u float32; +typedef Bit64u float64; + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE floating-point class. +*----------------------------------------------------------------------------*/ +typedef enum { + float_zero, + float_SNaN, + float_QNaN, + float_negative_inf, + float_positive_inf, + float_denormal, + float_normalized +} float_class_t; + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE floating-point NaN operands handling mode. +*----------------------------------------------------------------------------*/ +enum float_nan_handling_mode_t { + float_larger_significand_nan = 0, // this mode used by x87 FPU + float_first_operand_nan = 1 // this mode used by SSE +}; + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE floating-point rounding mode. +*----------------------------------------------------------------------------*/ +enum float_round_t { + float_round_nearest_even = 0, + float_round_down = 1, + float_round_up = 2, + float_round_to_zero = 3 +}; + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE floating-point exception flags. +*----------------------------------------------------------------------------*/ +enum float_exception_flag_t { + float_flag_invalid = 0x01, + float_flag_denormal = 0x02, + float_flag_divbyzero = 0x04, + float_flag_overflow = 0x08, + float_flag_underflow = 0x10, + float_flag_inexact = 0x20 +}; + +extern const unsigned float_all_exceptions_mask; + +#ifdef FLOATX80 +#define RAISE_SW_C1 0x0200 +#endif + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE floating-point ordering relations +*----------------------------------------------------------------------------*/ +enum { + float_relation_less = -1, + float_relation_equal = 0, + float_relation_greater = 1, + float_relation_unordered = 2 +}; + +/*---------------------------------------------------------------------------- +| Options to indicate which negations to perform in float*_muladd() +| Using these differs from negating an input or output before calling +| the muladd function in that this means that a NaN doesn't have its +| sign bit inverted before it is propagated. +*----------------------------------------------------------------------------*/ +enum { + float_muladd_negate_c = 1, + float_muladd_negate_product = 2, + float_muladd_negate_result = float_muladd_negate_c | float_muladd_negate_product +}; + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE floating-point status structure. +*----------------------------------------------------------------------------*/ +struct float_status_t +{ +#ifdef FLOATX80 + int float_rounding_precision; /* floatx80 only */ +#endif + int float_rounding_mode; + int float_exception_flags; + int float_exception_masks; + int float_suppress_exception; + int float_nan_handling_mode; /* flag register */ + int flush_underflow_to_zero; /* flag register */ + int denormals_are_zeros; /* flag register */ +}; + +/*---------------------------------------------------------------------------- +| Routine to raise any or all of the software IEC/IEEE floating-point +| exception flags. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE void float_raise(struct float_status_t *status, int flags) +{ + status->float_exception_flags |= flags; +} + +/*---------------------------------------------------------------------------- +| Returns raised IEC/IEEE floating-point exception flags. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int get_exception_flags(const struct float_status_t *status) +{ + return status->float_exception_flags & ~status->float_suppress_exception; +} + +/*---------------------------------------------------------------------------- +| Routine to check if any or all of the software IEC/IEEE floating-point +| exceptions are masked. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int float_exception_masked(const struct float_status_t *status, int flag) +{ + return status->float_exception_masks & flag; +} + +/*---------------------------------------------------------------------------- +| Returns current floating point rounding mode specified by status word. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int get_float_rounding_mode(const struct float_status_t *status) +{ + return status->float_rounding_mode; +} + +/*---------------------------------------------------------------------------- +| Returns current floating point precision (floatx80 only). +*----------------------------------------------------------------------------*/ + +#ifdef FLOATX80 +BX_CPP_INLINE int get_float_rounding_precision(const struct float_status_t *status) +{ + return status->float_rounding_precision; +} +#endif + +/*---------------------------------------------------------------------------- +| Returns current floating point NaN operands handling mode specified +| by status word. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int get_float_nan_handling_mode(const struct float_status_t *status) +{ + return status->float_nan_handling_mode; +} + +/*---------------------------------------------------------------------------- +| Raise floating point precision lost up flag (floatx80 only). +*----------------------------------------------------------------------------*/ + +#ifdef FLOATX80 +BX_CPP_INLINE void set_float_rounding_up(struct float_status_t *status) +{ + status->float_exception_flags |= RAISE_SW_C1; +} +#endif + +/*---------------------------------------------------------------------------- +| Returns 1 if the feature is supported; +| otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int get_denormals_are_zeros(const struct float_status_t *status) +{ + return status->denormals_are_zeros; +} + +/*---------------------------------------------------------------------------- +| Returns 1 if the feature is supported; +| otherwise returns 0. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE int get_flush_underflow_to_zero(const struct float_status_t *status) +{ + return status->flush_underflow_to_zero; +} + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE integer-to-floating-point conversion routines. +*----------------------------------------------------------------------------*/ +float32 int32_to_float32(Bit32s, struct float_status_t *status); +float64 int32_to_float64(Bit32s); +float32 int64_to_float32(Bit64s, struct float_status_t *status); +float64 int64_to_float64(Bit64s, struct float_status_t *status); + +float32 uint32_to_float32(Bit32u, struct float_status_t *status); +float64 uint32_to_float64(Bit32u); +float32 uint64_to_float32(Bit64u, struct float_status_t *status); +float64 uint64_to_float64(Bit64u, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE single-precision conversion routines. +*----------------------------------------------------------------------------*/ +Bit32s float32_to_int32(float32, struct float_status_t *status); +Bit32s float32_to_int32_round_to_zero(float32, struct float_status_t *status); +Bit64s float32_to_int64(float32, struct float_status_t *status); +Bit64s float32_to_int64_round_to_zero(float32, struct float_status_t *status); +Bit32u float32_to_uint32(float32, struct float_status_t *status); +Bit32u float32_to_uint32_round_to_zero(float32, struct float_status_t *status); +Bit64u float32_to_uint64(float32, struct float_status_t *status); +Bit64u float32_to_uint64_round_to_zero(float32, struct float_status_t *status); +float64 float32_to_float64(float32, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE single-precision operations. +*----------------------------------------------------------------------------*/ +float32 float32_round_to_int(float32, Bit8u scale, struct float_status_t *status); +float32 float32_add(float32, float32, struct float_status_t *status); +float32 float32_sub(float32, float32, struct float_status_t *status); +float32 float32_mul(float32, float32, struct float_status_t *status); +float32 float32_div(float32, float32, struct float_status_t *status); +float32 float32_sqrt(float32, struct float_status_t *status); +float32 float32_frc(float32, struct float_status_t *status); +float32 float32_muladd(float32, float32, float32, int flags, struct float_status_t *status); +float32 float32_scalef(float32, float32, struct float_status_t *status); +int float32_compare(float32, float32, int quiet, struct float_status_t *status); + +BX_CPP_INLINE float32 float32_round_to_int_one(float32 a, struct float_status_t *status) +{ + return float32_round_to_int(a, 0, status); +} + +BX_CPP_INLINE float32 float32_fmadd(float32 a, float32 b, float32 c, struct float_status_t *status) +{ + return float32_muladd(a, b, c, 0, status); +} + +BX_CPP_INLINE float32 float32_fmsub(float32 a, float32 b, float32 c, struct float_status_t *status) +{ + return float32_muladd(a, b, c, float_muladd_negate_c, status); +} + +BX_CPP_INLINE float32 float32_fnmadd(float32 a, float32 b, float32 c, struct float_status_t *status) +{ + return float32_muladd(a, b, c, float_muladd_negate_product, status); +} + +BX_CPP_INLINE float32 float32_fnmsub(float32 a, float32 b, float32 c, struct float_status_t *status) +{ + return float32_muladd(a, b, c, float_muladd_negate_result, status); +} + +BX_CPP_INLINE int float32_compare_two(float32 a, float32 b, struct float_status_t *status) +{ + return float32_compare(a, b, 0, status); +} + +BX_CPP_INLINE int float32_compare_quiet(float32 a, float32 b, struct float_status_t *status) +{ + return float32_compare(a, b, 1, status); +} + +float_class_t float32_class(float32); + +float32 float32_min(float32 a, float32 b, struct float_status_t *status); +float32 float32_max(float32 a, float32 b, struct float_status_t *status); + +float32 float32_minmax(float32 a, float32 b, int is_max, int is_abs, struct float_status_t *status); +float32 float32_getexp(float32 a, struct float_status_t *status); +float32 float32_getmant(float32 a, struct float_status_t *status, int sign_ctrl, int interv); + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE double-precision conversion routines. +*----------------------------------------------------------------------------*/ +Bit32s float64_to_int32(float64, struct float_status_t *status); +Bit32s float64_to_int32_round_to_zero(float64, struct float_status_t *status); +Bit64s float64_to_int64(float64, struct float_status_t *status); +Bit64s float64_to_int64_round_to_zero(float64, struct float_status_t *status); +Bit32u float64_to_uint32(float64, struct float_status_t *status); +Bit32u float64_to_uint32_round_to_zero(float64, struct float_status_t *status); +Bit64u float64_to_uint64(float64, struct float_status_t *status); +Bit64u float64_to_uint64_round_to_zero(float64, struct float_status_t *status); +float32 float64_to_float32(float64, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE double-precision operations. +*----------------------------------------------------------------------------*/ +float64 float64_round_to_int(float64, Bit8u scale, struct float_status_t *status); +float64 float64_add(float64, float64, struct float_status_t *status); +float64 float64_sub(float64, float64, struct float_status_t *status); +float64 float64_mul(float64, float64, struct float_status_t *status); +float64 float64_div(float64, float64, struct float_status_t *status); +float64 float64_sqrt(float64, struct float_status_t *status); +float64 float64_frc(float64, struct float_status_t *status); +float64 float64_muladd(float64, float64, float64, int flags, struct float_status_t *status); +float64 float64_scalef(float64, float64, struct float_status_t *status); +int float64_compare(float64, float64, int quiet, struct float_status_t *status); + +BX_CPP_INLINE float64 float64_round_to_int_one(float64 a, struct float_status_t *status) +{ + return float64_round_to_int(a, 0, status); +} + +BX_CPP_INLINE float64 float64_fmadd(float64 a, float64 b, float64 c, struct float_status_t *status) +{ + return float64_muladd(a, b, c, 0, status); +} + +BX_CPP_INLINE float64 float64_fmsub(float64 a, float64 b, float64 c, struct float_status_t *status) +{ + return float64_muladd(a, b, c, float_muladd_negate_c, status); +} + +BX_CPP_INLINE float64 float64_fnmadd(float64 a, float64 b, float64 c, struct float_status_t *status) +{ + return float64_muladd(a, b, c, float_muladd_negate_product, status); +} + +BX_CPP_INLINE float64 float64_fnmsub(float64 a, float64 b, float64 c, struct float_status_t *status) +{ + return float64_muladd(a, b, c, float_muladd_negate_result, status); +} + +BX_CPP_INLINE int float64_compare_two(float64 a, float64 b, struct float_status_t *status) +{ + return float64_compare(a, b, 0, status); +} + +BX_CPP_INLINE int float64_compare_quiet(float64 a, float64 b, struct float_status_t *status) +{ + return float64_compare(a, b, 1, status); +} + +float_class_t float64_class(float64); + +float64 float64_min(float64 a, float64 b, struct float_status_t *status); +float64 float64_max(float64 a, float64 b, struct float_status_t *status); + +float64 float64_minmax(float64 a, float64 b, int is_max, int is_abs, struct float_status_t *status); +float64 float64_getexp(float64 a, struct float_status_t *status); +float64 float64_getmant(float64 a, struct float_status_t *status, int sign_ctrl, int interv); + +#ifdef FLOAT16 +float32 float16_to_float32(float16, struct float_status_t *status); +float16 float32_to_float16(float32, struct float_status_t *status); + +float_class_t float16_class(float16); +#endif + +#ifdef FLOATX80 +/*---------------------------------------------------------------------------- +| Software IEC/IEEE floating-point types. +*----------------------------------------------------------------------------*/ + +#ifdef BX_BIG_ENDIAN +typedef struct floatx80 { // leave alignment to compiler + Bit16u exp; + Bit64u fraction; +}; floatx80 +#else +typedef struct floatx80 { + Bit64u fraction; + Bit16u exp; +} floatx80; +#endif + +#ifdef __cplusplus +extern "C" { +#endif +/*---------------------------------------------------------------------------- +| Software IEC/IEEE integer-to-floating-point conversion routines. +*----------------------------------------------------------------------------*/ +floatx80 int32_to_floatx80(Bit32s); +floatx80 int64_to_floatx80(Bit64s); + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE extended double-precision conversion routines. +*----------------------------------------------------------------------------*/ +floatx80 float32_to_floatx80(float32, struct float_status_t *status); +floatx80 float64_to_floatx80(float64, struct float_status_t *status); + +Bit32s floatx80_to_int32(floatx80, struct float_status_t *status); +Bit32s floatx80_to_int32_round_to_zero(floatx80, struct float_status_t *status); +Bit64s floatx80_to_int64(floatx80, struct float_status_t *status); +Bit64s floatx80_to_int64_round_to_zero(floatx80, struct float_status_t *status); + +float32 floatx80_to_float32(floatx80, struct float_status_t *status); +float64 floatx80_to_float64(floatx80, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE extended double-precision operations. +*----------------------------------------------------------------------------*/ +floatx80 floatx80_round_to_int(floatx80, struct float_status_t *status); +floatx80 floatx80_add(floatx80, floatx80, struct float_status_t *status); +floatx80 floatx80_sub(floatx80, floatx80, struct float_status_t *status); +floatx80 floatx80_mul(floatx80, floatx80, struct float_status_t *status); +floatx80 floatx80_div(floatx80, floatx80, struct float_status_t *status); +floatx80 floatx80_sqrt(floatx80, struct float_status_t *status); + +float_class_t floatx80_class(floatx80); +#ifdef __cplusplus +} +#endif +#endif /* FLOATX80 */ + +#ifdef FLOAT128 + +#ifdef BX_BIG_ENDIAN +typedef struct float128 { + Bit64u hi, lo; +} float128; +#else +typedef struct float128 { + Bit64u lo, hi; +} float128; +#endif + +#ifdef __cplusplus +extern "C" { +#endif +/*---------------------------------------------------------------------------- +| Software IEC/IEEE quadruple-precision conversion routines. +*----------------------------------------------------------------------------*/ +float128 floatx80_to_float128(floatx80 a, struct float_status_t *status); +floatx80 float128_to_floatx80(float128 a, struct float_status_t *status); + +float128 int64_to_float128(Bit64s a); + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE extended double-precision operations. +*----------------------------------------------------------------------------*/ +floatx80 floatx80_128_mul(floatx80 a, float128 b, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE quadruple-precision operations. +*----------------------------------------------------------------------------*/ +float128 float128_add(float128 a, float128 b, struct float_status_t *status); +float128 float128_sub(float128 a, float128 b, struct float_status_t *status); +float128 float128_mul(float128 a, float128 b, struct float_status_t *status); +float128 float128_div(float128 a, float128 b, struct float_status_t *status); +#ifdef __cplusplus +} +#endif +#endif /* FLOAT128 */ + +#endif diff --git a/src/cpu/softfloat/softfloat16.cc b/src/cpu/softfloat/softfloat16.cc new file mode 100644 index 000000000..8c17d3a86 --- /dev/null +++ b/src/cpu/softfloat/softfloat16.cc @@ -0,0 +1,129 @@ +/*============================================================================ +This C source file is part of the SoftFloat IEC/IEEE Floating-point Arithmetic +Package, Release 2b. + +Written by John R. Hauser. This work was made possible in part by the +International Computer Science Institute, located at Suite 600, 1947 Center +Street, Berkeley, California 94704. Funding was partially provided by the +National Science Foundation under grant MIP-9311980. The original version +of this code was written as part of a project to build a fixed-point vector +processor in collaboration with the University of California at Berkeley, +overseen by Profs. Nelson Morgan and John Wawrzynek. More information +is available through the Web page `http://www.cs.berkeley.edu/~jhauser/ +arithmetic/SoftFloat.html'. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Adapted for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#include "softfloat.h" + +#ifdef FLOAT16 + +#include "softfloat-round-pack.h" +#include "softfloat-specialize.h" +#include "softfloat-macros.h" + +/*---------------------------------------------------------------------------- +| Determine half-precision floating-point number class +*----------------------------------------------------------------------------*/ + +float_class_t float16_class(float16 a) +{ + Bit16s aExp = extractFloat16Exp(a); + Bit16u aSig = extractFloat16Frac(a); + int aSign = extractFloat16Sign(a); + + if(aExp == 0x1F) { + if (aSig == 0) + return (aSign) ? float_negative_inf : float_positive_inf; + + return (aSig & 0x200) ? float_QNaN : float_SNaN; + } + + if(aExp == 0) { + if (aSig == 0) return float_zero; + return float_denormal; + } + + return float_normalized; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the half-precision floating-point value +| `a' to the single-precision floating-point format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic. +*----------------------------------------------------------------------------*/ + +float32 float16_to_float32(float16 a, struct float_status_t *status) +{ + Bit16u aSig = extractFloat16Frac(a); + Bit16s aExp = extractFloat16Exp(a); + int aSign = extractFloat16Sign(a); + + if (aExp == 0x1F) { + if (aSig) return commonNaNToFloat32(float16ToCommonNaN(a, status)); + return packFloat32(aSign, 0xFF, 0); + } + if (aExp == 0) { + // ignore denormals_are_zeros flag + if (aSig == 0) return packFloat32(aSign, 0, 0); + float_raise(status, float_flag_denormal); + normalizeFloat16Subnormal(aSig, &aExp, &aSig); + --aExp; + } + + return packFloat32(aSign, aExp + 0x70, ((Bit32u) aSig)<<13); +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the single-precision floating-point value +| `a' to the half-precision floating-point format. The conversion is +| performed according to the IEC/IEEE Standard for Binary Floating-Point +| Arithmetic. +*----------------------------------------------------------------------------*/ + +float16 float32_to_float16(float32 a, struct float_status_t *status) +{ + Bit32u aSig = extractFloat32Frac(a); + Bit16s aExp = extractFloat32Exp(a); + int aSign = extractFloat32Sign(a); + + if (aExp == 0xFF) { + if (aSig) return commonNaNToFloat16(float32ToCommonNaN(a, status)); + return packFloat16(aSign, 0x1F, 0); + } + if (aExp == 0) { + if (get_denormals_are_zeros(status)) aSig = 0; + if (aSig == 0) return packFloat16(aSign, 0, 0); + float_raise(status, float_flag_denormal); + } + + aSig = shift32RightJamming(aSig, 9); + Bit16u zSig = (Bit16u) aSig; + if (aExp || zSig) { + zSig |= 0x4000; + aExp -= 0x71; + } + + return roundAndPackFloat16(aSign, aExp, zSig, status); +} + +#endif diff --git a/src/cpu/softfloat/softfloatx80.cc b/src/cpu/softfloat/softfloatx80.cc new file mode 100644 index 000000000..3ac3e61b3 --- /dev/null +++ b/src/cpu/softfloat/softfloatx80.cc @@ -0,0 +1,367 @@ +/*============================================================================ +This source file is an extension to the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b, written for Bochs (x86 achitecture simulator) +floating point emulation. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Written for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#include "softfloatx80.h" +#include "softfloat-round-pack.h" +#include "softfloat-macros.h" + +const floatx80 Const_QNaN = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); +const floatx80 Const_Z = packFloatx80(0, 0x0000, 0); +const floatx80 Const_1 = packFloatx80(0, 0x3fff, BX_CONST64(0x8000000000000000)); +const floatx80 Const_L2T = packFloatx80(0, 0x4000, BX_CONST64(0xd49a784bcd1b8afe)); +const floatx80 Const_L2E = packFloatx80(0, 0x3fff, BX_CONST64(0xb8aa3b295c17f0bc)); +const floatx80 Const_PI = packFloatx80(0, 0x4000, BX_CONST64(0xc90fdaa22168c235)); +const floatx80 Const_LG2 = packFloatx80(0, 0x3ffd, BX_CONST64(0x9a209a84fbcff799)); +const floatx80 Const_LN2 = packFloatx80(0, 0x3ffe, BX_CONST64(0xb17217f7d1cf79ac)); +const floatx80 Const_INF = packFloatx80(0, 0x7fff, BX_CONST64(0x8000000000000000)); + +/*---------------------------------------------------------------------------- +| Commonly used single-precision floating point constants +*----------------------------------------------------------------------------*/ +const float32 float32_negative_inf = 0xff800000; +const float32 float32_positive_inf = 0x7f800000; +const float32 float32_negative_zero = 0x80000000; +const float32 float32_positive_zero = 0x00000000; +const float32 float32_negative_one = 0xbf800000; +const float32 float32_positive_one = 0x3f800000; +const float32 float32_max_float = 0x7f7fffff; +const float32 float32_min_float = 0xff7fffff; + +/*---------------------------------------------------------------------------- +| The pattern for a default generated single-precision NaN. +*----------------------------------------------------------------------------*/ +const float32 float32_default_nan = 0xffc00000; + +/*---------------------------------------------------------------------------- +| Commonly used single-precision floating point constants +*----------------------------------------------------------------------------*/ +const float64 float64_negative_inf = BX_CONST64(0xfff0000000000000); +const float64 float64_positive_inf = BX_CONST64(0x7ff0000000000000); +const float64 float64_negative_zero = BX_CONST64(0x8000000000000000); +const float64 float64_positive_zero = BX_CONST64(0x0000000000000000); +const float64 float64_negative_one = BX_CONST64(0xbff0000000000000); +const float64 float64_positive_one = BX_CONST64(0x3ff0000000000000); +const float64 float64_max_float = BX_CONST64(0x7fefffffffffffff); +const float64 float64_min_float = BX_CONST64(0xffefffffffffffff); + +/*---------------------------------------------------------------------------- +| The pattern for a default generated double-precision NaN. +*----------------------------------------------------------------------------*/ +const float64 float64_default_nan = BX_CONST64(0xFFF8000000000000); + +/*---------------------------------------------------------------------------- +| Returns the result of converting the extended double-precision floating- +| point value `a' to the 16-bit two's complement integer format. The +| conversion is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic - which means in particular that the conversion +| is rounded according to the current rounding mode. If `a' is a NaN or the +| conversion overflows, the integer indefinite value is returned. +*----------------------------------------------------------------------------*/ + +Bit16s floatx80_to_int16(floatx80 a, struct float_status_t *status) +{ + if (floatx80_is_unsupported(a)) { + float_raise(status, float_flag_invalid); + return int16_indefinite; + } + + Bit32s v32 = floatx80_to_int32(a, status); + + if ((v32 > 32767) || (v32 < -32768)) { + status->float_exception_flags = float_flag_invalid; // throw away other flags + return int16_indefinite; + } + + return (Bit16s) v32; +} + +/*---------------------------------------------------------------------------- +| Returns the result of converting the extended double-precision floating- +| point value `a' to the 16-bit two's complement integer format. The +| conversion is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic, except that the conversion is always rounded +| toward zero. If `a' is a NaN or the conversion overflows, the integer +| indefinite value is returned. +*----------------------------------------------------------------------------*/ + +Bit16s floatx80_to_int16_round_to_zero(floatx80 a, struct float_status_t *status) +{ + if (floatx80_is_unsupported(a)) { + float_raise(status, float_flag_invalid); + return int16_indefinite; + } + + Bit32s v32 = floatx80_to_int32_round_to_zero(a, status); + + if ((v32 > 32767) || (v32 < -32768)) { + status->float_exception_flags = float_flag_invalid; // throw away other flags + return int16_indefinite; + } + + return (Bit16s) v32; +} + +/*---------------------------------------------------------------------------- +| Separate the source extended double-precision floating point value `a' +| into its exponent and significand, store the significant back to the +| 'a' and return the exponent. The operation performed is a superset of +| the IEC/IEEE recommended logb(x) function. +*----------------------------------------------------------------------------*/ + +floatx80 floatx80_extract(floatx80 *a, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + Bit64u aSig = extractFloatx80Frac(*a); + Bit32s aExp = extractFloatx80Exp(*a); + int aSign = extractFloatx80Sign(*a); + + if (floatx80_is_unsupported(*a)) + { + float_raise(status, float_flag_invalid); + *a = floatx80_default_nan; + return *a; + } + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1)) + { + *a = propagateFloatx80NaNOne(*a, status); + return *a; + } + return packFloatx80(0, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (aExp == 0) + { + if (aSig == 0) { + float_raise(status, float_flag_divbyzero); + *a = packFloatx80(aSign, 0, 0); + return packFloatx80(1, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + } + + a->exp = (aSign << 15) + 0x3FFF; + a->fraction = aSig; + return int32_to_floatx80(aExp - 0x3FFF); +} + +/*---------------------------------------------------------------------------- +| Scales extended double-precision floating-point value in operand `a' by +| value `b'. The function truncates the value in the second operand 'b' to +| an integral value and adds that value to the exponent of the operand 'a'. +| The operation performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +floatx80 floatx80_scale(floatx80 a, floatx80 b, struct float_status_t *status) +{ +/*---------------------------------------------------------------------------- +| The pattern for a default generated extended double-precision NaN. +*----------------------------------------------------------------------------*/ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + Bit32s aExp, bExp; + Bit64u aSig, bSig; + + // handle unsupported extended double-precision floating encodings + if (floatx80_is_unsupported(a) || floatx80_is_unsupported(b)) + { + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + + aSig = extractFloatx80Frac(a); + aExp = extractFloatx80Exp(a); + int aSign = extractFloatx80Sign(a); + bSig = extractFloatx80Frac(b); + bExp = extractFloatx80Exp(b); + int bSign = extractFloatx80Sign(b); + + if (aExp == 0x7FFF) { + if ((Bit64u) (aSig<<1) || ((bExp == 0x7FFF) && (Bit64u) (bSig<<1))) + { + return propagateFloatx80NaN(a, b, status); + } + if ((bExp == 0x7FFF) && bSign) { + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + return a; + } + if (bExp == 0x7FFF) { + if ((Bit64u) (bSig<<1)) return propagateFloatx80NaN(a, b, status); + if ((aExp | aSig) == 0) { + if (! bSign) { + float_raise(status, float_flag_invalid); + return floatx80_default_nan; + } + return a; + } + if (aSig && (aExp == 0)) float_raise(status, float_flag_denormal); + if (bSign) return packFloatx80(aSign, 0, 0); + return packFloatx80(aSign, 0x7FFF, BX_CONST64(0x8000000000000000)); + } + if (aExp == 0) { + if (bSig && (bExp == 0)) float_raise(status, float_flag_denormal); + if (aSig == 0) return a; + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + if (bExp < 0x3FFF) + return normalizeRoundAndPackFloatx80(80, aSign, aExp, aSig, 0, status); + } + if (bExp == 0) { + if (bSig == 0) return a; + float_raise(status, float_flag_denormal); + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + } + + if (bExp > 0x400E) { + /* generate appropriate overflow/underflow */ + return roundAndPackFloatx80(80, aSign, + bSign ? -0x3FFF : 0x7FFF, aSig, 0, status); + } + + if (bExp < 0x3FFF) return a; + + int shiftCount = 0x403E - bExp; + bSig >>= shiftCount; + Bit32s scale = (Bit32s) bSig; + if (bSign) scale = -scale; /* -32768..32767 */ + return + roundAndPackFloatx80(80, aSign, aExp+scale, aSig, 0, status); +} + +/*---------------------------------------------------------------------------- +| Determine extended-precision floating-point number class. +*----------------------------------------------------------------------------*/ + +float_class_t floatx80_class(floatx80 a) +{ + Bit32s aExp = extractFloatx80Exp(a); + Bit64u aSig = extractFloatx80Frac(a); + + if(aExp == 0) { + if (aSig == 0) + return float_zero; + + /* denormal or pseudo-denormal */ + return float_denormal; + } + + /* valid numbers have the MS bit set */ + if (!(aSig & BX_CONST64(0x8000000000000000))) + return float_SNaN; /* report unsupported as SNaNs */ + + if(aExp == 0x7fff) { + int aSign = extractFloatx80Sign(a); + + if (((Bit64u) (aSig<< 1)) == 0) + return (aSign) ? float_negative_inf : float_positive_inf; + + return (aSig & BX_CONST64(0x4000000000000000)) ? float_QNaN : float_SNaN; + } + + return float_normalized; +} + +/*---------------------------------------------------------------------------- +| Compare between two extended precision floating point numbers. Returns +| 'float_relation_equal' if the operands are equal, 'float_relation_less' if +| the value 'a' is less than the corresponding value `b', +| 'float_relation_greater' if the value 'a' is greater than the corresponding +| value `b', or 'float_relation_unordered' otherwise. +*----------------------------------------------------------------------------*/ + +int floatx80_compare(floatx80 a, floatx80 b, int quiet, struct float_status_t *status) +{ + float_class_t aClass = floatx80_class(a); + float_class_t bClass = floatx80_class(b); + + if (aClass == float_SNaN || bClass == float_SNaN) + { + /* unsupported reported as SNaN */ + float_raise(status, float_flag_invalid); + return float_relation_unordered; + } + + if (aClass == float_QNaN || bClass == float_QNaN) { + if (! quiet) float_raise(status, float_flag_invalid); + return float_relation_unordered; + } + + if (aClass == float_denormal || bClass == float_denormal) { + float_raise(status, float_flag_denormal); + } + + int aSign = extractFloatx80Sign(a); + int bSign = extractFloatx80Sign(b); + + if (aClass == float_zero) { + if (bClass == float_zero) return float_relation_equal; + return bSign ? float_relation_greater : float_relation_less; + } + + if (bClass == float_zero || aSign != bSign) { + return aSign ? float_relation_less : float_relation_greater; + } + + Bit64u aSig = extractFloatx80Frac(a); + Bit32s aExp = extractFloatx80Exp(a); + Bit64u bSig = extractFloatx80Frac(b); + Bit32s bExp = extractFloatx80Exp(b); + + if (aClass == float_denormal) + normalizeFloatx80Subnormal(aSig, &aExp, &aSig); + + if (bClass == float_denormal) + normalizeFloatx80Subnormal(bSig, &bExp, &bSig); + + if (aExp == bExp && aSig == bSig) + return float_relation_equal; + + int less_than = + aSign ? ((bExp < aExp) || ((bExp == aExp) && (bSig < aSig))) + : ((aExp < bExp) || ((aExp == bExp) && (aSig < bSig))); + + if (less_than) return float_relation_less; + return float_relation_greater; +} + + +int floatx80_compare_two(floatx80 a, floatx80 b, struct float_status_t *status) +{ + return floatx80_compare(a, b, 0, status); +} + +int floatx80_compare_quiet(floatx80 a, floatx80 b, struct float_status_t *status) +{ + return floatx80_compare(a, b, 1, status); +} diff --git a/src/cpu/softfloat/softfloatx80.h b/src/cpu/softfloat/softfloatx80.h new file mode 100644 index 000000000..8378169e2 --- /dev/null +++ b/src/cpu/softfloat/softfloatx80.h @@ -0,0 +1,113 @@ +/*============================================================================ +This source file is an extension to the SoftFloat IEC/IEEE Floating-point +Arithmetic Package, Release 2b, written for Bochs (x86 achitecture simulator) +floating point emulation. + +THIS SOFTWARE IS DISTRIBUTED AS IS, FOR FREE. Although reasonable effort has +been made to avoid it, THIS SOFTWARE MAY CONTAIN FAULTS THAT WILL AT TIMES +RESULT IN INCORRECT BEHAVIOR. USE OF THIS SOFTWARE IS RESTRICTED TO PERSONS +AND ORGANIZATIONS WHO CAN AND WILL TAKE FULL RESPONSIBILITY FOR ALL LOSSES, +COSTS, OR OTHER PROBLEMS THEY INCUR DUE TO THE SOFTWARE, AND WHO FURTHERMORE +EFFECTIVELY INDEMNIFY JOHN HAUSER AND THE INTERNATIONAL COMPUTER SCIENCE +INSTITUTE (possibly via similar legal warning) AGAINST ALL LOSSES, COSTS, OR +OTHER PROBLEMS INCURRED BY THEIR CUSTOMERS AND CLIENTS DUE TO THE SOFTWARE. + +Derivative works are acceptable, even for commercial purposes, so long as +(1) the source code for the derivative work includes prominent notice that +the work is derivative, and (2) the source code includes prominent notice with +these four paragraphs for those parts of this code that are retained. +=============================================================================*/ + +/*============================================================================ + * Written for Bochs (x86 achitecture simulator) by + * Stanislav Shwartsman [sshwarts at sourceforge net] + * ==========================================================================*/ + +#ifndef _SOFTFLOATX80_EXTENSIONS_H_ +#define _SOFTFLOATX80_EXTENSIONS_H_ + +#include "softfloat.h" +#include "softfloat-specialize.h" + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE integer-to-floating-point conversion routines. +*----------------------------------------------------------------------------*/ + +#ifdef __cplusplus +extern "C" { +#endif + +Bit16s floatx80_to_int16(floatx80, struct float_status_t *status); +Bit16s floatx80_to_int16_round_to_zero(floatx80, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE extended double-precision operations. +*----------------------------------------------------------------------------*/ + +floatx80 floatx80_extract(floatx80 *a, struct float_status_t *status); +floatx80 floatx80_scale(floatx80 a, floatx80 b, struct float_status_t *status); +int floatx80_remainder(floatx80 a, floatx80 b, floatx80 *r, Bit64u *q, struct float_status_t *status); +int floatx80_ieee754_remainder(floatx80 a, floatx80 b, floatx80 *r, Bit64u *q, struct float_status_t *status); +floatx80 f2xm1(floatx80 a, struct float_status_t *status); +floatx80 fyl2x(floatx80 a, floatx80 b, struct float_status_t *status); +floatx80 fyl2xp1(floatx80 a, floatx80 b, struct float_status_t *status); +floatx80 fpatan(floatx80 a, floatx80 b, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE extended double-precision trigonometric functions. +*----------------------------------------------------------------------------*/ + +int fsincos(floatx80 a, floatx80 *sin_a, floatx80 *cos_a, struct float_status_t *status); +int fsin(floatx80 *a, struct float_status_t *status); +int fcos(floatx80 *a, struct float_status_t *status); +int ftan(floatx80 *a, struct float_status_t *status); + +/*---------------------------------------------------------------------------- +| Software IEC/IEEE extended double-precision compare. +*----------------------------------------------------------------------------*/ + +int floatx80_compare(floatx80, floatx80, int quiet, struct float_status_t *status); +int floatx80_compare_two(floatx80 a, floatx80 b, struct float_status_t *status); +int floatx80_compare_quiet(floatx80 a, floatx80 b, struct float_status_t *status); + +#ifdef __cplusplus +} +#endif + +/*----------------------------------------------------------------------------- +| Calculates the absolute value of the extended double-precision floating-point +| value `a'. The operation is performed according to the IEC/IEEE Standard +| for Binary Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE floatx80 floatx80_abs(floatx80 reg) +{ + reg.exp &= 0x7FFF; + return reg; +} + +/*----------------------------------------------------------------------------- +| Changes the sign of the extended double-precision floating-point value 'a'. +| The operation is performed according to the IEC/IEEE Standard for Binary +| Floating-Point Arithmetic. +*----------------------------------------------------------------------------*/ + +BX_CPP_INLINE floatx80 floatx80_chs(floatx80 reg) +{ + reg.exp ^= 0x8000; + return reg; +} + +/*----------------------------------------------------------------------------- +| Commonly used extended double-precision floating-point constants. +*----------------------------------------------------------------------------*/ + +extern const floatx80 Const_Z; +extern const floatx80 Const_1; +extern const floatx80 Const_L2T; +extern const floatx80 Const_L2E; +extern const floatx80 Const_PI; +extern const floatx80 Const_LG2; +extern const floatx80 Const_LN2; +extern const floatx80 Const_INF; +#endif diff --git a/src/cpu/softfloat/x87_ops_arith.h b/src/cpu/softfloat/x87_ops_arith.h new file mode 100644 index 000000000..10b100b2a --- /dev/null +++ b/src/cpu/softfloat/x87_ops_arith.h @@ -0,0 +1,750 @@ +#define sf_FPU(name, optype, a_size, load_var, rw, use_var, is_nan, cycle_postfix) \ + static int sf_FADD##name##_a##a_size(uint32_t fetchdat) \ + { \ + floatx80 a, result; \ + struct float_status_t status; \ + optype temp; \ + FP_ENTER(); \ + FPU_check_pending_exceptions(); \ + fetch_ea_##a_size(fetchdat); \ + SEG_CHECK_READ(cpu_state.ea_seg); \ + load_var = rw; \ + if (cpu_state.abrt) \ + return 1;\ + clear_C1(); \ + if (IS_TAG_EMPTY(0)) { \ + FPU_stack_underflow(fetchdat, 0, 0); \ + goto next_ins; \ + } \ + status = i387cw_to_softfloat_status_word(i387_get_control_word()); \ + a = FPU_read_regi(0); \ + if (!is_nan) \ + result = floatx80_add(a, use_var, &status); \ + \ + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) \ + FPU_save_regi(result, 0); \ + \ +next_ins: \ + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd##cycle_postfix) : ((x87_timings.fadd##cycle_postfix) * cpu_multi)); \ + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd##cycle_postfix) : ((x87_concurrency.fadd##cycle_postfix) * cpu_multi)); \ + return 0; \ + } \ + static int sf_FDIV##name##_a##a_size(uint32_t fetchdat) \ + { \ + floatx80 a, result; \ + struct float_status_t status; \ + optype temp; \ + FP_ENTER(); \ + FPU_check_pending_exceptions(); \ + fetch_ea_##a_size(fetchdat); \ + SEG_CHECK_READ(cpu_state.ea_seg); \ + load_var = rw; \ + if (cpu_state.abrt) \ + return 1;\ + clear_C1(); \ + if (IS_TAG_EMPTY(0)) { \ + FPU_stack_underflow(fetchdat, 0, 0); \ + goto next_ins; \ + } \ + status = i387cw_to_softfloat_status_word(i387_get_control_word()); \ + a = FPU_read_regi(0); \ + if (!is_nan) { \ + result = floatx80_div(a, use_var, &status); \ + } \ + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) \ + FPU_save_regi(result, 0); \ + \ +next_ins: \ + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fdiv##cycle_postfix) : ((x87_timings.fdiv##cycle_postfix) * cpu_multi)); \ + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd##cycle_postfix) : ((x87_concurrency.fadd##cycle_postfix) * cpu_multi)); \ + return 0; \ + } \ + static int sf_FDIVR##name##_a##a_size(uint32_t fetchdat) \ + { \ + floatx80 a, result; \ + struct float_status_t status; \ + optype temp; \ + FP_ENTER(); \ + FPU_check_pending_exceptions(); \ + fetch_ea_##a_size(fetchdat); \ + SEG_CHECK_READ(cpu_state.ea_seg); \ + load_var = rw; \ + if (cpu_state.abrt) \ + return 1;\ + clear_C1(); \ + if (IS_TAG_EMPTY(0)) { \ + FPU_stack_underflow(fetchdat, 0, 0); \ + goto next_ins; \ + } \ + status = i387cw_to_softfloat_status_word(i387_get_control_word()); \ + a = FPU_read_regi(0); \ + if (!is_nan) { \ + result = floatx80_div(use_var, a, &status); \ + } \ + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) \ + FPU_save_regi(result, 0); \ + \ +next_ins: \ + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fdiv##cycle_postfix) : ((x87_timings.fdiv##cycle_postfix) * cpu_multi)); \ + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fdiv##cycle_postfix) : ((x87_concurrency.fdiv##cycle_postfix) * cpu_multi)); \ + return 0; \ + } \ + static int sf_FMUL##name##_a##a_size(uint32_t fetchdat) \ + { \ + floatx80 a, result; \ + struct float_status_t status; \ + optype temp; \ + FP_ENTER(); \ + FPU_check_pending_exceptions(); \ + fetch_ea_##a_size(fetchdat); \ + SEG_CHECK_READ(cpu_state.ea_seg); \ + load_var = rw; \ + if (cpu_state.abrt) \ + return 1;\ + clear_C1(); \ + if (IS_TAG_EMPTY(0)) { \ + FPU_stack_underflow(fetchdat, 0, 0); \ + goto next_ins; \ + } \ + status = i387cw_to_softfloat_status_word(i387_get_control_word()); \ + a = FPU_read_regi(0); \ + if (!is_nan) { \ + result = floatx80_mul(a, use_var, &status); \ + } \ + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) \ + FPU_save_regi(result, 0); \ + \ +next_ins: \ + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fmul##cycle_postfix) : ((x87_timings.fmul##cycle_postfix) * cpu_multi)); \ + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fmul##cycle_postfix) : ((x87_concurrency.fmul##cycle_postfix) * cpu_multi)); \ + return 0; \ + } \ + static int sf_FSUB##name##_a##a_size(uint32_t fetchdat) \ + { \ + floatx80 a, result; \ + struct float_status_t status; \ + optype temp; \ + FP_ENTER(); \ + FPU_check_pending_exceptions(); \ + fetch_ea_##a_size(fetchdat); \ + SEG_CHECK_READ(cpu_state.ea_seg); \ + load_var = rw; \ + if (cpu_state.abrt) \ + return 1;\ + clear_C1(); \ + if (IS_TAG_EMPTY(0)) { \ + FPU_stack_underflow(fetchdat, 0, 0); \ + goto next_ins; \ + } \ + status = i387cw_to_softfloat_status_word(i387_get_control_word()); \ + a = FPU_read_regi(0); \ + if (!is_nan) \ + result = floatx80_sub(a, use_var, &status); \ + \ + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) \ + FPU_save_regi(result, 0); \ + \ +next_ins: \ + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd##cycle_postfix) : ((x87_timings.fadd##cycle_postfix) * cpu_multi)); \ + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd##cycle_postfix) : ((x87_concurrency.fadd##cycle_postfix) * cpu_multi)); \ + return 0; \ + } \ + static int sf_FSUBR##name##_a##a_size(uint32_t fetchdat) \ + { \ + floatx80 a, result; \ + struct float_status_t status; \ + optype temp; \ + FP_ENTER(); \ + FPU_check_pending_exceptions(); \ + fetch_ea_##a_size(fetchdat); \ + SEG_CHECK_READ(cpu_state.ea_seg); \ + load_var = rw; \ + if (cpu_state.abrt) \ + return 1;\ + clear_C1(); \ + if (IS_TAG_EMPTY(0)) { \ + FPU_stack_underflow(fetchdat, 0, 0); \ + goto next_ins; \ + } \ + status = i387cw_to_softfloat_status_word(i387_get_control_word()); \ + a = FPU_read_regi(0); \ + if (!is_nan) \ + result = floatx80_sub(use_var, a, &status); \ + \ + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) \ + FPU_save_regi(result, 0); \ + \ +next_ins: \ + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd##cycle_postfix) : ((x87_timings.fadd##cycle_postfix) * cpu_multi)); \ + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd##cycle_postfix) : ((x87_concurrency.fadd##cycle_postfix) * cpu_multi)); \ + return 0; \ + } + +// clang-format off +sf_FPU(s, float32, 16, temp, geteal(), float32_to_floatx80(temp, &status), FPU_handle_NaN32(a, temp, &result, &status), _32) +#ifndef FPU_8087 +sf_FPU(s, float32, 32, temp, geteal(), float32_to_floatx80(temp, &status), FPU_handle_NaN32(a, temp, &result, &status), _32) +#endif +sf_FPU(d, float64, 16, temp, geteaq(), float64_to_floatx80(temp, &status), FPU_handle_NaN64(a, temp, &result, &status), _64) +#ifndef FPU_8087 +sf_FPU(d, float64, 32, temp, geteaq(), float64_to_floatx80(temp, &status), FPU_handle_NaN64(a, temp, &result, &status), _64) +#endif + +sf_FPU(iw, uint16_t, 16, temp, geteaw(), int32_to_floatx80((int16_t)temp), 0, _i16) +#ifndef FPU_8087 +sf_FPU(iw, uint16_t, 32, temp, geteaw(), int32_to_floatx80((int16_t)temp), 0, _i16) +#endif +sf_FPU(il, uint32_t, 16, temp, geteal(), int32_to_floatx80((int32_t)temp), 0, _i32) +#ifndef FPU_8087 +sf_FPU(il, uint32_t, 32, temp, geteal(), int32_to_floatx80((int32_t)temp), 0, _i32) +#endif +// clang-format on + +static int +sf_FADD_st0_stj(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + result = floatx80_add(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_save_regi(result, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd) : (x87_timings.fadd * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd) : (x87_concurrency.fadd * cpu_multi)); + return 0; +} +static int +sf_FADD_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(fetchdat & 7); + b = FPU_read_regi(0); + result = floatx80_add(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_save_regi(result, fetchdat & 7); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd) : (x87_timings.fadd * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd) : (x87_concurrency.fadd * cpu_multi)); + return 0; +} + +static int +sf_FADDP_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 1); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(fetchdat & 7); + b = FPU_read_regi(0); + result = floatx80_add(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, fetchdat & 7); + FPU_pop(); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd) : (x87_timings.fadd * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd) : (x87_concurrency.fadd * cpu_multi)); + return 0; +} + +static int +sf_FDIV_st0_stj(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + result = floatx80_div(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_save_regi(result, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fdiv) : (x87_timings.fdiv * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fdiv) : (x87_concurrency.fdiv * cpu_multi)); + return 0; +} + +static int +sf_FDIV_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(fetchdat & 7); + b = FPU_read_regi(0); + result = floatx80_div(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_save_regi(result, fetchdat & 7); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fdiv) : (x87_timings.fdiv * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fdiv) : (x87_concurrency.fdiv * cpu_multi)); + return 0; +} +static int +sf_FDIVP_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 1); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(fetchdat & 7); + b = FPU_read_regi(0); + result = floatx80_div(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, fetchdat & 7); + FPU_pop(); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fdiv) : (x87_timings.fdiv * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fdiv) : (x87_concurrency.fdiv * cpu_multi)); + return 0; +} + +static int +sf_FDIVR_st0_stj(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(fetchdat & 7); + b = FPU_read_regi(0); + result = floatx80_div(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_save_regi(result, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fdiv) : (x87_timings.fdiv * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fdiv) : (x87_concurrency.fdiv * cpu_multi)); + return 0; +} +static int +sf_FDIVR_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + result = floatx80_div(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_save_regi(result, fetchdat & 7); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fdiv) : (x87_timings.fdiv * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fdiv) : (x87_concurrency.fdiv * cpu_multi)); + return 0; +} +static int +sf_FDIVRP_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 1); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + result = floatx80_div(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, fetchdat & 7); + FPU_pop(); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fdiv) : (x87_timings.fdiv * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fdiv) : (x87_concurrency.fdiv * cpu_multi)); + return 0; +} + +static int +sf_FMUL_st0_stj(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + result = floatx80_mul(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fmul) : (x87_timings.fmul * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fmul) : (x87_concurrency.fmul * cpu_multi)); + return 0; +} +static int +sf_FMUL_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + result = floatx80_mul(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, fetchdat & 7); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fmul) : (x87_timings.fmul * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fmul) : (x87_concurrency.fmul * cpu_multi)); + return 0; +} +static int +sf_FMULP_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 1); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(fetchdat & 7); + b = FPU_read_regi(0); + result = floatx80_mul(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, fetchdat & 7); + FPU_pop(); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fmul) : (x87_timings.fmul * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fmul) : (x87_concurrency.fmul * cpu_multi)); + return 0; +} + +static int +sf_FSUB_st0_stj(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + result = floatx80_sub(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd) : (x87_timings.fadd * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd) : (x87_concurrency.fadd * cpu_multi)); + return 0; +} +static int +sf_FSUB_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(fetchdat & 7); + b = FPU_read_regi(0); + result = floatx80_sub(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, fetchdat & 7); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd) : (x87_timings.fadd * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd) : (x87_concurrency.fadd * cpu_multi)); + return 0; +} +static int +sf_FSUBP_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 1); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(fetchdat & 7); + b = FPU_read_regi(0); + result = floatx80_sub(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, fetchdat & 7); + FPU_pop(); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd) : (x87_timings.fadd * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd) : (x87_concurrency.fadd * cpu_multi)); + return 0; +} + +static int +sf_FSUBR_st0_stj(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(fetchdat & 7); + b = FPU_read_regi(0); + result = floatx80_sub(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd) : (x87_timings.fadd * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd) : (x87_concurrency.fadd * cpu_multi)); + return 0; +} +static int +sf_FSUBR_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + result = floatx80_sub(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, fetchdat & 7); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd) : (x87_timings.fadd * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd) : (x87_concurrency.fadd * cpu_multi)); + return 0; +} +static int +sf_FSUBRP_sti_st0(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 1); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + result = floatx80_sub(a, b, &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, fetchdat & 7); + FPU_pop(); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fadd) : (x87_timings.fadd * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fadd) : (x87_concurrency.fadd * cpu_multi)); + return 0; +} + +static int +sf_FSQRT(uint32_t fetchdat) +{ + floatx80 result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + result = floatx80_sqrt(FPU_read_regi(0), &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fsqrt) : (x87_timings.fsqrt * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fsqrt) : (x87_concurrency.fsqrt * cpu_multi)); + return 0; +} + +static int +sf_FRNDINT(uint32_t fetchdat) +{ + floatx80 result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + result = floatx80_round_to_int(FPU_read_regi(0), &status); + + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.frndint) : (x87_timings.frndint * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.frndint) : (x87_concurrency.frndint * cpu_multi)); + return 0; +} diff --git a/src/cpu/softfloat/x87_ops_compare.h b/src/cpu/softfloat/x87_ops_compare.h new file mode 100644 index 000000000..59135c05b --- /dev/null +++ b/src/cpu/softfloat/x87_ops_compare.h @@ -0,0 +1,489 @@ +#define cmp_FPU(name, optype, a_size, load_var, rw, use_var, is_nan, cycle_postfix) \ + static int sf_FCOM##name##_a##a_size(uint32_t fetchdat) \ + { \ + floatx80 a; \ + int rc; \ + struct float_status_t status; \ + optype temp; \ + FP_ENTER(); \ + fetch_ea_##a_size(fetchdat); \ + SEG_CHECK_READ(cpu_state.ea_seg); \ + load_var = rw; \ + if (cpu_state.abrt) \ + return 1;\ + clear_C1(); \ + if (IS_TAG_EMPTY(0)) { \ + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); \ + setcc(C0 | C2 | C3); \ + goto next_ins; \ + } \ + status = i387cw_to_softfloat_status_word(i387_get_control_word()); \ + a = FPU_read_regi(0); \ + if (is_nan) { \ + rc = float_relation_unordered; \ + float_raise(&status, float_flag_invalid); \ + } else { \ + rc = floatx80_compare_two(a, use_var, &status); \ + } \ + setcc(FPU_status_word_flags_fpu_compare(rc)); \ + FPU_exception(fetchdat, status.float_exception_flags, 0); \ + \ +next_ins: \ + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fcom##cycle_postfix) : ((x87_timings.fcom##cycle_postfix) * cpu_multi)); \ + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fcom##cycle_postfix) : ((x87_concurrency.fcom##cycle_postfix) * cpu_multi)); \ + return 0; \ + } \ + static int sf_FCOMP##name##_a##a_size(uint32_t fetchdat) \ + { \ + floatx80 a; \ + int rc; \ + struct float_status_t status; \ + optype temp; \ + FP_ENTER(); \ + fetch_ea_##a_size(fetchdat); \ + SEG_CHECK_READ(cpu_state.ea_seg); \ + load_var = rw; \ + if (cpu_state.abrt) \ + return 1;\ + clear_C1(); \ + if (IS_TAG_EMPTY(0)) { \ + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); \ + setcc(C0 | C2 | C3); \ + if (is_IA_masked()) \ + FPU_pop(); \ + \ + goto next_ins; \ + } \ + status = i387cw_to_softfloat_status_word(i387_get_control_word()); \ + a = FPU_read_regi(0); \ + if (is_nan) { \ + rc = float_relation_unordered; \ + float_raise(&status, float_flag_invalid); \ + } else { \ + rc = floatx80_compare_two(a, use_var, &status); \ + } \ + setcc(FPU_status_word_flags_fpu_compare(rc)); \ + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) \ + FPU_pop(); \ + \ +next_ins: \ + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fcom##cycle_postfix) : ((x87_timings.fcom##cycle_postfix) * cpu_multi)); \ + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fcom##cycle_postfix) : ((x87_concurrency.fcom##cycle_postfix) * cpu_multi)); \ + return 0; \ + } \ + +// clang-format off +cmp_FPU(s, float32, 16, temp, geteal(), float32_to_floatx80(temp, &status), floatx80_is_nan(a) || floatx80_is_unsupported(a) || float32_is_nan(temp), _32) +#ifndef FPU_8087 +cmp_FPU(s, float32, 32, temp, geteal(), float32_to_floatx80(temp, &status), floatx80_is_nan(a) || floatx80_is_unsupported(a) || float32_is_nan(temp), _32) +#endif +cmp_FPU(d, float64, 16, temp, geteaq(), float64_to_floatx80(temp, &status), floatx80_is_nan(a) || floatx80_is_unsupported(a) || float64_is_nan(temp), _64) +#ifndef FPU_8087 +cmp_FPU(d, float64, 32, temp, geteaq(), float64_to_floatx80(temp, &status), floatx80_is_nan(a) || floatx80_is_unsupported(a) || float64_is_nan(temp), _64) +#endif + +cmp_FPU(iw, int16_t, 16, temp, (int16_t)geteaw(), int32_to_floatx80((int32_t)temp), 0, _i16) +#ifndef FPU_8087 +cmp_FPU(iw, int16_t, 32, temp, (int16_t)geteaw(), int32_to_floatx80((int32_t)temp), 0, _i16) +#endif +cmp_FPU(il, int32_t, 16, temp, (int32_t)geteal(), int32_to_floatx80(temp), 0, _i32) +#ifndef FPU_8087 +cmp_FPU(il, int32_t, 32, temp, (int32_t)geteal(), int32_to_floatx80(temp), 0, _i32) +#endif +// clang-format on + +static int +sf_FCOM_sti(uint32_t fetchdat) +{ + floatx80 a, b; + struct float_status_t status; + int rc; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + setcc(C0 | C2 | C3); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + rc = floatx80_compare_two(a, b, &status); + setcc(FPU_status_word_flags_fpu_compare(rc)); + FPU_exception(fetchdat, status.float_exception_flags, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fcom) : (x87_timings.fcom * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fcom) : (x87_concurrency.fcom * cpu_multi)); + return 0; +} + +static int +sf_FCOMP_sti(uint32_t fetchdat) +{ + floatx80 a, b; + struct float_status_t status; + int rc; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + setcc(C0 | C2 | C3); + if (is_IA_masked()) { + FPU_pop(); + } + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + rc = floatx80_compare_two(a, b, &status); + setcc(FPU_status_word_flags_fpu_compare(rc)); + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_pop(); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fcom) : (x87_timings.fcom * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fcom) : (x87_concurrency.fcom * cpu_multi)); + return 0; +} + +static int +sf_FCOMPP(uint32_t fetchdat) +{ + floatx80 a, b; + struct float_status_t status; + int rc; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(1)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + setcc(C0 | C2 | C3); + if (is_IA_masked()) { + FPU_pop(); + FPU_pop(); + } + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(1); + rc = floatx80_compare_two(a, b, &status); + setcc(FPU_status_word_flags_fpu_compare(rc)); + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_pop(); + FPU_pop(); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fcom) : (x87_timings.fcom * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fcom) : (x87_concurrency.fcom * cpu_multi)); + return 0; +} + +#ifndef FPU_8087 +static int +sf_FUCOMPP(uint32_t fetchdat) +{ + floatx80 a, b; + struct float_status_t status; + int rc; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(1)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + setcc(C0 | C2 | C3); + if (is_IA_masked()) { + FPU_pop(); + FPU_pop(); + } + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(1); + rc = floatx80_compare_quiet(a, b, &status); + setcc(FPU_status_word_flags_fpu_compare(rc)); + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_pop(); + FPU_pop(); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fucom) : (x87_timings.fucom * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fucom) : (x87_concurrency.fucom * cpu_multi)); + return 0; +} + +static int +sf_FCOMI_st0_stj(uint32_t fetchdat) +{ + floatx80 a, b; + struct float_status_t status; + int rc; + + FP_ENTER(); + cpu_state.pc++; + flags_rebuild(); + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + cpu_state.flags |= (Z_FLAG | P_FLAG | C_FLAG); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + rc = floatx80_compare_two(a, b, &status); + FPU_write_eflags_fpu_compare(rc); + FPU_exception(fetchdat, status.float_exception_flags, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fcom) : (x87_timings.fcom * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fcom) : (x87_concurrency.fcom * cpu_multi)); + return 0; +} +static int +sf_FCOMIP_st0_stj(uint32_t fetchdat) +{ + floatx80 a, b; + struct float_status_t status; + int rc; + + FP_ENTER(); + cpu_state.pc++; + flags_rebuild(); + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + cpu_state.flags |= (Z_FLAG | P_FLAG | C_FLAG); + if (is_IA_masked()) { + FPU_pop(); + } + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + rc = floatx80_compare_two(a, b, &status); + FPU_write_eflags_fpu_compare(rc); + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_pop(); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fcom) : (x87_timings.fcom * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fcom) : (x87_concurrency.fcom * cpu_multi)); + return 0; +} + +static int +sf_FUCOM_sti(uint32_t fetchdat) +{ + floatx80 a, b; + struct float_status_t status; + int rc; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + setcc(C0 | C2 | C3); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + rc = floatx80_compare_quiet(a, b, &status); + setcc(FPU_status_word_flags_fpu_compare(rc)); + FPU_exception(fetchdat, status.float_exception_flags, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fucom) : (x87_timings.fucom * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fucom) : (x87_concurrency.fucom * cpu_multi)); + return 0; +} + +static int +sf_FUCOMP_sti(uint32_t fetchdat) +{ + floatx80 a, b; + struct float_status_t status; + int rc; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + setcc(C0 | C2 | C3); + if (is_IA_masked()) + FPU_pop(); + + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + rc = floatx80_compare_quiet(a, b, &status); + setcc(FPU_status_word_flags_fpu_compare(rc)); + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fucom) : (x87_timings.fucom * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fucom) : (x87_concurrency.fucom * cpu_multi)); + return 0; +} + +static int +sf_FUCOMI_st0_stj(uint32_t fetchdat) +{ + floatx80 a, b; + struct float_status_t status; + int rc; + + FP_ENTER(); + cpu_state.pc++; + flags_rebuild(); + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + cpu_state.flags |= (Z_FLAG | P_FLAG | C_FLAG); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + rc = floatx80_compare_quiet(a, b, &status); + FPU_write_eflags_fpu_compare(rc); + FPU_exception(fetchdat, status.float_exception_flags, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fucom) : (x87_timings.fucom * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fucom) : (x87_concurrency.fucom * cpu_multi)); + return 0; +} +static int +sf_FUCOMIP_st0_stj(uint32_t fetchdat) +{ + floatx80 a, b; + struct float_status_t status; + int rc; + + FP_ENTER(); + cpu_state.pc++; + flags_rebuild(); + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + cpu_state.flags |= (Z_FLAG | P_FLAG | C_FLAG); + if (is_IA_masked()) + FPU_pop(); + + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(fetchdat & 7); + rc = floatx80_compare_quiet(a, b, &status); + FPU_write_eflags_fpu_compare(rc); + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fucom) : (x87_timings.fucom * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fucom) : (x87_concurrency.fucom * cpu_multi)); + return 0; +} +#endif + +static int +sf_FTST(uint32_t fetchdat) +{ + int rc; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + setcc(C0 | C2 | C3); + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + rc = floatx80_compare_two(FPU_read_regi(0), Const_Z, &status); + setcc(FPU_status_word_flags_fpu_compare(rc)); + FPU_exception(fetchdat, status.float_exception_flags, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.ftst) : (x87_timings.ftst * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.ftst) : (x87_concurrency.ftst * cpu_multi)); + return 0; +} + +static int +sf_FXAM(uint32_t fetchdat) +{ + floatx80 reg; + int sign; + float_class_t aClass; + + FP_ENTER(); + cpu_state.pc++; + reg = FPU_read_regi(0); + sign = floatx80_sign(reg); + /* + * Examine the contents of the ST(0) register and sets the condition + * code flags C0, C2 and C3 in the FPU status word to indicate the + * class of value or number in the register. + */ + if (IS_TAG_EMPTY(0)) { + setcc(C3 | C1 | C0); + } else { + aClass = floatx80_class(reg); + switch (aClass) { + case float_zero: + setcc(C3 | C1); + break; + case float_SNaN: + case float_QNaN: + // unsupported handled as NaNs + if (floatx80_is_unsupported(reg)) { + setcc(C1); + } else { + setcc(C1 | C0); + } + break; + case float_negative_inf: + case float_positive_inf: + setcc(C2 | C1 | C0); + break; + case float_denormal: + setcc(C3 | C2 | C1); + break; + case float_normalized: + setcc(C2 | C1); + break; + } + } + /* + * The C1 flag is set to the sign of the value in ST(0), regardless + * of whether the register is empty or full. + */ + if (!sign) + clear_C1(); + + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fxam) : (x87_timings.fxam * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fxam) : (x87_concurrency.fxam * cpu_multi)); + return 0; +} diff --git a/src/cpu/softfloat/x87_ops_const.h b/src/cpu/softfloat/x87_ops_const.h new file mode 100644 index 000000000..5e722ede4 --- /dev/null +++ b/src/cpu/softfloat/x87_ops_const.h @@ -0,0 +1,131 @@ +/* A fast way to find out whether x is one of RC_DOWN or RC_CHOP + (and not one of RC_RND or RC_UP). + */ +#define DOWN_OR_CHOP() (fpu_state.cwd & FPU_CW_RC & FPU_RC_DOWN) + +static __inline floatx80 +FPU_round_const(const floatx80 a, int adj) +{ + floatx80 result = a; + result.fraction += adj; + return result; +} + +static int +sf_FLDL2T(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) + FPU_stack_overflow(fetchdat); + else { + FPU_push(); + FPU_save_regi(FPU_round_const(Const_L2T, (fpu_state.cwd & FPU_CW_RC) == X87_ROUNDING_UP), 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_const) : (x87_timings.fld_const * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_const) : (x87_concurrency.fld_const * cpu_multi)); + return 0; +} + +static int +sf_FLDL2E(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) + FPU_stack_overflow(fetchdat); + else { + FPU_push(); + FPU_save_regi(FPU_round_const(Const_L2E, DOWN_OR_CHOP() ? -1 : 0), 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_const) : (x87_timings.fld_const * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_const) : (x87_concurrency.fld_const * cpu_multi)); + return 0; +} + +static int +sf_FLDPI(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) + FPU_stack_overflow(fetchdat); + else { + FPU_push(); + FPU_save_regi(FPU_round_const(Const_PI, DOWN_OR_CHOP() ? -1 : 0), 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_const) : (x87_timings.fld_const * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_const) : (x87_concurrency.fld_const * cpu_multi)); + return 0; +} + +static int +sf_FLDEG2(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) + FPU_stack_overflow(fetchdat); + else { + FPU_push(); + FPU_save_regi(FPU_round_const(Const_LG2, DOWN_OR_CHOP() ? -1 : 0), 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_const) : (x87_timings.fld_const * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_const) : (x87_concurrency.fld_const * cpu_multi)); + return 0; +} + +static int +sf_FLDLN2(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) + FPU_stack_overflow(fetchdat); + else { + FPU_push(); + FPU_save_regi(FPU_round_const(Const_LN2, DOWN_OR_CHOP() ? -1 : 0), 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_const) : (x87_timings.fld_const * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_const) : (x87_concurrency.fld_const * cpu_multi)); + return 0; +} + +static int +sf_FLD1(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) + FPU_stack_overflow(fetchdat); + else { + FPU_push(); + FPU_save_regi(Const_1, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_z1) : (x87_timings.fld_z1 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_z1) : (x87_concurrency.fld_z1 * cpu_multi)); + return 0; +} + +static int +sf_FLDZ(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) + FPU_stack_overflow(fetchdat); + else { + FPU_push(); + FPU_save_regi(Const_Z, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_z1) : (x87_timings.fld_z1 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_z1) : (x87_concurrency.fld_z1 * cpu_multi)); + return 0; +} diff --git a/src/cpu/softfloat/x87_ops_load_store.h b/src/cpu/softfloat/x87_ops_load_store.h new file mode 100644 index 000000000..c6dab1b44 --- /dev/null +++ b/src/cpu/softfloat/x87_ops_load_store.h @@ -0,0 +1,1314 @@ +/* + * 86Box A hypervisor and IBM PC system emulator that specializes in + * running old operating systems and software designed for IBM + * PC systems and compatibles from 1981 through fairly recent + * system designs based on the PCI bus. + * + * This file is part of the 86Box distribution. + * + * x87 FPU instructions core. + * + * + * + * Authors: Sarah Walker, + * Miran Grca, + * + * Copyright 2008-2019 Sarah Walker. + * Copyright 2016-2019 Miran Grca. + */ + +#define swap_values16u(a, b) { uint16_t tmp = a; a = b; b = tmp; } + +static int +sf_FILDiw_a16(uint32_t fetchdat) +{ + floatx80 result; + int16_t temp; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + temp = geteaw(); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + } else { + result = int32_to_floatx80(temp); + FPU_push(); + FPU_save_regi(result, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fild_16) : (x87_timings.fild_16 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fild_16) : (x87_concurrency.fild_16 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FILDiw_a32(uint32_t fetchdat) +{ + floatx80 result; + int16_t temp; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + temp = geteaw(); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + } else { + result = int32_to_floatx80(temp); + FPU_push(); + FPU_save_regi(result, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fild_16) : (x87_timings.fild_16 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fild_16) : (x87_concurrency.fild_16 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FILDil_a16(uint32_t fetchdat) +{ + floatx80 result; + int32_t templ; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + templ = geteal(); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + } else { + result = int32_to_floatx80(templ); + FPU_push(); + FPU_save_regi(result, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fild_32) : (x87_timings.fild_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fild_32) : (x87_concurrency.fild_32 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FILDil_a32(uint32_t fetchdat) +{ + floatx80 result; + int32_t templ; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + templ = geteal(); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + } else { + result = int32_to_floatx80(templ); + FPU_push(); + FPU_save_regi(result, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fild_32) : (x87_timings.fild_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fild_32) : (x87_concurrency.fild_32 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FILDiq_a16(uint32_t fetchdat) +{ + floatx80 result; + int64_t temp64; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + temp64 = geteaq(); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + } else { + result = int64_to_floatx80(temp64); + FPU_push(); + FPU_save_regi(result, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fild_64) : (x87_timings.fild_64 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fild_64) : (x87_concurrency.fild_64 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FILDiq_a32(uint32_t fetchdat) +{ + floatx80 result; + int64_t temp64; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + temp64 = geteaq(); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + } else { + result = int64_to_floatx80(temp64); + FPU_push(); + FPU_save_regi(result, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fild_64) : (x87_timings.fild_64 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fild_64) : (x87_concurrency.fild_64 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FLDs_a16(uint32_t fetchdat) +{ + struct float_status_t status; + floatx80 result; + float32 load_reg; + unsigned unmasked; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + load_reg = geteal(); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + result = float32_to_floatx80(load_reg, &status); + unmasked = FPU_exception(fetchdat, status.float_exception_flags, 0); + if (!(unmasked & FPU_CW_Invalid)) { + FPU_push(); + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_32) : (x87_timings.fst_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_32) : (x87_concurrency.fst_32 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FLDs_a32(uint32_t fetchdat) +{ + struct float_status_t status; + floatx80 result; + float32 load_reg; + unsigned unmasked; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + load_reg = geteal(); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + result = float32_to_floatx80(load_reg, &status); + unmasked = FPU_exception(fetchdat, status.float_exception_flags, 0); + if (!(unmasked & FPU_CW_Invalid)) { + FPU_push(); + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_32) : (x87_timings.fst_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_32) : (x87_concurrency.fst_32 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FLDd_a16(uint32_t fetchdat) +{ + struct float_status_t status; + floatx80 result; + float64 load_reg; + unsigned unmasked; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + load_reg = geteaq(); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + result = float64_to_floatx80(load_reg, &status); + unmasked = FPU_exception(fetchdat, status.float_exception_flags, 0); + if (!(unmasked & FPU_CW_Invalid)) { + FPU_push(); + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_64) : (x87_timings.fld_64 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_64) : (x87_concurrency.fld_64 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FLDd_a32(uint32_t fetchdat) +{ + struct float_status_t status; + floatx80 result; + float64 load_reg; + unsigned unmasked; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + load_reg = geteaq(); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + result = float64_to_floatx80(load_reg, &status); + unmasked = FPU_exception(fetchdat, status.float_exception_flags, 0); + if (!(unmasked & FPU_CW_Invalid)) { + FPU_push(); + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_64) : (x87_timings.fld_64 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_64) : (x87_concurrency.fld_64 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FLDe_a16(uint32_t fetchdat) +{ + floatx80 result; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + result.fraction = readmemq(easeg, cpu_state.eaaddr); + result.exp = readmemw(easeg, cpu_state.eaaddr + 8); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + } else { + FPU_push(); + FPU_save_regi(result, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_80) : (x87_timings.fld_80 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_80) : (x87_concurrency.fld_80 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FLDe_a32(uint32_t fetchdat) +{ + floatx80 result; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + result.fraction = readmemq(easeg, cpu_state.eaaddr); + result.exp = readmemw(easeg, cpu_state.eaaddr + 8); + if (cpu_state.abrt) + return 1; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + } else { + FPU_push(); + FPU_save_regi(result, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_80) : (x87_timings.fld_80 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_80) : (x87_concurrency.fld_80 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FLD_sti(uint32_t fetchdat) +{ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + floatx80 sti_reg; + + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + clear_C1(); + if (!IS_TAG_EMPTY(-1)) { + FPU_stack_overflow(fetchdat); + goto next_ins; + } + sti_reg = floatx80_default_nan; + if (IS_TAG_EMPTY(fetchdat & 7)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + sti_reg = FPU_read_regi(fetchdat & 7); + } + + FPU_push(); + FPU_save_regi(sti_reg, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld) : (x87_timings.fld * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld) : (x87_concurrency.fld * cpu_multi)); + return 0; +} + +static int +sf_FISTiw_a16(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + int16_t save_reg = int16_indefinite; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) { + goto next_ins; + } + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_int16(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) { + goto next_ins; + } + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteaw(save_reg); + fpu_state.swd = sw; + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fist_16) : (x87_timings.fist_16 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fist_16) : (x87_concurrency.fist_16 * cpu_multi)); + return cpu_state.abrt; +} +#ifndef FPU_8087 +static int +sf_FISTiw_a32(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + int16_t save_reg = int16_indefinite; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_int16(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) + goto next_ins; + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteaw(save_reg); + fpu_state.swd = sw; + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fist_16) : (x87_timings.fist_16 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fist_16) : (x87_concurrency.fist_16 * cpu_multi)); + return cpu_state.abrt; +} +#endif + +static int +sf_FISTPiw_a16(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + int16_t save_reg = int16_indefinite; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_int16(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) { + goto next_ins; + } + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteaw(save_reg); + if (cpu_state.abrt) + return 1; + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fist_16) : (x87_timings.fist_16 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fist_16) : (x87_concurrency.fist_16 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FISTPiw_a32(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + int16_t save_reg = int16_indefinite; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_int16(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) + goto next_ins; + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteaw(save_reg); + if (cpu_state.abrt) + return 1; + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fist_16) : (x87_timings.fist_16 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fist_16) : (x87_concurrency.fist_16 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FISTil_a16(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + int32_t save_reg = int32_indefinite; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_int32(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) { + goto next_ins; + } + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteal(save_reg); + fpu_state.swd = sw; + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fist_32) : (x87_timings.fist_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fist_32) : (x87_concurrency.fist_32 * cpu_multi)); + return cpu_state.abrt; +} +#ifndef FPU_8087 +static int +sf_FISTil_a32(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + int32_t save_reg = int32_indefinite; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_int32(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) + goto next_ins; + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteal(save_reg); + fpu_state.swd = sw; + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fist_32) : (x87_timings.fist_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fist_32) : (x87_concurrency.fist_32 * cpu_multi)); + return cpu_state.abrt; +} +#endif + +static int +sf_FISTPil_a16(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + int32_t save_reg = int32_indefinite; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_int32(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) { + goto next_ins; + } + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteal(save_reg); + if (cpu_state.abrt) + return 1; + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fist_32) : (x87_timings.fist_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fist_32) : (x87_concurrency.fist_32 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FISTPil_a32(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + int32_t save_reg = int32_indefinite; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_int32(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) + goto next_ins; + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteal(save_reg); + if (cpu_state.abrt) + return 1; + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fist_32) : (x87_timings.fist_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fist_32) : (x87_concurrency.fist_32 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FISTPiq_a16(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + int64_t save_reg = int64_indefinite; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_int64(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) { + goto next_ins; + } + } + // store to the memory might generate an exception, in this case origial FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteaq(save_reg); + if (cpu_state.abrt) + return 1; + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fist_64) : (x87_timings.fist_64 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fist_64) : (x87_concurrency.fist_64 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FISTPiq_a32(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + int64_t save_reg = int64_indefinite; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_int64(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) + goto next_ins; + } + // store to the memory might generate an exception, in this case origial FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteaq(save_reg); + if (cpu_state.abrt) + return 1; + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fist_64) : (x87_timings.fist_64 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fist_64) : (x87_concurrency.fist_64 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FBSTP_PACKED_BCD_a16(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + uint16_t save_reg_hi = 0xffff; + uint64_t save_reg_lo = BX_CONST64(0xC000000000000000); + floatx80 reg; + int64_t save_val; + int sign; + int c; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + reg = FPU_read_regi(0); + save_val = floatx80_to_int64(reg, &status); + sign = (reg.exp & 0x8000) != 0; + if (sign) + save_val = -save_val; + + if (save_val > BX_CONST64(999999999999999999)) + status.float_exception_flags = float_flag_invalid; // throw away other flags + + if (!(status.float_exception_flags & float_flag_invalid)) { + save_reg_hi = sign ? 0x8000 : 0; + save_reg_lo = 0; + for (int i = 0; i < 16; i++) { + save_reg_lo += ((uint64_t)(save_val % 10)) << (4 * i); + save_val /= 10; + } + save_reg_hi += (uint16_t)(save_val % 10); + save_val /= 10; + save_reg_hi += (uint16_t)(save_val % 10) << 4; + } + /* check for fpu arithmetic exceptions */ + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) { + goto next_ins; + } + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + + // write packed bcd to memory + writememq(easeg, cpu_state.eaaddr, save_reg_lo); + writememw(easeg, cpu_state.eaaddr + 8, save_reg_hi); + if (cpu_state.abrt) + return 1; + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fbstp) : (x87_timings.fbstp * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fbstp) : (x87_concurrency.fbstp * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FBSTP_PACKED_BCD_a32(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + uint16_t save_reg_hi = 0xffff; + uint64_t save_reg_lo = BX_CONST64(0xC000000000000000); + floatx80 reg; + int64_t save_val; + int sign; + int c; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + reg = FPU_read_regi(0); + save_val = floatx80_to_int64(reg, &status); + sign = (reg.exp & 0x8000) != 0; + if (sign) + save_val = -save_val; + + if (save_val > BX_CONST64(999999999999999999)) + status.float_exception_flags = float_flag_invalid; // throw away other flags + + if (!(status.float_exception_flags & float_flag_invalid)) { + save_reg_hi = sign ? 0x8000 : 0; + save_reg_lo = 0; + for (int i = 0; i < 16; i++) { + save_reg_lo += ((uint64_t)(save_val % 10)) << (4 * i); + save_val /= 10; + } + save_reg_hi += (uint16_t)(save_val % 10); + save_val /= 10; + save_reg_hi += (uint16_t)(save_val % 10) << 4; + } + /* check for fpu arithmetic exceptions */ + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) { + goto next_ins; + } + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + + // write packed bcd to memory + writememq(easeg, cpu_state.eaaddr, save_reg_lo); + writememw(easeg, cpu_state.eaaddr + 8, save_reg_hi); + if (cpu_state.abrt) + return 1; + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fbstp) : (x87_timings.fbstp * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fbstp) : (x87_concurrency.fbstp * cpu_multi)); + return 0; +} +#endif + +static int +sf_FSTs_a16(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + float32 save_reg = float32_default_nan; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_float32(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) { + goto next_ins; + } + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteal(save_reg); + fpu_state.swd = sw; + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_32) : (x87_timings.fst_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_32) : (x87_concurrency.fst_32 * cpu_multi)); + return cpu_state.abrt; +} +#ifndef FPU_8087 +static int +sf_FSTs_a32(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + float32 save_reg = float32_default_nan; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_float32(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) + goto next_ins; + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteal(save_reg); + fpu_state.swd = sw; + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_32) : (x87_timings.fst_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_32) : (x87_concurrency.fst_32 * cpu_multi)); + return cpu_state.abrt; +} +#endif + +static int +sf_FSTPs_a16(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + float32 save_reg = float32_default_nan; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_float32(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) { + goto next_ins; + } + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteal(save_reg); + if (cpu_state.abrt) { + return 1; + } + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_32) : (x87_timings.fst_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_32) : (x87_concurrency.fst_32 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FSTPs_a32(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + float32 save_reg = float32_default_nan; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_float32(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) + goto next_ins; + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteal(save_reg); + if (cpu_state.abrt) + return 1; + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_32) : (x87_timings.fst_32 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_32) : (x87_concurrency.fst_32 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FSTd_a16(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + float64 save_reg = float64_default_nan; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_float64(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) { + goto next_ins; + } + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteaq(save_reg); + fpu_state.swd = sw; + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_64) : (x87_timings.fst_64 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_64) : (x87_concurrency.fst_64 * cpu_multi)); + return cpu_state.abrt; +} +#ifndef FPU_8087 +static int +sf_FSTd_a32(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + float64 save_reg = float64_default_nan; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_float64(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) + goto next_ins; + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteaq(save_reg); + fpu_state.swd = sw; + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_64) : (x87_timings.fst_64 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_64) : (x87_concurrency.fst_64 * cpu_multi)); + return cpu_state.abrt; +} +#endif + +static int +sf_FSTPd_a16(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + float64 save_reg = float64_default_nan; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) { + goto next_ins; + } + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_float64(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) { + goto next_ins; + } + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteaq(save_reg); + if (cpu_state.abrt) + return 1; + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_64) : (x87_timings.fst_64 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_64) : (x87_concurrency.fst_64 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FSTPd_a32(uint32_t fetchdat) +{ + struct float_status_t status; + uint16_t sw = fpu_state.swd; + float64 save_reg = float64_default_nan; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + save_reg = floatx80_to_float64(FPU_read_regi(0), &status); + if (FPU_exception(fetchdat, status.float_exception_flags, 1)) + goto next_ins; + } + // store to the memory might generate an exception, in this case original FPU_SW must be kept + swap_values16u(sw, fpu_state.swd); + seteaq(save_reg); + if (cpu_state.abrt) + return 1; + fpu_state.swd = sw; + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_64) : (x87_timings.fst_64 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_64) : (x87_concurrency.fst_64 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FSTPe_a16(uint32_t fetchdat) +{ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + floatx80 save_reg; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + if (cpu_state.abrt) + return 1; + save_reg = floatx80_default_nan; + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) { + goto next_ins; + } + } else { + save_reg = FPU_read_regi(0); + } + writememq(easeg, cpu_state.eaaddr, save_reg.fraction); + writememw(easeg, cpu_state.eaaddr + 8, save_reg.exp); + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_80) : (x87_timings.fst_80 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_80) : (x87_concurrency.fst_80 * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FSTPe_a32(uint32_t fetchdat) +{ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + floatx80 save_reg; + + FP_ENTER(); + FPU_check_pending_exceptions(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + if (cpu_state.abrt) + return 1; + save_reg = floatx80_default_nan; + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (!is_IA_masked()) + goto next_ins; + } else { + save_reg = FPU_read_regi(0); + } + writememq(easeg, cpu_state.eaaddr, save_reg.fraction); + writememw(easeg, cpu_state.eaaddr + 8, save_reg.exp); + FPU_pop(); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst_80) : (x87_timings.fst_80 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst_80) : (x87_concurrency.fst_80 * cpu_multi)); + return 0; +} +#endif + +static int +sf_FST_sti(uint32_t fetchdat) +{ + floatx80 st0_reg; + + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 0); + } else { + st0_reg = FPU_read_regi(0); + FPU_save_regi(st0_reg, fetchdat & 7); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst) : (x87_timings.fst * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst) : (x87_concurrency.fst * cpu_multi)); + return 0; +} + +static int +sf_FSTP_sti(uint32_t fetchdat) +{ + floatx80 st0_reg; + + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_stack_underflow(fetchdat, fetchdat & 7, 1); + } else { + st0_reg = FPU_read_regi(0); + FPU_save_regi(st0_reg, fetchdat & 7); + FPU_pop(); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fst) : (x87_timings.fst * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fst) : (x87_concurrency.fst * cpu_multi)); + return 0; +} + +#ifndef FPU_8087 +# define sf_FCMOV(condition) \ + static int sf_FCMOV##condition(uint32_t fetchdat) \ + { \ + FP_ENTER(); \ + FPU_check_pending_exceptions(); \ + cpu_state.pc++; \ + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(fetchdat & 7)) \ + FPU_stack_underflow(fetchdat, 0, 0); \ + else { \ + if (cond_##condition) { \ + FPU_save_regi(FPU_read_regi(fetchdat & 7), 0); \ + } \ + } \ + CLOCK_CYCLES_FPU(4); \ + return 0; \ + } + +# define cond_U (PF_SET()) +# define cond_NU (!PF_SET()) + +// clang-format off +sf_FCMOV(B) +sf_FCMOV(E) +sf_FCMOV(BE) +sf_FCMOV(U) +sf_FCMOV(NB) +sf_FCMOV(NE) +sf_FCMOV(NBE) +sf_FCMOV(NU) +// clang-format on +#endif diff --git a/src/cpu/softfloat/x87_ops_misc.h b/src/cpu/softfloat/x87_ops_misc.h new file mode 100644 index 000000000..d8a3d7368 --- /dev/null +++ b/src/cpu/softfloat/x87_ops_misc.h @@ -0,0 +1,134 @@ +static int +sf_FXCH_sti(uint32_t fetchdat) +{ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + floatx80 st0_reg, sti_reg; + int st0_tag, sti_tag; + + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + st0_tag = FPU_gettagi(0); + sti_tag = FPU_gettagi(fetchdat & 7); + st0_reg = FPU_read_regi(0); + sti_reg = FPU_read_regi(fetchdat & 7); + + clear_C1(); + if ((st0_tag == X87_TAG_EMPTY) || (sti_tag == X87_TAG_EMPTY)) { + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + if (is_IA_masked()) { + /* Masked response */ + if (st0_tag == X87_TAG_EMPTY) + st0_reg = floatx80_default_nan; + if (sti_tag == X87_TAG_EMPTY) + sti_reg = floatx80_default_nan; + } else + goto next_ins; + } + FPU_save_regi(st0_reg, fetchdat & 7); + FPU_save_regi(sti_reg, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fxch) : (x87_timings.fxch * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fxch) : (x87_concurrency.fxch * cpu_multi)); + return 0; +} + +static int +sf_FCHS(uint32_t fetchdat) +{ + floatx80 st0_reg; + floatx80 result; + + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + if (IS_TAG_EMPTY(0)) + FPU_stack_underflow(fetchdat, 0, 0); + else { + clear_C1(); + st0_reg = FPU_read_regi(0); + result = floatx80_chs(st0_reg); + FPU_save_regi(result, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fchs) : (x87_timings.fchs * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fchs) : (x87_concurrency.fchs * cpu_multi)); + return 0; +} + +static int +sf_FABS(uint32_t fetchdat) +{ + floatx80 st0_reg; + floatx80 result; + + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + if (IS_TAG_EMPTY(0)) + FPU_stack_underflow(fetchdat, 0, 0); + else { + clear_C1(); + st0_reg = FPU_read_regi(0); + result = floatx80_abs(st0_reg); + FPU_save_regi(result, 0); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fabs) : (x87_timings.fabs * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fabs) : (x87_concurrency.fabs * cpu_multi)); + return 0; +} + +static int +sf_FDECSTP(uint32_t fetchdat) +{ + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + clear_C1(); + fpu_state.tos = (fpu_state.tos - 1) & 7; + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fincdecstp) : (x87_timings.fincdecstp * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fincdecstp) : (x87_concurrency.fincdecstp * cpu_multi)); + return 0; +} + +static int +sf_FINCSTP(uint32_t fetchdat) +{ + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + clear_C1(); + fpu_state.tos = (fpu_state.tos + 1) & 7; + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fincdecstp) : (x87_timings.fincdecstp * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fincdecstp) : (x87_concurrency.fincdecstp * cpu_multi)); + return 0; +} + +static int +sf_FFREE_sti(uint32_t fetchdat) +{ + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + clear_C1(); + FPU_settagi(X87_TAG_EMPTY, fetchdat & 7); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.ffree) : (x87_timings.ffree * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.ffree) : (x87_concurrency.ffree * cpu_multi)); + return 0; +} + +static int +sf_FFREEP_sti(uint32_t fetchdat) +{ + FP_ENTER(); + FPU_check_pending_exceptions(); + cpu_state.pc++; + clear_C1(); + FPU_settagi(X87_TAG_EMPTY, fetchdat & 7); + if (cpu_state.abrt) + return 1; + FPU_pop(); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.ffree) : (x87_timings.ffree * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.ffree) : (x87_concurrency.ffree * cpu_multi)); + return 0; +} diff --git a/src/cpu/softfloat/x87_ops_other.h b/src/cpu/softfloat/x87_ops_other.h new file mode 100644 index 000000000..4de3b1c90 --- /dev/null +++ b/src/cpu/softfloat/x87_ops_other.h @@ -0,0 +1,593 @@ +static uint32_t +fpu_save_environment(void) +{ + int tag; + unsigned offset; + + /* read all registers in stack order and update x87 tag word */ + for (int n = 0; n < 8; n++) { + // update tag only if it is not empty + if (!IS_TAG_EMPTY(n)) { + tag = FPU_tagof(FPU_read_regi(n)); + FPU_settagi(tag, n); + } + } + + fpu_state.swd = (fpu_state.swd & ~(7 << 11)) | ((fpu_state.tos & 7) << 11); + + switch ((cr0 & 1) | (cpu_state.op32 & 0x100)) { + case 0x000: { /*16-bit real mode*/ + uint16_t tmp; + uint32_t fp_ip, fp_dp; + + fp_ip = ((uint32_t)(fpu_state.fcs << 4)) | fpu_state.fip; + fp_dp = ((uint32_t)(fpu_state.fds << 4)) | fpu_state.fdp; + + tmp = i387_get_control_word(); + writememw(easeg, cpu_state.eaaddr + 0x00, tmp); + tmp = i387_get_status_word(); + writememw(easeg, cpu_state.eaaddr + 0x02, tmp); + tmp = fpu_state.tag; + writememw(easeg, cpu_state.eaaddr + 0x04, tmp); + tmp = fp_ip & 0xffff; + writememw(easeg, cpu_state.eaaddr + 0x06, tmp); + tmp = (uint16_t)((fp_ip & 0xf0000) >> 4) | fpu_state.foo; + writememw(easeg, cpu_state.eaaddr + 0x08, tmp); + tmp = fp_dp & 0xffff; + writememw(easeg, cpu_state.eaaddr + 0x0a, tmp); + tmp = (uint16_t)((fp_dp & 0xf0000) >> 4); + writememw(easeg, cpu_state.eaaddr + 0x0c, tmp); + offset = 0x0e; + } + break; + case 0x001: {/*16-bit protected mode*/ + uint16_t tmp; + tmp = i387_get_control_word(); + writememw(easeg, cpu_state.eaaddr + 0x00, tmp); + tmp = i387_get_status_word(); + writememw(easeg, cpu_state.eaaddr + 0x02, tmp); + tmp = fpu_state.tag; + writememw(easeg, cpu_state.eaaddr + 0x04, tmp); + tmp = (uint16_t)(fpu_state.fip) & 0xffff; + writememw(easeg, cpu_state.eaaddr + 0x06, tmp); + tmp = fpu_state.fcs; + writememw(easeg, cpu_state.eaaddr + 0x08, tmp); + tmp = (uint16_t)(fpu_state.fdp) & 0xffff; + writememw(easeg, cpu_state.eaaddr + 0x0a, tmp); + tmp = fpu_state.fds; + writememw(easeg, cpu_state.eaaddr + 0x0c, tmp); + offset = 0x0e; + } + break; + case 0x100: { /*32-bit real mode*/ + uint32_t tmp, fp_ip, fp_dp; + + fp_ip = ((uint32_t)(fpu_state.fcs << 4)) | fpu_state.fip; + fp_dp = ((uint32_t)(fpu_state.fds << 4)) | fpu_state.fdp; + + tmp = 0xffff0000 | i387_get_control_word(); + writememl(easeg, cpu_state.eaaddr + 0x00, tmp); + tmp = 0xffff0000 | i387_get_status_word(); + writememl(easeg, cpu_state.eaaddr + 0x04, tmp); + tmp = 0xffff0000 | fpu_state.tag; + writememl(easeg, cpu_state.eaaddr + 0x08, tmp); + tmp = 0xffff0000 | (fp_ip & 0xffff); + writememl(easeg, cpu_state.eaaddr + 0x0c, tmp); + tmp = ((fp_ip & 0xffff0000) >> 4) | fpu_state.foo; + writememl(easeg, cpu_state.eaaddr + 0x10, tmp); + tmp = 0xffff0000 | (fp_dp & 0xffff); + writememl(easeg, cpu_state.eaaddr + 0x14, tmp); + tmp = (fp_dp & 0xffff0000) >> 4; + writememl(easeg, cpu_state.eaaddr + 0x18, tmp); + offset = 0x1c; + } + break; + case 0x101: { /*32-bit protected mode*/ + uint32_t tmp; + tmp = 0xffff0000 | i387_get_control_word(); + writememl(easeg, cpu_state.eaaddr + 0x00, tmp); + tmp = 0xffff0000 | i387_get_status_word(); + writememl(easeg, cpu_state.eaaddr + 0x04, tmp); + tmp = 0xffff0000 | fpu_state.tag; + writememl(easeg, cpu_state.eaaddr + 0x08, tmp); + tmp = (uint32_t)(fpu_state.fip); + writememl(easeg, cpu_state.eaaddr + 0x0c, tmp); + tmp = fpu_state.fcs | (((uint32_t)(fpu_state.foo)) << 16); + writememl(easeg, cpu_state.eaaddr + 0x10, tmp); + tmp = (uint32_t)(fpu_state.fdp); + writememl(easeg, cpu_state.eaaddr + 0x14, tmp); + tmp = 0xffff0000 | fpu_state.fds; + writememl(easeg, cpu_state.eaaddr + 0x18, tmp); + offset = 0x1c; + } + break; + } + + return (cpu_state.eaaddr + offset); +} + +static uint32_t +fpu_load_environment(void) +{ + unsigned offset; + + switch ((cr0 & 1) | (cpu_state.op32 & 0x100)) { + case 0x000: { /*16-bit real mode*/ + uint16_t tmp; + uint32_t fp_ip, fp_dp; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x0c); + fp_dp = (tmp & 0xf000) << 4; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x0a); + fpu_state.fdp = fp_dp | tmp; + fpu_state.fds = 0; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x08); + fp_ip = (tmp & 0xf000) << 4; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x06); + fpu_state.fip = fp_ip | tmp; + fpu_state.fcs = 0; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x04); + fpu_state.tag = tmp; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x02); + fpu_state.swd = tmp; + fpu_state.tos = (tmp >> 11) & 7; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x00); + fpu_state.cwd = tmp; + offset = 0x0e; + } + break; + case 0x001: {/*16-bit protected mode*/ + uint16_t tmp; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x0c); + fpu_state.fds = tmp; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x0a); + fpu_state.fdp = tmp; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x08); + fpu_state.fcs = tmp; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x06); + fpu_state.fip = tmp; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x04); + fpu_state.tag = tmp; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x02); + fpu_state.swd = tmp; + fpu_state.tos = (tmp >> 11) & 7; + tmp = readmemw(easeg, cpu_state.eaaddr + 0x00); + fpu_state.cwd = tmp; + offset = 0x0e; + } + break; + case 0x100: { /*32-bit real mode*/ + uint32_t tmp, fp_ip, fp_dp; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x18); + fp_dp = (tmp & 0x0ffff000) << 4; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x14); + fp_dp |= (tmp & 0xffff); + fpu_state.fdp = fp_dp; + fpu_state.fds = 0; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x10); + fpu_state.foo = tmp & 0x07ff; + fp_ip = (tmp & 0x0ffff000) << 4; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x0c); + fp_ip |= (tmp & 0xffff); + fpu_state.fip = fp_ip; + fpu_state.fcs = 0; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x08); + fpu_state.tag = tmp & 0xffff; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x04); + fpu_state.swd = tmp & 0xffff; + fpu_state.tos = (tmp >> 11) & 7; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x00); + fpu_state.cwd = tmp & 0xffff; + offset = 0x1c; + } + break; + case 0x101: { /*32-bit protected mode*/ + uint32_t tmp; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x18); + fpu_state.fds = tmp & 0xffff; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x14); + fpu_state.fdp = tmp; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x10); + fpu_state.fcs = tmp & 0xffff; + fpu_state.foo = (tmp >> 16) & 0x07ff; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x0c); + fpu_state.fip = tmp; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x08); + fpu_state.tag = tmp & 0xffff; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x04); + fpu_state.swd = tmp & 0xffff; + fpu_state.tos = (tmp >> 11) & 7; + tmp = readmeml(easeg, cpu_state.eaaddr + 0x00); + fpu_state.cwd = tmp & 0xffff; + offset = 0x1c; + } + break; + } + + /* always set bit 6 as '1 */ + fpu_state.cwd = (fpu_state.cwd & ~FPU_CW_Reserved_Bits) | 0x0040; + + /* check for unmasked exceptions */ + if (fpu_state.swd & ~fpu_state.cwd & FPU_CW_Exceptions_Mask) { + /* set the B and ES bits in the status-word */ + fpu_state.swd |= (FPU_SW_Summary | FPU_SW_Backward); + } else { + /* clear the B and ES bits in the status-word */ + fpu_state.swd &= ~(FPU_SW_Summary | FPU_SW_Backward); + } + + return (cpu_state.eaaddr + offset); +} + +static int +sf_FLDCW_a16(uint32_t fetchdat) +{ + uint16_t tempw; + + FP_ENTER(); + fetch_ea_16(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + tempw = geteaw(); + if (cpu_state.abrt) + return 1; + fpu_state.cwd = (tempw & ~FPU_CW_Reserved_Bits) | 0x0040; // bit 6 is reserved as '1 + /* check for unmasked exceptions */ + if (fpu_state.swd & (~fpu_state.cwd & FPU_CW_Exceptions_Mask)) { + /* set the B and ES bits in the status-word */ + fpu_state.swd |= (FPU_SW_Summary | FPU_SW_Backward); + } else { + /* clear the B and ES bits in the status-word */ + fpu_state.swd &= ~(FPU_SW_Summary | FPU_SW_Backward); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fldcw) : (x87_timings.fldcw * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fldcw) : (x87_concurrency.fldcw * cpu_multi)); + return 0; +} +#ifndef FPU_8087 +static int +sf_FLDCW_a32(uint32_t fetchdat) +{ + uint16_t tempw; + + FP_ENTER(); + fetch_ea_32(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + tempw = geteaw(); + if (cpu_state.abrt) + return 1; + fpu_state.cwd = (tempw & ~FPU_CW_Reserved_Bits) | 0x0040; // bit 6 is reserved as '1 + /* check for unmasked exceptions */ + if (fpu_state.swd & (~fpu_state.cwd & FPU_CW_Exceptions_Mask)) { + /* set the B and ES bits in the status-word */ + fpu_state.swd |= (FPU_SW_Summary | FPU_SW_Backward); + } else { + /* clear the B and ES bits in the status-word */ + fpu_state.swd &= ~(FPU_SW_Summary | FPU_SW_Backward); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fldcw) : (x87_timings.fldcw * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fldcw) : (x87_concurrency.fldcw * cpu_multi)); + return 0; +} +#endif + +static int +sf_FNSTCW_a16(uint32_t fetchdat) +{ + uint16_t cwd = i387_get_control_word(); + + FP_ENTER(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + seteaw(cwd); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fstcw_sw) : (x87_timings.fstcw_sw * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fstenv) : (x87_concurrency.fstenv * cpu_multi)); + return cpu_state.abrt; +} +#ifndef FPU_8087 +static int +sf_FNSTCW_a32(uint32_t fetchdat) +{ + uint16_t cwd = i387_get_control_word(); + + FP_ENTER(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + seteaw(cwd); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fstcw_sw) : (x87_timings.fstcw_sw * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fstcw_sw) : (x87_concurrency.fstcw_sw * cpu_multi)); + return cpu_state.abrt; +} +#endif + +static int +sf_FNSTSW_a16(uint32_t fetchdat) +{ + uint16_t swd = i387_get_status_word(); + + FP_ENTER(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + seteaw(swd); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fstcw_sw) : (x87_timings.fstcw_sw * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fstcw_sw) : (x87_concurrency.fstcw_sw * cpu_multi)); + return cpu_state.abrt; +} +#ifndef FPU_8087 +static int +sf_FNSTSW_a32(uint32_t fetchdat) +{ + uint16_t swd = i387_get_status_word(); + + FP_ENTER(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + seteaw(swd); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fstcw_sw) : (x87_timings.fstcw_sw * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fstcw_sw) : (x87_concurrency.fstcw_sw * cpu_multi)); + return cpu_state.abrt; +} +#endif + +#ifdef FPU_8087 +static int +sf_FI(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; + fpu_state.cwd &= ~FPU_SW_Summary; + if (rmdat == 0xe1) + fpu_state.cwd |= FPU_SW_Summary; + wait(3, 0); + return 0; +} +#else +static int +sf_FNSTSW_AX(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; + AX = i387_get_status_word(); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fstcw_sw) : (x87_timings.fstcw_sw * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fstcw_sw) : (x87_concurrency.fstcw_sw * cpu_multi)); + return 0; +} +#endif + +static int +sf_FRSTOR_a16(uint32_t fetchdat) +{ + floatx80 tmp; + int offset; + + FP_ENTER(); + fetch_ea_16(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + offset = fpu_load_environment(); + for (int n = 0; n < 8; n++) { + tmp.fraction = readmemq(easeg, offset + (n * 10)); + tmp.exp = readmemw(easeg, offset + (n * 10) + 8); + FPU_save_regi_tag(tmp, IS_TAG_EMPTY(n) ? X87_TAG_EMPTY : FPU_tagof(tmp), n); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.frstor) : (x87_timings.frstor * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.frstor) : (x87_concurrency.frstor * cpu_multi)); + return cpu_state.abrt; +} +#ifndef FPU_8087 +static int +sf_FRSTOR_a32(uint32_t fetchdat) +{ + floatx80 tmp; + int offset; + + FP_ENTER(); + fetch_ea_32(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + offset = fpu_load_environment(); + for (int n = 0; n < 8; n++) { + tmp.fraction = readmemq(easeg, offset + (n * 10)); + tmp.exp = readmemw(easeg, offset + (n * 10) + 8); + FPU_save_regi_tag(tmp, IS_TAG_EMPTY(n) ? X87_TAG_EMPTY : FPU_tagof(tmp), n); + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.frstor) : (x87_timings.frstor * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.frstor) : (x87_concurrency.frstor * cpu_multi)); + return cpu_state.abrt; +} +#endif + +static int +sf_FNSAVE_a16(uint32_t fetchdat) +{ + floatx80 stn; + int offset; + + FP_ENTER(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + offset = fpu_save_environment(); + /* save all registers in stack order. */ + for (int m = 0; m < 8; m++) { + stn = FPU_read_regi(m); + writememq(easeg, offset + (m * 10), stn.fraction); + writememw(easeg, offset + (m * 10) + 8, stn.exp); + } + +#ifdef FPU_8087 + fpu_state.swd = 0x3FF; +#else + fpu_state.cwd = 0x37F; +#endif + fpu_state.swd = 0; + fpu_state.tos = 0; + fpu_state.tag = 0xffff; + cpu_state.ismmx = 0; + fpu_state.foo = 0; + fpu_state.fds = 0; + fpu_state.fdp = 0; + fpu_state.fcs = 0; + fpu_state.fip = 0; + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fsave) : (x87_timings.fsave * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fsave) : (x87_concurrency.fsave * cpu_multi)); + return cpu_state.abrt; +} +#ifndef FPU_8087 +static int +sf_FNSAVE_a32(uint32_t fetchdat) +{ + floatx80 stn; + int offset; + + FP_ENTER(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + offset = fpu_save_environment(); + /* save all registers in stack order. */ + for (int m = 0; m < 8; m++) { + stn = FPU_read_regi(m); + writememq(easeg, offset + (m * 10), stn.fraction); + writememw(easeg, offset + (m * 10) + 8, stn.exp); + } + +#ifdef FPU_8087 + fpu_state.swd = 0x3FF; +#else + fpu_state.cwd = 0x37F; +#endif + fpu_state.swd = 0; + fpu_state.tos = 0; + fpu_state.tag = 0xffff; + cpu_state.ismmx = 0; + fpu_state.foo = 0; + fpu_state.fds = 0; + fpu_state.fdp = 0; + fpu_state.fcs = 0; + fpu_state.fip = 0; + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fsave) : (x87_timings.fsave * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fsave) : (x87_concurrency.fsave * cpu_multi)); + return cpu_state.abrt; +} +#endif + +static int +sf_FNCLEX(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; + fpu_state.swd &= ~(FPU_SW_Backward | FPU_SW_Summary | FPU_SW_Stack_Fault | FPU_SW_Precision | + FPU_SW_Underflow | FPU_SW_Overflow | FPU_SW_Zero_Div | FPU_SW_Denormal_Op | + FPU_SW_Invalid); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fnop) : (x87_timings.fnop * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fnop) : (x87_concurrency.fnop * cpu_multi)); + return 0; +} + +static int +sf_FNINIT(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; +#ifdef FPU_8087 + fpu_state.cwd = 0x3FF; +#else + fpu_state.cwd = 0x37F; +#endif + fpu_state.swd = 0; + fpu_state.tos = 0; + fpu_state.tag = 0xffff; + fpu_state.foo = 0; + fpu_state.fds = 0; + fpu_state.fdp = 0; + fpu_state.fcs = 0; + fpu_state.fip = 0; + cpu_state.ismmx = 0; + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.finit) : (x87_timings.finit * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.finit) : (x87_concurrency.finit * cpu_multi)); + CPU_BLOCK_END(); + return 0; +} + +static int +sf_FLDENV_a16(uint32_t fetchdat) +{ + int tag; + + FP_ENTER(); + fetch_ea_16(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + fpu_load_environment(); + /* read all registers in stack order and update x87 tag word */ + for (int n = 0; n < 8; n++) { + // update tag only if it is not empty + if (!IS_TAG_EMPTY(n)) { + tag = FPU_tagof(FPU_read_regi(n)); + FPU_settagi(tag, n); + } + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fldenv) : (x87_timings.fldenv * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fldenv) : (x87_concurrency.fldenv * cpu_multi)); + return cpu_state.abrt; +} +#ifndef FPU_8087 +static int +sf_FLDENV_a32(uint32_t fetchdat) +{ + int tag; + + FP_ENTER(); + fetch_ea_32(fetchdat); + SEG_CHECK_READ(cpu_state.ea_seg); + fpu_load_environment(); + /* read all registers in stack order and update x87 tag word */ + for (int n = 0; n < 8; n++) { + // update tag only if it is not empty + if (!IS_TAG_EMPTY(n)) { + tag = FPU_tagof(FPU_read_regi(n)); + FPU_settagi(tag, n); + } + } + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fldenv) : (x87_timings.fldenv * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fldenv) : (x87_concurrency.fldenv * cpu_multi)); + return cpu_state.abrt; +} +#endif + +static int +sf_FNSTENV_a16(uint32_t fetchdat) +{ + FP_ENTER(); + fetch_ea_16(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + fpu_save_environment(); + /* mask all floating point exceptions */ + fpu_state.cwd |= FPU_CW_Exceptions_Mask; + /* clear the B and ES bits in the status word */ + fpu_state.swd &= ~(FPU_SW_Backward|FPU_SW_Summary); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fstenv) : (x87_timings.fstenv * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fstenv) : (x87_concurrency.fstenv * cpu_multi)); + return cpu_state.abrt; +} +#ifndef FPU_8087 +static int +sf_FNSTENV_a32(uint32_t fetchdat) +{ + FP_ENTER(); + fetch_ea_32(fetchdat); + SEG_CHECK_WRITE(cpu_state.ea_seg); + fpu_save_environment(); + /* mask all floating point exceptions */ + fpu_state.cwd |= FPU_CW_Exceptions_Mask; + /* clear the B and ES bits in the status word */ + fpu_state.swd &= ~(FPU_SW_Backward|FPU_SW_Summary); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fstenv) : (x87_timings.fstenv * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fstenv) : (x87_concurrency.fstenv * cpu_multi)); + return cpu_state.abrt; +} +#endif + +static int +sf_FNOP(uint32_t fetchdat) +{ + FP_ENTER(); + cpu_state.pc++; + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fnop) : (x87_timings.fnop * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fnop) : (x87_concurrency.fnop * cpu_multi)); + return 0; +} diff --git a/src/cpu/softfloat/x87_ops_trans.h b/src/cpu/softfloat/x87_ops_trans.h new file mode 100644 index 000000000..7ecbbe4ec --- /dev/null +++ b/src/cpu/softfloat/x87_ops_trans.h @@ -0,0 +1,418 @@ +static int +sf_F2XM1(uint32_t fetchdat) +{ + floatx80 result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word() | FPU_PR_80_BITS); + result = f2xm1(FPU_read_regi(0), &status); + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_save_regi(result, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.f2xm1) : (x87_timings.f2xm1 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.f2xm1) : (x87_concurrency.f2xm1 * cpu_multi)); + return 0; +} + +static int +sf_FYL2X(uint32_t fetchdat) +{ + floatx80 result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(1)) { + FPU_stack_underflow(fetchdat, 1, 1); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word() | FPU_PR_80_BITS); + result = fyl2x(FPU_read_regi(0), FPU_read_regi(1), &status); + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_pop(); + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fyl2x) : (x87_timings.fyl2x * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fyl2x) : (x87_concurrency.fyl2x * cpu_multi)); + return 0; +} + +static int +sf_FPTAN(uint32_t fetchdat) +{ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + floatx80 y; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + clear_C2(); + if (IS_TAG_EMPTY(0) || !IS_TAG_EMPTY(-1)) { + if (IS_TAG_EMPTY(0)) + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + else + FPU_exception(fetchdat, FPU_EX_Stack_Overflow, 0); + + /* The masked response */ + if (is_IA_masked()) { + FPU_save_regi(floatx80_default_nan, 0); + FPU_push(); + FPU_save_regi(floatx80_default_nan, 0); + } + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word() | FPU_PR_80_BITS); + y = FPU_read_regi(0); + if (ftan(&y, &status) == -1) { + fpu_state.swd |= C2; + goto next_ins; + } + + if (floatx80_is_nan(y)) { + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(y, 0); + FPU_push(); + FPU_save_regi(y, 0); + } + goto next_ins; + } + + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(y, 0); + FPU_push(); + FPU_save_regi(Const_1, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fptan) : (x87_timings.fptan * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fptan) : (x87_concurrency.fptan * cpu_multi)); + return 0; +} + +static int +sf_FPATAN(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(1)) { + FPU_stack_underflow(fetchdat, 1, 1); + goto next_ins; + } + a = FPU_read_regi(0); + b = FPU_read_regi(1); + status = i387cw_to_softfloat_status_word(i387_get_control_word() | FPU_PR_80_BITS); + result = fpatan(a, b, &status); + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_pop(); + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fpatan) : (x87_timings.fpatan * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fpatan) : (x87_concurrency.fpatan * cpu_multi)); + return 0; +} + +static int +sf_FXTRACT(uint32_t fetchdat) +{ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + struct float_status_t status; + floatx80 a, b; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + +#if 0 //TODO + if ((IS_TAG_EMPTY(0) || IS_TAG_EMPTY(-1))) { + if (IS_TAG_EMPTY(0)) + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + else + FPU_exception(fetchdat, FPU_EX_Stack_Overflow, 0); + + /* The masked response */ + if (is_IA_masked()) { + FPU_save_regi(floatx80_default_nan, 0); + FPU_push(); + FPU_save_regi(floatx80_default_nan, 0); + } + goto next_ins; + } +#endif + + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = floatx80_extract(&a, &status); + if (!FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(b, 0); // exponent + FPU_push(); + FPU_save_regi(a, 0); // fraction + } + +#if 0 //TODO. +next_ins: +#endif + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fxtract) : (x87_timings.fxtract * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fxtract) : (x87_concurrency.fxtract * cpu_multi)); + return 0; +} + +static int +sf_FPREM1(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + uint64_t quotient = 0; + int flags, cc; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + clear_C2(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(1)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(1); + flags = floatx80_ieee754_remainder(a, b, &result, "ient, &status); + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) { + if (flags >= 0) { + cc = 0; + if (flags) + cc = C2; + else { + if (quotient & 1) + cc |= C1; + if (quotient & 2) + cc |= C3; + if (quotient & 4) + cc |= C0; + } + setcc(cc); + } + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fprem1) : (x87_timings.fprem1 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fprem1) : (x87_concurrency.fprem1 * cpu_multi)); + return 0; +} + +static int +sf_FPREM(uint32_t fetchdat) +{ + floatx80 a, b, result; + struct float_status_t status; + uint64_t quotient = 0; + int flags, cc; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + clear_C2(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(1)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + a = FPU_read_regi(0); + b = FPU_read_regi(1); + // handle unsupported extended double-precision floating encodings + flags = floatx80_remainder(a, b, &result, "ient, &status); + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) { + if (flags >= 0) { + cc = 0; + if (flags) + cc = C2; + else { + if (quotient & 1) + cc |= C1; + if (quotient & 2) + cc |= C3; + if (quotient & 4) + cc |= C0; + } + setcc(cc); + } + FPU_save_regi(result, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fprem) : (x87_timings.fprem * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fprem) : (x87_concurrency.fprem * cpu_multi)); + return 0; +} + +static int +sf_FYL2XP1(uint32_t fetchdat) +{ + floatx80 result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(1)) { + FPU_stack_underflow(fetchdat, 1, 1); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word() | FPU_PR_80_BITS); + result = fyl2xp1(FPU_read_regi(0), FPU_read_regi(1), &status); + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(result, 1); + FPU_pop(); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fyl2xp1) : (x87_timings.fyl2xp1 * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fyl2xp1) : (x87_concurrency.fyl2xp1 * cpu_multi)); + return 0; +} + +#ifndef FPU_8087 +static int +sf_FSINCOS(uint32_t fetchdat) +{ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + struct float_status_t status; + floatx80 y, sin_y, cos_y; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + clear_C2(); + if (IS_TAG_EMPTY(0) || !IS_TAG_EMPTY(-1)) { + if (IS_TAG_EMPTY(0)) + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); + else + FPU_exception(fetchdat, FPU_EX_Stack_Overflow, 0); + + /* The masked response */ + if (is_IA_masked()) { + FPU_save_regi(floatx80_default_nan, 0); + FPU_push(); + FPU_save_regi(floatx80_default_nan, 0); + } + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word() | FPU_PR_80_BITS); + y = FPU_read_regi(0); + if (fsincos(y, &sin_y, &cos_y, &status) == -1) { + fpu_state.swd |= C2; + goto next_ins; + } + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) { + FPU_save_regi(sin_y, 0); + FPU_push(); + FPU_save_regi(cos_y, 0); + } + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fsincos) : (x87_timings.fsincos * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fsincos) : (x87_concurrency.fsincos * cpu_multi)); + return 0; +} +#endif + +static int +sf_FSCALE(uint32_t fetchdat) +{ + floatx80 result; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + if (IS_TAG_EMPTY(0) || IS_TAG_EMPTY(1)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word()); + result = floatx80_scale(FPU_read_regi(0), FPU_read_regi(1), &status); + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_save_regi(result, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fscale) : (x87_timings.fscale * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fscale) : (x87_concurrency.fscale * cpu_multi)); + return 0; +} + +#ifndef FPU_8087 +static int +sf_FSIN(uint32_t fetchdat) +{ + floatx80 y; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + clear_C2(); + if (IS_TAG_EMPTY(0)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word() | FPU_PR_80_BITS); + y = FPU_read_regi(0); + if (fsin(&y, &status) == -1) { + fpu_state.swd |= C2; + goto next_ins; + } + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_save_regi(y, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fsin_cos) : (x87_timings.fsin_cos * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fsin_cos) : (x87_concurrency.fsin_cos * cpu_multi)); + return 0; +} + +static int +sf_FCOS(uint32_t fetchdat) +{ + floatx80 y; + struct float_status_t status; + + FP_ENTER(); + cpu_state.pc++; + clear_C1(); + clear_C2(); + if (IS_TAG_EMPTY(0)) { + FPU_stack_underflow(fetchdat, 0, 0); + goto next_ins; + } + status = i387cw_to_softfloat_status_word(i387_get_control_word() | FPU_PR_80_BITS); + y = FPU_read_regi(0); + if (fcos(&y, &status) == -1) { + fpu_state.swd |= C2; + goto next_ins; + } + if (! FPU_exception(fetchdat, status.float_exception_flags, 0)) + FPU_save_regi(y, 0); + +next_ins: + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fsin_cos) : (x87_timings.fsin_cos * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fsin_cos) : (x87_concurrency.fsin_cos * cpu_multi)); + return 0; +} +#endif diff --git a/src/cpu/x86_ops.h b/src/cpu/x86_ops.h index ca4d83d69..9d34c71ec 100644 --- a/src/cpu/x86_ops.h +++ b/src/cpu/x86_ops.h @@ -151,6 +151,7 @@ extern const OpFn dynarec_ops_3DNOWE[256]; void x86_setopcodes(const OpFn *opcodes, const OpFn *opcodes_0f); #endif + extern const OpFn *x86_opcodes; extern const OpFn *x86_opcodes_0f; extern const OpFn *x86_opcodes_d8_a16; @@ -205,6 +206,38 @@ extern const OpFn ops_pentiumpro_0f[1024]; extern const OpFn ops_pentium2_0f[1024]; extern const OpFn ops_pentium2d_0f[1024]; +extern const OpFn ops_sf_fpu_287_d9_a16[256]; +extern const OpFn ops_sf_fpu_287_d9_a32[256]; +extern const OpFn ops_sf_fpu_287_da_a16[256]; +extern const OpFn ops_sf_fpu_287_da_a32[256]; +extern const OpFn ops_sf_fpu_287_db_a16[256]; +extern const OpFn ops_sf_fpu_287_db_a32[256]; +extern const OpFn ops_sf_fpu_287_dc_a16[32]; +extern const OpFn ops_sf_fpu_287_dc_a32[32]; +extern const OpFn ops_sf_fpu_287_dd_a16[256]; +extern const OpFn ops_sf_fpu_287_dd_a32[256]; +extern const OpFn ops_sf_fpu_287_de_a16[256]; +extern const OpFn ops_sf_fpu_287_de_a32[256]; +extern const OpFn ops_sf_fpu_287_df_a16[256]; +extern const OpFn ops_sf_fpu_287_df_a32[256]; + +extern const OpFn ops_sf_fpu_d8_a16[32]; +extern const OpFn ops_sf_fpu_d8_a32[32]; +extern const OpFn ops_sf_fpu_d9_a16[256]; +extern const OpFn ops_sf_fpu_d9_a32[256]; +extern const OpFn ops_sf_fpu_da_a16[256]; +extern const OpFn ops_sf_fpu_da_a32[256]; +extern const OpFn ops_sf_fpu_db_a16[256]; +extern const OpFn ops_sf_fpu_db_a32[256]; +extern const OpFn ops_sf_fpu_dc_a16[32]; +extern const OpFn ops_sf_fpu_dc_a32[32]; +extern const OpFn ops_sf_fpu_dd_a16[256]; +extern const OpFn ops_sf_fpu_dd_a32[256]; +extern const OpFn ops_sf_fpu_de_a16[256]; +extern const OpFn ops_sf_fpu_de_a32[256]; +extern const OpFn ops_sf_fpu_df_a16[256]; +extern const OpFn ops_sf_fpu_df_a32[256]; + extern const OpFn ops_fpu_287_d9_a16[256]; extern const OpFn ops_fpu_287_d9_a32[256]; extern const OpFn ops_fpu_287_da_a16[256]; @@ -239,6 +272,13 @@ extern const OpFn ops_fpu_df_a32[256]; extern const OpFn ops_nofpu_a16[256]; extern const OpFn ops_nofpu_a32[256]; +extern const OpFn ops_sf_fpu_686_da_a16[256]; +extern const OpFn ops_sf_fpu_686_da_a32[256]; +extern const OpFn ops_sf_fpu_686_db_a16[256]; +extern const OpFn ops_sf_fpu_686_db_a32[256]; +extern const OpFn ops_sf_fpu_686_df_a16[256]; +extern const OpFn ops_sf_fpu_686_df_a32[256]; + extern const OpFn ops_fpu_686_da_a16[256]; extern const OpFn ops_fpu_686_da_a32[256]; extern const OpFn ops_fpu_686_db_a16[256]; diff --git a/src/cpu/x86_ops_fpu.h b/src/cpu/x86_ops_fpu.h index 314ec321b..502218be5 100644 --- a/src/cpu/x86_ops_fpu.h +++ b/src/cpu/x86_ops_fpu.h @@ -96,6 +96,15 @@ opWAIT(uint32_t fetchdat) x86_int(7); return 1; } + + if (!cpu_use_dynarec && fpu_softfloat) { + if (fpu_state.swd & FPU_SW_Summary) { + if (cr0 & 0x20) { + x86_int(16); + return 1; + } + } + } CLOCK_CYCLES(4); return 0; } diff --git a/src/cpu/x87.c b/src/cpu/x87.c index 0b93af9da..98ceb105b 100644 --- a/src/cpu/x87.c +++ b/src/cpu/x87.c @@ -15,6 +15,7 @@ #include "x86_ops.h" #include "x87.h" #include "386_common.h" +#include "softfloat/softfloat-specialize.h" uint32_t x87_pc_off, x87_op_off; uint16_t x87_pc_seg, x87_op_seg; @@ -37,11 +38,6 @@ fpu_log(const char *fmt, ...) # define fpu_log(fmt, ...) #endif -#define X87_TAG_VALID 0 -#define X87_TAG_ZERO 1 -#define X87_TAG_INVALID 2 -#define X87_TAG_EMPTY 3 - #ifdef USE_NEW_DYNAREC uint16_t x87_gettag(void) @@ -110,6 +106,340 @@ x87_settag(uint16_t new_tag) } #endif + +static floatx80 +FPU_handle_NaN32_Func(floatx80 a, int aIsNaN, float32 b32, int bIsNaN, struct float_status_t *status) +{ + int aIsSignalingNaN = floatx80_is_signaling_nan(a); + int bIsSignalingNaN = float32_is_signaling_nan(b32); + + if (aIsSignalingNaN | bIsSignalingNaN) + float_raise(status, float_flag_invalid); + + // propagate QNaN to SNaN + a = propagateFloatx80NaNOne(a, status); + + if (aIsNaN & !bIsNaN) return a; + + // float32 is NaN so conversion will propagate SNaN to QNaN and raise + // appropriate exception flags + floatx80 b = float32_to_floatx80(b32, status); + + if (aIsSignalingNaN) { + if (bIsSignalingNaN) goto returnLargerSignificand; + return bIsNaN ? b : a; + } + else if (aIsNaN) { + if (bIsSignalingNaN) return a; + returnLargerSignificand: + if (a.fraction < b.fraction) return b; + if (b.fraction < a.fraction) return a; + return (a.exp < b.exp) ? a : b; + } + else { + return b; + } +} + +int +FPU_handle_NaN32(floatx80 a, float32 b, floatx80 *r, struct float_status_t *status) +{ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + if (floatx80_is_unsupported(a)) { + float_raise(status, float_flag_invalid); + *r = floatx80_default_nan; + return 1; + } + + int aIsNaN = floatx80_is_nan(a), bIsNaN = float32_is_nan(b); + if (aIsNaN | bIsNaN) { + *r = FPU_handle_NaN32_Func(a, aIsNaN, b, bIsNaN, status); + return 1; + } + return 0; +} + +static floatx80 +FPU_handle_NaN64_Func(floatx80 a, int aIsNaN, float64 b64, int bIsNaN, struct float_status_t *status) +{ + int aIsSignalingNaN = floatx80_is_signaling_nan(a); + int bIsSignalingNaN = float64_is_signaling_nan(b64); + + if (aIsSignalingNaN | bIsSignalingNaN) + float_raise(status, float_flag_invalid); + + // propagate QNaN to SNaN + a = propagateFloatx80NaNOne(a, status); + + if (aIsNaN & !bIsNaN) return a; + + // float64 is NaN so conversion will propagate SNaN to QNaN and raise + // appropriate exception flags + floatx80 b = float64_to_floatx80(b64, status); + + if (aIsSignalingNaN) { + if (bIsSignalingNaN) goto returnLargerSignificand; + return bIsNaN ? b : a; + } + else if (aIsNaN) { + if (bIsSignalingNaN) return a; + returnLargerSignificand: + if (a.fraction < b.fraction) return b; + if (b.fraction < a.fraction) return a; + return (a.exp < b.exp) ? a : b; + } + else { + return b; + } +} + +int +FPU_handle_NaN64(floatx80 a, float64 b, floatx80 *r, struct float_status_t *status) +{ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + if (floatx80_is_unsupported(a)) { + float_raise(status, float_flag_invalid); + *r = floatx80_default_nan; + return 1; + } + + int aIsNaN = floatx80_is_nan(a), bIsNaN = float64_is_nan(b); + if (aIsNaN | bIsNaN) { + *r = FPU_handle_NaN64_Func(a, aIsNaN, b, bIsNaN, status); + return 1; + } + return 0; +} + +struct float_status_t +i387cw_to_softfloat_status_word(uint16_t control_word) +{ + struct float_status_t status; + int precision = control_word & FPU_CW_PC; + + switch (precision) { + case FPU_PR_32_BITS: + status.float_rounding_precision = 32; + break; + case FPU_PR_64_BITS: + status.float_rounding_precision = 64; + break; + case FPU_PR_80_BITS: + status.float_rounding_precision = 80; + break; + default: + /* With the precision control bits set to 01 "(reserved)", a + real CPU behaves as if the precision control bits were + set to 11 "80 bits" */ + status.float_rounding_precision = 80; + break; + } + + status.float_exception_flags = 0; // clear exceptions before execution + status.float_nan_handling_mode = float_first_operand_nan; + status.float_rounding_mode = (control_word & FPU_CW_RC) >> 10; + status.flush_underflow_to_zero = 0; + status.float_suppress_exception = 0; + status.float_exception_masks = control_word & FPU_CW_Exceptions_Mask; + status.denormals_are_zeros = 0; + return status; +} + + +int +FPU_status_word_flags_fpu_compare(int float_relation) +{ + switch (float_relation) { + case float_relation_unordered: + return (C0 | C2 | C3); + + case float_relation_greater: + return (0); + + case float_relation_less: + return (C0); + + case float_relation_equal: + return (C3); + } + + return (-1); // should never get here +} + +void +FPU_write_eflags_fpu_compare(int float_relation) +{ + switch (float_relation) { + case float_relation_unordered: + cpu_state.flags |= (Z_FLAG | P_FLAG | C_FLAG); + break; + + case float_relation_greater: + break; + + case float_relation_less: + cpu_state.flags |= (C_FLAG); + break; + + case float_relation_equal: + cpu_state.flags |= (Z_FLAG); + break; + + default: + break; + } +} + +uint16_t +FPU_exception(uint32_t fetchdat, uint16_t exceptions, int store) +{ + uint16_t status; + uint16_t unmasked; + + /* Extract only the bits which we use to set the status word */ + exceptions &= FPU_SW_Exceptions_Mask; + status = fpu_state.swd; + + unmasked = (exceptions & ~fpu_state.cwd) & FPU_CW_Exceptions_Mask; + + // if IE or DZ exception happen nothing else will be reported + if (exceptions & (FPU_EX_Invalid | FPU_EX_Zero_Div)) { + unmasked &= (FPU_EX_Invalid | FPU_EX_Zero_Div); + } + + /* Set summary bits if exception isn't masked */ + if (unmasked) { + fpu_state.swd |= (FPU_SW_Summary | FPU_SW_Backward); + } + + if (exceptions & FPU_EX_Invalid) { + // FPU_EX_Invalid cannot come with any other exception but x87 stack fault + fpu_state.swd |= exceptions; + if (exceptions & FPU_SW_Stack_Fault) { + if (!(exceptions & C1)) { + /* This bit distinguishes over- from underflow for a stack fault, + and roundup from round-down for precision loss. */ + fpu_state.swd &= ~C1; + } + } + return unmasked; + } + + if (exceptions & FPU_EX_Zero_Div) { + fpu_state.swd |= FPU_EX_Zero_Div; + if (!(fpu_state.cwd & FPU_EX_Zero_Div)) { +#ifdef FPU_8087 + if (!(fpu_state.cwd & FPU_SW_Summary)) { + fpu_state.cwd |= FPU_SW_Summary; + nmi = 1; + } +#else + picint(1 << 13); +#endif // FPU_8087 + } + return unmasked; + } + + if (exceptions & FPU_EX_Denormal) { + fpu_state.swd |= FPU_EX_Denormal; + if (unmasked & FPU_EX_Denormal) { + return (unmasked & FPU_EX_Denormal); + } + } + + /* Set the corresponding exception bits */ + fpu_state.swd |= exceptions; + + if (exceptions & FPU_EX_Precision) { + if (!(exceptions & C1)) { + /* This bit distinguishes over- from underflow for a stack fault, + and roundup from round-down for precision loss. */ + fpu_state.swd &= ~C1; + } + } + + // If #P unmasked exception occurred the result still has to be + // written to the destination. + unmasked &= ~FPU_EX_Precision; + + if (unmasked & (FPU_EX_Underflow | FPU_EX_Overflow)) { + // If unmasked over- or underflow occurs and dest is a memory location: + // - the TOS and destination operands remain unchanged + // - the inexact-result condition is not reported and C1 flag is cleared + // - no result is stored in the memory + // If the destination is in the register stack, adjusted resulting value + // is stored in the destination operand. + if (!store) + unmasked &= ~(FPU_EX_Underflow | FPU_EX_Overflow); + else { + fpu_state.swd &= ~C1; + if (!(status & FPU_EX_Precision)) + fpu_state.swd &= ~FPU_EX_Precision; + } + } + return unmasked; +} + +void +FPU_stack_overflow(uint32_t fetchdat) +{ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + /* The masked response */ + if (is_IA_masked()) { + FPU_push(); + FPU_save_regi(floatx80_default_nan, 0); + } + FPU_exception(fetchdat, FPU_EX_Stack_Overflow, 0); +} + +void +FPU_stack_underflow(uint32_t fetchdat, int stnr, int pop_stack) +{ + const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); + + /* The masked response */ + if (is_IA_masked()) { + FPU_save_regi(floatx80_default_nan, stnr); + if (pop_stack) + FPU_pop(); + } + FPU_exception(fetchdat, FPU_EX_Stack_Underflow, 0); +} + +/* ----------------------------------------------------------- + * Slimmed down version used to compile against a CPU simulator + * rather than a kernel (ported by Kevin Lawton) + * ------------------------------------------------------------ */ +int +FPU_tagof(const floatx80 reg) +{ + int32_t exp = floatx80_exp(reg); + if (exp == 0) { + if (!floatx80_fraction(reg)) + return X87_TAG_ZERO; + + /* The number is a de-normal or pseudodenormal. */ + return X87_TAG_INVALID; + } + + if (exp == 0x7fff) { + /* Is an Infinity, a NaN, or an unsupported data type. */ + return X87_TAG_INVALID; + } + + if (!(reg.fraction & BX_CONST64(0x8000000000000000))) { + /* Unsupported data type. */ + /* Valid numbers have the ms bit set to 1. */ + return X87_TAG_INVALID; + } + + return X87_TAG_VALID; +} + + #ifdef ENABLE_808X_LOG void x87_dumpregs(void) diff --git a/src/cpu/x87.h b/src/cpu/x87.h index 96ad835c8..5d460bc4b 100644 --- a/src/cpu/x87.h +++ b/src/cpu/x87.h @@ -1,7 +1,7 @@ -#define C0 (1 << 8) -#define C1 (1 << 9) -#define C2 (1 << 10) -#define C3 (1 << 14) +#define X87_TAG_VALID 0 +#define X87_TAG_ZERO 1 +#define X87_TAG_INVALID 2 +#define X87_TAG_EMPTY 3 extern uint32_t x87_pc_off, x87_op_off; extern uint16_t x87_pc_seg, x87_op_seg; @@ -46,3 +46,184 @@ void x87_settag(uint16_t new_tag); #define X87_ROUNDING_CHOP 3 void codegen_set_rounding_mode(int mode); + +/* Status Word */ +#define FPU_SW_Backward (0x8000) /* backward compatibility */ +#define FPU_SW_C3 (0x4000) /* condition bit 3 */ +#define FPU_SW_Top (0x3800) /* top of stack */ +#define FPU_SW_C2 (0x0400) /* condition bit 2 */ +#define FPU_SW_C1 (0x0200) /* condition bit 1 */ +#define FPU_SW_C0 (0x0100) /* condition bit 0 */ +#define FPU_SW_Summary (0x0080) /* exception summary */ +#define FPU_SW_Stack_Fault (0x0040) /* stack fault */ +#define FPU_SW_Precision (0x0020) /* loss of precision */ +#define FPU_SW_Underflow (0x0010) /* underflow */ +#define FPU_SW_Overflow (0x0008) /* overflow */ +#define FPU_SW_Zero_Div (0x0004) /* divide by zero */ +#define FPU_SW_Denormal_Op (0x0002) /* denormalized operand */ +#define FPU_SW_Invalid (0x0001) /* invalid operation */ + +#define C0 (1 << 8) +#define C1 (1 << 9) +#define C2 (1 << 10) +#define C3 (1 << 14) + +#define FPU_SW_CC (C0 | C1 | C2 | C3) + +#define FPU_SW_Exceptions_Mask (0x027f) /* status word exceptions bit mask */ + +/* Exception flags: */ +#define FPU_EX_Precision (0x0020) /* loss of precision */ +#define FPU_EX_Underflow (0x0010) /* underflow */ +#define FPU_EX_Overflow (0x0008) /* overflow */ +#define FPU_EX_Zero_Div (0x0004) /* divide by zero */ +#define FPU_EX_Denormal (0x0002) /* denormalized operand */ +#define FPU_EX_Invalid (0x0001) /* invalid operation */ + +/* Special exceptions: */ +#define FPU_EX_Stack_Overflow (0x0041| C1) /* stack overflow */ +#define FPU_EX_Stack_Underflow (0x0041) /* stack underflow */ + +/* precision control */ +#define FPU_EX_Precision_Lost_Up (EX_Precision | C1) +#define FPU_EX_Precision_Lost_Dn (EX_Precision) + +#define setcc(cc) \ + fpu_state.swd = (fpu_state.swd & ~(FPU_SW_CC)) | ((cc) & FPU_SW_CC) + +#define clear_C1() { fpu_state.swd &= ~C1; } +#define clear_C2() { fpu_state.swd &= ~C2; } + +/* ************ */ +/* Control Word */ +/* ************ */ + +#define FPU_CW_Inf (0x1000) /* infinity control, legacy */ + +#define FPU_CW_RC (0x0C00) /* rounding control */ +#define FPU_CW_PC (0x0300) /* precision control */ + +#define FPU_RC_RND (0x0000) /* rounding control */ +#define FPU_RC_DOWN (0x0400) +#define FPU_RC_UP (0x0800) +#define FPU_RC_CHOP (0x0C00) + +#define FPU_CW_Precision (0x0020) /* loss of precision mask */ +#define FPU_CW_Underflow (0x0010) /* underflow mask */ +#define FPU_CW_Overflow (0x0008) /* overflow mask */ +#define FPU_CW_Zero_Div (0x0004) /* divide by zero mask */ +#define FPU_CW_Denormal (0x0002) /* denormalized operand mask */ +#define FPU_CW_Invalid (0x0001) /* invalid operation mask */ + +#define FPU_CW_Exceptions_Mask (0x003f) /* all masks */ + +/* Precision control bits affect only the following: + ADD, SUB(R), MUL, DIV(R), and SQRT */ +#define FPU_PR_32_BITS (0x000) +#define FPU_PR_RESERVED_BITS (0x100) +#define FPU_PR_64_BITS (0x200) +#define FPU_PR_80_BITS (0x300) + +#include "softfloat/softfloatx80.h" + +static __inline const int +is_IA_masked(void) +{ + return (fpu_state.cwd & FPU_CW_Invalid); +} + +struct float_status_t i387cw_to_softfloat_status_word(uint16_t control_word); +uint16_t FPU_exception(uint32_t fetchdat, uint16_t exceptions, int store); +int FPU_status_word_flags_fpu_compare(int float_relation); +void FPU_write_eflags_fpu_compare(int float_relation); +void FPU_stack_overflow(uint32_t fetchdat); +void FPU_stack_underflow(uint32_t fetchdat, int stnr, int pop_stack); +int FPU_handle_NaN32(floatx80 a, float32 b, floatx80 *r, struct float_status_t *status); +int FPU_handle_NaN64(floatx80 a, float64 b, floatx80 *r, struct float_status_t *status); +int FPU_tagof(const floatx80 reg); + +static __inline uint16_t +i387_get_control_word(void) +{ + return (fpu_state.cwd); +} + +static __inline uint16_t +i387_get_status_word(void) +{ + return (fpu_state.swd & ~FPU_SW_Top & 0xFFFF) | ((fpu_state.tos << 11) & FPU_SW_Top); +} + +#define IS_TAG_EMPTY(i) \ + (FPU_gettagi(i) == X87_TAG_EMPTY) + +static __inline int +FPU_gettagi(int stnr) +{ + return (fpu_state.tag >> (((stnr + fpu_state.tos) & 7) * 2)) & 3; +} + +static __inline void +FPU_settagi_valid(int stnr) +{ + int regnr = (stnr + fpu_state.tos) & 7; + fpu_state.tag &= ~(3 << (regnr * 2)); // FPU_Tag_Valid == '00 +} + +static __inline void +FPU_settagi(int tag, int stnr) +{ + int regnr = (stnr + fpu_state.tos) & 7; + fpu_state.tag &= ~(3 << (regnr * 2)); + fpu_state.tag |= (tag & 3) << (regnr * 2); +} + +static __inline void +FPU_push(void) +{ + fpu_state.tos = (fpu_state.tos - 1) & 7; +} + +static __inline void +FPU_pop(void) +{ + fpu_state.tag |= 3 << (fpu_state.tos * 2); + fpu_state.tos = (fpu_state.tos + 1) & 7; +} + +static __inline floatx80 +FPU_read_regi(int stnr) +{ + return fpu_state.st_space[(stnr + fpu_state.tos) & 7]; +} + +// it is only possible to read FPU tag word through certain +// instructions like FNSAVE, and they update tag word to its +// real value anyway +static __inline void +FPU_save_regi(floatx80 reg, int stnr) +{ + fpu_state.st_space[(stnr + fpu_state.tos) & 7] = reg; + FPU_settagi_valid(stnr); +} + +static __inline void +FPU_save_regi_tag(floatx80 reg, int tag, int stnr) +{ + fpu_state.st_space[(stnr + fpu_state.tos) & 7] = reg; + FPU_settagi(tag, stnr); +} + + +#define FPU_check_pending_exceptions() \ +do { \ + if (fpu_state.swd & FPU_SW_Summary) { \ + if (cr0 & 0x20) { \ + x86_int(16); \ + return 1; \ + } else { \ + picint(1 << 13); \ + return 1; \ + } \ + } \ +} while (0) diff --git a/src/cpu/x87_ops.h b/src/cpu/x87_ops.h index b2b082107..0ab6b2e68 100644 --- a/src/cpu/x87_ops.h +++ b/src/cpu/x87_ops.h @@ -26,6 +26,7 @@ #ifdef _MSC_VER # include #endif +#include "x87_ops_conv.h" #ifdef ENABLE_FPU_LOG extern void fpu_log(const char *fmt, ...); @@ -44,6 +45,11 @@ static int rounding_modes[4] = { FE_TONEAREST, FE_DOWNWARD, FE_UPWARD, FE_TOWARD #define C2 (1 << 10) #define C3 (1 << 14) +#define X87_TAG_VALID 0 +#define X87_TAG_ZERO 1 +#define X87_TAG_INVALID 2 +#define X87_TAG_EMPTY 3 + #define STATUS_ZERODIVIDE 4 typedef union @@ -250,8 +256,6 @@ x87_fround(double b) return 0LL; } -#include "x87_ops_conv.h" - static __inline double x87_ld80(void) { @@ -477,6 +481,13 @@ typedef union { # define FP_TAG_VALID_N cpu_state.tag[(cpu_state.TOP + 1) & 7] &= ~TAG_UINT64 #endif +#include "softfloat/x87_ops_arith.h" +#include "softfloat/x87_ops_compare.h" +#include "softfloat/x87_ops_const.h" +#include "softfloat/x87_ops_load_store.h" +#include "softfloat/x87_ops_misc.h" +#include "softfloat/x87_ops_trans.h" +#include "softfloat/x87_ops_other.h" #include "x87_ops_arith.h" #include "x87_ops_misc.h" #include "x87_ops_loadstore.h" @@ -537,6 +548,264 @@ FPU_ILLEGAL_a32(uint32_t fetchdat) #define ILLEGAL_a16 FPU_ILLEGAL_a16 #ifdef FPU_8087 +const OpFn OP_TABLE(sf_fpu_8087_d8)[32] = { + // clang-format off + sf_FADDs_a16, sf_FMULs_a16, sf_FCOMs_a16, sf_FCOMPs_a16, sf_FSUBs_a16, sf_FSUBRs_a16, sf_FDIVs_a16, sf_FDIVRs_a16, + sf_FADDs_a16, sf_FMULs_a16, sf_FCOMs_a16, sf_FCOMPs_a16, sf_FSUBs_a16, sf_FSUBRs_a16, sf_FDIVs_a16, sf_FDIVRs_a16, + sf_FADDs_a16, sf_FMULs_a16, sf_FCOMs_a16, sf_FCOMPs_a16, sf_FSUBs_a16, sf_FSUBRs_a16, sf_FDIVs_a16, sf_FDIVRs_a16, + sf_FADD_st0_stj, sf_FMUL_st0_stj, sf_FCOM_sti, sf_FCOMP_sti, sf_FSUB_st0_stj, sf_FSUBR_st0_stj, sf_FDIV_st0_stj, sf_FDIVR_st0_stj, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_8087_d9)[256] = { + // clang-format off + sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, + sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, + sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, + sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, + sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, + sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, + + sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, + sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, + sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, + sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, + sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, + sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, + + sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, + sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, + sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, + sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, + sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, + sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, + + sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, + sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, + sf_FNOP, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, /*Invalid*/ + sf_FCHS, sf_FABS, ILLEGAL_a16, ILLEGAL_a16, sf_FTST, sf_FXAM, ILLEGAL_a16, ILLEGAL_a16, + sf_FLD1, sf_FLDL2T, sf_FLDL2E, sf_FLDPI, sf_FLDEG2, sf_FLDLN2, sf_FLDZ, ILLEGAL_a16, + sf_F2XM1, sf_FYL2X, sf_FPTAN, sf_FPATAN, sf_FXTRACT, sf_FPREM1, sf_FDECSTP, sf_FINCSTP, + sf_FPREM, sf_FYL2XP1, sf_FSQRT, ILLEGAL_a16, sf_FRNDINT, sf_FSCALE, ILLEGAL_a16, ILLEGAL_a16 + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_8087_da)[256] = { + // clang-format off + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_8087_db)[256] = { + // clang-format off + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FI, sf_FI, sf_FNCLEX, sf_FNINIT, ILLEGAL_a16, sf_FNOP, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_8087_dc)[32] = { + // clang-format off + sf_FADDd_a16, sf_FMULd_a16, sf_FCOMd_a16, sf_FCOMPd_a16, sf_FSUBd_a16, sf_FSUBRd_a16, sf_FDIVd_a16, sf_FDIVRd_a16, + sf_FADDd_a16, sf_FMULd_a16, sf_FCOMd_a16, sf_FCOMPd_a16, sf_FSUBd_a16, sf_FSUBRd_a16, sf_FDIVd_a16, sf_FDIVRd_a16, + sf_FADDd_a16, sf_FMULd_a16, sf_FCOMd_a16, sf_FCOMPd_a16, sf_FSUBd_a16, sf_FSUBRd_a16, sf_FDIVd_a16, sf_FDIVRd_a16, + sf_FADD_sti_st0, sf_FMUL_sti_st0, ILLEGAL_a16, ILLEGAL_a16, sf_FSUBR_sti_st0, sf_FSUB_sti_st0, sf_FDIVR_sti_st0, sf_FDIV_sti_st0, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_8087_dd)[256] = { + // clang-format off + sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, + sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, + sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, + sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, + + sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, + sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, + sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, + sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, + + sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, + sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, + sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, + sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, + + sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_8087_de)[256] = { + // clang-format off + sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, + sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, + sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, + sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, + sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, + sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, + sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, + sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, + + sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, + sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, + sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, + sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, + sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, + sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, + sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, + sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, + + sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, + sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, + sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, + sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, + sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, + sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, + sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, + sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, + + sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, + sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, sf_FCOMPP, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, + sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, + sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, + sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_8087_df)[256] = { + // clang-format off + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + const OpFn OP_TABLE(fpu_8087_d8)[32] = { // clang-format off opFADDs_a16, opFMULs_a16, opFCOMs_a16, opFCOMPs_a16, opFSUBs_a16, opFSUBRs_a16, opFDIVs_a16, opFDIVRs_a16, @@ -581,7 +850,7 @@ const OpFn OP_TABLE(fpu_8087_d9)[256] = { ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a16, ILLEGAL_a16, opFTST, opFXAM, ILLEGAL_a16, ILLEGAL_a16, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a16, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, ILLEGAL_a16, opFRNDINT, opFSCALE, ILLEGAL_a16, ILLEGAL_a16 // clang-format on }; @@ -797,6 +1066,1260 @@ const OpFn OP_TABLE(fpu_8087_df)[256] = { #else # define ILLEGAL_a32 FPU_ILLEGAL_a32 + +const OpFn OP_TABLE(sf_fpu_d8_a16)[32] = { + // clang-format off + sf_FADDs_a16, sf_FMULs_a16, sf_FCOMs_a16, sf_FCOMPs_a16, sf_FSUBs_a16, sf_FSUBRs_a16, sf_FDIVs_a16, sf_FDIVRs_a16, + sf_FADDs_a16, sf_FMULs_a16, sf_FCOMs_a16, sf_FCOMPs_a16, sf_FSUBs_a16, sf_FSUBRs_a16, sf_FDIVs_a16, sf_FDIVRs_a16, + sf_FADDs_a16, sf_FMULs_a16, sf_FCOMs_a16, sf_FCOMPs_a16, sf_FSUBs_a16, sf_FSUBRs_a16, sf_FDIVs_a16, sf_FDIVRs_a16, + sf_FADD_st0_stj, sf_FMUL_st0_stj, sf_FCOM_sti, sf_FCOMP_sti, sf_FSUB_st0_stj, sf_FSUBR_st0_stj, sf_FDIV_st0_stj, sf_FDIVR_st0_stj, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_d8_a32)[32] = { + // clang-format off + sf_FADDs_a32, sf_FMULs_a32, sf_FCOMs_a32, sf_FCOMPs_a32, sf_FSUBs_a32, sf_FSUBRs_a32, sf_FDIVs_a32, sf_FDIVRs_a32, + sf_FADDs_a32, sf_FMULs_a32, sf_FCOMs_a32, sf_FCOMPs_a32, sf_FSUBs_a32, sf_FSUBRs_a32, sf_FDIVs_a32, sf_FDIVRs_a32, + sf_FADDs_a32, sf_FMULs_a32, sf_FCOMs_a32, sf_FCOMPs_a32, sf_FSUBs_a32, sf_FSUBRs_a32, sf_FDIVs_a32, sf_FDIVRs_a32, + sf_FADD_st0_stj, sf_FMUL_st0_stj, sf_FCOM_sti, sf_FCOMP_sti, sf_FSUB_st0_stj, sf_FSUBR_st0_stj, sf_FDIV_st0_stj, sf_FDIVR_st0_stj, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_d9_a16)[256] = { + // clang-format off + sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, + sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, + sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, + sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, + sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, + sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, + + sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, + sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, + sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, + sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, + sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, + sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, + + sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, + sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, + sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, + sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, + sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, + sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, + + sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, + sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, + sf_FNOP, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, /*Invalid*/ + sf_FCHS, sf_FABS, ILLEGAL_a16, ILLEGAL_a16, sf_FTST, sf_FXAM, ILLEGAL_a16, ILLEGAL_a16, + sf_FLD1, sf_FLDL2T, sf_FLDL2E, sf_FLDPI, sf_FLDEG2, sf_FLDLN2, sf_FLDZ, ILLEGAL_a16, + sf_F2XM1, sf_FYL2X, sf_FPTAN, sf_FPATAN, sf_FXTRACT, sf_FPREM1, sf_FDECSTP, sf_FINCSTP, + sf_FPREM, sf_FYL2XP1, sf_FSQRT, sf_FSINCOS, sf_FRNDINT, sf_FSCALE, sf_FSIN, sf_FCOS, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_d9_a32)[256] = { + // clang-format off + sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, + sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, + sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, + sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, + sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, + sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, + + sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, + sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, + sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, + sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, + sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, + sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, + + sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, + sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, + sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, + sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, + sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, + sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, + + sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, + sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, + sf_FNOP, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, /*Invalid*/ + sf_FCHS, sf_FABS, ILLEGAL_a32, ILLEGAL_a32, sf_FTST, sf_FXAM, ILLEGAL_a32, ILLEGAL_a32, + sf_FLD1, sf_FLDL2T, sf_FLDL2E, sf_FLDPI, sf_FLDEG2, sf_FLDLN2, sf_FLDZ, ILLEGAL_a32, + sf_F2XM1, sf_FYL2X, sf_FPTAN, sf_FPATAN, sf_FXTRACT, sf_FPREM1, sf_FDECSTP, sf_FINCSTP, + sf_FPREM, sf_FYL2XP1, sf_FSQRT, sf_FSINCOS, sf_FRNDINT, sf_FSCALE, sf_FSIN, sf_FCOS, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_d9_a16)[256] = { + // clang-format off + sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, + sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, + sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, + sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, + sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, + sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, + + sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, + sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, + sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, + sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, + sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, + sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, + + sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, sf_FLDs_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, sf_FSTs_a16, + sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, sf_FSTPs_a16, + sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, sf_FLDENV_a16, + sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, sf_FLDCW_a16, + sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, sf_FNSTENV_a16, + sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, sf_FNSTCW_a16, + + sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, + sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, + sf_FNOP, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, /*Invalid*/ + sf_FCHS, sf_FABS, ILLEGAL_a16, ILLEGAL_a16, sf_FTST, sf_FXAM, ILLEGAL_a16, ILLEGAL_a16, + sf_FLD1, sf_FLDL2T, sf_FLDL2E, sf_FLDPI, sf_FLDEG2, sf_FLDLN2, sf_FLDZ, ILLEGAL_a16, + sf_F2XM1, sf_FYL2X, sf_FPTAN, sf_FPATAN, sf_FXTRACT, sf_FPREM1, sf_FDECSTP, sf_FINCSTP, + sf_FPREM, sf_FYL2XP1, sf_FSQRT, sf_FSINCOS, sf_FRNDINT, sf_FSCALE, sf_FSIN, sf_FCOS, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_d9_a32)[256] = { + // clang-format off + sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, + sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, + sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, + sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, + sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, + sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, + + sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, + sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, + sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, + sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, + sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, + sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, + + sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, sf_FLDs_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, sf_FSTs_a32, + sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, sf_FSTPs_a32, + sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, sf_FLDENV_a32, + sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, sf_FLDCW_a32, + sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, sf_FNSTENV_a32, + sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, sf_FNSTCW_a32, + + sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, sf_FLD_sti, + sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, + sf_FNOP, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, /*Invalid*/ + sf_FCHS, sf_FABS, ILLEGAL_a32, ILLEGAL_a32, sf_FTST, sf_FXAM, ILLEGAL_a32, ILLEGAL_a32, + sf_FLD1, sf_FLDL2T, sf_FLDL2E, sf_FLDPI, sf_FLDEG2, sf_FLDLN2, sf_FLDZ, ILLEGAL_a32, + sf_F2XM1, sf_FYL2X, sf_FPTAN, sf_FPATAN, sf_FXTRACT, sf_FPREM1, sf_FDECSTP, sf_FINCSTP, + sf_FPREM, sf_FYL2XP1, sf_FSQRT, sf_FSINCOS, sf_FRNDINT, sf_FSCALE, sf_FSIN, sf_FCOS, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_da_a16)[256] = { + // clang-format off + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_da_a32)[256] = { + // clang-format off + sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, + sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, + sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, + sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, + sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, + sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, + sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, + sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, + + sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, + sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, + sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, + sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, + sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, + sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, + sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, + sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, + + sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, + sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, + sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, + sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, + sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, + sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, + sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, + sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, + + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_da_a16)[256] = { + // clang-format off + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, sf_FUCOMPP, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_da_a32)[256] = { + // clang-format off + sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, + sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, + sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, + sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, + sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, + sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, + sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, + sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, + + sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, + sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, + sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, + sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, + sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, + sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, + sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, + sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, + + sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, + sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, + sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, + sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, + sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, + sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, + sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, + sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, + + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, sf_FUCOMPP, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_686_da_a16)[256] = { + // clang-format off + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, sf_FADDil_a16, + sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, sf_FMULil_a16, + sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, sf_FCOMil_a16, + sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, sf_FCOMPil_a16, + sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, sf_FSUBil_a16, + sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, sf_FSUBRil_a16, + sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, sf_FDIVil_a16, + sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, sf_FDIVRil_a16, + + sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, + sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, + sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, + sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, sf_FUCOMPP, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_686_da_a32)[256] = { + // clang-format off + sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, + sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, + sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, + sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, + sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, + sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, + sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, + sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, + + sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, + sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, + sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, + sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, + sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, + sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, + sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, + sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, + + sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, sf_FADDil_a32, + sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, sf_FMULil_a32, + sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, sf_FCOMil_a32, + sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, sf_FCOMPil_a32, + sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, sf_FSUBil_a32, + sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, sf_FSUBRil_a32, + sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, sf_FDIVil_a32, + sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, sf_FDIVRil_a32, + + sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, sf_FCMOVB, + sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, sf_FCMOVE, + sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, sf_FCMOVBE, + sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, sf_FCMOVU, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, sf_FUCOMPP, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_db_a16)[256] = { + // clang-format off + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNOP, sf_FNOP, sf_FNCLEX, sf_FNINIT, sf_FNOP, sf_FNOP, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_db_a32)[256] = { + // clang-format off + sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, + sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, + + sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, + sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, + + sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, + sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, + + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FNOP, sf_FNOP, sf_FNCLEX, sf_FNINIT, sf_FNOP, sf_FNOP, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_db_a16)[256] = { + // clang-format off + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNOP, sf_FNOP, sf_FNCLEX, sf_FNINIT, sf_FNOP, sf_FNOP, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_db_a32)[256] = { + // clang-format off + sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, + sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, + + sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, + sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, + + sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, + sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, + + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FNOP, sf_FNOP, sf_FNCLEX, sf_FNINIT, sf_FNOP, sf_FNOP, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_686_db_a16)[256] = { + // clang-format off + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, sf_FILDil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, sf_FISTil_a16, + sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, sf_FISTPil_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, sf_FLDe_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, sf_FSTPe_a16, + + sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, + sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, + sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, + sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, + sf_FNOP, sf_FNOP, sf_FNCLEX, sf_FNINIT, sf_FNOP, sf_FNOP, ILLEGAL_a16, ILLEGAL_a16, + sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, + sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; +const OpFn OP_TABLE(sf_fpu_686_db_a32)[256] = { + // clang-format off + sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, + sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, + + sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, + sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, + + sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, sf_FILDil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, sf_FISTil_a32, + sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, sf_FISTPil_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, sf_FLDe_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, sf_FSTPe_a32, + + sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, sf_FCMOVNB, + sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, sf_FCMOVNE, + sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, sf_FCMOVNBE, + sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, sf_FCMOVNU, + sf_FNOP, sf_FNOP, sf_FNCLEX, sf_FNINIT, sf_FNOP, sf_FNOP, ILLEGAL_a32, ILLEGAL_a32, + sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, sf_FUCOMI_st0_stj, + sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, sf_FCOMI_st0_stj, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_dc_a16)[32] = { + // clang-format off + sf_FADDd_a16, sf_FMULd_a16, sf_FCOMd_a16, sf_FCOMPd_a16, sf_FSUBd_a16, sf_FSUBRd_a16, sf_FDIVd_a16, sf_FDIVRd_a16, + sf_FADDd_a16, sf_FMULd_a16, sf_FCOMd_a16, sf_FCOMPd_a16, sf_FSUBd_a16, sf_FSUBRd_a16, sf_FDIVd_a16, sf_FDIVRd_a16, + sf_FADDd_a16, sf_FMULd_a16, sf_FCOMd_a16, sf_FCOMPd_a16, sf_FSUBd_a16, sf_FSUBRd_a16, sf_FDIVd_a16, sf_FDIVRd_a16, + sf_FADD_sti_st0, sf_FMUL_sti_st0, ILLEGAL_a16, ILLEGAL_a16, sf_FSUBR_sti_st0, sf_FSUB_sti_st0, sf_FDIVR_sti_st0, sf_FDIV_sti_st0, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_dc_a32)[32] = { + // clang-format off + sf_FADDd_a32, sf_FMULd_a32, sf_FCOMd_a32, sf_FCOMPd_a32, sf_FSUBd_a32, sf_FSUBRd_a32, sf_FDIVd_a32, sf_FDIVRd_a32, + sf_FADDd_a32, sf_FMULd_a32, sf_FCOMd_a32, sf_FCOMPd_a32, sf_FSUBd_a32, sf_FSUBRd_a32, sf_FDIVd_a32, sf_FDIVRd_a32, + sf_FADDd_a32, sf_FMULd_a32, sf_FCOMd_a32, sf_FCOMPd_a32, sf_FSUBd_a32, sf_FSUBRd_a32, sf_FDIVd_a32, sf_FDIVRd_a32, + sf_FADD_sti_st0, sf_FMUL_sti_st0, ILLEGAL_a32, ILLEGAL_a32, sf_FSUBR_sti_st0, sf_FSUB_sti_st0, sf_FDIVR_sti_st0, sf_FDIV_sti_st0, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_dc_a16)[32] = { + // clang-format off + sf_FADDd_a16, sf_FMULd_a16, sf_FCOMd_a16, sf_FCOMPd_a16, sf_FSUBd_a16, sf_FSUBRd_a16, sf_FDIVd_a16, sf_FDIVRd_a16, + sf_FADDd_a16, sf_FMULd_a16, sf_FCOMd_a16, sf_FCOMPd_a16, sf_FSUBd_a16, sf_FSUBRd_a16, sf_FDIVd_a16, sf_FDIVRd_a16, + sf_FADDd_a16, sf_FMULd_a16, sf_FCOMd_a16, sf_FCOMPd_a16, sf_FSUBd_a16, sf_FSUBRd_a16, sf_FDIVd_a16, sf_FDIVRd_a16, + sf_FADD_sti_st0, sf_FMUL_sti_st0, sf_FCOM_sti, sf_FCOMP_sti, sf_FSUBR_sti_st0, sf_FSUB_sti_st0, sf_FDIVR_sti_st0, sf_FDIV_sti_st0, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_dc_a32)[32] = { + // clang-format off + sf_FADDd_a32, sf_FMULd_a32, sf_FCOMd_a32, sf_FCOMPd_a32, sf_FSUBd_a32, sf_FSUBRd_a32, sf_FDIVd_a32, sf_FDIVRd_a32, + sf_FADDd_a32, sf_FMULd_a32, sf_FCOMd_a32, sf_FCOMPd_a32, sf_FSUBd_a32, sf_FSUBRd_a32, sf_FDIVd_a32, sf_FDIVRd_a32, + sf_FADDd_a32, sf_FMULd_a32, sf_FCOMd_a32, sf_FCOMPd_a32, sf_FSUBd_a32, sf_FSUBRd_a32, sf_FDIVd_a32, sf_FDIVRd_a32, + sf_FADD_sti_st0, sf_FMUL_sti_st0, sf_FCOM_sti, sf_FCOMP_sti, sf_FSUBR_sti_st0, sf_FSUB_sti_st0, sf_FDIVR_sti_st0, sf_FDIV_sti_st0, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_dd_a16)[256] = { + // clang-format off + sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, + sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, + sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, + sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, + + sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, + sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, + sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, + sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, + + sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, + sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, + sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, + sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, + + sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_dd_a32)[256] = { + // clang-format off + sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, + sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, + sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, + sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, + + sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, + sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, + sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, + sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, + + sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, + sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, + sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, + sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, + + sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_dd_a16)[256] = { + // clang-format off + sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, + sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, + sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, + sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, + + sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, + sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, + sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, + sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, + + sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, sf_FLDd_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, sf_FSTd_a16, + sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, sf_FSTPd_a16, + sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, sf_FRSTOR_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, sf_FNSAVE_a16, + sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, sf_FNSTSW_a16, + + sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, + sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, + sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, + sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_dd_a32)[256] = { + // clang-format off + sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, + sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, + sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, + sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, + + sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, + sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, + sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, + sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, + + sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, sf_FLDd_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, sf_FSTd_a32, + sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, sf_FSTPd_a32, + sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, sf_FRSTOR_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, sf_FNSAVE_a32, + sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, sf_FNSTSW_a32, + + sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, sf_FFREE_sti, + sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, + sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, sf_FST_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, sf_FUCOM_sti, + sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, sf_FUCOMP_sti, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_de_a16)[256] = { + // clang-format off + sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, + sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, + sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, + sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, + sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, + sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, + sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, + sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, + + sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, + sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, + sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, + sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, + sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, + sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, + sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, + sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, + + sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, + sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, + sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, + sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, + sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, + sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, + sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, + sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, + + sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, + sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, sf_FCOMPP, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, + sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, + sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, + sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_de_a32)[256] = { + // clang-format off + sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, + sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, + sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, + sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, + sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, + sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, + sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, + sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, + + sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, + sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, + sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, + sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, + sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, + sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, + sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, + sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, + + sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, + sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, + sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, + sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, + sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, + sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, + sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, + sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, + + sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, + sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, sf_FCOMPP, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, + sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, + sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, + sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_de_a16)[256] = { + // clang-format off + sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, + sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, + sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, + sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, + sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, + sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, + sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, + sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, + + sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, + sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, + sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, + sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, + sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, + sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, + sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, + sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, + + sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, sf_FADDiw_a16, + sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, sf_FMULiw_a16, + sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, sf_FCOMiw_a16, + sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, sf_FCOMPiw_a16, + sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, sf_FSUBiw_a16, + sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, sf_FSUBRiw_a16, + sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, sf_FDIViw_a16, + sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, sf_FDIVRiw_a16, + + sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, + sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, + sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, + ILLEGAL_a16, sf_FCOMPP, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, + sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, + sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, + sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_de_a32)[256] = { + // clang-format off + sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, + sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, + sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, + sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, + sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, + sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, + sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, + sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, + + sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, + sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, + sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, + sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, + sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, + sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, + sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, + sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, + + sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, sf_FADDiw_a32, + sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, sf_FMULiw_a32, + sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, sf_FCOMiw_a32, + sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, sf_FCOMPiw_a32, + sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, sf_FSUBiw_a32, + sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, sf_FSUBRiw_a32, + sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, sf_FDIViw_a32, + sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, sf_FDIVRiw_a32, + + sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, sf_FADDP_sti_st0, + sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, sf_FMULP_sti_st0, + sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, sf_FCOMP_sti, + ILLEGAL_a32, sf_FCOMPP, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, sf_FSUBRP_sti_st0, + sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, sf_FSUBP_sti_st0, + sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, sf_FDIVRP_sti_st0, + sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, sf_FDIVP_sti_st0, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_df_a16)[256] = { + // clang-format off + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FNSTSW_AX, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_287_df_a32)[256] = { + // clang-format off + sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, + sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, + sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, + sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, + + sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, + sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, + sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, + sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, + + sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, + sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, + sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, + sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, + + sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FNSTSW_AX, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_df_a16)[256] = { + // clang-format off + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, + sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + sf_FNSTSW_AX, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_df_a32)[256] = { + // clang-format off + sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, + sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, + sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, + sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, + + sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, + sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, + sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, + sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, + + sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, + sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, + sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, + sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, + + sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, + sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + sf_FNSTSW_AX, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_686_df_a16)[256] = { + // clang-format off + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, sf_FILDiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, sf_FISTiw_a16, + sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, sf_FISTPiw_a16, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, sf_FILDiq_a16, + sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, sf_FBSTP_PACKED_BCD_a16, + sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, sf_FISTPiq_a16, + + sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, + sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + sf_FNSTSW_AX, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, + sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, + ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, + // clang-format on +}; + +const OpFn OP_TABLE(sf_fpu_686_df_a32)[256] = { + // clang-format off + sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, + sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, + sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, + sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, + + sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, + sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, + sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, + sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, + + sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, sf_FILDiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, sf_FISTiw_a32, + sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, sf_FISTPiw_a32, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, sf_FILDiq_a32, + sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, sf_FBSTP_PACKED_BCD_a32, + sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, sf_FISTPiq_a32, + + sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, sf_FFREEP_sti, + sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, sf_FXCH_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, sf_FSTP_sti, + sf_FNSTSW_AX, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, sf_FUCOMIP_st0_stj, + sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, sf_FCOMIP_st0_stj, + ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, + // clang-format on +}; + const OpFn OP_TABLE(fpu_d8_a16)[32] = { // clang-format off opFADDs_a16, opFMULs_a16, opFCOMs_a16, opFCOMPs_a16, opFSUBs_a16, opFSUBRs_a16, opFDIVs_a16, opFDIVRs_a16, @@ -850,7 +2373,7 @@ const OpFn OP_TABLE(fpu_287_d9_a16)[256] = { ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a16, ILLEGAL_a16, opFTST, opFXAM, ILLEGAL_a16, ILLEGAL_a16, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a16, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, opFSINCOS, opFRNDINT, opFSCALE, opFSIN, opFCOS // clang-format on }; @@ -890,7 +2413,7 @@ const OpFn OP_TABLE(fpu_287_d9_a32)[256] = { ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a32, ILLEGAL_a32, opFTST, opFXAM, ILLEGAL_a32, ILLEGAL_a32, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a32, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, ILLEGAL_a32, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, opFSINCOS, opFRNDINT, opFSCALE, opFSIN, opFCOS // clang-format on }; @@ -930,7 +2453,7 @@ const OpFn OP_TABLE(fpu_d9_a16)[256] = { opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a16, ILLEGAL_a16, opFTST, opFXAM, ILLEGAL_a16, ILLEGAL_a16, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a16, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, opFSINCOS, opFRNDINT, opFSCALE, opFSIN, opFCOS // clang-format on }; @@ -970,7 +2493,7 @@ const OpFn OP_TABLE(fpu_d9_a32)[256] = { opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a32, ILLEGAL_a32, opFTST, opFXAM, ILLEGAL_a32, ILLEGAL_a32, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a32, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, ILLEGAL_a32, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, opFSINCOS, opFRNDINT, opFSCALE, opFSIN, opFCOS // clang-format on }; diff --git a/src/cpu/x87_ops_misc.h b/src/cpu/x87_ops_misc.h index 3a528f847..e21819f94 100644 --- a/src/cpu/x87_ops_misc.h +++ b/src/cpu/x87_ops_misc.h @@ -33,20 +33,6 @@ opFNOP(uint32_t fetchdat) return 0; } -static int -opFXTRACT(uint32_t fetchdat) -{ - double_decompose_t temp = (double_decompose_t) ST(0); - - FP_ENTER(); - cpu_state.pc++; - ST(0) = (double) temp.exponent; - x87_push((double) temp.mantissa); - CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fxtract) : (x87_timings.fxtract * cpu_multi)); - CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fxtract) : (x87_concurrency.fxtract * cpu_multi)); - return 0; -} - static int opFCLEX(uint32_t fetchdat) { @@ -511,6 +497,20 @@ opFCHS(uint32_t fetchdat) return 0; } +static int +opFXTRACT(uint32_t fetchdat) +{ + double_decompose_t temp = (double_decompose_t) ST(0); + + FP_ENTER(); + cpu_state.pc++; + ST(0) = (double) temp.exponent; + x87_push((double) temp.mantissa); + CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fxtract) : (x87_timings.fxtract * cpu_multi)); + CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fxtract) : (x87_concurrency.fxtract * cpu_multi)); + return 0; +} + static int opFABS(uint32_t fetchdat) { @@ -755,6 +755,7 @@ opFPREM(uint32_t fetchdat) CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fprem) : (x87_concurrency.fprem * cpu_multi)); return 0; } + static int opFPREM1(uint32_t fetchdat) { diff --git a/src/include/86box/86box.h b/src/include/86box/86box.h index a4c0a5761..d472a3e03 100644 --- a/src/include/86box/86box.h +++ b/src/include/86box/86box.h @@ -129,7 +129,8 @@ extern uint32_t mem_size; /* (C) memory size (Installed on system board) extern uint32_t isa_mem_size; /* (C) memory size (ISA Memory Cards) */ extern int cpu, /* (C) cpu type */ cpu_use_dynarec, /* (C) cpu uses/needs Dyna */ - fpu_type; /* (C) fpu type */ + fpu_type, /* (C) fpu type */ + fpu_softfloat; /* (C) fpu uses softfloat */ extern int time_sync; /* (C) enable time sync */ extern int hdd_format_type; /* (C) hard disk file format */ extern int confirm_reset, /* (C) enable reset confirmation */ diff --git a/src/qt/qt_settingsmachine.cpp b/src/qt/qt_settingsmachine.cpp index e08b07997..2794af71b 100644 --- a/src/qt/qt_settingsmachine.cpp +++ b/src/qt/qt_settingsmachine.cpp @@ -105,6 +105,8 @@ SettingsMachine::save() cpu = ui->comboBoxSpeed->currentData().toInt(); fpu_type = ui->comboBoxFPU->currentData().toInt(); cpu_use_dynarec = ui->checkBoxDynamicRecompiler->isChecked() ? 1 : 0; + fpu_softfloat = (ui->checkBoxFPUSoftfloat->isChecked() && !cpu_use_dynarec) ? 1 : 0; + int64_t temp_mem_size; if (machine_get_ram_granularity(machine) < 1024) { temp_mem_size = ui->spinBoxRAM->value(); @@ -270,13 +272,22 @@ SettingsMachine::on_comboBoxSpeed_currentIndexChanged(int index) if (!(flags & CPU_SUPPORTS_DYNAREC)) { ui->checkBoxDynamicRecompiler->setChecked(false); ui->checkBoxDynamicRecompiler->setEnabled(false); + ui->checkBoxFPUSoftfloat->setChecked(fpu_softfloat); + ui->checkBoxFPUSoftfloat->setEnabled(cpu_use_dynarec ? false : true); } else if (flags & CPU_REQUIRES_DYNAREC) { ui->checkBoxDynamicRecompiler->setChecked(true); ui->checkBoxDynamicRecompiler->setEnabled(false); + ui->checkBoxFPUSoftfloat->setChecked(false); + ui->checkBoxFPUSoftfloat->setEnabled(false); } else { ui->checkBoxDynamicRecompiler->setChecked(cpu_use_dynarec); ui->checkBoxDynamicRecompiler->setEnabled(true); + ui->checkBoxFPUSoftfloat->setChecked(fpu_softfloat); + ui->checkBoxFPUSoftfloat->setEnabled(cpu_use_dynarec ? false : true); } +#else + ui->checkBoxFPUSoftfloat->setChecked(fpu_softfloat); + ui->checkBoxFPUSoftfloat->setEnabled(true); #endif // win_settings_machine_recalc_fpu diff --git a/src/qt/qt_settingsmachine.ui b/src/qt/qt_settingsmachine.ui index d5ff1ca59..ee8a048f4 100644 --- a/src/qt/qt_settingsmachine.ui +++ b/src/qt/qt_settingsmachine.ui @@ -200,6 +200,19 @@ + + + + + 3 + 3 + + + + Softfloat FPU + + + diff --git a/src/win/Makefile.mingw b/src/win/Makefile.mingw index 3725e6e09..b2e2ddf0b 100644 --- a/src/win/Makefile.mingw +++ b/src/win/Makefile.mingw @@ -241,7 +241,7 @@ PROG := 86Box ######################################################################### # Nothing should need changing from here on.. # ######################################################################### -VPATH := $(EXPATH) . $(CODEGEN) minitrace cpu \ +VPATH := $(EXPATH) . $(CODEGEN) minitrace cpu cpu/softfloat \ cdrom chipset device disk disk/minivhd floppy \ game machine mem printer \ sio sound \ @@ -551,7 +551,9 @@ CPUOBJ := $(DYNARECOBJ) \ $(CGTOBJ) \ cpu.o cpu_table.o fpu.o x86.o \ 8080.o 808x.o 386.o 386_common.o 386_dynarec.o 386_dynarec_ops.o \ - x86seg.o x87.o x87_timings.o + x86seg.o x87.o x87_timings.o \ + f2xm1.o fpatan.o fprem.o fsincos.o fyl2x.o poly.o softfloat.o softfloat16.o \ + softfloat-muladd.o softfloat-round-pack.o softfloat-specialize.o softfloatx80.o CHIPSETOBJ := 82c100.o acc2168.o \ contaq_82c59x.o \ From 7e90e9215aebd3f87ed7d10c30179f21c96d2eef Mon Sep 17 00:00:00 2001 From: Cacodemon345 Date: Sun, 30 Apr 2023 00:59:11 +0600 Subject: [PATCH 35/60] OHCI: HcHCCA's lower 8 bits are always zero Start of work on USB endpoint device infrastructure --- src/include/86box/usb.h | 8 ++++++++ src/usb.c | 2 ++ 2 files changed, 10 insertions(+) diff --git a/src/include/86box/usb.h b/src/include/86box/usb.h index d0b169b6c..ab0549844 100644 --- a/src/include/86box/usb.h +++ b/src/include/86box/usb.h @@ -22,6 +22,7 @@ extern "C" { #endif +/* USB Host Controller device struct */ typedef struct { uint8_t uhci_io[32], ohci_mmio[4096]; @@ -31,6 +32,13 @@ typedef struct mem_mapping_t ohci_mmio_mapping; } usb_t; +/* USB endpoint device struct. Incomplete and unused. */ +typedef struct +{ + uint16_t vendor_id; + uint16_t device_id; +} usb_device_t; + /* Global variables. */ extern const device_t usb_device; diff --git a/src/usb.c b/src/usb.c index eecb2902c..e9702afa7 100644 --- a/src/usb.c +++ b/src/usb.c @@ -208,6 +208,8 @@ ohci_mmio_write(uint32_t addr, uint8_t val, void *p) val &= ~0x01; } break; + case OHCI_HcHCCA: + return; case OHCI_HcInterruptStatus: dev->ohci_mmio[addr] &= ~(val & 0x7f); return; From 3ea8a9607fdae391a81ba9da5848c728093a3420 Mon Sep 17 00:00:00 2001 From: OBattler Date: Sun, 30 Apr 2023 00:32:50 +0200 Subject: [PATCH 36/60] Replaced my implmenetation of FXTRACT with TC1995's. --- src/cpu/x87_ops_misc.h | 13 ++++++++++--- 1 file changed, 10 insertions(+), 3 deletions(-) diff --git a/src/cpu/x87_ops_misc.h b/src/cpu/x87_ops_misc.h index 3a528f847..21fd4c084 100644 --- a/src/cpu/x87_ops_misc.h +++ b/src/cpu/x87_ops_misc.h @@ -36,12 +36,19 @@ opFNOP(uint32_t fetchdat) static int opFXTRACT(uint32_t fetchdat) { - double_decompose_t temp = (double_decompose_t) ST(0); + x87_conv_t test; + int64_t exp80, exp80final; + double mant; FP_ENTER(); cpu_state.pc++; - ST(0) = (double) temp.exponent; - x87_push((double) temp.mantissa); + test.eind.d = ST(0); + exp80 = test.eind.ll & (0x7ff0000000000000ll); + exp80final = (exp80 >> 52) - BIAS64; + mant = test.eind.d / (pow(2.0, (double)exp80final)); + ST(0) = (double)exp80final; + FP_TAG_VALID; + x87_push(mant); CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fxtract) : (x87_timings.fxtract * cpu_multi)); CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fxtract) : (x87_concurrency.fxtract * cpu_multi)); return 0; From 1eaa3830d341861321c8b2b286a74c4bc4cb4aa2 Mon Sep 17 00:00:00 2001 From: OBattler Date: Sun, 30 Apr 2023 17:13:03 +0200 Subject: [PATCH 37/60] KBC command output is now correctly two-phased like in the M&KB branch, fixes keyboard input on the Intel Advanced/EV with no PS/2 mouse. --- src/device/kbc_at.c | 189 ++++++++++++++++++++++++++++---------------- 1 file changed, 120 insertions(+), 69 deletions(-) diff --git a/src/device/kbc_at.c b/src/device/kbc_at.c index 24121e699..b3b5c5784 100644 --- a/src/device/kbc_at.c +++ b/src/device/kbc_at.c @@ -88,24 +88,27 @@ #define FLAG_PCI 0x08 enum { - STATE_RESET = 0, - STATE_MAIN_IBF, - STATE_MAIN_KBD, - STATE_MAIN_AUX, - STATE_MAIN_BOTH, - STATE_KBC_OUT, - STATE_KBC_PARAM, - STATE_SEND_KBD, - STATE_SCAN_KBD, - STATE_SEND_AUX, - STATE_SCAN_AUX + STATE_RESET = 0, /* KBC reset state, only accepts command AA. */ + STATE_KBC_DELAY_OUT, /* KBC is sending one single byte. */ + STATE_KBC_AMI_OUT, /* KBC waiting for OBF - needed for AMIKey commands that require clearing of the output byte. */ + STATE_MAIN_IBF, /* KBC checking if the input buffer is full. */ + STATE_MAIN_KBD, /* KBC checking if the keyboard has anything to send. */ + STATE_MAIN_AUX, /* KBC checking if the auxiliary has anything to send. */ + STATE_MAIN_BOTH, /* KBC checking if either device has anything to send. */ + STATE_KBC_OUT, /* KBC is sending multiple bytes. */ + STATE_KBC_PARAM, /* KBC wants a parameter. */ + STATE_SEND_KBD, /* KBC is sending command to the keyboard. */ + STATE_SCAN_KBD, /* KBC is waiting for the keyboard command response. */ + STATE_SEND_AUX, /* KBC is sending command to the auxiliary device. */ + STATE_SCAN_AUX /* KBC is waiting for the auxiliary command response. */ }; typedef struct { uint8_t state, command, command_phase, status, wantdata, ib, ob, sc_or, mem_addr, p1, p2, old_p2, - misc_flags, ami_flags, key_ctrl_queue_start, key_ctrl_queue_end; + misc_flags, ami_flags, key_ctrl_queue_start, key_ctrl_queue_end, + val, channel, stat_hi, pending; uint8_t mem[0x100]; @@ -202,14 +205,15 @@ kbc_at_queue_add(atkbc_t *dev, uint8_t val) kbc_at_log("ATkbc: dev->key_ctrl_queue[%02X] = %02X;\n", dev->key_ctrl_queue_end, val); dev->key_ctrl_queue[dev->key_ctrl_queue_end] = val; dev->key_ctrl_queue_end = (dev->key_ctrl_queue_end + 1) & 0x3f; + dev->state = STATE_KBC_OUT; } static int kbc_translate(atkbc_t *dev, uint8_t val) { - /* TODO: Does the IBM AT keyboard controller firmware apply translation in XT mode or not? */ int xt_mode = (dev->mem[0x20] & 0x20) && !(dev->misc_flags & FLAG_PS2); - int translate = (dev->mem[0x20] & 0x40) || xt_mode || ((dev->flags & KBC_TYPE_MASK) == KBC_TYPE_PS2_2); + /* The IBM AT keyboard controller firmware does not apply translation in XT mode. */ + int translate = !xt_mode && ((dev->mem[0x20] & 0x40) || ((dev->flags & KBC_TYPE_MASK) == KBC_TYPE_PS2_2)); uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; int ret = - 1; @@ -298,7 +302,7 @@ kbc_translate(atkbc_t *dev, uint8_t val) } static void -add_to_kbc_queue_front(atkbc_t *dev, uint8_t val, uint8_t channel, uint8_t stat_hi) +kbc_send_to_ob(atkbc_t *dev, uint8_t val, uint8_t channel, uint8_t stat_hi) { uint8_t kbc_ven = dev->flags & KBC_VEN_MASK; int temp = (channel == 1) ? kbc_translate(dev, val) : val; @@ -312,7 +316,7 @@ add_to_kbc_queue_front(atkbc_t *dev, uint8_t val, uint8_t channel, uint8_t stat_ else stat_hi |= 0x10; - kbc_at_log("ATkbc: Adding %02X to front on channel %i...\n", temp, channel); + kbc_at_log("ATkbc: Sending %02X to the output buffer on channel %i...\n", temp, channel); dev->status = (dev->status & ~0xf0) | STAT_OFULL | stat_hi; /* WARNING: On PS/2, all IRQ's are level-triggered, but the IBM PS/2 KBC firmware is explicitly @@ -335,6 +339,16 @@ add_to_kbc_queue_front(atkbc_t *dev, uint8_t val, uint8_t channel, uint8_t stat_ dev->ob = temp; } +static void +kbc_delay_to_ob(atkbc_t *dev, uint8_t val, uint8_t channel, uint8_t stat_hi) +{ + dev->val = val; + dev->channel = channel; + dev->stat_hi = stat_hi; + dev->pending = 1; + dev->state = STATE_KBC_DELAY_OUT; +} + static void kbc_at_process_cmd(void *priv); static void @@ -366,7 +380,7 @@ kbc_ibf_process(atkbc_t *dev) dev->ports[0]->dat = dev->ib; dev->state = STATE_SEND_KBD; } else - add_to_kbc_queue_front(dev, 0xfe, 1, 0x40); + kbc_delay_to_ob(dev, 0xfe, 1, 0x40); } } @@ -378,7 +392,7 @@ kbc_scan_kbd_at(atkbc_t *dev) /* XT mode. */ if (dev->mem[0x20] & 0x20) { if ((dev->ports[0] != NULL) && (dev->ports[0]->out_new != -1)) { - add_to_kbc_queue_front(dev, dev->ports[0]->out_new, 1, 0x00); + kbc_send_to_ob(dev, dev->ports[0]->out_new, 1, 0x00); dev->ports[0]->out_new = -1; dev->state = STATE_MAIN_IBF; } else if (dev->status & STAT_IFULL) @@ -397,10 +411,10 @@ kbc_scan_kbd_at(atkbc_t *dev) /* Read data from the keyboard. */ if (dev->mem[0x20] & 0x40) { if ((dev->mem[0x20] & 0x08) || (dev->p1 & 0x80)) - add_to_kbc_queue_front(dev, dev->ports[0]->out_new, 1, 0x00); + kbc_send_to_ob(dev, dev->ports[0]->out_new, 1, 0x00); dev->mem[0x2d] = (dev->ports[0]->out_new == 0xf0) ? 0x80 : 0x00; } else - add_to_kbc_queue_front(dev, dev->ports[0]->out_new, 1, 0x00); + kbc_send_to_ob(dev, dev->ports[0]->out_new, 1, 0x00); dev->ports[0]->out_new = -1; dev->state = STATE_MAIN_IBF; } @@ -421,8 +435,13 @@ kbc_at_poll_at(atkbc_t *dev) kbc_at_process_cmd(dev); } break; + case STATE_KBC_AMI_OUT: + if (dev->status & STAT_OFULL) + break; + /* FALLTHROUGH */ case STATE_MAIN_IBF: default: +at_main_ibf: if (dev->status & STAT_OFULL) { /* OBF set, wait until it is cleared but still process commands. */ if ((dev->status & STAT_IFULL) && (dev->status & STAT_CD)) { @@ -443,6 +462,15 @@ kbc_at_poll_at(atkbc_t *dev) dev->state = STATE_MAIN_IBF; } break; + case STATE_KBC_DELAY_OUT: + /* Keyboard controller command want to output a single byte. */ + kbc_at_log("ATkbc: %02X coming from channel %i with high status %02X\n", dev->val, dev->channel, dev->stat_hi); + kbc_send_to_ob(dev, dev->val, dev->channel, dev->stat_hi); + // dev->state = (dev->pending == 2) ? STATE_KBC_AMI_OUT : STATE_MAIN_IBF; + dev->state = STATE_MAIN_IBF; + dev->pending = 0; + goto at_main_ibf; + break; case STATE_KBC_OUT: /* Keyboard controller command want to output multiple bytes. */ if (dev->status & STAT_IFULL) { @@ -453,7 +481,7 @@ kbc_at_poll_at(atkbc_t *dev) /* Do not continue dumping until OBF is clear. */ if (!(dev->status & STAT_OFULL)) { kbc_at_log("ATkbc: %02X coming from channel 0\n", dev->key_ctrl_queue[dev->key_ctrl_queue_start]); - add_to_kbc_queue_front(dev, dev->key_ctrl_queue[dev->key_ctrl_queue_start], 0, 0x00); + kbc_send_to_ob(dev, dev->key_ctrl_queue[dev->key_ctrl_queue_start], 0, 0x00); dev->key_ctrl_queue_start = (dev->key_ctrl_queue_start + 1) & 0x3f; if (dev->key_ctrl_queue_start == dev->key_ctrl_queue_end) dev->state = STATE_MAIN_IBF; @@ -494,7 +522,7 @@ kbc_scan_kbd_ps2(atkbc_t *dev) { if ((dev->ports[0] != NULL) && (dev->ports[0]->out_new != -1)) { kbc_at_log("ATkbc: %02X coming from channel 1\n", dev->ports[0]->out_new & 0xff); - add_to_kbc_queue_front(dev, dev->ports[0]->out_new, 1, 0x00); + kbc_send_to_ob(dev, dev->ports[0]->out_new, 1, 0x00); dev->ports[0]->out_new = -1; dev->state = STATE_MAIN_IBF; return 1; @@ -508,7 +536,7 @@ kbc_scan_aux_ps2(atkbc_t *dev) { if ((dev->ports[1] != NULL) && (dev->ports[1]->out_new != -1)) { kbc_at_log("ATkbc: %02X coming from channel 2\n", dev->ports[1]->out_new & 0xff); - add_to_kbc_queue_front(dev, dev->ports[1]->out_new, 2, 0x00); + kbc_send_to_ob(dev, dev->ports[1]->out_new, 2, 0x00); dev->ports[1]->out_new = -1; dev->state = STATE_MAIN_IBF; return 1; @@ -528,8 +556,13 @@ kbc_at_poll_ps2(atkbc_t *dev) kbc_at_process_cmd(dev); } break; + case STATE_KBC_AMI_OUT: + if (dev->status & STAT_OFULL) + break; + /* FALLTHROUGH */ case STATE_MAIN_IBF: default: +ps2_main_ibf: if (dev->status & STAT_IFULL) kbc_ibf_process(dev); else if (!(dev->status & STAT_OFULL)) { @@ -571,6 +604,15 @@ kbc_at_poll_ps2(atkbc_t *dev) else dev->state = STATE_MAIN_AUX; break; + case STATE_KBC_DELAY_OUT: + /* Keyboard controller command want to output a single byte. */ + kbc_at_log("ATkbc: %02X coming from channel %i with high status %02X\n", dev->val, dev->channel, dev->stat_hi); + kbc_send_to_ob(dev, dev->val, dev->channel, dev->stat_hi); + // dev->state = (dev->pending == 2) ? STATE_KBC_AMI_OUT : STATE_MAIN_IBF; + dev->state = STATE_MAIN_IBF; + dev->pending = 0; + goto ps2_main_ibf; + break; case STATE_KBC_OUT: /* Keyboard controller command want to output multiple bytes. */ if (dev->status & STAT_IFULL) { @@ -581,7 +623,7 @@ kbc_at_poll_ps2(atkbc_t *dev) /* Do not continue dumping until OBF is clear. */ if (!(dev->status & STAT_OFULL)) { kbc_at_log("ATkbc: %02X coming from channel 0\n", dev->key_ctrl_queue[dev->key_ctrl_queue_start] & 0xff); - add_to_kbc_queue_front(dev, dev->key_ctrl_queue[dev->key_ctrl_queue_start], 0, 0x00); + kbc_send_to_ob(dev, dev->key_ctrl_queue[dev->key_ctrl_queue_start], 0, 0x00); dev->key_ctrl_queue_start = (dev->key_ctrl_queue_start + 1) & 0x3f; if (dev->key_ctrl_queue_start == dev->key_ctrl_queue_end) dev->state = STATE_MAIN_IBF; @@ -761,7 +803,7 @@ write64_generic(void *priv, uint8_t val) case 0xa4: /* check if password installed */ if (dev->misc_flags & FLAG_PS2) { kbc_at_log("ATkbc: check if password installed\n"); - add_to_kbc_queue_front(dev, 0xf1, 0, 0x00); + kbc_delay_to_ob(dev, 0xf1, 0, 0x00); return 0; } break; @@ -785,14 +827,14 @@ write64_generic(void *priv, uint8_t val) case 0xa9: /* Test auxiliary port */ kbc_at_log("ATkbc: test auxiliary port\n"); if (dev->misc_flags & FLAG_PS2) { - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); /* no error, this is testing the channel 2 interface */ + kbc_delay_to_ob(dev, 0x00, 0, 0x00); /* no error, this is testing the channel 2 interface */ return 0; } break; case 0xaf: /* read keyboard version */ kbc_at_log("ATkbc: read keyboard version\n"); - add_to_kbc_queue_front(dev, kbc_award_revision, 0, 0x00); + kbc_delay_to_ob(dev, kbc_award_revision, 0, 0x00); return 0; /* @@ -869,8 +911,8 @@ write64_generic(void *priv, uint8_t val) if (kbc_ven == KBC_VEN_IBM_PS1) { current_drive = fdc_get_current_drive(); /* (B0 or F0) | (fdd_is_525(current_drive) on bit 6) */ - add_to_kbc_queue_front(dev, dev->p1 | fixed_bits | (fdd_is_525(current_drive) ? 0x40 : 0x00), - 0, 0x00); + kbc_delay_to_ob(dev, dev->p1 | fixed_bits | (fdd_is_525(current_drive) ? 0x40 : 0x00), + 0, 0x00); } else if (kbc_ven == KBC_VEN_NCR) { /* switch settings * bit 7: keyboard disable @@ -883,8 +925,8 @@ write64_generic(void *priv, uint8_t val) * bit 0: dma mode */ /* (B0 or F0) | 0x04 | (display on bit 6) | (fpu on bit 3) */ - add_to_kbc_queue_front(dev, (dev->p1 | fixed_bits | (video_is_mda() ? 0x40 : 0x00) | (hasfpu ? 0x08 : 0x00)) & 0xdf, - 0, 0x00); + kbc_delay_to_ob(dev, (dev->p1 | fixed_bits | (video_is_mda() ? 0x40 : 0x00) | (hasfpu ? 0x08 : 0x00)) & 0xdf, + 0, 0x00); } else if (kbc_ven == KBC_VEN_TRIGEM_AMI) { /* Bit 3, 2: 1, 1: TriGem logo; @@ -894,13 +936,13 @@ write64_generic(void *priv, uint8_t val) if (dev->misc_flags & FLAG_PCI) fixed_bits |= 8; /* (B0 or F0) | (0x04 or 0x0c) */ - add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); + kbc_delay_to_ob(dev, dev->p1 | fixed_bits, 0, 0x00); } else if (((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) && ((dev->flags & KBC_TYPE_MASK) < KBC_TYPE_GREEN)) /* (B0 or F0) | (0x08 or 0x0c) */ - add_to_kbc_queue_front(dev, ((dev->p1 | fixed_bits) & 0xf0) | (((dev->flags & KBC_VEN_MASK) == KBC_VEN_ACER) ? 0x08 : 0x0c), 0, 0x00); + kbc_delay_to_ob(dev, ((dev->p1 | fixed_bits) & 0xf0) | (((dev->flags & KBC_VEN_MASK) == KBC_VEN_ACER) ? 0x08 : 0x0c), 0, 0x00); else /* (B0 or F0) | (0x04 or 0x44) */ - add_to_kbc_queue_front(dev, dev->p1 | fixed_bits, 0, 0x00); + kbc_delay_to_ob(dev, dev->p1 | fixed_bits, 0, 0x00); dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc); return 0; @@ -963,7 +1005,7 @@ write60_ami(void *priv, uint8_t val) case 0xa5: /* get extended controller RAM */ kbc_at_log("ATkbc: AMI - get extended controller RAM\n"); - add_to_kbc_queue_front(dev, dev->mem[val], 0, 0x00); + kbc_delay_to_ob(dev, dev->mem[val], 0, 0x00); return 0; case 0xaf: /* set extended controller RAM */ @@ -1011,7 +1053,7 @@ write64_ami(void *priv, uint8_t val) switch (val) { case 0x00 ... 0x1f: kbc_at_log("ATkbc: AMI - alias read from %08X\n", val); - add_to_kbc_queue_front(dev, dev->mem[val + 0x20], 0, 0x00); + kbc_delay_to_ob(dev, dev->mem[val + 0x20], 0, 0x00); return 0; case 0x40 ... 0x5f: @@ -1023,19 +1065,18 @@ write64_ami(void *priv, uint8_t val) case 0xa0: /* copyright message */ kbc_at_queue_add(dev, 0x28); kbc_at_queue_add(dev, 0x00); - dev->state = STATE_KBC_OUT; return 0; case 0xa1: /* get controller version */ kbc_at_log("ATkbc: AMI - get controller version\n"); - add_to_kbc_queue_front(dev, kbc_ami_revision, 0, 0x00); + kbc_delay_to_ob(dev, kbc_ami_revision, 0, 0x00); return 0; case 0xa2: /* clear keyboard controller lines P22/P23 */ if (!(dev->misc_flags & FLAG_PS2)) { kbc_at_log("ATkbc: AMI - clear KBC lines P22 and P23\n"); write_p2(dev, dev->p2 & 0xf3); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, 0x00, 0, 0x00); return 0; } break; @@ -1044,7 +1085,7 @@ write64_ami(void *priv, uint8_t val) if (!(dev->misc_flags & FLAG_PS2)) { kbc_at_log("ATkbc: AMI - set KBC lines P22 and P23\n"); write_p2(dev, dev->p2 | 0x0c); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, 0x00, 0, 0x00); return 0; } break; @@ -1071,7 +1112,7 @@ write64_ami(void *priv, uint8_t val) case 0xa6: /* read clock */ if (!(dev->misc_flags & FLAG_PS2)) { kbc_at_log("ATkbc: AMI - read clock\n"); - add_to_kbc_queue_front(dev, (dev->misc_flags & FLAG_CLOCK) ? 0xff : 0x00, 0, 0x00); + kbc_delay_to_ob(dev, (dev->misc_flags & FLAG_CLOCK) ? 0xff : 0x00, 0, 0x00); return 0; } break; @@ -1095,7 +1136,7 @@ write64_ami(void *priv, uint8_t val) case 0xa9: /* read cache */ if (!(dev->misc_flags & FLAG_PS2)) { kbc_at_log("ATkbc: AMI - read cache\n"); - add_to_kbc_queue_front(dev, (dev->misc_flags & FLAG_CACHE) ? 0xff : 0x00, 0, 0x00); + kbc_delay_to_ob(dev, (dev->misc_flags & FLAG_CACHE) ? 0xff : 0x00, 0, 0x00); return 0; } break; @@ -1115,7 +1156,8 @@ write64_ami(void *priv, uint8_t val) kbc_at_log("ATkbc: set KBC lines P10-P13 (P1 bits 0-3) low\n"); if (!(dev->flags & DEVICE_PCI) || (val > 0xb1)) dev->p1 &= ~(1 << (val & 0x03)); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, dev->ob, 0, 0x00); + dev->pending++; return 0; /* TODO: The ICS SB486PV sends command B4 but expects to read *TWO* bytes. */ @@ -1124,7 +1166,8 @@ write64_ami(void *priv, uint8_t val) kbc_at_log("ATkbc: set KBC lines P22-P23 (P2 bits 2-3) low\n"); if (!(dev->flags & DEVICE_PCI)) write_p2(dev, dev->p2 & ~(4 << (val & 0x01))); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, dev->ob, 0, 0x00); + dev->pending++; return 0; case 0xb8 ... 0xbb: @@ -1132,7 +1175,8 @@ write64_ami(void *priv, uint8_t val) kbc_at_log("ATkbc: set KBC lines P10-P13 (P1 bits 0-3) high\n"); if (!(dev->flags & DEVICE_PCI) || (val > 0xb9)) { dev->p1 |= (1 << (val & 0x03)); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, dev->ob, 0, 0x00); + dev->pending++; } return 0; @@ -1141,7 +1185,8 @@ write64_ami(void *priv, uint8_t val) kbc_at_log("ATkbc: set KBC lines P22-P23 (P2 bits 2-3) high\n"); if (!(dev->flags & DEVICE_PCI)) write_p2(dev, dev->p2 | (4 << (val & 0x01))); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, dev->ob, 0, 0x00); + dev->pending++; return 0; case 0xc1: /* write P1 */ @@ -1154,13 +1199,15 @@ write64_ami(void *priv, uint8_t val) /* set KBC line P14 low */ kbc_at_log("ATkbc: set KBC line P14 (P1 bit 4) low\n"); dev->p1 &= 0xef; - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, dev->ob, 0, 0x00); + dev->pending++; return 0; case 0xc5: /* set KBC line P15 low */ kbc_at_log("ATkbc: set KBC line P15 (P1 bit 5) low\n"); dev->p1 &= 0xdf; - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, dev->ob, 0, 0x00); + dev->pending++; return 0; case 0xc8: @@ -1185,13 +1232,15 @@ write64_ami(void *priv, uint8_t val) /* set KBC line P14 high */ kbc_at_log("ATkbc: set KBC line P14 (P1 bit 4) high\n"); dev->p1 |= 0x10; - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, dev->ob, 0, 0x00); + dev->pending++; return 0; case 0xcd: /* set KBC line P15 high */ kbc_at_log("ATkbc: set KBC line P15 (P1 bit 5) high\n"); dev->p1 |= 0x20; - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, dev->ob, 0, 0x00); + dev->pending++; return 0; case 0xef: /* ??? - sent by AMI486 */ @@ -1230,7 +1279,7 @@ write64_olivetti(void *priv, uint8_t val) * bit 2: keyboard fuse present * bits 0-1: ??? */ - add_to_kbc_queue_front(dev, (0x0c | ((is386) ? 0x00 : 0x80)) & 0xdf, 0, 0x00); + kbc_delay_to_ob(dev, (0x0c | ((is386) ? 0x00 : 0x80)) & 0xdf, 0, 0x00); dev->p1 = ((dev->p1 + 1) & 3) | (dev->p1 & 0xfc); return 0; } @@ -1305,12 +1354,12 @@ write64_toshiba(void *priv, uint8_t val) case 0xb4: /* T3100e: Get configuration / status */ kbc_at_log("ATkbc: T3100e: Get configuration / status\n"); - add_to_kbc_queue_front(dev, t3100e_config_get(), 0, 0x00); + kbc_delay_to_ob(dev, t3100e_config_get(), 0, 0x00); return 0; case 0xb5: /* T3100e: Get colour / mono byte */ kbc_at_log("ATkbc: T3100e: Get colour / mono byte\n"); - add_to_kbc_queue_front(dev, t3100e_mono_get(), 0, 0x00); + kbc_delay_to_ob(dev, t3100e_mono_get(), 0, 0x00); return 0; case 0xb6: /* T3100e: Set colour / mono byte */ @@ -1340,9 +1389,9 @@ write64_toshiba(void *priv, uint8_t val) kbc_at_log("ATkbc: T3100e: Read 'Fn' key\n"); if (keyboard_recv(0xb8) || /* Right Alt */ keyboard_recv(0x9d)) /* Right Ctrl */ - add_to_kbc_queue_front(dev, 0x04, 0, 0x00); + kbc_delay_to_ob(dev, 0x04, 0, 0x00); else - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, 0x00, 0, 0x00); return 0; case 0xbc: /* T3100e: Reset Fn+Key notification */ @@ -1356,7 +1405,7 @@ write64_toshiba(void *priv, uint8_t val) /* The T3100e returns all bits set except bit 6 which * is set by t3100e_mono_set() */ dev->p1 = (t3100e_mono_get() & 1) ? 0xff : 0xbf; - add_to_kbc_queue_front(dev, dev->p1, 0, 0x00); + kbc_delay_to_ob(dev, dev->p1, 0, 0x00); return 0; } @@ -1382,7 +1431,9 @@ kbc_at_process_cmd(void *priv) switch (dev->ib) { /* Read data from KBC memory. */ case 0x20 ... 0x3f: - add_to_kbc_queue_front(dev, dev->mem[dev->ib], 0, 0x00); + kbc_delay_to_ob(dev, dev->mem[dev->ib], 0, 0x00); + if (dev->ib == 0x20) + dev->pending++; break; /* Write data to KBC memory. */ @@ -1442,16 +1493,12 @@ kbc_at_process_cmd(void *priv) dev->ports[1]->out_new = -1; kbc_at_queue_reset(dev); - // dev->state = STATE_MAIN_IBF; - dev->state = STATE_KBC_OUT; - - // add_to_kbc_queue_front(dev, 0x55, 0, 0x00); kbc_at_queue_add(dev, 0x55); break; case 0xab: /* interface test */ kbc_at_log("ATkbc: interface test\n"); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); /*no error*/ + kbc_delay_to_ob(dev, 0x00, 0, 0x00); /*no error*/ break; case 0xac: /* diagnostic dump */ @@ -1467,7 +1514,6 @@ kbc_at_process_cmd(void *priv) kbc_at_queue_add(dev, cmd_ac_conv[dev->mem[i + 0x20] & 0x0f]); kbc_at_queue_add(dev, 0x39); } - dev->state = STATE_KBC_OUT; } break; @@ -1489,7 +1535,7 @@ kbc_at_process_cmd(void *priv) case 0xca: /* read keyboard mode */ kbc_at_log("ATkbc: AMI - read keyboard mode\n"); - add_to_kbc_queue_front(dev, dev->ami_flags, 0, 0x00); + kbc_delay_to_ob(dev, dev->ami_flags, 0, 0x00); break; case 0xcb: /* set keyboard mode */ @@ -1503,7 +1549,7 @@ kbc_at_process_cmd(void *priv) mask = 0xff; if ((kbc_ven != KBC_VEN_OLIVETTI) && !(dev->misc_flags & FLAG_PS2) && (dev->mem[0x20] & 0x10)) mask &= 0xbf; - add_to_kbc_queue_front(dev, (((dev->p2 & 0xfd) | mem_a20_key) & mask), 0, 0x00); + kbc_delay_to_ob(dev, ((dev->p2 & 0xfd) | mem_a20_key) & mask, 0, 0x00); break; case 0xd1: /* write P2 */ @@ -1526,7 +1572,7 @@ kbc_at_process_cmd(void *priv) case 0xe0: /* read test inputs */ kbc_at_log("ATkbc: read test inputs\n"); - add_to_kbc_queue_front(dev, 0x00, 0, 0x00); + kbc_delay_to_ob(dev, 0x00, 0, 0x00); break; default: @@ -1578,12 +1624,12 @@ kbc_at_process_cmd(void *priv) case 0xd2: /* write to keyboard output buffer */ kbc_at_log("ATkbc: write to keyboard output buffer\n"); - add_to_kbc_queue_front(dev, dev->ib, 0, 0x00); + kbc_delay_to_ob(dev, dev->ib, 0, 0x00); break; case 0xd3: /* write to auxiliary output buffer */ kbc_at_log("ATkbc: write to auxiliary output buffer\n"); - add_to_kbc_queue_front(dev, dev->ib, 2, 0x00); + kbc_delay_to_ob(dev, dev->ib, 2, 0x00); break; case 0xd4: /* write to auxiliary port */ @@ -1599,7 +1645,7 @@ kbc_at_process_cmd(void *priv) dev->ports[1]->dat = dev->ib; dev->state = STATE_SEND_AUX; } else - add_to_kbc_queue_front(dev, 0xfe, 2, 0x40); + kbc_delay_to_ob(dev, 0xfe, 2, 0x40); } break; @@ -1633,6 +1679,7 @@ kbc_at_write(uint16_t port, uint8_t val, void *priv) if (dev->wantdata && (dev->command == 0xd1)) { kbc_at_log("ATkbc: write P2\n"); +#if 0 /* Fast A20 - ignore all other bits. */ val = (val & 0x02) | (dev->p2 & 0xfd); @@ -1646,6 +1693,10 @@ kbc_at_write(uint16_t port, uint8_t val, void *priv) } write_p2_fast_a20(dev, val | 0x01); +#else + /* Fast A20 - ignore all other bits. */ + write_p2_fast_a20(dev, (dev->p2 & 0xfd) | (val & 0x02)); +#endif dev->wantdata = 0; dev->state = STATE_MAIN_IBF; From 7c372ca78968a813b7d5e37bd6cc47923a376849 Mon Sep 17 00:00:00 2001 From: TC1995 Date: Sun, 30 Apr 2023 18:18:12 +0200 Subject: [PATCH 38/60] Moved the softfloat-enabled ops back to the cpu directory. Made softfloat always enabled, thus dynarec disabled, only for the IBM PS/2 model 70 type 4, in preparation for its comeback to main use. --- src/config.c | 7 +++++++ src/cpu/x87_ops.h | 15 ++++++++------- .../{softfloat/x87_ops_other.h => x87_ops_sf.h} | 0 .../x87_ops_arith.h => x87_ops_sf_arith.h} | 0 .../x87_ops_compare.h => x87_ops_sf_compare.h} | 0 .../x87_ops_const.h => x87_ops_sf_const.h} | 0 ...7_ops_load_store.h => x87_ops_sf_load_store.h} | 0 .../x87_ops_misc.h => x87_ops_sf_misc.h} | 0 .../x87_ops_trans.h => x87_ops_sf_trans.h} | 0 src/qt/qt_settingsmachine.cpp | 4 ++++ 10 files changed, 19 insertions(+), 7 deletions(-) rename src/cpu/{softfloat/x87_ops_other.h => x87_ops_sf.h} (100%) rename src/cpu/{softfloat/x87_ops_arith.h => x87_ops_sf_arith.h} (100%) rename src/cpu/{softfloat/x87_ops_compare.h => x87_ops_sf_compare.h} (100%) rename src/cpu/{softfloat/x87_ops_const.h => x87_ops_sf_const.h} (100%) rename src/cpu/{softfloat/x87_ops_load_store.h => x87_ops_sf_load_store.h} (100%) rename src/cpu/{softfloat/x87_ops_misc.h => x87_ops_sf_misc.h} (100%) rename src/cpu/{softfloat/x87_ops_trans.h => x87_ops_sf_trans.h} (100%) diff --git a/src/config.c b/src/config.c index a83512bde..75a3973e4 100644 --- a/src/config.c +++ b/src/config.c @@ -505,6 +505,13 @@ load_machine(void) cpu_use_dynarec = !!ini_section_get_int(cat, "cpu_use_dynarec", 0); fpu_softfloat = !!ini_section_get_int(cat, "fpu_softfloat", 0); + /*The IBM PS/2 model 70 type 4 BIOS does heavy tests to the FPU in 80-bit precision mode, requiring softfloat + otherwise it would always throw error 12903 on POST, so always disable dynarec and enable softfloat for this + machine only.*/ + if (!strcmp(machines[machine].internal_name, "ibmps2_m70_type4")) { + cpu_use_dynarec = 0; + fpu_softfloat = 1; + } p = ini_section_get_string(cat, "time_sync", NULL); if (p != NULL) { diff --git a/src/cpu/x87_ops.h b/src/cpu/x87_ops.h index 0ab6b2e68..742ed3e5d 100644 --- a/src/cpu/x87_ops.h +++ b/src/cpu/x87_ops.h @@ -481,13 +481,14 @@ typedef union { # define FP_TAG_VALID_N cpu_state.tag[(cpu_state.TOP + 1) & 7] &= ~TAG_UINT64 #endif -#include "softfloat/x87_ops_arith.h" -#include "softfloat/x87_ops_compare.h" -#include "softfloat/x87_ops_const.h" -#include "softfloat/x87_ops_load_store.h" -#include "softfloat/x87_ops_misc.h" -#include "softfloat/x87_ops_trans.h" -#include "softfloat/x87_ops_other.h" +#include "x87_ops_sf_arith.h" +#include "x87_ops_sf_compare.h" +#include "x87_ops_sf_const.h" +#include "x87_ops_sf_load_store.h" +#include "x87_ops_sf_misc.h" +#include "x87_ops_sf_trans.h" +#include "x87_ops_sf.h" + #include "x87_ops_arith.h" #include "x87_ops_misc.h" #include "x87_ops_loadstore.h" diff --git a/src/cpu/softfloat/x87_ops_other.h b/src/cpu/x87_ops_sf.h similarity index 100% rename from src/cpu/softfloat/x87_ops_other.h rename to src/cpu/x87_ops_sf.h diff --git a/src/cpu/softfloat/x87_ops_arith.h b/src/cpu/x87_ops_sf_arith.h similarity index 100% rename from src/cpu/softfloat/x87_ops_arith.h rename to src/cpu/x87_ops_sf_arith.h diff --git a/src/cpu/softfloat/x87_ops_compare.h b/src/cpu/x87_ops_sf_compare.h similarity index 100% rename from src/cpu/softfloat/x87_ops_compare.h rename to src/cpu/x87_ops_sf_compare.h diff --git a/src/cpu/softfloat/x87_ops_const.h b/src/cpu/x87_ops_sf_const.h similarity index 100% rename from src/cpu/softfloat/x87_ops_const.h rename to src/cpu/x87_ops_sf_const.h diff --git a/src/cpu/softfloat/x87_ops_load_store.h b/src/cpu/x87_ops_sf_load_store.h similarity index 100% rename from src/cpu/softfloat/x87_ops_load_store.h rename to src/cpu/x87_ops_sf_load_store.h diff --git a/src/cpu/softfloat/x87_ops_misc.h b/src/cpu/x87_ops_sf_misc.h similarity index 100% rename from src/cpu/softfloat/x87_ops_misc.h rename to src/cpu/x87_ops_sf_misc.h diff --git a/src/cpu/softfloat/x87_ops_trans.h b/src/cpu/x87_ops_sf_trans.h similarity index 100% rename from src/cpu/softfloat/x87_ops_trans.h rename to src/cpu/x87_ops_sf_trans.h diff --git a/src/qt/qt_settingsmachine.cpp b/src/qt/qt_settingsmachine.cpp index 2794af71b..fbe30949c 100644 --- a/src/qt/qt_settingsmachine.cpp +++ b/src/qt/qt_settingsmachine.cpp @@ -106,6 +106,10 @@ SettingsMachine::save() fpu_type = ui->comboBoxFPU->currentData().toInt(); cpu_use_dynarec = ui->checkBoxDynamicRecompiler->isChecked() ? 1 : 0; fpu_softfloat = (ui->checkBoxFPUSoftfloat->isChecked() && !cpu_use_dynarec) ? 1 : 0; + if (!strcmp(machines[machine].internal_name, "ibmps2_m70_type4")) { + cpu_use_dynarec = 0; + fpu_softfloat = 1; + } int64_t temp_mem_size; if (machine_get_ram_granularity(machine) < 1024) { From 1057722efc318e2969d6317fd6ec34af3fac5e73 Mon Sep 17 00:00:00 2001 From: OBattler Date: Sun, 30 Apr 2023 18:21:17 +0200 Subject: [PATCH 39/60] Command A5 is in fact the IBM PS/2 Load Security command, fixes the AMI Excalibur PCI Pentium. --- src/device/kbc_at.c | 28 ++++++++++++++++++---------- 1 file changed, 18 insertions(+), 10 deletions(-) diff --git a/src/device/kbc_at.c b/src/device/kbc_at.c index b3b5c5784..64403a5ed 100644 --- a/src/device/kbc_at.c +++ b/src/device/kbc_at.c @@ -808,6 +808,12 @@ write64_generic(void *priv, uint8_t val) } break; + case 0xa5: /* load security */ + kbc_at_log("ATkbc: load security\n"); + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + return 0; + case 0xa7: /* disable auxiliary port */ if (dev->misc_flags & FLAG_PS2) { kbc_at_log("ATkbc: disable auxiliary port\n"); @@ -1003,11 +1009,6 @@ write60_ami(void *priv, uint8_t val) write_cmd(dev, val); return 0; - case 0xa5: /* get extended controller RAM */ - kbc_at_log("ATkbc: AMI - get extended controller RAM\n"); - kbc_delay_to_ob(dev, dev->mem[val], 0, 0x00); - return 0; - case 0xaf: /* set extended controller RAM */ kbc_at_log("ATkbc: AMI - set extended controller RAM\n"); if (dev->command_phase == 1) { @@ -1102,12 +1103,8 @@ write64_ami(void *priv, uint8_t val) if (!(dev->misc_flags & FLAG_PS2)) { kbc_at_log("ATkbc: AMI - write clock = high\n"); dev->misc_flags |= FLAG_CLOCK; - } else { - kbc_at_log("ATkbc: get extended controller RAM\n"); - dev->wantdata = 1; - dev->state = STATE_KBC_PARAM; + return 0; } - return 0; case 0xa6: /* read clock */ if (!(dev->misc_flags & FLAG_PS2)) { @@ -1604,6 +1601,17 @@ kbc_at_process_cmd(void *priv) write_cmd(dev, dev->ib); break; + case 0xa5: /* load security */ + if (dev->misc_flags & FLAG_PS2) { + kbc_at_log("ATkbc: load security (%02X)\n", dev->ib); + + if (dev->ib != 0x00) { + dev->wantdata = 1; + dev->state = STATE_KBC_PARAM; + } + } + break; + case 0xc7: /* set port1 bits */ kbc_at_log("ATkbc: Phoenix - set port1 bits\n"); dev->p1 |= dev->ib; From 125315ee613a1e2009701cb43c9c464cb1cee38b Mon Sep 17 00:00:00 2001 From: OBattler Date: Sun, 30 Apr 2023 18:24:14 +0200 Subject: [PATCH 40/60] Fixed the KBC PCI flag, fixes the logo on the TriGem HAWK. --- src/device/kbc_at.c | 8 ++++---- 1 file changed, 4 insertions(+), 4 deletions(-) diff --git a/src/device/kbc_at.c b/src/device/kbc_at.c index 64403a5ed..aed771b9e 100644 --- a/src/device/kbc_at.c +++ b/src/device/kbc_at.c @@ -1788,7 +1788,7 @@ kbc_at_reset(void *priv) dev->sc_or = 0; dev->ami_flags = ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) ? 0x01 : 0x00; - dev->misc_flags = 0x00; + dev->misc_flags &= FLAG_PCI; if ((dev->flags & KBC_TYPE_MASK) >= KBC_TYPE_PS2_1) { dev->misc_flags |= FLAG_PS2; @@ -1842,12 +1842,12 @@ kbc_at_init(const device_t *info) dev->flags = info->local; - if (info->flags & DEVICE_PCI) - dev->misc_flags |= FLAG_PCI; - video_reset(gfxcard[0]); kbc_at_reset(dev); + if (info->flags & DEVICE_PCI) + dev->misc_flags |= FLAG_PCI; + io_sethandler(0x0060, 1, kbc_at_read, NULL, NULL, kbc_at_write, NULL, NULL, dev); io_sethandler(0x0064, 1, kbc_at_read, NULL, NULL, kbc_at_write, NULL, NULL, dev); From 07a7af84a5a81925cca10545e61049d3f66635c5 Mon Sep 17 00:00:00 2001 From: TC1995 Date: Sun, 30 Apr 2023 18:43:26 +0200 Subject: [PATCH 41/60] Update x87_ops_misc.h Fix PR commit. --- src/cpu/x87_ops_misc.h | 15 +-------------- 1 file changed, 1 insertion(+), 14 deletions(-) diff --git a/src/cpu/x87_ops_misc.h b/src/cpu/x87_ops_misc.h index b055a389a..91fc52bdc 100644 --- a/src/cpu/x87_ops_misc.h +++ b/src/cpu/x87_ops_misc.h @@ -33,6 +33,7 @@ opFNOP(uint32_t fetchdat) return 0; } +static int opFXTRACT(uint32_t fetchdat) { x87_conv_t test; @@ -516,20 +517,6 @@ opFCHS(uint32_t fetchdat) return 0; } -static int -opFXTRACT(uint32_t fetchdat) -{ - double_decompose_t temp = (double_decompose_t) ST(0); - - FP_ENTER(); - cpu_state.pc++; - ST(0) = (double) temp.exponent; - x87_push((double) temp.mantissa); - CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fxtract) : (x87_timings.fxtract * cpu_multi)); - CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fxtract) : (x87_concurrency.fxtract * cpu_multi)); - return 0; -} - static int opFABS(uint32_t fetchdat) { From c778d144cbcb724ad8d4fdbb0ae8aa91d86ad1d9 Mon Sep 17 00:00:00 2001 From: TC1995 Date: Sun, 30 Apr 2023 18:44:03 +0200 Subject: [PATCH 42/60] Update x87_ops_misc.h Fix compile 2. --- src/cpu/x87_ops_misc.h | 1 + 1 file changed, 1 insertion(+) diff --git a/src/cpu/x87_ops_misc.h b/src/cpu/x87_ops_misc.h index 91fc52bdc..bd2b05c52 100644 --- a/src/cpu/x87_ops_misc.h +++ b/src/cpu/x87_ops_misc.h @@ -54,6 +54,7 @@ opFXTRACT(uint32_t fetchdat) return 0; } +static int opFCLEX(uint32_t fetchdat) { FP_ENTER(); From 91ccfa3344857edf3e6f1fe6c00e7d088d05a46c Mon Sep 17 00:00:00 2001 From: Cacodemon345 Date: Sun, 30 Apr 2023 23:01:15 +0600 Subject: [PATCH 43/60] usb: Set up infrastructure for system interrupts from OHCI --- src/include/86box/usb.h | 13 ++++++- src/usb.c | 79 ++++++++++++++++++++++++----------------- 2 files changed, 59 insertions(+), 33 deletions(-) diff --git a/src/include/86box/usb.h b/src/include/86box/usb.h index ab0549844..987eb1314 100644 --- a/src/include/86box/usb.h +++ b/src/include/86box/usb.h @@ -22,14 +22,25 @@ extern "C" { #endif -/* USB Host Controller device struct */ +typedef struct usb_t usb_t; + +/* USB device creation parameters struct */ typedef struct +{ + void (*raise_interrupt)(usb_t*, void*); + void* parent_priv; +} usb_params_t; + +/* USB Host Controller device struct */ +typedef struct usb_t { uint8_t uhci_io[32], ohci_mmio[4096]; uint16_t uhci_io_base; int uhci_enable, ohci_enable; uint32_t ohci_mem_base; mem_mapping_t ohci_mmio_mapping; + + usb_params_t* usb_params; } usb_t; /* USB endpoint device struct. Incomplete and unused. */ diff --git a/src/usb.c b/src/usb.c index e9702afa7..ca8ee1d38 100644 --- a/src/usb.c +++ b/src/usb.c @@ -47,6 +47,48 @@ usb_log(const char *fmt, ...) # define usb_log(fmt, ...) #endif +/* OHCI registers */ +enum +{ + OHCI_HcRevision = 0x00, + OHCI_HcControl = 0x04, + OHCI_HcCommandStatus = 0x08, + OHCI_HcInterruptStatus = 0x0C, + OHCI_HcInterruptEnable = 0x10, + OHCI_HcInterruptDisable = 0x14, + OHCI_HcHCCA = 0x18, + OHCI_HcPeriodCurrentED = 0x1C, + OHCI_HcControlHeadED = 0x20, + OHCI_HcControlCurrentED = 0x24, + OHCI_HcBulkHeadED = 0x28, + OHCI_HcBulkCurrentED = 0x2C, + OHCI_HcDoneHead = 0x30, + OHCI_HcFMInterval = 0x34, + OHCI_HcFmRemaining = 0x38, + OHCI_HcFmNumber = 0x3C, + OHCI_HcPeriodicStart = 0x40, + OHCI_HcLSThreshold = 0x44, + OHCI_HcRhDescriptorA = 0x48, + OHCI_HcRhDescriptorB = 0x4C, + OHCI_HcRhStatus = 0x50, + OHCI_HcRhPortStatus1 = 0x54, + OHCI_HcRhPortStatus2 = 0x58, + OHCI_HcRhPortStatus3 = 0x5C +}; + +static void +usb_interrupt_ohci(usb_t* usb) +{ + if (usb->ohci_mmio[OHCI_HcControl + 1] & 1) { + smi_raise(); + } + else if (usb->usb_params != NULL) { + if (usb->usb_params->parent_priv != NULL && usb->usb_params->raise_interrupt != NULL) { + usb->usb_params->raise_interrupt(usb, usb->usb_params->parent_priv); + } + } +} + static uint8_t uhci_reg_read(uint16_t addr, void *p) { @@ -131,35 +173,6 @@ uhci_update_io_mapping(usb_t *dev, uint8_t base_l, uint8_t base_h, int enable) io_sethandler(dev->uhci_io_base, 0x20, uhci_reg_read, NULL, NULL, uhci_reg_write, uhci_reg_writew, NULL, dev); } -/* OHCI registers */ -enum -{ - OHCI_HcRevision = 0x00, - OHCI_HcControl = 0x04, - OHCI_HcCommandStatus = 0x08, - OHCI_HcInterruptStatus = 0x0C, - OHCI_HcInterruptEnable = 0x10, - OHCI_HcInterruptDisable = 0x14, - OHCI_HcHCCA = 0x18, - OHCI_HcPeriodCurrentED = 0x1C, - OHCI_HcControlHeadED = 0x20, - OHCI_HcControlCurrentED = 0x24, - OHCI_HcBulkHeadED = 0x28, - OHCI_HcBulkCurrentED = 0x2C, - OHCI_HcDoneHead = 0x30, - OHCI_HcFMInterval = 0x34, - OHCI_HcFmRemaining = 0x38, - OHCI_HcFmNumber = 0x3C, - OHCI_HcPeriodicStart = 0x40, - OHCI_HcLSThreshold = 0x44, - OHCI_HcRhDescriptorA = 0x48, - OHCI_HcRhDescriptorB = 0x4C, - OHCI_HcRhStatus = 0x50, - OHCI_HcRhPortStatus1 = 0x54, - OHCI_HcRhPortStatus2 = 0x58, - OHCI_HcRhPortStatus3 = 0x5C -}; - static uint8_t ohci_mmio_read(uint32_t addr, void *p) { @@ -419,7 +432,7 @@ usb_close(void *priv) } static void * -usb_init(const device_t *info) +usb_init_ext(const device_t *info, void* params) { usb_t *dev; @@ -428,6 +441,8 @@ usb_init(const device_t *info) return (NULL); memset(dev, 0x00, sizeof(usb_t)); + dev->usb_params = (usb_params_t*)params; + mem_mapping_add(&dev->ohci_mmio_mapping, 0, 0, ohci_mmio_read, NULL, NULL, ohci_mmio_write, NULL, NULL, @@ -440,9 +455,9 @@ usb_init(const device_t *info) const device_t usb_device = { .name = "Universal Serial Bus", .internal_name = "usb", - .flags = DEVICE_PCI, + .flags = DEVICE_PCI | DEVICE_EXTPARAMS, .local = 0, - .init = usb_init, + .init_ext = usb_init_ext, .close = usb_close, .reset = usb_reset, { .available = NULL }, From ad44c454c99a4f31aff04740b47be0e7c64fee35 Mon Sep 17 00:00:00 2001 From: TC1995 Date: Sun, 30 Apr 2023 21:52:58 +0200 Subject: [PATCH 44/60] Re-added the IBM PS/2 model 70 type 4 (Softfloat is always used in this machine). --- src/include/86box/machine.h | 1 + src/machine/m_ps2_mca.c | 21 +++++++++++++++++++ src/machine/machine_table.c | 42 +++++++++++++++++++++++++++++++++++-- 3 files changed, 62 insertions(+), 2 deletions(-) diff --git a/src/include/86box/machine.h b/src/include/86box/machine.h index 4d1effe9a..4477c4781 100644 --- a/src/include/86box/machine.h +++ b/src/include/86box/machine.h @@ -770,6 +770,7 @@ extern int machine_ps2_model_65sx_init(const machine_t *); extern int machine_ps2_model_70_type3_init(const machine_t *); extern int machine_ps2_model_80_init(const machine_t *); extern int machine_ps2_model_80_axx_init(const machine_t *); +extern int machine_ps2_model_70_type4_init(const machine_t *); /* m_tandy.c */ extern int tandy1k_eeprom_read(void); diff --git a/src/machine/m_ps2_mca.c b/src/machine/m_ps2_mca.c index 328de216b..d867ddb24 100644 --- a/src/machine/m_ps2_mca.c +++ b/src/machine/m_ps2_mca.c @@ -1495,3 +1495,24 @@ machine_ps2_model_80_axx_init(const machine_t *model) return ret; } + +int +machine_ps2_model_70_type4_init(const machine_t *model) +{ + int ret; + + ret = bios_load_interleaved("roms/machines/ibmps2_m70_type4/64F3126.BIN", + "roms/machines/ibmps2_m70_type4/64F3125.BIN", + 0x000e0000, 131072, 0); + + if (bios_only || !ret) + return ret; + + machine_ps2_common_init(model); + + ps2.planar_id = 0xf9ff; + + ps2_mca_board_model_70_type34_init(1, 4); + + return ret; +} diff --git a/src/machine/machine_table.c b/src/machine/machine_table.c index 244af7623..f089fe93e 100644 --- a/src/machine/machine_table.c +++ b/src/machine/machine_table.c @@ -5470,7 +5470,45 @@ const machine_t machines[] = { .snd_device = NULL, .net_device = NULL }, - + /* Has IBM PS/2 Type 1 KBC firmware. */ + { + .name = "[MCA] IBM PS/2 model 70 (type 4)", + .internal_name = "ibmps2_m70_type4", + .type = MACHINE_TYPE_486, + .chipset = MACHINE_CHIPSET_PROPRIETARY, + .init = machine_ps2_model_70_type4_init, + .pad = 0, + .pad0 = 0, + .pad1 = MACHINE_AVAILABLE, + .pad2 = 0, + .cpu = { + .package = CPU_PKG_SOCKET1, + .block = CPU_BLOCK_NONE, + .min_bus = 0, + .max_bus = 0, + .min_voltage = 0, + .max_voltage = 0, + .min_multi = 0, + .max_multi = 0 + }, + .bus_flags = MACHINE_PS2_MCA, + .flags = MACHINE_VIDEO, + .ram = { + .min = 2048, + .max = 65536, + .step = 2048 + }, + .nvrmask = 63, + .kbc_device = NULL, + .kbc_p1 = 0, + .gpio = 0, + .device = NULL, + .fdc_device = NULL, + .sio_device = NULL, + .vid_device = NULL, + .snd_device = NULL, + .net_device = NULL + }, /* 486 machines - Socket 2 */ /* 486 machines with just the ISA slot */ /* Uses some variant of Phoenix MultiKey/42 as the BIOS sends keyboard controller @@ -12517,7 +12555,7 @@ const machine_t machines[] = { .min_voltage = 1300, .max_voltage = 3500, .min_multi = 1.5, - .max_multi = 8.0 /* limits assumed */ + .max_multi = 8.0 /* limits assumed */ }, .bus_flags = MACHINE_PS2_AGP, .flags = MACHINE_IDE_DUAL | MACHINE_APM | MACHINE_ACPI, From 8fca57aa799fe26f60c1d3a34b25f97cdce5939f Mon Sep 17 00:00:00 2001 From: OBattler Date: Mon, 1 May 2023 01:35:16 +0200 Subject: [PATCH 45/60] Universalize the keyboard and mouse latches again, fixes #3280. --- src/chipset/ali1489.c | 4 ---- src/chipset/ali1543.c | 7 ------- src/chipset/ali6117.c | 6 ------ src/chipset/ims8848.c | 3 --- src/chipset/intel_420ex.c | 4 ---- src/chipset/intel_piix.c | 4 ---- src/chipset/intel_sio.c | 16 ---------------- src/chipset/sis_5571.c | 3 --- src/chipset/sis_85c50x.c | 5 ----- src/chipset/umc_8886.c | 3 --- src/chipset/via_pipc.c | 6 +----- src/machine/m_ps2_mca.c | 3 --- src/pic.c | 12 ++++++++++-- 13 files changed, 11 insertions(+), 65 deletions(-) diff --git a/src/chipset/ali1489.c b/src/chipset/ali1489.c index 706b67f12..70ff509ab 100644 --- a/src/chipset/ali1489.c +++ b/src/chipset/ali1489.c @@ -180,9 +180,6 @@ ali1489_defaults(ali1489_t *dev) dev->regs[0x3d] = 0x01; dev->regs[0x40] = 0x03; - pic_kbd_latch(0x01); - pic_mouse_latch(0x00); - ali1489_shadow_recalc(dev); cpu_cache_int_enabled = 0; cpu_cache_ext_enabled = 0; @@ -298,7 +295,6 @@ ali1489_write(uint16_t addr, uint8_t val, void *priv) case 0x2a: /* I/O Recovery Register */ dev->regs[dev->index] = val; - pic_mouse_latch(val & 0x80); break; case 0x2b: /* Turbo Function Register */ diff --git a/src/chipset/ali1543.c b/src/chipset/ali1543.c index f3296bd20..b587f91b5 100644 --- a/src/chipset/ali1543.c +++ b/src/chipset/ali1543.c @@ -151,12 +151,6 @@ ali1533_write(int func, int addr, uint8_t val, void *priv) break; case 0x41: - pic_kbd_latch(1); - // pic_kbd_latch(!!(val & 0x80)); - if (dev->type == 1) - pic_mouse_latch(!!(val & 0x40) || !(dev->pci_conf[0x78] & 0x02)); - else - pic_mouse_latch(!!(val & 0x40)); dev->pci_conf[addr] = val; break; @@ -433,7 +427,6 @@ ali1533_write(int func, int addr, uint8_t val, void *priv) if (dev->type == 1) { ali1543_log("PCI78 = %02X\n", val); dev->pci_conf[addr] = val & 0x33; - pic_mouse_latch(!!(dev->pci_conf[0x41] & 0x40) || !(val & 0x02)); } break; diff --git a/src/chipset/ali6117.c b/src/chipset/ali6117.c index 588aec3c3..98451067a 100644 --- a/src/chipset/ali6117.c +++ b/src/chipset/ali6117.c @@ -302,7 +302,6 @@ ali6117_reg_write(uint16_t addr, uint8_t val, void *priv) case 0x36: val &= 0xf0; val |= dev->regs[dev->reg_offset]; - pic_mouse_latch(val & 0x40); break; case 0x37: @@ -427,8 +426,6 @@ ali6117_reset(void *priv) /* On-board memory 15-16M is enabled by default. */ mem_set_mem_state_both(0x00f00000, 0x00100000, MEM_READ_INTERNAL | MEM_WRITE_INTERNAL); ali6117_bank_recalc(dev); - - pic_mouse_latch(0x00); } } @@ -478,9 +475,6 @@ ali6117_init(const device_t *info) } } - if (!(dev->local & 0x08)) - pic_kbd_latch(0x01); - ali6117_reset(dev); if (!(dev->local & 0x08)) diff --git a/src/chipset/ims8848.c b/src/chipset/ims8848.c index 57580f125..0b67661ef 100644 --- a/src/chipset/ims8848.c +++ b/src/chipset/ims8848.c @@ -389,9 +389,6 @@ ims8848_init(const device_t *info) ims8848_reset(dev); - pic_kbd_latch(0x01); - pic_mouse_latch(0x01); - return dev; } diff --git a/src/chipset/intel_420ex.c b/src/chipset/intel_420ex.c index 2b1a08622..492f7a0d1 100644 --- a/src/chipset/intel_420ex.c +++ b/src/chipset/intel_420ex.c @@ -218,7 +218,6 @@ i420ex_write(int func, int addr, uint8_t val, void *priv) break; case 0x4e: dev->regs[addr] = (val & 0xf7); - pic_mouse_latch(!!(val & 0x10)); break; case 0x50: dev->regs[addr] = (val & 0x0f); @@ -389,7 +388,6 @@ i420ex_reset_hard(void *priv) dev->regs[0x4c] = 0x4d; dev->regs[0x4e] = 0x03; - pic_mouse_latch(0x00); /* Bits 2:1 of register 50h are 00 is 25 MHz, and 01 if 33 MHz, 10 and 11 are reserved. */ if (cpu_busspeed >= 33333333) dev->regs[0x50] |= 0x02; @@ -526,8 +524,6 @@ i420ex_init(const device_t *info) i420ex_reset_hard(dev); - pic_kbd_latch(0x01); - return dev; } diff --git a/src/chipset/intel_piix.c b/src/chipset/intel_piix.c index 94468b435..718df8344 100644 --- a/src/chipset/intel_piix.c +++ b/src/chipset/intel_piix.c @@ -512,7 +512,6 @@ piix_write(int func, int addr, uint8_t val, void *priv) break; case 0x4e: fregs[0x4e] = val; - pic_mouse_latch(!!(val & 0x10)); if (dev->type >= 4) kbc_alias_update_io_mapping(dev); break; @@ -1275,7 +1274,6 @@ piix_reset_hard(piix_t *dev) fregs[0x0e] = ((dev->type > 1) || (dev->rev != 2)) ? 0x80 : 0x00; fregs[0x4c] = 0x4d; fregs[0x4e] = 0x03; - pic_mouse_latch(0x00); fregs[0x60] = fregs[0x61] = fregs[0x62] = fregs[0x63] = 0x80; fregs[0x64] = (dev->type > 3) ? 0x10 : 0x00; fregs[0x69] = 0x02; @@ -1681,8 +1679,6 @@ piix_init(const device_t *info) // device_add(&i8254_sec_device); - pic_kbd_latch(0x01); - return dev; } diff --git a/src/chipset/intel_sio.c b/src/chipset/intel_sio.c index 3f253d832..26f3cb422 100644 --- a/src/chipset/intel_sio.c +++ b/src/chipset/intel_sio.c @@ -204,7 +204,6 @@ sio_write(int func, int addr, uint8_t val, void *priv) break; case 0x4d: dev->regs[addr] = (val & 0x7f); - // pic_mouse_latch(!!(val & 0x10)); break; case 0x4f: dev->regs[addr] = val; @@ -396,7 +395,6 @@ sio_reset_hard(void *priv) dev->regs[0x4b] = 0x0f; dev->regs[0x4c] = 0x56; dev->regs[0x4d] = 0x40; - // pic_mouse_latch(0x00); dev->regs[0x4e] = 0x07; dev->regs[0x4f] = 0x4f; dev->regs[0x57] = 0x04; @@ -546,20 +544,6 @@ sio_init(const device_t *info) // device_add(&i8254_sec_device); - // pic_kbd_latch(0x01); - - /* The situation is as follow: SIO.AB has the IRQ 1 latch but SIO.IB and SIO.ZB do not, - and I suspect that because of that, the IRQ 12 latch on SIO.IB and SIO.ZB, while - evidently planned and documented in the datashet, was basically non-functional, and - motherboard manufacturers had to install their own latches to use PS/2 keyboards - and/or mice. One such example is the AMI Excalibur PCI Pentium, which never enables - the SIO.ZB's IRQ 12 latch but clearly expects one since otherwise, the PS/2 mouse - behaves erractically in the WinBIOS CMOS Setup. */ - if (machine_has_bus(machine, MACHINE_BUS_PS2)) { - pic_kbd_latch(0x01); - pic_mouse_latch(0x01); - } - return dev; } diff --git a/src/chipset/sis_5571.c b/src/chipset/sis_5571.c index 53ef7956e..0f77a1a07 100644 --- a/src/chipset/sis_5571.c +++ b/src/chipset/sis_5571.c @@ -726,9 +726,6 @@ sis_5571_init(const device_t *info) sis_5571_reset(dev); - pic_kbd_latch(0x01); - pic_mouse_latch(0x01); - return dev; } diff --git a/src/chipset/sis_85c50x.c b/src/chipset/sis_85c50x.c index ebb895db7..f174576c9 100644 --- a/src/chipset/sis_85c50x.c +++ b/src/chipset/sis_85c50x.c @@ -418,11 +418,6 @@ sis_85c50x_init(const device_t *info) sis_85c50x_reset(dev); - if (machine_has_bus(machine, MACHINE_BUS_PS2)) { - pic_kbd_latch(0x01); - pic_mouse_latch(0x01); - } - return dev; } diff --git a/src/chipset/umc_8886.c b/src/chipset/umc_8886.c index 3def68666..dea5ac99a 100644 --- a/src/chipset/umc_8886.c +++ b/src/chipset/umc_8886.c @@ -374,9 +374,6 @@ umc_8886_init(const device_t *info) umc_8886_reset(dev); - pic_kbd_latch(0x01); - pic_mouse_latch(0x01); - return dev; } diff --git a/src/chipset/via_pipc.c b/src/chipset/via_pipc.c index 31da38b48..c2abc4465 100644 --- a/src/chipset/via_pipc.c +++ b/src/chipset/via_pipc.c @@ -222,9 +222,6 @@ pipc_reset_hard(void *priv) dev->pci_isa_regs[0x0b] = 0x06; dev->pci_isa_regs[0x0e] = 0x80; - pic_kbd_latch(0x01); - pic_mouse_latch(dev->local >= VIA_PIPC_586B); - dev->pci_isa_regs[0x48] = 0x01; dev->pci_isa_regs[0x4a] = 0x04; dev->pci_isa_regs[0x4f] = 0x03; @@ -1067,8 +1064,7 @@ pipc_write(int func, int addr, uint8_t val, void *priv) break; case 0x44: - if (dev->local < VIA_PIPC_586B) - pic_mouse_latch(val & 0x01); + dev->pci_isa_regs[0x44] = val; break; case 0x47: diff --git a/src/machine/m_ps2_mca.c b/src/machine/m_ps2_mca.c index 328de216b..558c3d96c 100644 --- a/src/machine/m_ps2_mca.c +++ b/src/machine/m_ps2_mca.c @@ -1343,9 +1343,6 @@ machine_ps2_common_init(const machine_t *model) nmi_mask = 0x80; ps2.uart = device_add_inst(&ns16550_device, 1); - - pic_kbd_latch(0x01); - pic_mouse_latch(0x01); } int diff --git a/src/pic.c b/src/pic.c index 4f9b8aa8f..62ceabd5d 100644 --- a/src/pic.c +++ b/src/pic.c @@ -570,8 +570,16 @@ pic_reset_hard(void) { pic_reset(); - pic_kbd_latch(0x00); - pic_mouse_latch(0x00); + /* The situation is as follows: There is a giant mess when it comes to these latches on real hardware, + to the point that there's even boards with board-level latched that get used in place of the latches + on the chipset, therefore, I'm just doing this here for the sake of simplicity. */ + if (machine_has_bus(machine, MACHINE_BUS_PS2)) { + pic_kbd_latch(0x01); + pic_mouse_latch(0x01); + } else { + pic_kbd_latch(0x00); + pic_mouse_latch(0x00); + } } void From a67af2368ebaa7cb4fc5fdbee9caebc1025384cf Mon Sep 17 00:00:00 2001 From: OBattler Date: Mon, 1 May 2023 02:42:47 +0200 Subject: [PATCH 46/60] Rename softfloat's poly.cc to softfloat_poly.cc, fixes the clobbering of Munt's poly.cpp when compiling with Makefile.mingw. --- src/cpu/softfloat/CMakeLists.txt | 2 +- src/cpu/softfloat/{poly.cc => softfloat_poly.cc} | 0 src/win/Makefile.mingw | 2 +- 3 files changed, 2 insertions(+), 2 deletions(-) rename src/cpu/softfloat/{poly.cc => softfloat_poly.cc} (100%) diff --git a/src/cpu/softfloat/CMakeLists.txt b/src/cpu/softfloat/CMakeLists.txt index 62458aada..936157185 100644 --- a/src/cpu/softfloat/CMakeLists.txt +++ b/src/cpu/softfloat/CMakeLists.txt @@ -13,5 +13,5 @@ # Copyright 2020-2021 David Hrdlička. # -add_library(softfloat OBJECT f2xm1.cc fpatan.cc fprem.cc fsincos.cc fyl2x.cc poly.cc softfloat.cc softfloat16.cc +add_library(softfloat OBJECT f2xm1.cc fpatan.cc fprem.cc fsincos.cc fyl2x.cc softfloat_poly.cc softfloat.cc softfloat16.cc softfloat-muladd.cc softfloat-round-pack.cc softfloat-specialize.cc softfloatx80.cc) diff --git a/src/cpu/softfloat/poly.cc b/src/cpu/softfloat/softfloat_poly.cc similarity index 100% rename from src/cpu/softfloat/poly.cc rename to src/cpu/softfloat/softfloat_poly.cc diff --git a/src/win/Makefile.mingw b/src/win/Makefile.mingw index b2e2ddf0b..c0077abc2 100644 --- a/src/win/Makefile.mingw +++ b/src/win/Makefile.mingw @@ -552,7 +552,7 @@ CPUOBJ := $(DYNARECOBJ) \ cpu.o cpu_table.o fpu.o x86.o \ 8080.o 808x.o 386.o 386_common.o 386_dynarec.o 386_dynarec_ops.o \ x86seg.o x87.o x87_timings.o \ - f2xm1.o fpatan.o fprem.o fsincos.o fyl2x.o poly.o softfloat.o softfloat16.o \ + f2xm1.o fpatan.o fprem.o fsincos.o fyl2x.o softfloat_poly.o softfloat.o softfloat16.o \ softfloat-muladd.o softfloat-round-pack.o softfloat-specialize.o softfloatx80.o CHIPSETOBJ := 82c100.o acc2168.o \ From 29ca01d290260ab365f305725e522adbb4717396 Mon Sep 17 00:00:00 2001 From: Cacodemon345 Date: Mon, 1 May 2023 12:11:14 +0600 Subject: [PATCH 47/60] mouse_wacom_tablet.c: fix warnings --- src/device/mouse_wacom_tablet.c | 18 +++++++++--------- 1 file changed, 9 insertions(+), 9 deletions(-) diff --git a/src/device/mouse_wacom_tablet.c b/src/device/mouse_wacom_tablet.c index 09d98083e..2fa909286 100644 --- a/src/device/mouse_wacom_tablet.c +++ b/src/device/mouse_wacom_tablet.c @@ -356,7 +356,7 @@ wacom_write(struct serial_s *serial, void *priv, uint8_t data) uint8_t out_of_range_data = wacom->settings_bits.out_of_range_data; wacom->settings_bits.out_of_range_data = !!out_of_range_data; } else if (!memcmp(wacom->data_rec, "RQ", 2)) { - uint8_t remote_mode = 0; + int remote_mode = 0; sscanf((const char *) wacom->data_rec, "RQ%d", &remote_mode); wacom->settings_bits.remote_mode = !!remote_mode; if (wacom->settings_bits.remote_mode) @@ -372,27 +372,27 @@ wacom_write(struct serial_s *serial, void *priv, uint8_t data) } else if (wacom->tablet_type->type == WACOM_TYPE_IV && wacom->data_rec[0] == '~') { if (!memcmp(wacom->data_rec, "~*", 2)) { uint32_t settings_dword = wacom->settings; - if (strstr(wacom->data_rec, ",")) { + if (strstr((const char *) wacom->data_rec, ",")) { uint32_t x_res = wacom->x_res, y_res = wacom->y_res; uint32_t increment = wacom->increment; uint32_t interval = wacom->interval; - sscanf("~*%08X,%d,%d,%d,%d", wacom->data_rec, &settings_dword, &increment, &interval, &x_res, &y_res); + sscanf((const char *) wacom->data_rec, "~*%08X,%d,%d,%d,%d", &settings_dword, &increment, &interval, &x_res, &y_res); wacom->interval = interval; wacom->increment = increment; wacom->x_res = x_res; wacom->y_res = y_res; } else { - sscanf("~*%X", wacom->data_rec, &settings_dword); + sscanf((const char *) wacom->data_rec, "~*%X", &settings_dword); } wacom_process_settings_dword(wacom, settings_dword); } else if (!memcmp(wacom->data_rec, "~C", 2)) { - fifo8_push_all(&wacom->data, "~C5039,3779\r", sizeof("~C5039,3779\r") - 1); + fifo8_push_all(&wacom->data, (const uint8_t *) "~C5039,3779\r", sizeof("~C5039,3779\r") - 1); } else if (!memcmp(wacom->data_rec, "~R", 2)) { uint8_t data[256] = { 0 }; - snprintf(data, sizeof(data), "~*%08X,%d,%d,%d,%d\r", wacom->settings, wacom->increment, wacom->interval, wacom->x_res, wacom->y_res); - fifo8_push_all(&wacom->data, data, strlen(data)); + snprintf((char *)data, sizeof(data), (const char *) "~*%08X,%d,%d,%d,%d\r", wacom->settings, wacom->increment, wacom->interval, wacom->x_res, wacom->y_res); + fifo8_push_all(&wacom->data, data, strlen((const char *) data)); } } } @@ -458,7 +458,7 @@ wacom_transmit_prepare(mouse_wacom_t *wacom, int x, int y) if (wacom->transmit_id) { uint8_t data[128] = { 0 }; snprintf((char *) data, sizeof(data), "%s", wacom->tablet_type->id); - fifo8_push_all(&wacom->data, data, strlen(data)); + fifo8_push_all(&wacom->data, data, strlen((char *)data)); wacom->transmit_id = 0; return; } @@ -520,7 +520,7 @@ wacom_transmit_prepare(mouse_wacom_t *wacom, int x, int y) snprintf((char *) data, sizeof(data), "*,%05d,%05d,%d\r\n", wacom->abs_x, wacom->abs_y, wacom->pressure_mode ? ((wacom->b & 0x1) ? (uint8_t) -31 : (uint8_t) 15) : ((wacom->b & 0x1) ? 21 : 00)); - fifo8_push_all(&wacom->data, data, strlen(data)); + fifo8_push_all(&wacom->data, data, strlen((char *)data)); } } From ea5b9cdbf887766a29663ceae20b72b4d0206a0d Mon Sep 17 00:00:00 2001 From: Cacodemon345 Date: Mon, 1 May 2023 16:55:49 +0600 Subject: [PATCH 48/60] usb: Port reset logic is now on a timer --- src/include/86box/usb.h | 2 ++ src/usb.c | 31 +++++++++++++++++++++++++++---- 2 files changed, 29 insertions(+), 4 deletions(-) diff --git a/src/include/86box/usb.h b/src/include/86box/usb.h index 987eb1314..a20f1b2a2 100644 --- a/src/include/86box/usb.h +++ b/src/include/86box/usb.h @@ -39,6 +39,8 @@ typedef struct usb_t int uhci_enable, ohci_enable; uint32_t ohci_mem_base; mem_mapping_t ohci_mmio_mapping; + pc_timer_t ohci_frame_timer; + pc_timer_t ohci_port_reset_timer[2]; usb_params_t* usb_params; } usb_t; diff --git a/src/usb.c b/src/usb.c index ca8ee1d38..8ac16edd1 100644 --- a/src/usb.c +++ b/src/usb.c @@ -26,8 +26,8 @@ #include <86box/device.h> #include <86box/io.h> #include <86box/mem.h> +#include <86box/timer.h> #include <86box/usb.h> -#include "cpu.h" #ifdef ENABLE_USB_LOG int usb_do_log = ENABLE_USB_LOG; @@ -189,6 +189,28 @@ ohci_mmio_read(uint32_t addr, void *p) return ret; } +void +ohci_update_frame_counter(void* priv) +{ + usb_t *dev = (usb_t *) priv; +} + +void +ohci_port_reset_callback(void* priv) +{ + usb_t *dev = (usb_t *) priv; + + dev->ohci_mmio[OHCI_HcRhPortStatus1] &= ~0x10; +} + +void +ohci_port_reset_callback_2(void* priv) +{ + usb_t *dev = (usb_t *) priv; + + dev->ohci_mmio[OHCI_HcRhPortStatus2] &= ~0x10; +} + static void ohci_mmio_write(uint32_t addr, uint8_t val, void *p) { @@ -331,8 +353,7 @@ ohci_mmio_write(uint32_t addr, uint8_t val, void *p) if (val & 0x10) { if (old & 0x01) { dev->ohci_mmio[addr] |= 0x10; - /* TODO: The clear should be on a 10 ms timer. */ - dev->ohci_mmio[addr] &= ~0x10; + timer_on_auto(&dev->ohci_port_reset_timer[(addr - OHCI_HcRhPortStatus1) / 4], 10000.); dev->ohci_mmio[addr + 2] |= 0x10; } else dev->ohci_mmio[addr + 2] |= 0x01; @@ -388,7 +409,6 @@ ohci_mmio_write(uint32_t addr, uint8_t val, void *p) dev->ohci_mmio[addr] = val; } - void ohci_update_mem_mapping(usb_t *dev, uint8_t base1, uint8_t base2, uint8_t base3, int enable) { @@ -447,6 +467,9 @@ usb_init_ext(const device_t *info, void* params) ohci_mmio_read, NULL, NULL, ohci_mmio_write, NULL, NULL, NULL, MEM_MAPPING_EXTERNAL, dev); + timer_add(&dev->ohci_frame_timer, ohci_update_frame_counter, dev, 0); /* Unused for now, to be used for frame counting. */ + timer_add(&dev->ohci_port_reset_timer[0], ohci_port_reset_callback, dev, 0); + timer_add(&dev->ohci_port_reset_timer[1], ohci_port_reset_callback_2, dev, 0); usb_reset(dev); return dev; From c289872cd63e9b9ad7d879a019d34e7ead9dc9f6 Mon Sep 17 00:00:00 2001 From: OBattler Date: Mon, 1 May 2023 16:19:02 +0200 Subject: [PATCH 49/60] Allow 8 MB VRAM on the Number Nine 771 since it turns out it correctly supports that much. --- src/video/vid_s3.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/video/vid_s3.c b/src/video/vid_s3.c index 68b84d9db..346de2ebb 100644 --- a/src/video/vid_s3.c +++ b/src/video/vid_s3.c @@ -8928,7 +8928,7 @@ const device_t s3_9fx_771_pci_device = { { .available = s3_9fx_771_available }, .speed_changed = s3_speed_changed, .force_redraw = s3_force_redraw, - .config = s3_standard_config + .config = s3_968_config }; const device_t s3_phoenix_vision968_pci_device = { From 948a78f6a906689c48ba9f0a0c3b4d6f1d9687fa Mon Sep 17 00:00:00 2001 From: Jasmine Iwanek Date: Mon, 1 May 2023 23:32:36 -0400 Subject: [PATCH 50/60] Config support for Softfloat FPU in win32 ui --- src/include/86box/resource.h | 23 ++++++++++++----------- src/win/languages/cs-CZ.rc | 1 + src/win/languages/de-DE.rc | 1 + src/win/languages/dialogs.rc | 14 ++++++++++---- src/win/languages/en-GB.rc | 1 + src/win/languages/en-US.rc | 1 + src/win/languages/es-ES.rc | 1 + src/win/languages/fi-FI.rc | 1 + src/win/languages/fr-FR.rc | 1 + src/win/languages/hr-HR.rc | 1 + src/win/languages/hu-HU.rc | 1 + src/win/languages/it-IT.rc | 1 + src/win/languages/ja-JP.rc | 1 + src/win/languages/ko-KR.rc | 1 + src/win/languages/pl-PL.rc | 1 + src/win/languages/pt-BR.rc | 1 + src/win/languages/pt-PT.rc | 1 + src/win/languages/ru-RU.rc | 1 + src/win/languages/sl-SI.rc | 1 + src/win/languages/tr-TR.rc | 1 + src/win/languages/uk-UA.rc | 1 + src/win/languages/zh-CN.rc | 1 + src/win/languages/zh-TW.rc | 1 + src/win/win_settings.c | 8 ++++++++ 24 files changed, 51 insertions(+), 15 deletions(-) diff --git a/src/include/86box/resource.h b/src/include/86box/resource.h index 397443299..431f42134 100644 --- a/src/include/86box/resource.h +++ b/src/include/86box/resource.h @@ -185,19 +185,20 @@ #ifdef USE_DYNAREC # define IDC_CHECK_DYNAREC 1017 #endif -#define IDC_MEMTEXT 1018 -#define IDC_MEMSPIN 1019 +#define IDC_CHECK_SOFTFLOAT 1018 +#define IDC_MEMTEXT 1019 +#define IDC_MEMSPIN 1020 #define IDC_TEXT_MB IDT_MB -#define IDC_VIDEO 1020 /* video config */ -#define IDC_COMBO_VIDEO 1021 -#define IDC_VIDEO_2 1022 -#define IDC_COMBO_VIDEO_2 1023 -#define IDC_CHECK_VOODOO 1024 -#define IDC_BUTTON_VOODOO 1025 -#define IDC_CHECK_IBM8514 1026 -#define IDC_CHECK_XGA 1027 -#define IDC_BUTTON_XGA 1028 +#define IDC_VIDEO 1021 /* video config */ +#define IDC_COMBO_VIDEO 1022 +#define IDC_VIDEO_2 1023 +#define IDC_COMBO_VIDEO_2 1024 +#define IDC_CHECK_VOODOO 1025 +#define IDC_BUTTON_VOODOO 1026 +#define IDC_CHECK_IBM8514 1027 +#define IDC_CHECK_XGA 1028 +#define IDC_BUTTON_XGA 1029 #define IDC_INPUT 1030 /* input config */ #define IDC_COMBO_MOUSE 1031 diff --git a/src/win/languages/cs-CZ.rc b/src/win/languages/cs-CZ.rc index a2fe0eaa6..262f059b0 100644 --- a/src/win/languages/cs-CZ.rc +++ b/src/win/languages/cs-CZ.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Zapnuta (místní čas)" #define STR_ENABLED_UTC "Zapnuta (UTC)" #define STR_DYNAREC "Dynamický překladač" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Grafika:" #define STR_VIDEO_2 "Grafika 2:" diff --git a/src/win/languages/de-DE.rc b/src/win/languages/de-DE.rc index 735aac2b2..b2e25e332 100644 --- a/src/win/languages/de-DE.rc +++ b/src/win/languages/de-DE.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Aktiviert (Lokale Uhrzeit)" #define STR_ENABLED_UTC "Aktiviert (UTC)" #define STR_DYNAREC "Dynamischer Recompiler" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Videokarte:" #define STR_VIDEO_2 "Videokarte 2:" diff --git a/src/win/languages/dialogs.rc b/src/win/languages/dialogs.rc index 12613a04f..ef3b8ac62 100644 --- a/src/win/languages/dialogs.rc +++ b/src/win/languages/dialogs.rc @@ -232,20 +232,25 @@ BEGIN CFG_HMARGIN, 120, 120, CFG_CHECKBOX_HEIGHT #endif + CONTROL STR_SOFTFLOAT, IDC_CHECK_SOFTFLOAT, + "Button", BS_AUTOCHECKBOX | WS_TABSTOP, + CFG_HMARGIN, 135, 120, CFG_CHECKBOX_HEIGHT + + GROUPBOX STR_TIME_SYNC, IDC_TIME_SYNC, - CFG_HMARGIN, 135, 110, 56 + CFG_HMARGIN, 150, 110, 56 CONTROL STR_DISABLED, IDC_RADIO_TS_DISABLED, "Button", BS_AUTORADIOBUTTON | WS_GROUP | WS_TABSTOP, - 14, 147, CFG_CHECKBOX_PRI_WIDTH, CFG_CHECKBOX_HEIGHT + 14, 162, CFG_CHECKBOX_PRI_WIDTH, CFG_CHECKBOX_HEIGHT CONTROL STR_ENABLED_LOCAL, IDC_RADIO_TS_LOCAL, "Button", BS_AUTORADIOBUTTON | WS_TABSTOP, - 14, 161, CFG_CHECKBOX_PRI_WIDTH, CFG_CHECKBOX_HEIGHT + 14, 176, CFG_CHECKBOX_PRI_WIDTH, CFG_CHECKBOX_HEIGHT CONTROL STR_ENABLED_UTC, IDC_RADIO_TS_UTC, "Button", BS_AUTORADIOBUTTON | WS_TABSTOP, - 14, 175, CFG_CHECKBOX_PRI_WIDTH, CFG_CHECKBOX_HEIGHT + 14, 190, CFG_CHECKBOX_PRI_WIDTH, CFG_CHECKBOX_HEIGHT END DLG_CFG_VIDEO DIALOG DISCARDABLE CFG_PANE_LEFT, CFG_PANE_TOP, CFG_PANE_WIDTH, CFG_PANE_HEIGHT @@ -974,6 +979,7 @@ END #undef STR_ENABLED_LOCAL #undef STR_ENABLED_UTC #undef STR_DYNAREC +#undef STR_SOFTFLOAT #undef STR_VIDEO #undef STR_VIDEO_2 diff --git a/src/win/languages/en-GB.rc b/src/win/languages/en-GB.rc index f94c6ab3b..a0ed1487e 100644 --- a/src/win/languages/en-GB.rc +++ b/src/win/languages/en-GB.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Enabled (local time)" #define STR_ENABLED_UTC "Enabled (UTC)" #define STR_DYNAREC "Dynamic Recompiler" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Video:" #define STR_VIDEO_2 "Video 2:" diff --git a/src/win/languages/en-US.rc b/src/win/languages/en-US.rc index a0719ac1d..9464c6d6b 100644 --- a/src/win/languages/en-US.rc +++ b/src/win/languages/en-US.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Enabled (local time)" #define STR_ENABLED_UTC "Enabled (UTC)" #define STR_DYNAREC "Dynamic Recompiler" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Video:" #define STR_VIDEO_2 "Video 2:" diff --git a/src/win/languages/es-ES.rc b/src/win/languages/es-ES.rc index 6bfce6e52..5f138c3c2 100644 --- a/src/win/languages/es-ES.rc +++ b/src/win/languages/es-ES.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Habilitado (hora local)" #define STR_ENABLED_UTC "Habilitado (UTC)" #define STR_DYNAREC "Recompilador Dinámico" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Vídeo:" #define STR_VIDEO_2 "Vídeo 2:" diff --git a/src/win/languages/fi-FI.rc b/src/win/languages/fi-FI.rc index 8cd80a4e7..c32f94b41 100644 --- a/src/win/languages/fi-FI.rc +++ b/src/win/languages/fi-FI.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Käytössä (paikallinen)" #define STR_ENABLED_UTC "Käytössä (UTC)" #define STR_DYNAREC "Dynaaminen uudelleenkääntäjä" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Näytönohjain:" #define STR_VIDEO_2 "Näytönohjain 2:" diff --git a/src/win/languages/fr-FR.rc b/src/win/languages/fr-FR.rc index 9e0296c4c..bffedce44 100644 --- a/src/win/languages/fr-FR.rc +++ b/src/win/languages/fr-FR.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Activé (heure locale)" #define STR_ENABLED_UTC "Activé (UTC)" #define STR_DYNAREC "Recompilateur dynamique" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Vidéo:" #define STR_VIDEO_2 "Vidéo 2:" diff --git a/src/win/languages/hr-HR.rc b/src/win/languages/hr-HR.rc index d8a19690e..b79defcbe 100644 --- a/src/win/languages/hr-HR.rc +++ b/src/win/languages/hr-HR.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Uključeno (lokalno vrijeme)" #define STR_ENABLED_UTC "Uključeno (UTC)" #define STR_DYNAREC "Dinamički rekompilator" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Video:" #define STR_VIDEO_2 "Video 2:" diff --git a/src/win/languages/hu-HU.rc b/src/win/languages/hu-HU.rc index b08797ab9..9486d8e61 100644 --- a/src/win/languages/hu-HU.rc +++ b/src/win/languages/hu-HU.rc @@ -283,6 +283,7 @@ END #define STR_ENABLED_LOCAL "Engedélyezve (helyi idő)" #define STR_ENABLED_UTC "Engedélyezve (UTC)" #define STR_DYNAREC "Dinamikus újrafordítás" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Videokártya:" #define STR_VIDEO_2 "Videokártya 2:" diff --git a/src/win/languages/it-IT.rc b/src/win/languages/it-IT.rc index 0790813a0..02ca9bf9f 100644 --- a/src/win/languages/it-IT.rc +++ b/src/win/languages/it-IT.rc @@ -279,6 +279,7 @@ END #define STR_ENABLED_LOCAL "Abilitata (ora locale)" #define STR_ENABLED_UTC "Abilitata (UTC)" #define STR_DYNAREC "Ricompilatore dinamico" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Video:" #define STR_VIDEO_2 "Video 2:" diff --git a/src/win/languages/ja-JP.rc b/src/win/languages/ja-JP.rc index 512bde8a0..89cc42011 100644 --- a/src/win/languages/ja-JP.rc +++ b/src/win/languages/ja-JP.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "有効にする (現地時間)" #define STR_ENABLED_UTC "有効にする (UTC)" #define STR_DYNAREC "動的リコンパイラ" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "ビデオカード:" #define STR_VIDEO_2 "ビデオカード 2:" diff --git a/src/win/languages/ko-KR.rc b/src/win/languages/ko-KR.rc index 49dfe34ba..cbe3e4752 100644 --- a/src/win/languages/ko-KR.rc +++ b/src/win/languages/ko-KR.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "사용 (현지 시간)" #define STR_ENABLED_UTC "사용 (UTC)" #define STR_DYNAREC "동적 재컴파일" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "비디오 카드:" #define STR_VIDEO_2 "비디오 카드 2:" diff --git a/src/win/languages/pl-PL.rc b/src/win/languages/pl-PL.rc index 803971ee1..84fccb70d 100644 --- a/src/win/languages/pl-PL.rc +++ b/src/win/languages/pl-PL.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Włączona (czas lokalny)" #define STR_ENABLED_UTC "Włączona (UTC)" #define STR_DYNAREC "Dynamiczny rekompilator" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Wideo:" #define STR_VIDEO_2 "Wideo 2:" diff --git a/src/win/languages/pt-BR.rc b/src/win/languages/pt-BR.rc index 669bb91b3..b01a214ff 100644 --- a/src/win/languages/pt-BR.rc +++ b/src/win/languages/pt-BR.rc @@ -281,6 +281,7 @@ END #define STR_ENABLED_LOCAL "Ativar (hora local)" #define STR_ENABLED_UTC "Ativar (UTC)" #define STR_DYNAREC "Recompilador dinâmico" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Vídeo:" #define STR_VIDEO_2 "Vídeo 2:" diff --git a/src/win/languages/pt-PT.rc b/src/win/languages/pt-PT.rc index 50f2852c8..6390453dd 100644 --- a/src/win/languages/pt-PT.rc +++ b/src/win/languages/pt-PT.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Ativada (hora local)" #define STR_ENABLED_UTC "Ativada (UTC)" #define STR_DYNAREC "Recompilador dinâmico" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Vídeo:" #define STR_VIDEO_2 "Vídeo 2:" diff --git a/src/win/languages/ru-RU.rc b/src/win/languages/ru-RU.rc index 741e6466e..f49247894 100644 --- a/src/win/languages/ru-RU.rc +++ b/src/win/languages/ru-RU.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Включить (местное)" #define STR_ENABLED_UTC "Включить (UTC)" #define STR_DYNAREC "Динамический рекомпилятор" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Видеокарта:" #define STR_VIDEO_2 "Видеокарта 2:" diff --git a/src/win/languages/sl-SI.rc b/src/win/languages/sl-SI.rc index 3f632f84c..beeb9183b 100644 --- a/src/win/languages/sl-SI.rc +++ b/src/win/languages/sl-SI.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Omogočeno (lokalni čas)" #define STR_ENABLED_UTC "Omogočeno (UTC)" #define STR_DYNAREC "Dinamični prevajalnik" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Video:" #define STR_VIDEO_2 "Video 2:" diff --git a/src/win/languages/tr-TR.rc b/src/win/languages/tr-TR.rc index 38f9bd16d..04e00eb0d 100644 --- a/src/win/languages/tr-TR.rc +++ b/src/win/languages/tr-TR.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Etkin (yerel zaman)" #define STR_ENABLED_UTC "Etkin (UTC)" #define STR_DYNAREC "Dinamik Derleyici" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Ekran kartı:" #define STR_VIDEO_2 "Ekran kartı 2:" diff --git a/src/win/languages/uk-UA.rc b/src/win/languages/uk-UA.rc index df9350364..fc3b29c84 100644 --- a/src/win/languages/uk-UA.rc +++ b/src/win/languages/uk-UA.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "Увімкнути (місцеве)" #define STR_ENABLED_UTC "Увімкнути (UTC)" #define STR_DYNAREC "Динамічний рекомпілятор" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "Відеокарта:" #define STR_VIDEO_2 "Відеокарта 2:" diff --git a/src/win/languages/zh-CN.rc b/src/win/languages/zh-CN.rc index 7a69ccbac..40ed20210 100644 --- a/src/win/languages/zh-CN.rc +++ b/src/win/languages/zh-CN.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "启用 (本地时间)" #define STR_ENABLED_UTC "启用 (UTC)" #define STR_DYNAREC "动态重编译器" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "显卡:" #define STR_VIDEO_2 "显卡 2:" diff --git a/src/win/languages/zh-TW.rc b/src/win/languages/zh-TW.rc index eda95096f..d6922164b 100644 --- a/src/win/languages/zh-TW.rc +++ b/src/win/languages/zh-TW.rc @@ -278,6 +278,7 @@ END #define STR_ENABLED_LOCAL "啟用 (本地時間)" #define STR_ENABLED_UTC "啟用 (UTC)" #define STR_DYNAREC "動態重編譯器" +#define STR_SOFTFLOAT "Softfloat FPU" #define STR_VIDEO "顯示卡:" #define STR_VIDEO_2 "顯示卡 2:" diff --git a/src/win/win_settings.c b/src/win/win_settings.c index 7129230a3..837627c0a 100644 --- a/src/win/win_settings.c +++ b/src/win/win_settings.c @@ -91,6 +91,7 @@ static uint32_t temp_mem_size; #ifdef USE_DYNAREC static int temp_dynarec; #endif +static int temp_fpu_softfloat; /* Video category */ static int temp_gfxcard[2], temp_ibm8514, temp_voodoo, temp_xga; @@ -331,6 +332,7 @@ win_settings_init(void) #ifdef USE_DYNAREC temp_dynarec = cpu_use_dynarec; #endif + temp_fpu_softfloat = fpu_softfloat; temp_fpu = fpu_type; temp_sync = time_sync; @@ -460,6 +462,7 @@ win_settings_changed(void) #ifdef USE_DYNAREC i = i || (temp_dynarec != cpu_use_dynarec); #endif + i = i || (temp_fpu_softfloat != fpu_softfloat); i = i || (temp_fpu != fpu_type); i = i || (temp_sync != time_sync); @@ -553,6 +556,7 @@ win_settings_save(void) #ifdef USE_DYNAREC cpu_use_dynarec = temp_dynarec; #endif + fpu_softfloat = temp_fpu_softfloat; fpu_type = temp_fpu; time_sync = temp_sync; @@ -921,6 +925,8 @@ win_settings_machine_proc(HWND hdlg, UINT message, WPARAM wParam, LPARAM lParam) settings_set_check(hdlg, IDC_CHECK_DYNAREC, 0); #endif + settings_set_check(hdlg, IDC_CHECK_SOFTFLOAT, 0); + h = GetDlgItem(hdlg, IDC_MEMSPIN); h2 = GetDlgItem(hdlg, IDC_MEMTEXT); SendMessage(h, UDM_SETBUDDY, (WPARAM) h2, 0); @@ -1014,6 +1020,8 @@ win_settings_machine_proc(HWND hdlg, UINT message, WPARAM wParam, LPARAM lParam) temp_dynarec = settings_get_check(hdlg, IDC_CHECK_DYNAREC); #endif + temp_fpu_softfloat = settings_get_check(hdlg, IDC_CHECK_SOFTFLOAT); + if (settings_get_check(hdlg, IDC_RADIO_TS_DISABLED)) temp_sync = TIME_SYNC_DISABLED; From b460e845c6b9535e8d381b8047a2b7d1a306116b Mon Sep 17 00:00:00 2001 From: Jasmine Iwanek Date: Tue, 2 May 2023 01:59:06 -0400 Subject: [PATCH 51/60] Make windres verbose The error messages it emits elsewise are worthless --- src/win/Makefile.mingw | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/win/Makefile.mingw b/src/win/Makefile.mingw index c0077abc2..0aa08d267 100644 --- a/src/win/Makefile.mingw +++ b/src/win/Makefile.mingw @@ -876,7 +876,7 @@ all: $(PROG).exe 86Box.res: 86Box.rc @echo Processing $< - @$(WINDRES) $(RFLAGS) $(EXTRAS) -i $< -o 86Box.res + @$(WINDRES) -v $(RFLAGS) $(EXTRAS) -i $< -o 86Box.res $(PROG).exe: $(OBJ) 86Box.res @echo Linking $(PROG).exe .. From a989171ebcdf49782c06a7e13b7a7381c23b7481 Mon Sep 17 00:00:00 2001 From: Jasmine Iwanek Date: Tue, 2 May 2023 02:02:11 -0400 Subject: [PATCH 52/60] codeql uses cmake so ignore win32 ui stuff --- .github/workflows/codeql.yml | 23 ++++++++++++++++++++++- 1 file changed, 22 insertions(+), 1 deletion(-) diff --git a/.github/workflows/codeql.yml b/.github/workflows/codeql.yml index 2cc36c6a6..e58004eb4 100644 --- a/.github/workflows/codeql.yml +++ b/.github/workflows/codeql.yml @@ -1,6 +1,27 @@ name: "CodeQL" -on: [ push, pull_request] +on: + + push: + paths: + - src/** + - cmake/** + - "**/CMakeLists.txt" + - "CMakePresets.json" + - .github/workflows/codeql.yml + - vcpkg.json + - "!**/Makefile*" + + pull_request: + paths: + - src/** + - cmake/** + - "**/CMakeLists.txt" + - "CMakePresets.json" + - .github/workflows/** + - .github/workflows/codeql.yml + - vcpkg.json + - "!**/Makefile*" jobs: analyze: From 927c26f496450e68fbb29cbdf0740f6d7add8845 Mon Sep 17 00:00:00 2001 From: Jasmine Iwanek Date: Tue, 2 May 2023 02:18:17 -0400 Subject: [PATCH 53/60] Fix some variant type comparisons --- src/cpu/808x.c | 4 ++-- src/floppy/fdd_86f.c | 12 ++++++------ src/sound/snd_adlibgold.c | 3 +-- src/sound/snd_audiopci.c | 3 +-- src/sound/snd_gus.c | 3 +-- src/sound/snd_sb_dsp.c | 5 ++--- src/video/vid_ht216.c | 2 +- 7 files changed, 14 insertions(+), 18 deletions(-) diff --git a/src/cpu/808x.c b/src/cpu/808x.c index d7e50b0b5..925594a11 100644 --- a/src/cpu/808x.c +++ b/src/cpu/808x.c @@ -440,10 +440,10 @@ pfq_write(void) static uint8_t pfq_read(void) { - uint8_t temp, i; + uint8_t temp; temp = pfq[0]; - for (i = 0; i < (pfq_size - 1); i++) + for (int i = 0; i < (pfq_size - 1); i++) pfq[i] = pfq[i + 1]; pfq_pos--; cpu_state.pc = (cpu_state.pc + 1) & 0xffff; diff --git a/src/floppy/fdd_86f.c b/src/floppy/fdd_86f.c index 0267cfe81..ff4acb989 100644 --- a/src/floppy/fdd_86f.c +++ b/src/floppy/fdd_86f.c @@ -2550,7 +2550,7 @@ uint16_t d86f_prepare_pretrack(int drive, int side, int iso) { d86f_t *dev = d86f[drive]; - uint16_t i, pos; + uint16_t pos; int mfm; int real_gap0_len; int sync_len; @@ -2575,22 +2575,22 @@ d86f_prepare_pretrack(int drive, int side, int iso) d86f_destroy_linked_lists(drive, side); - for (i = 0; i < raw_size; i++) + for (uint32_t i = 0; i < raw_size; i++) d86f_write_direct_common(drive, side, gap_fill, 0, i); pos = 0; if (!iso) { - for (i = 0; i < real_gap0_len; i++) { + for (int i = 0; i < real_gap0_len; i++) { d86f_write_direct_common(drive, side, gap_fill, 0, pos); pos = (pos + 1) % raw_size; } - for (i = 0; i < sync_len; i++) { + for (int i = 0; i < sync_len; i++) { d86f_write_direct_common(drive, side, 0, 0, pos); pos = (pos + 1) % raw_size; } if (mfm) { - for (i = 0; i < 3; i++) { + for (uint8_t i = 0; i < 3; i++) { d86f_write_direct_common(drive, side, 0x2452, 1, pos); pos = (pos + 1) % raw_size; } @@ -2600,7 +2600,7 @@ d86f_prepare_pretrack(int drive, int side, int iso) pos = (pos + 1) % raw_size; } - for (i = 0; i < real_gap1_len; i++) { + for (int i = 0; i < real_gap1_len; i++) { d86f_write_direct_common(drive, side, gap_fill, 0, pos); pos = (pos + 1) % raw_size; } diff --git a/src/sound/snd_adlibgold.c b/src/sound/snd_adlibgold.c index 0616e8fa6..5c95194a3 100644 --- a/src/sound/snd_adlibgold.c +++ b/src/sound/snd_adlibgold.c @@ -842,7 +842,6 @@ static void adgold_input_msg(void *p, uint8_t *msg, uint32_t len) { adgold_t *adgold = (adgold_t *) p; - uint8_t i; if (adgold->sysex) return; @@ -850,7 +849,7 @@ adgold_input_msg(void *p, uint8_t *msg, uint32_t len) if (adgold->uart_in) { adgold->adgold_mma_status |= 0x04; - for (i = 0; i < len; i++) { + for (uint32_t i = 0; i < len; i++) { adgold->midi_queue[adgold->midi_w++] = msg[i]; adgold->midi_w &= 0x0f; } diff --git a/src/sound/snd_audiopci.c b/src/sound/snd_audiopci.c index 105907ede..47812d84a 100644 --- a/src/sound/snd_audiopci.c +++ b/src/sound/snd_audiopci.c @@ -1969,9 +1969,8 @@ static void es1371_input_msg(void *p, uint8_t *msg, uint32_t len) { es1371_t *dev = (es1371_t *) p; - uint8_t i; - for (i = 0; i < len; i++) + for (uint32_t i = 0; i < len; i++) es1371_write_fifo(dev, msg[i]); } diff --git a/src/sound/snd_gus.c b/src/sound/snd_gus.c index 2bef7edac..1557f97ba 100644 --- a/src/sound/snd_gus.c +++ b/src/sound/snd_gus.c @@ -1085,7 +1085,6 @@ static void gus_input_msg(void *p, uint8_t *msg, uint32_t len) { gus_t *gus = (gus_t *) p; - uint8_t i; if (gus->sysex) return; @@ -1093,7 +1092,7 @@ gus_input_msg(void *p, uint8_t *msg, uint32_t len) if (gus->uart_in) { gus->midi_status |= MIDI_INT_RECEIVE; - for (i = 0; i < len; i++) { + for (uint32_t i = 0; i < len; i++) { gus->midi_queue[gus->midi_w++] = msg[i]; gus->midi_w &= 63; } diff --git a/src/sound/snd_sb_dsp.c b/src/sound/snd_sb_dsp.c index e6a7b8312..e340c1482 100644 --- a/src/sound/snd_sb_dsp.c +++ b/src/sound/snd_sb_dsp.c @@ -1055,7 +1055,6 @@ void sb_dsp_input_msg(void *p, uint8_t *msg, uint32_t len) { sb_dsp_t *dsp = (sb_dsp_t *) p; - uint8_t i = 0; sb_dsp_log("MIDI in sysex = %d, uart irq = %d, msg = %d\n", dsp->midi_in_sysex, dsp->uart_irq, len); @@ -1068,11 +1067,11 @@ sb_dsp_input_msg(void *p, uint8_t *msg, uint32_t len) return; if (dsp->uart_irq) { - for (i = 0; i < len; i++) + for (uint32_t i = 0; i < len; i++) sb_add_data(dsp, msg[i]); sb_irq(dsp, 1); } else if (dsp->midi_in_poll) { - for (i = 0; i < len; i++) + for (uint32_t i = 0; i < len; i++) sb_add_data(dsp, msg[i]); } } diff --git a/src/video/vid_ht216.c b/src/video/vid_ht216.c index 255a9e8b8..91c542164 100644 --- a/src/video/vid_ht216.c +++ b/src/video/vid_ht216.c @@ -1347,7 +1347,7 @@ ht216_read_common(ht216_t *ht216, uint32_t addr) temp = 0xff; for (pixel = 0; pixel < 8; pixel++) { - for (plane = 0; plane < (1 << count); plane++) { + for (plane = 0; plane < (uint8_t)(1 << count); plane++) { if (svga->colournocare & (1 << plane)) { /* If we care about a plane, and the pixel has a mismatch on it, clear its bit. */ if (((svga->latch.b[plane] >> pixel) & 1) != ((svga->colourcompare >> plane) & 1)) From 637e1cfe70afc2254c091725e5fc869b9f9e60d1 Mon Sep 17 00:00:00 2001 From: Jasmine Iwanek Date: Tue, 2 May 2023 03:04:33 -0400 Subject: [PATCH 54/60] Update win_settings.c --- src/win/win_settings.c | 2 ++ 1 file changed, 2 insertions(+) diff --git a/src/win/win_settings.c b/src/win/win_settings.c index 837627c0a..104ae0078 100644 --- a/src/win/win_settings.c +++ b/src/win/win_settings.c @@ -682,6 +682,8 @@ win_settings_machine_recalc_fpu(HWND hdlg) c++; } + settings_set_check(hdlg, IDC_CHECK_SOFTFLOAT, temp_fpu_softfloat); + settings_enable_window(hdlg, IDC_COMBO_FPU, c > 1); temp_fpu = fpu_get_type_from_index(temp_cpu_f, temp_cpu, settings_get_cur_sel(hdlg, IDC_COMBO_FPU)); From 7ebdd1c74be6a2099d0748238a8f3e9d419a44d7 Mon Sep 17 00:00:00 2001 From: OBattler Date: Tue, 2 May 2023 15:18:05 +0200 Subject: [PATCH 55/60] Re-added the 32-bit address variants of FXTRACT, should fix OpenStep again. --- src/cpu/x87_ops.h | 8 ++++---- 1 file changed, 4 insertions(+), 4 deletions(-) diff --git a/src/cpu/x87_ops.h b/src/cpu/x87_ops.h index 742ed3e5d..e321df959 100644 --- a/src/cpu/x87_ops.h +++ b/src/cpu/x87_ops.h @@ -851,8 +851,8 @@ const OpFn OP_TABLE(fpu_8087_d9)[256] = { ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, ILLEGAL_a16, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a16, ILLEGAL_a16, opFTST, opFXAM, ILLEGAL_a16, ILLEGAL_a16, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a16, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, - opFPREM, opFYL2XP1, opFSQRT, ILLEGAL_a16, opFRNDINT, opFSCALE, ILLEGAL_a16, ILLEGAL_a16 + opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, + opFPREM, opFYL2XP1, opFSQRT, ILLEGAL_a16, opFRNDINT, opFSCALE, ILLEGAL_a16, ILLEGAL_a16 // clang-format on }; @@ -2414,7 +2414,7 @@ const OpFn OP_TABLE(fpu_287_d9_a32)[256] = { ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, ILLEGAL_a32, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a32, ILLEGAL_a32, opFTST, opFXAM, ILLEGAL_a32, ILLEGAL_a32, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a32, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, ILLEGAL_a32, opFPREM1, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, opFSINCOS, opFRNDINT, opFSCALE, opFSIN, opFCOS // clang-format on }; @@ -2494,7 +2494,7 @@ const OpFn OP_TABLE(fpu_d9_a32)[256] = { opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, opFSTP, /*Invalid*/ opFCHS, opFABS, ILLEGAL_a32, ILLEGAL_a32, opFTST, opFXAM, ILLEGAL_a32, ILLEGAL_a32, opFLD1, opFLDL2T, opFLDL2E, opFLDPI, opFLDEG2, opFLDLN2, opFLDZ, ILLEGAL_a32, - opF2XM1, opFYL2X, opFPTAN, opFPATAN, ILLEGAL_a32, opFPREM1, opFDECSTP, opFINCSTP, + opF2XM1, opFYL2X, opFPTAN, opFPATAN, opFXTRACT, opFPREM1, opFDECSTP, opFINCSTP, opFPREM, opFYL2XP1, opFSQRT, opFSINCOS, opFRNDINT, opFSCALE, opFSIN, opFCOS // clang-format on }; From 5f384427fc4d21e698176149d9c2496f2e48b620 Mon Sep 17 00:00:00 2001 From: OBattler Date: Tue, 2 May 2023 15:20:15 +0200 Subject: [PATCH 56/60] A small warning fix to shut up the compiler. --- src/cpu/x87_ops_sf.h | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/cpu/x87_ops_sf.h b/src/cpu/x87_ops_sf.h index 4de3b1c90..ad12b6515 100644 --- a/src/cpu/x87_ops_sf.h +++ b/src/cpu/x87_ops_sf.h @@ -2,7 +2,7 @@ static uint32_t fpu_save_environment(void) { int tag; - unsigned offset; + unsigned offset = 0; /* read all registers in stack order and update x87 tag word */ for (int n = 0; n < 8; n++) { From 10bf8884b87d40f79b63f4e18a119f4b74ef921d Mon Sep 17 00:00:00 2001 From: OBattler Date: Tue, 2 May 2023 15:22:30 +0200 Subject: [PATCH 57/60] And another such warning (how is GCC unaware that it has literally evaluated every possible case?!). --- src/cpu/x87_ops_sf.h | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/cpu/x87_ops_sf.h b/src/cpu/x87_ops_sf.h index ad12b6515..e70556fea 100644 --- a/src/cpu/x87_ops_sf.h +++ b/src/cpu/x87_ops_sf.h @@ -109,7 +109,7 @@ fpu_save_environment(void) static uint32_t fpu_load_environment(void) { - unsigned offset; + unsigned offset = 0; switch ((cr0 & 1) | (cpu_state.op32 & 0x100)) { case 0x000: { /*16-bit real mode*/ From 5a342c0a8046ccff8852b86ba62e8fce257290c5 Mon Sep 17 00:00:00 2001 From: OBattler Date: Tue, 2 May 2023 15:23:27 +0200 Subject: [PATCH 58/60] Two unused variables. --- src/cpu/x87_ops_sf_load_store.h | 2 -- 1 file changed, 2 deletions(-) diff --git a/src/cpu/x87_ops_sf_load_store.h b/src/cpu/x87_ops_sf_load_store.h index c6dab1b44..69bc5598c 100644 --- a/src/cpu/x87_ops_sf_load_store.h +++ b/src/cpu/x87_ops_sf_load_store.h @@ -768,7 +768,6 @@ sf_FBSTP_PACKED_BCD_a16(uint32_t fetchdat) floatx80 reg; int64_t save_val; int sign; - int c; FP_ENTER(); FPU_check_pending_exceptions(); @@ -833,7 +832,6 @@ sf_FBSTP_PACKED_BCD_a32(uint32_t fetchdat) floatx80 reg; int64_t save_val; int sign; - int c; FP_ENTER(); FPU_check_pending_exceptions(); From fcd1d3f354568c847dc688f8351299ad74ec1d79 Mon Sep 17 00:00:00 2001 From: OBattler Date: Tue, 2 May 2023 15:25:53 +0200 Subject: [PATCH 59/60] And another unused variable removed. Only the bitwise comparison warning is left now. --- src/cpu/x87_ops_sf_trans.h | 1 - 1 file changed, 1 deletion(-) diff --git a/src/cpu/x87_ops_sf_trans.h b/src/cpu/x87_ops_sf_trans.h index 7ecbbe4ec..5289b2bbf 100644 --- a/src/cpu/x87_ops_sf_trans.h +++ b/src/cpu/x87_ops_sf_trans.h @@ -131,7 +131,6 @@ next_ins: static int sf_FXTRACT(uint32_t fetchdat) { - const floatx80 floatx80_default_nan = packFloatx80(0, floatx80_default_nan_exp, floatx80_default_nan_fraction); struct float_status_t status; floatx80 a, b; From 18f96d28231c64a24111cd51832f9b39d5de42a4 Mon Sep 17 00:00:00 2001 From: OBattler Date: Tue, 2 May 2023 15:27:20 +0200 Subject: [PATCH 60/60] And that's the last softfloat warning fixed. --- src/cpu/x87_ops_sf_const.h | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/cpu/x87_ops_sf_const.h b/src/cpu/x87_ops_sf_const.h index 5e722ede4..708c6ff7a 100644 --- a/src/cpu/x87_ops_sf_const.h +++ b/src/cpu/x87_ops_sf_const.h @@ -21,7 +21,7 @@ sf_FLDL2T(uint32_t fetchdat) FPU_stack_overflow(fetchdat); else { FPU_push(); - FPU_save_regi(FPU_round_const(Const_L2T, (fpu_state.cwd & FPU_CW_RC) == X87_ROUNDING_UP), 0); + FPU_save_regi(FPU_round_const(Const_L2T, (fpu_state.cwd & FPU_CW_RC) == FPU_RC_UP), 0); } CLOCK_CYCLES_FPU((fpu_type >= FPU_487SX) ? (x87_timings.fld_const) : (x87_timings.fld_const * cpu_multi)); CONCURRENCY_CYCLES((fpu_type >= FPU_487SX) ? (x87_concurrency.fld_const) : (x87_concurrency.fld_const * cpu_multi));